nlin0511014/body.tmp
1: %%Page: 1 1
2: TeXDict begin HPSdict begin 1 0 bop 0 9520 a Fp(Dark)717
3: b(and)g(Brigh)-60 b(t)716 b(solitons)g(of)h(driv)-60
4: b(en)716 b(non-linear)0 11955 y(Sc)-60 b(hr\304)-1076
5: b(odinger)715 b(and)i(higher)f(order)g(non-linear)0 14390
6: y(Sc)-60 b(hr\304)-1076 b(odinger)715 b(equations)7970
7: 18154 y Fo(Viv)-42 b(ek)499 b(M)e(Vy)-42 b(as)p Fn(\\)p
8: Fo(,)500 b(T)e(Soloman)i(Ra)83 b(ju)498 b Fm(y)p Fo(,)g(C)h(Nagara)83
9: b(ja)500 b(Kumar)p Fm(z)p Fo(,)g(and)7970 19925 y(Prasan)-42
10: b(ta)501 b(K)d(P)-42 b(anigrahi)p Fm({)p Fl(x)7970 21696
11: y Fk(\\)370 b Fj(Departmen)-31 b(t)370 b(of)g(Ph)-31
12: b(ysics,)370 b(M)e(S)h(Univ)-31 b(ersit)g(y)371 b(of)f(Baro)31
13: b(da,)370 b(V)-92 b(ado)31 b(dara,)371 b(390)f(002,)h(India)7970
14: 23135 y Fi(y)e Fj(Ph)-31 b(ysics)370 b(Group,)f(BITS-Pilani,)j(Goa)d
15: (Campus,)i(Zuari)f(Nagar,)h(Goa,)f(403)g(726,)h(India)7970
16: 24575 y Fi(z)e Fj(Departmen)-31 b(t)370 b(of)g(Ph)-31
17: b(ysics,)370 b(P)-31 b(anjab)371 b(Univ)-31 b(ersit)g(y)-92
18: b(,)371 b(Chandigarh,)g(160)g(014,)g(India)7970 26014
19: y Fi({)p Fj(Ph)-31 b(ysical)371 b(Researc)-31 b(h)369
20: b(Lab)31 b(oratory)-92 b(,)371 b(Na)-31 b(vrangpura,)371
21: b(Ahmedabad)f(380)h(009,)g(India)7970 29224 y Fh(Abstract.)1107
22: b Fj(W)-92 b(e)406 b(analyse)h(the)g(structure)e(of)i(the)f(exact,)417
23: b(dark)406 b(and)h(brigh)-31 b(t)407 b(soliton)h(solutions)7970
24: 30663 y(of)430 b(the)f(driv)-31 b(en)430 b(non-linear)g(Sc)-31
25: b(hr\304)-553 b(odinger)430 b(equation)h(\(NLSE\).)f(It)g(is)f(found)g
26: (that,)446 b(a)430 b(wide)f(class)7970 32102 y(of)387
27: b(the)f(higher)g(order)g(non-linear)h(Sc)-31 b(hr\304)-553
28: b(odinger)387 b(equation)h(\(HNLSE\))f(with,)392 b(a)387
29: b(source)e(can)i(also)7970 33541 y(b)31 b(e)485 b(obtained)i(through)g
30: (the)e(ab)31 b(o)-31 b(v)g(e)487 b(pro)31 b(cedure.)841
31: b(Distinct)486 b(parameter)g(ranges,)515 b(allo)-31 b(wing)489
32: b(the)7970 34980 y(existence)410 b(of)f(these)g(solutions,)421
33: b(phase)409 b(lo)31 b(c)-31 b(k)g(ed)411 b(with)f(the)g(resp)31
34: b(ectiv)-31 b(e)409 b(sources,)418 b(are)409 b(delineated.)7970
35: 36419 y(A)369 b(sp)31 b(ecial)370 b(case,)f(where)g(the)g(scale)h(of)f
36: (the)h(soliton)h(emerges)e(as)g(a)g(free)f(parameter,)j(is)e(obtained)
37: 7970 37858 y(and)306 b(the)f(condition)j(under)c(whic)-31
38: b(h)306 b(solitons)h(can)f(dev)-31 b(elop)306 b(singularit)-31
39: b(y)308 b(is)d(in)-31 b(v)g(estigated.)474 b(W)-92 b(e)305
40: b(also)7970 39297 y(study)445 b(the)h(highly)g(restrictiv)-31
41: b(e)446 b(structure)f(of)g(the)h(lo)31 b(calized)447
42: b(solutions,)466 b(when)445 b(the)g(phase)g(and)7970
43: 40736 y(amplitude)371 b(get)f(coupled.)0 46502 y Fo(1.)664
44: b(In)-42 b(tro)42 b(duction)0 49588 y Fg(The)561 b(externally)g(driv)
45: -36 b(en,)593 b(non-linear)560 b(Sc)-36 b(hr\304)-650
46: b(odinger)559 b(equation)i(\(NLSE\))e(with)i(a)g(source)f(in)h(one)0
47: 51359 y(dimension)c(has)g(b)36 b(een)557 b(in)-36 b(v)g(estigated)557
48: b(in)g(the)g(con)-36 b(text)557 b(of)h(a)g(v)-72 b(ariet)-36
49: b(y)558 b(of)g(ph)-36 b(ysical)557 b(pro)36 b(cesses.)950
50: b(It)0 53130 y(arises)631 b(in)f(the)f(problem)h(of)h(Josephson)f
51: (junction)g([1],)680 b(c)-36 b(harge)630 b(densit)-36
52: b(y)630 b(w)-36 b(a)g(v)g(es)631 b([2)q(],)680 b(t)-36
53: b(win-core)0 54902 y(optical)440 b(\257b)36 b(ers)439
54: b([3)q(,)h(4,)g(5,)g(6)q(],)h(plasma)g(driv)-36 b(en)439
55: b(b)-36 b(y)440 b(rf)f(\257elds)h([7])g(and)f(a)h(n)-36
56: b(um)g(b)36 b(er)438 b(of)j(other)e(problems)0 56673
57: y([8)q(].)570 b(As)407 b(compared)g(to)g(NLSE,)g(whic)-36
58: b(h)408 b(is)f(an)g(in)-36 b(tegrable)408 b(system)g([9],)413
59: b(not)407 b(m)-36 b(uc)g(h)407 b(is)g(kno)-36 b(wn)408
60: b(ab)36 b(out)0 58444 y(the)533 b(exact)g(solutions)h(of)g(this)f
61: (equation.)877 b(P)-36 b(erturbativ)g(e)532 b(solutions)i(around)e(the)
62: h(stable)g(soliton)0 60215 y(solutions)394 b(of)g(NLSE)f(ha)-36
63: b(v)g(e)394 b(b)36 b(een)393 b(studied)f(eariler.)566
64: b(Analysis)394 b(around)f(constan)-36 b(t)393 b(bac)-36
65: b(kground)393 b(and)0 61986 y(n)-36 b(umerical)517 b(in)-36
66: b(v)g(estigations)518 b([10)q(,)f(11)q(,)g(12)q(])g(ha)-36
67: b(v)g(e)518 b(rev)-36 b(ealed)517 b(the)g(phenomenon)e(of)j
68: (auto-resonance)0 63757 y([13)q(,)372 b(14])g(as)g(a)g(k)-36
69: b(ey)372 b(c)-36 b(haracteristic)372 b(of)h(this)e(system,)384
70: b(where)372 b(a)g(con)-36 b(tin)g(uous)370 b(phase)h(lo)36
71: b(c)-36 b(king)373 b(b)36 b(et)-36 b(w)g(een)0 65528
72: y(the)433 b(solutions)h(of)g(NLSE)f(and)g(the)g(driv)-36
73: b(en)433 b(\257eld)h(is)f(observ)-36 b(ed.)2601 67299
74: y(In)321 b(a)g(recen)-36 b(t)320 b(w)-36 b(ork)321 b([15)q(],)344
75: b(some)321 b(of)g(the)f(presen)-36 b(t)319 b(authors)i(ha)-36
76: b(v)g(e)320 b(devised)h(a)g(pro)36 b(cedure)320 b(based)g(on)0
77: 69071 y(fractional)433 b(linear)f(transformation)g(for)h(obtaining)f
78: (exact)g(solutions)g(of)h(this)e(dynamical)i(system.)0
79: 70842 y(The)641 b(ab)36 b(o)-36 b(v)g(e)641 b(transformation)g
80: (connects)f(the)g(solutions)h(of)g(NLSE)e(with)i(a)g(source)f(to)h
81: (elliptic)0 72613 y(functions;)732 b(b)36 b(oth)633 b(lo)36
82: b(calized)634 b(and)e(oscillatory)j(solutions)e(ha)-36
83: b(v)g(e)633 b(b)36 b(een)632 b(obtained.)1176 b(Apart)632
84: b(from)0 74997 y Fi(x)615 b Fj(prasan)-31 b(ta@prl.ernet.in)p
85: eop end end
86: %%Page: 2 2
87: TeXDict begin HPSdict begin 2 1 bop 0 221 a Ff(Dark)332
88: b(and)g(Bright)g(solitons)g(of)f(driven)g(non-line)-66
89: b(ar)330 b(Schr\304)-664 b(odinger)331 b(and)h(higher)f(or)-66
90: b(der)332 b(non-line)-66 b(ar)330 b(Schr\304)-664 b(odinger)331
91: b(e)-66 b(quations)p Fg(2)0 3099 y(these)634 b(regular)g(solutions,)685
92: b(under)633 b(certain)h(constrain)-36 b(ts)634 b(the)f(existence)i(of)g
93: (singular)f(solutions)0 4871 y(implying)454 b(extreme)f(increase)g(in)g
94: (the)f(\257eld)h(in)-36 b(tensit)g(y)452 b(has)h(also)h(b)36
95: b(een)453 b(observ)-36 b(ed.)636 b(This)453 b(approac)-36
96: b(h)0 6642 y(is)570 b(non-p)36 b(erturbativ)-36 b(e)569
97: b(in)h(the)g(sense)g(that,)604 b(the)569 b(obtained)h(exact)h
98: (solutions)f(are)h(necessarily)g(of)0 8413 y(rational)626
99: b(t)-36 b(yp)36 b(e,)674 b(with)626 b(b)36 b(oth)625
100: b(n)-36 b(umerator)625 b(and)g(denominator)h(con)-36
101: b(taining)625 b(terms)h(quadratic)g(in)0 10184 y(elliptic)434
102: b(functions.)2601 11955 y(The)461 b(goal)g(of)g(the)f(presen)-36
103: b(t)459 b(pap)36 b(er)460 b(is)h(to)f(analyze)i(in)e(detail)h(the)e
104: (structure)g(of)i(the)f(lo)36 b(calized)0 13726 y(brigh)-36
105: b(t)339 b(and)f(dark)i(solitons)g(in)f(the)f(NLSE)h(with)g(a)h(source.)
106: 546 b(W)-108 b(e)340 b(also)g(\257nd)e(a)h(large)h(class)g(of)g
107: (solution)0 15497 y(to)577 b(higher)f(order)g(nonlinear)g(Sc)-36
108: b(hro)36 b(dinger)576 b(equation)h(\(HNLSE\))e(b)-36
109: b(y)576 b(connecting)g(the)g(solution)0 17269 y(space)623
110: b(of)h(these)f(t)-36 b(w)g(o)624 b(equations.)1148 b(HNLSE)623
111: b(whic)-36 b(h)623 b(is)g(a)h(generalization)h(of)f(NLSE)e(has)h(b)36
112: b(een)0 19040 y(prop)g(osed)433 b(b)-36 b(y)434 b(Ko)36
113: b(dama)435 b([16)q(])f(and)g(Ko)36 b(dama)435 b(and)e(Hasega)-36
114: b(w)g(a)436 b([17)q(])e(to)g(describ)36 b(e)434 b(the)f(propagation)0
115: 20811 y(of)417 b(short)f(duration)f(\(ultrashort)h(fem)-36
116: b(to)416 b(second\))g(pulses)g(in)g(optical)h(\257bres.)571
117: b(The)417 b(driv)-36 b(en)415 b(HNLSE)0 22582 y(is)434
118: b(written)f(as,)7970 25899 y Fn(i)8547 25000 y(@)72 b(\303)p
119: 8547 25589 1653 45 v 8759 26810 a(@)g(t)10332 25899 y
120: Fg(+)11477 25000 y Fn(@)12236 24518 y Fe(2)12761 25000
121: y Fn(\303)p 11477 25589 2178 45 v 11554 26810 a(@)g(x)13052
122: 26426 y Fe(2)13787 25899 y Fg(+)p Fn(g)416 b Fl(j)369
123: b Fn(\303)416 b Fl(j)18207 25350 y Fe(2)19102 25899 y
124: Fn(\303)48 b Fg(+)p Fn(\271\303)g Fg(+)p Fn(i)10 b Fg(\271)-660
125: b Fn(\262)m Fg([)25367 25563 y(~)25024 25899 y Fn(A)26132
126: 25000 y(@)26891 24518 y Fe(3)27417 25000 y Fn(\303)p
127: 26132 25589 V 26209 26810 a(@)72 b(x)27707 26426 y Fe(3)28443
128: 25899 y Fg(+)29765 25563 y(~)29455 25899 y Fn(B)436 b
129: Fl(j)369 b Fn(\303)416 b Fl(j)33248 25350 y Fe(2)34276
130: 25000 y Fn(@)72 b(\303)p 34276 25589 1653 45 v 34353
131: 26810 a(@)g(x)36061 25899 y Fg(+)37368 25563 y(~)37073
132: 25899 y Fn(C)94 b(\303)39124 25000 y(@)72 b Fl(j)369
133: b Fn(\303)416 b Fl(j)42252 24518 y Fe(2)p 39124 25589
134: 3654 45 v 40202 26810 a Fn(@)72 b(x)42911 25899 y Fg(])369
135: b(=)g Fn(\267e)46374 25350 y Fd(i)p Fe(\()p Fd(k)24 b(x)p
136: Fc(\241)p Fd(!)32 b(t)p Fe(\))50212 25899 y Fn(;)p Fg(\(1\))0
137: 29134 y(where)433 b Fn(g)48 b Fg(,)434 b Fn(\271)p Fg(,)443
138: b(\271)-660 b Fn(\262)p Fg(,)8463 28798 y(~)8120 29134
139: y Fn(A)p Fg(,)10201 28798 y(~)9890 29134 y Fn(B)67 b
140: Fg(,)12036 28798 y(~)11740 29134 y Fn(C)95 b Fg(,)434
141: b Fn(!)481 b Fg(and)433 b Fn(k)479 b Fg(are)434 b(real)g(constan)-36
142: b(ts,)433 b(and)g Fn(\267)g Fg(is)h(the)f(source)h(strength.)2601
143: 30905 y(The)891 b(di\256eren)-36 b(t)890 b(nonlinear)h(terms)f(describ)
144: 36 b(e)891 b(v)-72 b(arious)891 b(in)-36 b(teractions)891
145: b(whic)-36 b(h)890 b(a\256ect)h(the)0 32676 y(propagation)537
146: b(of)g(fem)-36 b(tosecond)537 b(pulses)f(in)h(optical)g(\257bres)f([18)
147: q(].)887 b(The)537 b(term)f(prop)36 b(ortional)537 b(to)48783
148: 32341 y(~)48440 32676 y Fn(A)0 34448 y Fg(results)306
149: b(from)h(the)f(inclusion)g(of)h(the)f(e\256ect)g(of)h(third)f(order)g
150: (disp)36 b(ersion)306 b(and)g(the)f(term)h(prop)36 b(ortional)0
151: 36219 y(to)1841 35883 y(~)1530 36219 y Fn(B)441 b Fg(comes)375
152: b(from)f(the)f(\257rst)h(deriv)-72 b(ativ)-36 b(e)374
153: b(of)h(the)e(slo)-36 b(wly)376 b(v)-72 b(arying)375 b(part)f(of)g
154: (nonlinear)g(p)36 b(olarization,)0 37990 y(whic)-36 b(h)686
155: b(is)h(resp)36 b(onsible)687 b(for)g(self-steep)36 b(ening)686
156: b(and)g(sho)36 b(c)-36 b(k)687 b(formation.)1338 b(The)687
157: b(dela)-36 b(y)g(ed)686 b(Raman)0 39761 y(resp)36 b(onse)433
158: b(for)h(self-frequency)h(shift)f(accoun)-36 b(ts)433
159: b(for)h(the)f(term)g(prop)36 b(ortional)434 b(to)40364
160: 39425 y(~)40068 39761 y Fn(C)95 b Fg(.)2601 41532 y(In)748
161: b(last)g(man)-36 b(y)748 b(y)-36 b(ears)748 b(lot)g(of)h(activit)-36
162: b(y)749 b(has)e(gone)h(in)-36 b(to)748 b(the)f(study)g(of)i(the)e(solv)
163: -72 b(abilit)-36 b(y)0 43303 y(of)612 b(the)f(ab)36 b(o)-36
164: b(v)g(e)612 b(equation)f(without)g(a)h(source.)1111 b(In)-36
165: b(tegrabilit)g(y)612 b(studies)f(w)-36 b(ere)611 b(p)36
166: b(erformed)611 b(using)0 45074 y(in)-36 b(v)g(erse)388
167: b(scattering)f(transform)h(metho)36 b(d)387 b(and)g(Hirota)h(metho)36
168: b(d)387 b(and)g(a)h(few)h(cases)f(of)g(in)-36 b(tegrabilit)g(y)0
169: 46846 y(has)479 b(b)36 b(een)478 b(iden)-36 b(ti\257ed:\(i\))478
170: b(Sasa-Satsuma)h(equation)g(\()27255 46510 y(~)27093
171: 46846 y(A:)28564 46510 y(~)28429 46846 y(B:)29856 46510
172: y(~)29711 46846 y(C=1:6:3\))i([19)q(],)491 b(\(ii\))480
173: b(Hirota)f(equation)0 48617 y(\()668 48281 y(~)506 48617
174: y(A:)1977 48281 y(~)1842 48617 y(B:)3269 48281 y(~)3124
175: 48617 y(C=1:6:0\))607 b([20)q(],)648 b(\(iii\))605 b(deriv)-72
176: b(ativ)-36 b(e)606 b(NLSE,)e(of)i(t)-36 b(yp)36 b(e)605
177: b(I)g(and)f(t)-36 b(yp)36 b(e)605 b(I)36 b(I)605 b([21)q(].)1093
178: b(Sev)-36 b(eral)605 b(exact)0 50388 y(solutions)716
179: b(of)g(solitary)i(w)-36 b(a)g(v)g(e)716 b(\(brigh)-36
180: b(t)715 b(soliton\))h(and)f(kink)i(t)-36 b(yp)36 b(e)715
181: b(\(dark)h(soliton\))g(ha)-36 b(v)g(e)716 b(b)36 b(een)0
182: 52159 y(obtained)433 b([22)q(,)h(23)q(].)2601 53930 y(Phase)641
183: b(mo)36 b(dulated)640 b(solutions)h(to)g(HNLSE)e(ha)-36
184: b(v)g(e)641 b(also)h(b)36 b(een)640 b(obtained)g([24)q(],)693
185: b(where)640 b(the)0 55701 y(generic)432 b(form)h(of)g(the)e(solution)i
186: (reads)f Fn(\303)48 b Fg(\()p Fn(x;)221 b(t)p Fg(\))368
187: b(=)h Fn(f)142 b Fg(\()p Fn(x;)221 b(t)p Fg(\))p Fn(e)29151
188: 55219 y Fd(i)p Fe(\()p Fd(\302)p Fe(\()p Fd(x;t)p Fe(\))p
189: Fc(\241)p Fd(!)32 b(t)p Fe(\))34393 55701 y Fg(,)433
190: b(where)f Fn(\302)g Fg(is)h(some)f(function)0 57472 y(of)317
191: b Fn(x)f Fg(and)f Fn(t)p Fg(.)539 b(The)316 b(phase)f(function)h(is)g
192: (dep)36 b(enden)-36 b(t)314 b(on)i(the)f(p)36 b(osition)316
193: b(and)g(c)-36 b(hanges)315 b(across)i(the)e(en)-36 b(tire)0
194: 59243 y(soliton)555 b(and)f(in)g(some)h(cases)g(it)g(ma)-36
195: b(y)555 b(ev)-36 b(en)554 b(ha)-36 b(v)g(e)555 b(singularites.)941
196: b(In)554 b(the)g(con)-36 b(text)555 b(of)g(nonlinear)0
197: 61015 y(optics,)701 b(where)647 b(the)g(function)g Fn(\303)48
198: b Fg(\()p Fn(x;)221 b(t)p Fg(\))646 b(represen)-36 b(ts)646
199: b(the)h(slo)-36 b(wly)649 b(v)-72 b(arying)648 b(en)-36
200: b(v)g(elop)36 b(e)647 b(amplitude)0 62786 y(\(the)633
201: b(v)-72 b(ariables)635 b(x)f(and)g(t)f(of)i(the)e(HNLSE,)g(needs)h(to)g
202: (b)36 b(e)633 b(exc)-36 b(hanged)634 b(to)g(corresp)36
203: b(ond)633 b(to)h(the)0 64557 y(standard)388 b(notation)h(in)f(optics)h
204: (literature\),)398 b(suc)-36 b(h)388 b(a)h(solution)g(corresp)36
205: b(onds)388 b(to)h(what)f(is)h(kno)-36 b(wn)389 b(as)0
206: 66328 y(an)d Ff(optic)-66 b(al)421 b(sho)-66 b(ck)p Fg(.)562
207: b(The)387 b(v)-72 b(ariation)387 b(of)g(the)f(phase)g(function)g(with)h
208: (time)f(is)h(a)f(phenomenon)f(kno)-36 b(wn)0 68099 y(as)434
209: b Ff(fr)-66 b(e)g(quency)463 b(chirping)432 b Fg(and)h(suc)-36
210: b(h)432 b(solutions)i(are)g(kno)-36 b(wn)434 b(as)g(c)-36
211: b(hirp)36 b(ed)432 b(solitons.)2601 69870 y(Here)557
212: b(the)g(structure)e(of)j(the)e(solitons)i(observ)-36
213: b(ed)557 b(for)h(driv)-36 b(en)556 b(NLSE)g(and)h(driv)-36
214: b(en)556 b(HNLSE)0 71641 y(is)550 b(analysed)g(and)f(the)g(parametric)h
215: (restrictions)f(under)f(whic)-36 b(h)550 b(singular)g(structures)e(can)
216: h(form)0 73413 y(is)596 b(obtained.)1065 b(The)596 b(p)36
217: b(ossibilit)-36 b(y)-108 b(,)637 b(where)596 b(the)g(phase)f(and)g
218: (amplitude)h(can)g(get)g(related)f(is)i(also)0 75184
219: y(in)-36 b(v)g(estigated.)1002 b(The)574 b(highly)h(restrictiv)-36
220: b(e)575 b(nature)f(of)h(the)f(resulting)g(dynamics)h(is)g(p)36
221: b(oin)-36 b(ted)574 b(out.)p eop end end
222: %%Page: 3 3
223: TeXDict begin HPSdict begin 3 2 bop 0 221 a Ff(Dark)332
224: b(and)g(Bright)g(solitons)g(of)f(driven)g(non-line)-66
225: b(ar)330 b(Schr\304)-664 b(odinger)331 b(and)h(higher)f(or)-66
226: b(der)332 b(non-line)-66 b(ar)330 b(Schr\304)-664 b(odinger)331
227: b(e)-66 b(quations)p Fg(3)0 3099 y(Unlik)-36 b(e)500
228: b(NLSE,)f(it)h(is)f(observ)-36 b(ed)500 b(that)e(dark)i(and)f(brigh)-36
229: b(t)499 b(solitons,)517 b(for)500 b(b)36 b(oth)498 b(driv)-36
230: b(en)500 b(NLSE)e(and)0 4871 y(HNLSE,)513 b(dep)36 b(end)512
231: b(b)36 b(oth)513 b(on)g(coupling)g(and)g(source)g(strengths.)817
232: b(F)-108 b(or)513 b(example,)534 b(brigh)-36 b(t)513
233: b(solitons)0 6642 y(can)316 b(also)h(form)g(in)f(the)f(repulsiv)-36
234: b(e)317 b(regime,)340 b(if)317 b(the)e(source)h(strength)g(has)g(p)36
235: b(ositiv)-36 b(e)317 b(v)-72 b(alues.)539 b(Similarly)0
236: 8413 y(dark)434 b(solitons)g(can)g(also)g(form)g(in)g(the)f(attractiv)
237: -36 b(e)434 b(regime.)2601 10184 y(The)f(pap)36 b(er)432
238: b(is)h(organised)h(as)f(follo)-36 b(ws.)580 b(In)432
239: b(the)g(follo)-36 b(wing)435 b(section,)f(w)-36 b(e)433
240: b(elab)36 b(orate)433 b(brie\260y)g(on)0 11955 y(the)492
241: b(metho)36 b(d)491 b(of)j(the)d(fractional)j(linear)f(transform)f(for)h
242: (obtaining)f(the)g(solutions)h(of)g(the)e(NLSE)0 13726
243: y(with)386 b(a)h(source.)563 b(In)386 b(this)g(section)g(w)-36
244: b(e)387 b(will)h(also)f(sho)-36 b(w)387 b(that)f(for)g(a)h(large)g
245: (class)g(of)h(solutions,)396 b(driv)-36 b(en)0 15497
246: y(HNLSE)475 b(can)h(also)g(b)36 b(e)476 b(connected)f(with)h(driv)-36
247: b(en)475 b(NLSE)g(hence)g(the)g(obtained)h(solution)g(are)g(also)0
248: 17269 y(solutions)523 b(of)g(HNLSE,)f(alb)36 b(eit)523
249: b(with)f(di\256eren)-36 b(t)521 b(relations)i(among)g(the)f
250: (parameters.)844 b(The)523 b(third)0 19040 y(section)411
251: b(is)h(dev)-36 b(oted)411 b(to)g(the)f(in)-36 b(v)g(estigation)413
252: b(of)e(appropriate)g(parameter)g(regimes,)416 b(c)-36
253: b(haracterizing)0 20811 y(brigh)g(t,)455 b(dark)c(and)g(singular)g
254: (solutions.)632 b(In)451 b(the)f(fourth)h(section,)456
255: b(the)450 b(structure)g(of)i(the)e(solution)0 22582 y(space)476
256: b(is)g(studied,)485 b(when)475 b(the)g(phase)g(and)g(amplitudes)g(are)h
257: (coupled.)704 b(W)-108 b(e)475 b(then)g(conclude)g(after)0
258: 24353 y(p)36 b(oin)-36 b(ting)433 b(out)h(the)f(op)36
259: b(en)433 b(problems)g(and)g(future)g(directions)h(of)g(w)-36
260: b(ork.)0 28126 y Fo(2.)664 b(Analysis)501 b(of)d(NLSE)g(phase)h(lo)42
261: b(c)-42 b(k)g(ed)499 b(with)g(source)0 29897 y(and)g(its)g(relation)g
262: (to)g(HNLSE)0 32984 y Fg(The)423 b(equation)h(whic)-36
263: b(h)422 b(w)-36 b(e)424 b(attempt)e(to)h(solv)-36 b(e)425
264: b(is)e(driv)-36 b(en)423 b(NLSE,)f(phase)h(lo)36 b(c)-36
265: b(k)g(ed)424 b(with)f(the)f(source:)7970 35968 y Fn(i)8547
266: 35070 y(@)72 b(\301)p 8547 35658 1529 45 v 8697 36879
267: a(@)g(t)10503 35968 y Fg(+)11943 35070 y Fn(@)12702 34588
268: y Fe(2)13228 35070 y Fn(\301)p 11943 35658 2055 45 v
269: 11958 36879 a(@)g(x)13456 36496 y Fe(2)14425 35968 y
270: Fg(+)295 b Fn(g)417 b Fl(j)369 b Fn(\301)f Fl(j)19017
271: 35420 y Fe(2)19912 35968 y Fn(\301)295 b Fg(+)g Fn(\271\301)368
272: b Fg(=)h Fn(\267e)26938 35420 y Fd(i)p Fe(\()p Fd(k)24
273: b(x)p Fc(\241)p Fd(!)32 b(t)p Fe(\))32077 35968 y Fn(;)15315
274: b Fg(\(2\))0 38577 y(where)519 b Fn(g)48 b Fg(,)541 b
275: Fn(\271)p Fg(,)g Fn(\267)p Fg(,)f Fn(!)567 b Fg(and)519
276: b Fn(k)565 b Fg(are)519 b(real)h(constan)-36 b(ts.)835
277: b(As)520 b(will)h(see)e(that)g(it)h(can)f(b)36 b(e)519
278: b(connected)g(with)0 40348 y(HNLSE,)477 b(for)i(a)f(wide)g(class)g(of)h
279: (solutions.)711 b(W)-108 b(e)478 b(consider)g(the)f(ansatz)h(tra)-36
280: b(v)g(elling)479 b(w)-36 b(a)g(v)g(e)478 b(solution)0
281: 42119 y(in)433 b(the)g(form,)7970 46658 y Fn(\301)p Fg(\()p
282: Fn(x;)221 b(t)p Fg(\))369 b(=)g Fn(\276)48 b Fg(\()p
283: Fn(\273)64 b Fg(\))p Fn(e)16327 46109 y Fd(i)p Fe(\()p
284: Fd(k)24 b(x)p Fc(\241)p Fd(!)32 b(t)p Fe(\))20165 46658
285: y Fn(;)0 49425 y Fg(where)575 b Fn(\273)673 b Fg(=)609
286: b Fn(\256)8 b Fg(\()p Fn(x)391 b Fl(\241)h Fn(v)48 b(t)p
287: Fg(\).)1000 b(Separating)575 b(the)f(real)h(and)f(imaginary)i(parts)e
288: (of)h(equation)h(\(2\),)610 b(one)0 51196 y(obtains,)d
289: Fn(v)653 b Fg(=)605 b(2)p Fn(k)45 b Fg(,)607 b(from)573
290: b(the)f(imaginary)i(part,)606 b(indicating)573 b(that)f(in)g(the)g
291: (presen)-36 b(t)571 b(case,)608 b(w)-36 b(a)g(v)g(e)0
292: 52967 y(v)g(elo)36 b(cit)-36 b(y)435 b Fn(v)481 b Fg(is)434
293: b(con)-36 b(trolled)434 b(b)-36 b(y)433 b Fn(k)45 b Fg(.)579
294: b(The)433 b(real)h(part)f(yields,)7970 55735 y Fn(\256)8805
295: 55186 y Fe(2)9332 55735 y Fn(\276)10119 55186 y Fc(00)10980
296: 55735 y Fg(+)294 b Fn(g)48 b(\276)13744 55186 y Fe(3)14565
297: 55735 y Fg(+)295 b Fn(\262\276)417 b Fg(=)368 b Fn(\267;)27710
298: b Fg(\(3\))0 58502 y(where)382 b Fn(\262)369 b Fg(=)f
299: Fn(!)237 b Fl(\241)189 b Fn(k)8970 58020 y Fe(2)9686
300: 58502 y Fg(+)g Fn(\271)p Fg(,)391 b(and)381 b(prime)h(indicates)g
301: (di\256eren)-36 b(tiation)381 b(with)g(resp)36 b(ect)382
302: b(to)g Fn(\273)64 b Fg(.)561 b(As)382 b(has)f(b)36 b(een)0
303: 60273 y(observ)-36 b(ed)422 b(earlier)g([15)q(],)j(this)c(equation)h
304: (can)g(b)36 b(e)421 b(connected)g(to)h(the)f(equation)h
305: Fn(f)40014 59791 y Fc(00)40851 60273 y Fg(+)271 b Fn(af)412
306: b Fg(+)271 b Fn(bf)46489 59791 y Fe(3)47384 60273 y Fg(=)368
307: b(0)0 62044 y(through)433 b(the)g(follo)-36 b(wing)435
308: b(fractional)g(linear)f(transformation)g(\(FT\):)7970
309: 65435 y Fn(\276)48 b Fg(\()p Fn(\273)64 b Fg(\))369 b(=)12283
310: 64536 y Fn(A)296 b Fg(+)e Fn(B)67 b(f)142 b Fg(\()p Fn(\273)64
311: b Fl(j)p Fn(m)p Fg(\))19849 64054 y Fe(2)p 12283 65125
312: 8092 45 v 12415 66346 a Fg(1)296 b(+)f Fn(D)36 b(f)142
313: b Fg(\()p Fn(\273)64 b Fl(j)p Fn(m)p Fg(\))19718 65962
314: y Fe(2)47753 65435 y Fg(\(4\))0 68781 y(where)595 b Fn(A)p
315: Fg(,)p Fn(B)662 b Fg(and)594 b Fn(D)631 b Fg(are)595
316: b(real)g(constan)-36 b(ts,)634 b(and)595 b Fn(f)142 b
317: Fg(\()p Fn(\273)64 b Fl(j)p Fn(m)p Fg(\))594 b(is)h(a)g(Jacobi)g
318: (elliptic)h(function,)635 b(with)0 70552 y(the)473 b(mo)36
319: b(dulus)472 b(parameter)h(m.)697 b(W)-108 b(e)474 b(consider)f(the)f
320: (case)i(where,)483 b Fn(f)142 b Fg(\()p Fn(\273)64 b
321: Fg(\))437 b(=)f Fn(cn)p Fg(\()p Fn(\273)64 b Fg(\),)483
322: b(other)473 b(cases)h(can)0 72324 y(b)36 b(e)598 b(similarly)h
323: (studied.)1070 b(Since)597 b(the)h(goal)h(is)f(to)g(study)f(the)g(lo)36
324: b(calized)599 b(solutions,)640 b(w)-36 b(e)598 b(consider)0
325: 74095 y(the)497 b(case)i(with)e(mo)36 b(dulus)498 b(parameter)f
326: Fn(m)478 b Fg(=)g(1,)515 b(whic)-36 b(h)497 b(reduces)g
327: Fn(cn)p Fg(\()p Fn(\273)64 b Fg(\))498 b(to)g Fn(sech)p
328: Fg(\()p Fn(\273)64 b Fg(\).)770 b(It)498 b(is)g(w)-36
329: b(orth)0 75866 y(p)36 b(oin)-36 b(ting)432 b(out)h(that,)f(other)g
330: (solutions)h(in)-36 b(v)g(olving)434 b Fn(sn)p Fg(\()p
331: Fn(\273)64 b Fg(\))433 b(and)f Fn(dn)p Fg(\()p Fn(\273)64
332: b Fg(\))432 b(naturally)h(emerge)g(from)g(the)p eop end
333: end
334: %%Page: 4 4
335: TeXDict begin HPSdict begin 4 3 bop 0 221 a Ff(Dark)332
336: b(and)g(Bright)g(solitons)g(of)f(driven)g(non-line)-66
337: b(ar)330 b(Schr\304)-664 b(odinger)331 b(and)h(higher)f(or)-66
338: b(der)332 b(non-line)-66 b(ar)330 b(Schr\304)-664 b(odinger)331
339: b(e)-66 b(quations)p Fg(4)0 3099 y(ab)36 b(o)-36 b(v)g(e)404
340: b(solution,)410 b(since)403 b(the)g(transform)g(in)-36
341: b(v)g(olv)g(es)405 b(square)e(of)h(the)f Fn(cn)p Fg(\()p
342: Fn(\273)64 b Fg(\))404 b(function.)568 b(It)403 b(should)g(also)0
343: 4871 y(b)36 b(e)502 b(men)-36 b(tioned)502 b(that,)520
344: b(in)502 b(the)g(ab)36 b(o)-36 b(v)g(e)503 b(fractional)h(transform)f
345: (the)f(second)g(p)36 b(o)-36 b(w)g(er)503 b(of)g(the)f(cnoidal)0
346: 6642 y(functions)433 b(emerge,)h(as)g(the)f(highest)h(p)36
347: b(o)-36 b(w)g(er.)2601 8413 y(W)-108 b(e)533 b(can)f(see)h(that)f
348: (equation)h(\(4\))f(connects)h Fn(\276)48 b Fg(\()p Fn(\273)64
349: b Fg(\))532 b(to)h(Jacobi)g(elliptic)g(equation,)558
350: b(pro)-36 b(vided)0 10184 y Fn(AD)36 b Fl(6)p Fg(=)p
351: Fn(B)67 b Fg(,)434 b(and)f(the)g(follo)-36 b(wing)436
352: b(conditions)d(are)h(satis\257ed:)7970 14723 y Fn(A\262)296
353: b Fg(+)e Fn(g)48 b(A)12718 14174 y Fe(3)13539 14723 y
354: Fl(\241)295 b Fn(\267)369 b Fg(=)g(0)p Fn(;)29376 b Fg(\(5\))7970
355: 16826 y(2)p Fn(\262AD)332 b Fg(+)295 b Fn(\262B)362 b
356: Fg(+)295 b(4)p Fn(\256)17506 16277 y Fe(2)18033 16826
357: y Fg(\()p Fn(B)362 b Fl(\241)295 b Fn(AD)36 b Fg(\))296
358: b(+)e(3)p Fn(g)48 b(A)27712 16277 y Fe(2)28238 16826
359: y Fn(B)362 b Fl(\241)296 b Fg(3)p Fn(\267D)405 b Fg(=)368
360: b(0)p Fn(;)11561 b Fg(\(6\))7970 18929 y Fn(A\262D)10586
361: 18381 y Fe(2)11407 18929 y Fg(+)295 b(2)p Fn(\262B)67
362: b(D)332 b Fg(+)295 b(4)p Fn(\256)19148 18381 y Fe(2)19675
363: 18929 y Fg(\()p Fn(AD)331 b Fl(\241)295 b Fn(B)67 b Fg(\))p
364: Fn(D)331 b Fg(+)295 b(6)p Fn(\256)29659 18381 y Fe(2)30186
365: 18929 y Fg(\()p Fn(AD)331 b Fl(\241)296 b Fn(B)67 b Fg(\))295
366: b(+)g(3)p Fn(g)48 b(AB)40921 18381 y Fe(2)41741 18929
367: y Fl(\241)296 b Fg(3)p Fn(\267D)45585 18381 y Fe(2)46480
368: 18929 y Fg(=)368 b(0)p Fn(;)-1118 b Fg(\(7\))7970 21032
369: y Fn(\262B)67 b(D)10666 20484 y Fe(2)11487 21032 y Fg(+)295
370: b(2)p Fn(\256)14279 20484 y Fe(2)14806 21032 y Fg(\()p
371: Fn(B)362 b Fl(\241)296 b Fn(AD)36 b Fg(\))p Fn(D)331
372: b Fg(+)295 b Fn(g)48 b(B)25032 20484 y Fe(3)25852 21032
373: y Fl(\241)296 b Fn(\267D)29046 20484 y Fe(3)29940 21032
374: y Fg(=)369 b(0)p Fn(:)15421 b Fg(\(8\))0 23800 y(If)616
375: b Fn(AD)716 b Fg(=)678 b Fn(B)67 b Fg(,)662 b(w)-36 b(e)616
376: b(ha)-36 b(v)g(e)616 b(only)h(a)f(trivial)h(constan)-36
377: b(t)615 b(solution.)1126 b(Equation)616 b(\(5\))g(in)f
378: Fn(A)h Fg(do)36 b(es)616 b(not)0 25571 y(in)-36 b(v)g(olv)g(e)691
379: b Fn(B)758 b Fg(and)689 b Fn(D)36 b Fg(,)755 b(whic)-36
380: b(h)690 b(is)h(\257rst)e(solv)-36 b(ed)691 b(to)f(get)h(the)e(real)i
381: Fn(A)p Fg(.)1348 b(Th)-36 b(us)690 b Fn(A)g Fg(is)h(determined)0
382: 27342 y(in)709 b(terms)g(of)h Fn(\262)p Fg(,)779 b Fn(\267)p
383: Fg(,)f(and)709 b Fn(g)48 b Fg(.)1404 b(F)-108 b(rom)709
384: b(equation)h(\(6\),)778 b(w)-36 b(e)710 b(determine)e
385: Fn(D)746 b Fg(in)709 b(terms)g(of)h Fn(B)776 b Fg(as,)0
386: 29113 y Fn(D)624 b Fg(=)588 b(\241)p Fn(B)67 b(;)562
387: b Fg(where,)594 b(\241)588 b(=)13896 28542 y Fd(\262)p
388: Fe(+4)p Fd(\256)16082 28230 y Fb(2)16544 28542 y Fe(+3)p
389: Fd(g)32 b(A)18931 28230 y Fb(2)p 13507 28803 6273 45
390: v 13507 29571 a Fe(4)p Fd(\256)14581 29319 y Fb(2)15043
391: 29571 y Fd(A)p Fe(+3)p Fd(\267)p Fc(\241)p Fe(2)p Fd(\262A)19913
392: 29113 y Fg(.)964 b(By)563 b(substituting)e(this)h(in)g(equation)h
393: (\(7\),)594 b Fn(B)630 b Fg(is)562 b(found)0 31135 y(as)448
394: b Fn(B)461 b Fg(=)9999 30515 y Fe(6)p Fd(\256)11073 30202
395: y Fb(2)11535 30515 y Fe(\(1)p Fc(\241)p Fd(A)p Fe(\241\))p
396: 4597 30825 15567 45 v 4597 31593 a(3)p Fd(g)32 b(A)p
397: Fe(+)p Fd(A\262)p Fe(\241)8657 31340 y Fb(2)9118 31593
398: y Fe(+2)p Fd(\262)p Fe(\241+4)p Fd(\256)13094 31340 y
399: Fb(2)13556 31593 y Fe(\241\()p Fd(A)p Fe(\241)p Fc(\241)p
400: Fe(1\))p Fc(\241)p Fe(3)p Fd(\267)p Fe(\241)19703 31340
401: y Fb(2)20296 31135 y Fg(.)622 b(F)-108 b(rom)447 b(equation)h(\(8\),)k
402: (w)-36 b(e)448 b(obtain)g(a)g(cubic)f(equation)i(in)0
403: 32906 y Fn(\257)443 b Fl(\264)369 b Fn(\256)3414 32424
404: y Fe(2)3941 32906 y Fg(:)7970 35341 y Fn(p)8623 35540
405: y Fe(1)9149 35341 y Fn(\257)9957 34792 y Fe(3)10778 35341
406: y Fg(+)294 b Fn(q)12661 35540 y Fe(1)13187 35341 y Fn(\257)13995
407: 34792 y Fe(2)14816 35341 y Fg(+)h Fn(r)16709 35540 y
408: Fe(1)17235 35341 y Fn(\257)369 b Fg(+)295 b Fn(c)20205
409: 35540 y Fe(1)21099 35341 y Fg(=)369 b(0)p Fn(;)24262
410: b Fg(\(9\))0 37776 y(where)617 b Fn(p)4594 37975 y Fe(1)5801
411: 37776 y Fg(=)681 b(64\()p Fn(A)10275 37294 y Fe(3)10801
412: 37776 y Fn(g)468 b Fl(\241)420 b Fn(A\262)g Fl(\241)h
413: Fn(\267)p Fg(\),)662 b Fn(q)19574 37975 y Fe(1)20781
414: 37776 y Fg(=)681 b(\(48)p Fn(A)25255 37294 y Fe(5)25782
415: 37776 y Fn(g)26453 37294 y Fe(2)27398 37776 y Fg(+)420
416: b(64)p Fn(A)31105 37294 y Fe(3)31631 37776 y Fn(g)48
417: b(\262)420 b Fg(+)g(16)p Fn(A\262)37479 37294 y Fe(2)38426
418: 37776 y Fl(\241)g Fg(48)p Fn(A)42154 37294 y Fe(2)42680
419: 37776 y Fn(g)48 b(\267)420 b Fl(\241)g Fg(16)p Fn(\262\267)p
420: Fg(\),)0 39547 y Fn(r)586 39746 y Fe(1)1481 39547 y Fg(=)369
421: b(\(12)p Fn(A)5643 39065 y Fe(7)6169 39547 y Fn(g)6840
422: 39065 y Fe(3)7650 39547 y Fg(+)285 b(36)p Fn(A)11222
423: 39065 y Fe(5)11748 39547 y Fn(g)12419 39065 y Fe(2)12944
424: 39547 y Fn(\262)g Fg(+)g(20)p Fn(A)17326 39065 y Fe(3)17852
425: 39547 y Fn(g)48 b(\262)19048 39065 y Fe(2)19859 39547
426: y Fl(\241)285 b Fg(4)p Fn(A\262)23327 39065 y Fe(3)24138
427: 39547 y Fl(\241)g Fg(60)p Fn(A)27731 39065 y Fe(4)28258
428: 39547 y Fn(g)28929 39065 y Fe(2)29454 39547 y Fn(\267)f
429: Fl(\241)h Fg(72)p Fn(A)34080 39065 y Fe(2)34607 39547
430: y Fn(g)48 b(\262\267)284 b Fg(+)h(4)p Fn(\262)39308 39065
431: y Fe(2)39834 39547 y Fn(\267)g Fg(+)f(48)p Fn(Ag)48 b(\267)45859
432: 39065 y Fe(2)46385 39547 y Fg(\))428 b(and)0 41319 y
433: Fn(c)560 41518 y Fe(1)1728 41319 y Fg(=)642 b(\(3)p Fn(A)5513
434: 40836 y Fe(7)6039 41319 y Fn(g)6710 40836 y Fe(3)7235
435: 41319 y Fn(\262)405 b Fl(\241)f Fg(3)p Fn(A)11227 40836
436: y Fe(5)11753 41319 y Fn(g)12424 40836 y Fe(2)12950 41319
437: y Fn(\262)13475 40836 y Fe(2)14405 41319 y Fl(\241)h
438: Fg(7)p Fn(A)17468 40836 y Fe(3)17994 41319 y Fn(g)48
439: b(\262)19190 40836 y Fe(3)20120 41319 y Fl(\241)405 b
440: Fn(A\262)23058 40836 y Fe(4)23988 41319 y Fl(\241)g Fg(18)p
441: Fn(A)27701 40836 y Fe(6)28227 41319 y Fn(g)28898 40836
442: y Fe(3)29423 41319 y Fn(\267)g Fl(\241)f Fg(15)p Fn(A)34289
443: 40836 y Fe(4)34816 41319 y Fn(g)35487 40836 y Fe(2)36012
444: 41319 y Fn(\262\267)g Fg(+)h(12)p Fn(A)41382 40836 y
445: Fe(2)41908 41319 y Fn(g)48 b(\262)43104 40836 y Fe(2)43630
446: 41319 y Fn(\267)404 b Fg(+)g Fn(\262)46724 40836 y Fe(3)47250
447: 41319 y Fn(\267)g Fg(+)0 43090 y(9)p Fn(A)1625 42608
448: y Fe(3)2151 43090 y Fn(g)2822 42608 y Fe(2)3347 43090
449: y Fn(\267)4096 42608 y Fe(2)4976 43090 y Fl(\241)355
450: b Fg(15)p Fn(Ag)48 b(\262\267)10584 42608 y Fe(2)11464
451: 43090 y Fg(+)353 b(9)p Fn(g)48 b(\267)14899 42608 y Fe(3)15425
452: 43090 y Fg(\).)838 b(It)520 b(can)g(b)36 b(e)520 b(straigh)-36
453: b(tforw)g(ardly)522 b(seen)d(that)h Fn(p)39705 43289
454: y Fe(1)40751 43090 y Fg(in)g(equation)h(\(9\))0 44861
455: y(is)609 b(the)e(consistency)i(condition)f(\(5\))g(and)g(hence)g(is)g
456: (iden)-36 b(tically)610 b(zero.)1102 b(Therefore,)653
457: b(the)608 b(width)0 46632 y(parameter)478 b Fn(\257)552
458: b Fg(is)478 b(the)f(solution)i(of)g(a)f(quadratic)g(equation.)712
459: b(Th)-36 b(us)478 b(for)g(an)-36 b(y)479 b(giv)-36 b(en)478
460: b(v)-72 b(alues)479 b(of)g Fn(g)48 b Fg(,)489 b Fn(\262)0
461: 48403 y Fg(and)433 b Fn(\267)p Fg(,)h(w)-36 b(e)434 b(can)f(\257nd)f
462: (the)h(v)-72 b(alues)435 b(of)f Fn(A)p Fg(,)g Fn(B)67
463: b Fg(,)434 b Fn(D)469 b Fg(and)433 b Fn(\256)8 b Fg(.)2601
464: 50174 y(Before)668 b(con)-36 b(tin)g(uing)667 b(the)f(analysis)j(of)f
465: (the)f(lo)36 b(calized)668 b(solutions,)726 b(let)668
466: b(us)f(turn)f(to)h(driv)-36 b(en)0 51945 y(HNLSE,)433
467: b(with)h(the)f(ansatz)h(solution)f(of)i(the)e(form,)7970
468: 54713 y Fn(\303)48 b Fg(\()p Fn(x;)221 b(t)p Fg(\))368
469: b(=)h Fn(\275)p Fg(\()p Fn(\273)64 b Fg(\))p Fn(e)16334
470: 54164 y Fd(i)p Fe(\()p Fd(k)24 b(x)p Fc(\241)p Fd(!)32
471: b(t)p Fe(\))20173 54713 y Fn(:)26568 b Fg(\(10\))0 57480
472: y(Substituting)426 b(the)h(ab)36 b(o)-36 b(v)g(e)429
473: b(expression)f(in)f(equation)i(\(1\))e(and)h(then)e(sep)36
474: b(erating)428 b(out)g(the)f(real)h(and)0 59251 y(imaginary)435
475: b(parts,)e(w)-36 b(e)434 b(get)g(t)-36 b(w)g(o)434 b(sim)-36
476: b(ultaneous)433 b(equations)h(as,)7970 62019 y Fn(\256)8805
477: 61470 y Fe(3)9332 62019 y Fn(\262)10200 61683 y Fg(~)9857
478: 62019 y Fn(A\275)11503 61470 y Fc(000)12619 62019 y Fg(+)295
479: b(\(2)p Fn(\256)8 b(k)341 b Fl(\241)295 b Fg(3)p Fn(\256)8
480: b(\262k)20993 61470 y Fe(2)21863 61683 y Fg(~)21520 62019
481: y Fn(A)296 b Fl(\241)f Fn(\256)8 b(v)48 b Fg(\))p Fn(\275)26808
482: 61470 y Fc(0)27414 62019 y Fg(+)294 b(\()p Fn(\256)8
483: b(\262)30898 61683 y Fg(~)30586 62019 y Fn(B)363 b Fg(+)295
484: b(2)p Fn(\256)8 b(\262)35552 61683 y Fg(~)35254 62019
485: y Fn(C)96 b Fg(\))p Fn(\275)37458 61470 y Fe(2)37984
486: 62019 y Fn(\275)38655 61470 y Fc(0)39334 62019 y Fg(=)369
487: b(0)p Fn(;)5376 b Fg(\(11\))0 64786 y(and)8099 67553
488: y(~)-779 b Fn(\256)8805 67005 y Fe(2)9332 67553 y Fn(\275)10003
489: 67005 y Fc(00)10863 67553 y Fg(+)342 b(~)-697 b Fn(g)48
490: b(\275)13512 67005 y Fe(3)14333 67553 y Fg(+)304 b(~)-660
491: b Fn(\262)q(\275)368 b Fg(=)h Fn(\267;)27407 b Fg(\(12\))0
492: 70321 y(where,)8099 73088 y(~)-779 b Fn(\256)8805 72540
493: y Fe(2)9701 73088 y Fg(=)368 b Fn(\256)11916 72540 y
494: Fe(2)12443 73088 y Fg(\(1)295 b Fl(\241)h Fg(3)10 b(\271)-660
495: b Fn(\262)16741 72753 y Fg(~)16398 73088 y Fn(Ak)45 b
496: Fg(\))p Fn(;)28141 b Fg(\(13\))8016 75856 y(~)-696 b
497: Fn(g)417 b Fg(=)368 b(\()p Fn(g)343 b Fl(\241)305 b Fg(\271)-660
498: b Fn(\262)14026 75520 y Fg(~)13715 75856 y Fn(B)67 b(k)45
499: b Fg(\))p Fn(;)30744 b Fg(\(14\))p eop end end
500: %%Page: 5 5
501: TeXDict begin HPSdict begin 5 4 bop 0 221 a Ff(Dark)332
502: b(and)g(Bright)g(solitons)g(of)f(driven)g(non-line)-66
503: b(ar)330 b(Schr\304)-664 b(odinger)331 b(and)h(higher)f(or)-66
504: b(der)332 b(non-line)-66 b(ar)330 b(Schr\304)-664 b(odinger)331
505: b(e)-66 b(quations)p Fg(5)0 3099 y(and)7980 5476 y(~)-660
506: b Fn(\262)369 b Fg(=)g(\()p Fn(!)342 b Fl(\241)296 b
507: Fn(k)13953 4928 y Fe(2)14774 5476 y Fg(+)f Fn(\271)f
508: Fg(+)305 b(\271)-660 b Fn(\262)19333 5140 y Fg(~)18990
509: 5476 y Fn(Ak)20686 4928 y Fe(3)21212 5476 y Fg(\))p Fn(:)25023
510: b Fg(\(15\))0 7853 y(Di\256eren)-36 b(tiating)344 b(equation)f(\(12\))h
511: (once)f(and)g(comparing)g(it)h(with)f(equation)h(\(11\),)362
512: b(w)-36 b(e)343 b(see)h(that)f(they)0 9624 y(are)434
513: b(consisten)-36 b(t)433 b(only)h(if)g(the)f(parameters)h(satisfy)h(the)
514: e(relations:)8281 12671 y(~)7970 13007 y Fn(B)362 b Fg(+)295
515: b(2)11574 12671 y(~)11277 13007 y Fn(C)465 b Fg(=)14186
516: 12108 y(3)p Fn(\256)15671 11626 y Fe(2)16541 11773 y
517: Fg(~)16198 12108 y Fn(Ag)p 14186 12697 3658 45 v 15463
518: 13918 a Fg(~)-779 b Fn(\256)16169 13535 y Fe(2)47102
519: 13007 y Fg(\(16\))0 15850 y(and)7970 18682 y Fn(v)417
520: b Fg(=)368 b(2)p Fn(k)341 b Fl(\241)295 b Fg(3)10 b(\271)-660
521: b Fn(\262)14910 18346 y Fg(~)14567 18682 y Fn(Ak)16263
522: 18134 y Fe(2)17084 18682 y Fl(\241)18545 17783 y Fn(\256)19380
523: 17301 y Fe(2)19916 17783 y Fg(\271)g Fn(\262)10 b Fg(~)-659
524: b Fn(\262)21300 17448 y Fg(~)20957 17783 y Fn(A)p 18545
525: 18372 3387 45 v 19913 19386 a Fg(~)19558 19769 y Fn(\256)20393
526: 19385 y Fe(2)22065 18682 y Fn(:)24676 b Fg(\(17\))0 21481
527: y(So)425 b(pro)-36 b(vided)424 b(conditions)h(\(16\))h(and)e(\(17\))h
528: (are)g(satis\257ed,)i(one)e(can)g(solv)-36 b(e)426 b(equation)f(\(12\))
529: h(whic)-36 b(h)424 b(is)0 23253 y(iden)-36 b(tical)386
530: b(to)g(equation)h(\(3\).)562 b(Hence,)396 b(for)387 b(a)f(class)h(of)g
531: (solutions)f(the)f(problem)h(of)h(solving)g(equation)0
532: 25024 y(\(1\))413 b(is)h(mapp)36 b(ed)413 b(to)h(the)e(problem)i(of)g
533: (solving)h(equation)f(\(12\))f(whic)-36 b(h)414 b(is)f(nothing)g(but)g
534: (real)h(part)f(of)0 26795 y(the)433 b(driv)-36 b(en)433
535: b(NLSE.)0 30547 y Fo(3.)664 b(Analysis)501 b(of)d(the)g(lo)42
536: b(calized)499 b(solutions)0 33634 y Fg(W)-108 b(e)456
537: b(no)-36 b(w)457 b(pro)36 b(ceed)456 b(to)h(analyze)g(carefully)h(the)e
538: (lo)36 b(calized)458 b(solutions)f(of)g(equation)g(\(3\).)647
539: b(It)456 b(is)h(clear)0 35405 y(that)451 b(lo)36 b(calized)453
540: b(solutions)f(are)f(b)36 b(ound)450 b(to)i(ha)-36 b(v)g(e)452
541: b(at)f(least)h(one)g(extrem)-36 b(um)450 b(in)i(their)f(pro\257le.)631
542: b(This)0 37176 y(implies)434 b(that)f(the)g(\257rst)g(deriv)-72
543: b(ativ)-36 b(e)434 b(of)h Fn(\276)48 b Fg(\()p Fn(\273)64
544: b Fg(\))433 b(m)-36 b(ust)433 b(v)-72 b(anish)433 b(at)h(the)f(extrem)
545: -36 b(um,)433 b(whic)-36 b(h)434 b(yields)8103 39221
546: y(2\()p Fn(B)362 b Fl(\241)296 b Fn(AD)36 b Fg(\))p Fn(f)142
547: b Fg(\()p Fn(\273)64 b Fg(\))p 8103 39809 8859 45 v 8603
548: 41159 a(\(1)295 b(+)g Fn(D)36 b(f)142 b Fg(\()p Fn(\273)64
549: b Fg(\))14904 40513 y Fe(2)15430 41159 y Fg(\))15936
550: 40775 y Fe(2)17094 40119 y Fn(f)17877 39571 y Fc(0)18188
551: 40119 y Fg(\()p Fn(\273)g Fg(\))369 b(=)f(0)p Fn(:)24510
552: b Fg(\(18\))0 43203 y(If)459 b Fn(AD)36 b Fl(6)p Fg(=)p
553: Fn(B)67 b Fg(,)466 b(then)458 b(either)g Fn(f)601 b Fg(or)459
554: b Fn(f)16648 42721 y Fc(0)17417 43203 y Fg(or)g(b)36
555: b(oth)459 b(m)-36 b(ust)458 b(b)36 b(e)458 b(zero.)655
556: b(Since,)465 b(w)-36 b(e)459 b(are)g(considering)g Fn(sech)p
557: Fg(\()p Fn(\273)64 b Fg(\))0 44974 y(as)543 b(our)f(function,)570
558: b(the)542 b(\257rst)f(deriv)-72 b(ativ)-36 b(e)544 b(v)-72
559: b(anishes)542 b(only)h(at)g(origin,)571 b(whic)-36 b(h)542
560: b(means)g(w)-36 b(e)543 b(ha)-36 b(v)g(e)543 b(an)0 46745
561: y(extrem)-36 b(um)433 b(at)h(origin.)579 b(The)433 b(second)h(deriv)-72
562: b(ativ)-36 b(e)434 b(at)g(origin)g(is,)7970 49908 y Fn(\276)8757
563: 49359 y Fc(00)9692 49908 y Fg(=)11205 49009 y(2\()p Fn(AD)332
564: b Fl(\241)295 b Fn(B)67 b Fg(\))p 11205 49598 6432 45
565: v 11968 50819 a(\(1)296 b(+)e Fn(D)36 b Fg(\))16348 50435
566: y Fe(2)17770 49908 y Fn(;)28971 b Fg(\(19\))0 53134 y(whic)-36
567: b(h)595 b(the)g(resolv)-36 b(es)597 b(maxim)-36 b(um)596
568: b(and)f(minim)-36 b(um.)1064 b(It)596 b(should)f(b)36
569: b(e)595 b(noted)g(that)g Fn(\276)42296 52652 y Fc(00)43457
570: 53134 y Fg(is)h(singular)0 54905 y(for)554 b Fn(D)608
571: b Fg(=)572 b Fl(\241)p Fg(1)554 b(and)f(corresp)36 b(onds)552
572: b(to)i(singular)f(solutions.)937 b(F)-108 b(rom)553 b(equation)h
573: (\(19\),)583 b(if)554 b Fn(D)609 b Fl(6)p Fg(=)572 b
574: Fl(\241)p Fg(1,)0 56676 y(w)-36 b(e)636 b(see)g(that)f(there)g(is)h(a)g
575: (clear)g(distinction)g(of)g(t)-36 b(w)g(o)636 b(regimes)g(of)h
576: (solutions:)983 b(One)635 b(for)h(whic)-36 b(h)0 58447
577: y Fn(AD)570 b(>)534 b(B)67 b Fg(,)556 b(where)530 b Fn(\276)10784
578: 57965 y Fc(00)11880 58447 y Fg(is)h(p)36 b(ositiv)-36
579: b(e)532 b(whic)-36 b(h)530 b(means)h(that)f(it)h(corresp)36
580: b(onds)530 b(to)h Ff(minimum)p Fg(,)553 b(second)0 60219
581: y(where)516 b Fn(AD)547 b(<)510 b(B)583 b Fg(is)517 b(negativ)-36
582: b(e,)538 b(w)-36 b(e)517 b(ha)-36 b(v)g(e)517 b(a)g Ff(maximum)p
583: Fg(.)826 b(Maxim)-36 b(um)517 b(infact,)538 b(corresp)36
584: b(onds)516 b(to)g(a)0 61990 y Ff(bright)i(soliton)p Fg(,)506
585: b(whereas)492 b(the)g(mimin)-36 b(um)491 b(corresp)36
586: b(onds)491 b(to)h(a)h Ff(dark)518 b(soliton)492 b Fg(in)g(the)f
587: (propagating)0 63761 y(media.This)465 b(clearly)g(suggest,)472
588: b(that)463 b(b)36 b(oth)463 b(t)-36 b(yp)36 b(es)464
589: b(of)h(solitons)f(exist)h(irresp)36 b(ectiv)-36 b(e)464
590: b(of)h(the)e(kind)h(of)0 65532 y(external)434 b(source.)2601
591: 67303 y(Since)723 b(the)g(solutions)h(are)g(necessarily)g(of)g(the)f
592: (rational)h(t)-36 b(yp)36 b(e)724 b(it)f(is)h(easy)g(to)g(see)f(that)0
593: 69074 y(the)660 b(parameters)g Fn(A)p Fg(,)717 b Fn(B)728
594: b Fg(and)659 b Fn(D)697 b Fg(are)660 b(solely)i(resp)36
595: b(onsible)660 b(for)h(the)f(nature)f(of)i(the)f(solutions.)0
596: 70845 y(P)-36 b(arameter)356 b Fn(A)g Fg(decides)g(the)f(strength)g(of)
597: i(the)e(bac)-36 b(kground)356 b(in)g(whic)-36 b(h)355
598: b(these)h(solutions)g(propagate.)0 72617 y(Considering)467
599: b Fn(\276)515 b Fg(to)467 b(b)36 b(e)467 b(p)36 b(ositiv)-36
600: b(e)468 b(semi-de\257nite)e(yields)i(further)e(constrain)-36
601: b(ts)466 b(as,)476 b(\(i\))p Fn(A)467 b Fg(should)g(b)36
602: b(e)0 74388 y(p)g(ositiv)-36 b(e)584 b(since)g(negativ)-36
603: b(e)585 b(bac)-36 b(kground)583 b(is)h(not)f(meaningful;)659
604: b(\(ii\))p Fn(A)625 b(>)f Fl(\241)p Fn(B)67 b Fg(;)659
605: b(\(iii\))p Fn(D)620 b Fg(should)583 b(b)36 b(e)0 76159
606: y(greater)434 b(than)f Fl(\241)p Fg(1)h(otherwise)g(the)f(solution)h(w)
607: -36 b(ould)433 b(b)36 b(e)434 b Ff(singular)p Fg(,)f(atleast)h(at)g
608: (one)g(p)36 b(oin)-36 b(t.)p eop end end
609: %%Page: 6 6
610: TeXDict begin HPSdict begin 6 5 bop 0 221 a Ff(Dark)332
611: b(and)g(Bright)g(solitons)g(of)f(driven)g(non-line)-66
612: b(ar)330 b(Schr\304)-664 b(odinger)331 b(and)h(higher)f(or)-66
613: b(der)332 b(non-line)-66 b(ar)330 b(Schr\304)-664 b(odinger)331
614: b(e)-66 b(quations)p Fg(6)0 24384 y @beginspecial 0 @llx
615: 0 @lly 842 @urx 595 @ury 2880 @rwi @setspecial
616: %%BeginDocument: plot.eps
617: %!PS-Adobe-3.0 EPSF-3.0
618: %%Title: (Graph4)
619: %%Version: 1 4
620: %%Creator: Adobe Acrobat 6.0
621: %%CreationDate: 17:29:44 10/31/05
622: %%For: (Guest)
623: %%DocumentData: Clean7Bit
624: %%BoundingBox: 0 0 842 595
625: %%HiResBoundingBox: 0.0 0.0 842.0 595.0
626: %%Pages: 0
627: %%DocumentProcessColors: Cyan Magenta Yellow Black
628: %%DocumentSuppliedResources:
629: %%+ procset (Adobe Acrobat - PDF operators) 1.2 0
630: %%+ procset (Adobe Acrobat - type operators) 1.2 0
631: %%EndComments
632: %%BeginProlog
633: %%EndProlog
634: %%BeginSetup
635: %ADOPrintSettings: L1 W0 VM op crd os scsa T h ef bg ucr sf ef r b fa pr SEPS ttf hb Printer/PostScript Color Management 0
636: 
637: 
638: %%BeginResource: file Pscript_T42Hdr PSVER
639: userdict /ct_T42Dict 15 dict put
640: ct_T42Dict begin
641: /Is2015?
642: {
643:   version
644:   cvi
645:   2015
646:   ge
647: } bind def
648: /AllocGlyphStorage
649: {
650:   Is2015?
651:   {	
652: 		pop
653:   } 
654:   { 
655: 		{string} forall
656:   } ifelse
657: } bind def
658: /Type42DictBegin
659: {
660: 	25 dict begin
661:   /FontName exch def
662:   /CharStrings 256 dict 
663: 	begin
664: 		  /.notdef 0 def
665: 		  currentdict 
666: 	end def
667:   /Encoding exch def
668:   /PaintType 0 def
669:   /FontType 42 def
670:   /FontMatrix [1 0 0 1 0 0] def
671:   4 array  astore cvx /FontBBox exch def
672:   /sfnts
673: } bind def
674: /Type42DictEnd  
675: {
676: 	 currentdict dup /FontName get exch definefont end
677: 	ct_T42Dict exch
678: 	dup /FontName get exch put
679: } bind def
680: /RD {string currentfile exch readstring pop} executeonly def
681: /PrepFor2015
682: {
683: 	Is2015?
684: 	{		  
685: 		 /GlyphDirectory 
686: 		 16
687: 		 dict def
688: 		 sfnts 0 get
689: 		 dup
690: 		 2 index
691: 		 (glyx)
692: 		 putinterval
693: 		 2 index  
694: 		 (locx)
695: 		 putinterval
696: 		 pop
697: 		 pop
698: 	}
699: 	{
700: 		 pop
701: 		 pop
702: 	} ifelse			
703: } bind def
704: /AddT42Char
705: {
706: 	Is2015?
707: 	{
708: 		/GlyphDirectory get 
709: 		begin
710: 		def
711: 		end
712: 		pop
713: 		pop
714: 	}
715: 	{
716: 		/sfnts get
717: 		4 index
718: 		get
719: 		3 index
720: 	  2 index
721: 		putinterval
722: 		pop
723: 		pop
724: 		pop
725: 		pop
726: 	} ifelse
727: } bind def
728: end
729: %%EndResource
730: %%BeginResource: procset Adobe_CoolType_Utility_MAKEOCF 1.18 0
731: %%Copyright: Copyright 1987-2003 Adobe Systems Incorporated.
732: %%Version: 1.18 0
733: systemdict /languagelevel known dup
734: 	{ currentglobal false setglobal }
735: 	{ false }
736: ifelse
737: exch
738: userdict /Adobe_CoolType_Utility 2 copy known
739: 	{ 2 copy get dup maxlength 25 add dict copy }
740: 	{ 25 dict }
741: ifelse put
742: Adobe_CoolType_Utility
743: 	begin
744: 	/ct_Level2? exch def
745: 	/ct_Clone? 1183615869 internaldict dup
746: 			/CCRun known not
747: 			exch /eCCRun known not
748: 			ct_Level2? and or def
749: ct_Level2?
750: 	{ globaldict begin currentglobal true setglobal }
751: if
752: 	/ct_AddStdCIDMap
753: 		ct_Level2?
754: 			{ {
755: 			((Hex) 57 StartData
756: 			0615 1e27 2c39 1c60 d8a8 cc31 fe2b f6e0
757: 			7aa3 e541 e21c 60d8 a8c9 c3d0 6d9e 1c60
758: 			d8a8 c9c2 02d7 9a1c 60d8 a849 1c60 d8a8
759: 			cc36 74f4 1144 b13b 77) 0 () /SubFileDecode filter cvx exec
760: 			} }
761: 			{ {
762: 			<BAB431EA07F209EB8C4348311481D9D3F76E3D15246555577D87BC510ED54E
763: 		 118C39697FA9F6DB58128E60EB8A12FA24D7CDD2FA94D221FA9EC8DA3E5E6A1C
764: 			4ACECC8C2D39C54E7C946031DD156C3A6B4A09AD29E1867A> eexec
765: 			} }
766: 		ifelse bind def
767: userdict /cid_extensions known
768: 	 {
769: 	 cid_extensions
770: 	 begin
771: 	 /cid_GetCIDSystemInfo
772: 		 {
773: 		 1 index type /stringtype eq
774: 			 { exch cvn exch }
775: 		 if
776: 		 cid_extensions
777: 			 begin
778: 			 dup load 2 index known
779: 				 {
780: 				 2 copy
781: 				 cid_GetStatusInfo
782: 				 dup null ne
783: 					 {
784: 					 1 index load
785: 					 3 index get
786: 					 dup null eq
787: 						  { pop pop cid_UpdateDB }
788: 						  {
789: 						  exch
790: 						  1 index /Created get eq
791: 							  { exch pop exch pop }
792: 							  { pop cid_UpdateDB }
793: 						  ifelse
794: 						  }
795: 					 ifelse
796: 					 }
797: 					 { pop cid_UpdateDB }
798: 				 ifelse
799: 				 }
800: 				 { cid_UpdateDB }
801: 			 ifelse
802: 			 end
803: 		 } bind def
804: 	 end
805: 	 }
806: if
807: ct_Level2?
808: 	{ end setglobal }
809: if
810: 	/ct_UseNativeCapability?  systemdict /composefont known def
811: 	/ct_MakeOCF 35 dict def
812: 	/ct_Vars 25 dict def
813: 	/ct_GlyphDirProcs 6 dict def
814: 	/ct_BuildCharDict 15 dict dup
815: 		begin
816: 		/charcode 2 string def
817: 		/dst_string 1500 string def
818: 		/nullstring () def
819: 		/usewidths? true def
820: 		end def
821: 	ct_Level2? { setglobal } { pop } ifelse
822: 	ct_GlyphDirProcs
823: 		begin
824: 		/GetGlyphDirectory
825: 			{
826: 			systemdict /languagelevel known
827: 				{ pop /CIDFont findresource /GlyphDirectory get }
828: 				{
829: 				1 index /CIDFont findresource /GlyphDirectory
830: 				get dup type /dicttype eq
831: 					{
832: 					dup dup maxlength exch length sub 2 index lt
833: 						{
834: 						dup length 2 index add dict copy 2 index
835: 						/CIDFont findresource/GlyphDirectory 2 index put
836: 						}
837: 					if
838: 					}
839: 				if
840: 				exch pop exch pop
841: 				}
842: 			ifelse
843: 			+
844: 			} def
845: 		/+
846: 			{
847: 			systemdict /languagelevel known
848: 				{
849: 				currentglobal false setglobal
850: 				3 dict begin
851: 					/vm exch def
852: 				}
853: 				{ 1 dict begin }
854: 			ifelse
855: 			/$ exch def
856: 			systemdict /languagelevel known
857: 				{
858: 				vm setglobal
859: 				/gvm currentglobal def
860: 				$ gcheck setglobal
861: 				}
862: 			if
863: 			? { $ begin } if
864: 			} def
865: 		/? { $ type /dicttype eq } def
866: 		/| {
867: 			userdict /Adobe_CoolType_Data known
868: 				{
869: 			Adobe_CoolType_Data /AddWidths? known
870: 				{
871: 				 currentdict Adobe_CoolType_Data
872: 					begin
873: 					  begin
874: 						AddWidths?
875: 								{
876: 								Adobe_CoolType_Data /CC 3 index put
877: 								? { def } { $ 3 1 roll put } ifelse
878: 								CC charcode exch 1 index 0 2 index 256 idiv put
879: 								1 index exch 1 exch 256 mod put
880: 								stringwidth 2 array astore
881: 								currentfont /Widths get exch CC exch put
882: 								}
883: 								{ ? { def } { $ 3 1 roll put } ifelse }
884: 							ifelse
885: 					end
886: 				end
887: 				}
888: 				{ ? { def } { $ 3 1 roll put } ifelse }	ifelse
889: 				}
890: 				{ ? { def } { $ 3 1 roll put } ifelse }
891: 			ifelse
892: 			} def
893: 		/!
894: 			{
895: 			? { end } if
896: 			systemdict /languagelevel known
897: 				{ gvm setglobal }
898: 			if
899: 			end
900: 			} def
901: 		/: { string currentfile exch readstring pop } executeonly def
902: 		end
903: 	ct_MakeOCF
904: 		begin
905: 		/ct_cHexEncoding
906: 		[/c00/c01/c02/c03/c04/c05/c06/c07/c08/c09/c0A/c0B/c0C/c0D/c0E/c0F/c10/c11/c12
907: 		 /c13/c14/c15/c16/c17/c18/c19/c1A/c1B/c1C/c1D/c1E/c1F/c20/c21/c22/c23/c24/c25
908: 		 /c26/c27/c28/c29/c2A/c2B/c2C/c2D/c2E/c2F/c30/c31/c32/c33/c34/c35/c36/c37/c38
909: 		 /c39/c3A/c3B/c3C/c3D/c3E/c3F/c40/c41/c42/c43/c44/c45/c46/c47/c48/c49/c4A/c4B
910: 		 /c4C/c4D/c4E/c4F/c50/c51/c52/c53/c54/c55/c56/c57/c58/c59/c5A/c5B/c5C/c5D/c5E
911: 		 /c5F/c60/c61/c62/c63/c64/c65/c66/c67/c68/c69/c6A/c6B/c6C/c6D/c6E/c6F/c70/c71
912: 		 /c72/c73/c74/c75/c76/c77/c78/c79/c7A/c7B/c7C/c7D/c7E/c7F/c80/c81/c82/c83/c84
913: 		 /c85/c86/c87/c88/c89/c8A/c8B/c8C/c8D/c8E/c8F/c90/c91/c92/c93/c94/c95/c96/c97
914: 		 /c98/c99/c9A/c9B/c9C/c9D/c9E/c9F/cA0/cA1/cA2/cA3/cA4/cA5/cA6/cA7/cA8/cA9/cAA
915: 		 /cAB/cAC/cAD/cAE/cAF/cB0/cB1/cB2/cB3/cB4/cB5/cB6/cB7/cB8/cB9/cBA/cBB/cBC/cBD
916: 		 /cBE/cBF/cC0/cC1/cC2/cC3/cC4/cC5/cC6/cC7/cC8/cC9/cCA/cCB/cCC/cCD/cCE/cCF/cD0
917: 		 /cD1/cD2/cD3/cD4/cD5/cD6/cD7/cD8/cD9/cDA/cDB/cDC/cDD/cDE/cDF/cE0/cE1/cE2/cE3
918: 		 /cE4/cE5/cE6/cE7/cE8/cE9/cEA/cEB/cEC/cED/cEE/cEF/cF0/cF1/cF2/cF3/cF4/cF5/cF6
919: 		 /cF7/cF8/cF9/cFA/cFB/cFC/cFD/cFE/cFF] def
920: 		/ct_CID_STR_SIZE 8000 def
921: 		/ct_mkocfStr100 100 string def
922: 		/ct_defaultFontMtx [.001 0 0 .001 0 0] def
923: 		/ct_1000Mtx [1000 0 0 1000 0 0] def
924: 		/ct_raise {exch cvx exch errordict exch get exec stop} bind def
925: 		/ct_reraise
926: 			{ cvx $error /errorname get (Error: ) print dup (						  ) cvs print
927: 					errordict exch get exec stop
928: 			} bind def
929: 		/ct_cvnsi
930: 			{
931: 			1 index add 1 sub 1 exch 0 4 1 roll
932: 				{
933: 				2 index exch get
934: 				exch 8 bitshift
935: 				add
936: 				}
937: 			for
938: 			exch pop
939: 			} bind def
940: 		/ct_GetInterval
941: 			{
942: 			Adobe_CoolType_Utility /ct_BuildCharDict get
943: 				begin
944: 				/dst_index 0 def
945: 				dup dst_string length gt
946: 					{ dup string /dst_string exch def }
947: 				if
948: 				1 index ct_CID_STR_SIZE idiv
949: 				/arrayIndex exch def
950: 				2 index arrayIndex  get
951: 				2 index
952: 				arrayIndex ct_CID_STR_SIZE mul
953: 				sub
954: 					{
955: 					dup 3 index add 2 index length le
956: 						{
957: 						2 index getinterval
958: 						dst_string  dst_index 2 index putinterval
959: 						length dst_index add /dst_index exch def
960: 						exit
961: 						}
962: 						{
963: 						1 index length 1 index sub
964: 						dup 4 1 roll
965: 						getinterval
966: 						dst_string  dst_index 2 index putinterval
967: 						pop dup dst_index add /dst_index exch def
968: 						sub
969: 						/arrayIndex arrayIndex 1 add def
970: 						2 index dup length arrayIndex gt
971: 							  { arrayIndex get }
972: 							  {
973: 							  pop
974: 							  exit
975: 							  }
976: 						ifelse
977: 						0
978: 						}
979: 					ifelse
980: 					}
981: 				loop
982: 				pop pop pop
983: 				dst_string 0 dst_index getinterval
984: 				end
985: 			} bind def
986: 		ct_Level2?
987: 			{
988: 			/ct_resourcestatus
989: 			currentglobal mark true setglobal
990: 				{ /unknowninstancename /Category resourcestatus }
991: 			stopped
992: 				{ cleartomark setglobal true }
993: 				{ cleartomark currentglobal not exch setglobal }
994: 			ifelse
995: 				{
996: 					{
997: 					mark 3 1 roll /Category findresource
998: 						begin
999: 						ct_Vars /vm currentglobal put
1000: 						({ResourceStatus} stopped) 0 () /SubFileDecode filter cvx exec
1001: 							{ cleartomark false }
1002: 							{ { 3 2 roll pop true } { cleartomark false } ifelse }
1003: 						ifelse
1004: 						ct_Vars /vm get setglobal
1005: 						end
1006: 					}
1007: 				}
1008: 				{ { resourcestatus } }
1009: 			ifelse bind def
1010: 			/CIDFont /Category ct_resourcestatus
1011: 				{ pop pop }
1012: 				{
1013: 				currentglobal  true setglobal
1014: 				/Generic /Category findresource
1015: 				dup length dict copy
1016: 				dup /InstanceType /dicttype put
1017: 				/CIDFont exch /Category defineresource pop
1018: 				setglobal
1019: 				}
1020: 			ifelse
1021: 			ct_UseNativeCapability?
1022: 				{
1023: 				/CIDInit /ProcSet findresource begin
1024: 				12 dict begin
1025: 				begincmap
1026: 				/CIDSystemInfo 3 dict dup begin
1027: 				  /Registry (Adobe) def
1028: 				  /Ordering (Identity) def
1029: 				  /Supplement 0 def
1030: 				end def
1031: 				/CMapName /Identity-H def
1032: 				/CMapVersion 1.000 def
1033: 				/CMapType 1 def
1034: 				1 begincodespacerange
1035: 				<0000> <FFFF>
1036: 				endcodespacerange
1037: 				1 begincidrange
1038: 				<0000> <FFFF> 0
1039: 				endcidrange
1040: 				endcmap
1041: 				CMapName currentdict /CMap defineresource pop
1042: 				end
1043: 				end
1044: 				}
1045: 			if
1046: 			}
1047: 			{
1048: 			/ct_Category 2 dict begin
1049: 			/CIDFont  10 dict def
1050: 			/ProcSet	2 dict def
1051: 			currentdict
1052: 			end
1053: 			def
1054: 			/defineresource
1055: 				{
1056: 				ct_Category 1 index 2 copy known
1057: 					{
1058: 					get
1059: 					dup dup maxlength exch length eq
1060: 						{
1061: 						dup length 10 add dict copy
1062: 						ct_Category 2 index 2 index put
1063: 						}
1064: 					if
1065: 					3 index 3 index put
1066: 					pop exch pop
1067: 					}
1068: 					{ pop pop /defineresource /undefined ct_raise }
1069: 				ifelse
1070: 				} bind def
1071: 			/findresource
1072: 				{
1073: 				ct_Category 1 index 2 copy known
1074: 					{
1075: 					get
1076: 					2 index 2 copy known
1077: 						{ get 3 1 roll pop pop}
1078: 						{ pop pop /findresource /undefinedresource ct_raise }
1079: 					ifelse
1080: 					}
1081: 					{ pop pop /findresource /undefined ct_raise }
1082: 				ifelse
1083: 				} bind def
1084: 			/resourcestatus
1085: 				{
1086: 				ct_Category 1 index 2 copy known
1087: 					{
1088: 					get
1089: 					2 index known
1090: 					exch pop exch pop
1091: 						{
1092: 						0 -1 true
1093: 						}
1094: 						{
1095: 						false
1096: 						}
1097: 					ifelse
1098: 					}
1099: 					{ pop pop /findresource /undefined ct_raise }
1100: 				ifelse
1101: 				} bind def
1102: 			/ct_resourcestatus /resourcestatus load def
1103: 			}
1104: 		ifelse
1105: 		/ct_CIDInit 2 dict
1106: 			begin
1107: 			/ct_cidfont_stream_init
1108: 				{
1109: 					{
1110: 					dup (Binary) eq
1111: 						{
1112: 						pop
1113: 						null
1114: 						currentfile
1115: 						ct_Level2?
1116: 							{
1117: 								{ cid_BYTE_COUNT () /SubFileDecode filter }
1118: 							stopped
1119: 								{ pop pop pop }
1120: 							if
1121: 							}
1122: 						if
1123: 						/readstring load
1124: 						exit
1125: 						}
1126: 					if
1127: 					dup (Hex) eq
1128: 						{
1129: 						pop
1130: 						currentfile
1131: 						ct_Level2?
1132: 							{
1133: 								{ null exch /ASCIIHexDecode filter /readstring }
1134: 							stopped
1135: 								{ pop exch pop (>) exch /readhexstring }
1136: 							if
1137: 							}
1138: 							{ (>) exch /readhexstring }
1139: 						ifelse
1140: 						load
1141: 						exit
1142: 						}
1143: 					if
1144: 					/StartData /typecheck ct_raise
1145: 					}
1146: 				loop
1147: 				cid_BYTE_COUNT ct_CID_STR_SIZE le
1148: 					{
1149: 					2 copy cid_BYTE_COUNT string exch exec
1150: 					pop
1151: 					1 array dup
1152: 					3 -1 roll
1153: 					0 exch put
1154: 					}
1155: 					{
1156: 					cid_BYTE_COUNT ct_CID_STR_SIZE div ceiling cvi
1157: 					dup array exch 2 sub 0 exch 1 exch
1158: 						{
1159: 						2 copy
1160: 						5 index
1161: 						ct_CID_STR_SIZE
1162: 						string
1163: 						6 index exec
1164: 						pop
1165: 						put
1166: 						pop
1167: 						}
1168: 					for
1169: 					2 index
1170: 					cid_BYTE_COUNT ct_CID_STR_SIZE mod string
1171: 					3 index exec
1172: 					pop
1173: 					1 index exch
1174: 					1 index length 1 sub
1175: 					exch put
1176: 					}
1177: 				ifelse
1178: 				cid_CIDFONT exch /GlyphData exch put
1179: 				2 index null eq
1180: 					{
1181: 					pop pop pop
1182: 					}
1183: 					{
1184: 					pop /readstring load
1185: 					1 string exch
1186: 						{
1187: 						3 copy exec
1188: 						pop
1189: 						dup length 0 eq
1190: 							{
1191: 							pop pop pop pop pop
1192: 							true exit
1193: 							}
1194: 						if
1195: 						4 index
1196: 						eq
1197: 							{
1198: 							pop pop pop pop
1199: 							false exit
1200: 							}
1201: 						if
1202: 						}
1203: 					loop
1204: 					pop
1205: 					}
1206: 				ifelse
1207: 				} bind def
1208: 			/StartData
1209: 				{
1210: 				mark
1211: 					{
1212: 					currentdict
1213: 					dup /FDArray get 0 get /FontMatrix get
1214: 					0 get 0.001 eq
1215: 						{
1216: 						dup /CDevProc known not
1217: 							{
1218: 							/CDevProc 1183615869 internaldict /stdCDevProc 2 copy known
1219: 								{ get }
1220: 								{
1221: 								pop pop
1222: 								{ pop pop pop pop pop 0 -1000 7 index 2 div 880 }
1223: 								}
1224: 							ifelse
1225: 							def
1226: 							}
1227: 						if
1228: 						}
1229: 						{
1230: 						 /CDevProc
1231: 							 {
1232: 							 pop pop pop pop pop
1233: 							 0
1234: 							 1 cid_temp /cid_CIDFONT get
1235: 							 /FDArray get 0 get
1236: 							 /FontMatrix get 0 get div
1237: 							 7 index 2 div
1238: 							 1 index 0.88 mul
1239: 							 } def
1240: 						}
1241: 					ifelse
1242: 					/cid_temp 15 dict def
1243: 					cid_temp
1244: 						begin
1245: 						/cid_CIDFONT exch def
1246: 						3 copy pop
1247: 						dup /cid_BYTE_COUNT exch def 0 gt
1248: 							{
1249: 							ct_cidfont_stream_init
1250: 							FDArray
1251: 								{
1252: 								/Private get
1253: 								dup /SubrMapOffset known
1254: 									{
1255: 									begin
1256: 									/Subrs SubrCount array def
1257: 									Subrs
1258: 									SubrMapOffset
1259: 									SubrCount
1260: 									SDBytes
1261: 									ct_Level2?
1262: 										{
1263: 										currentdict dup /SubrMapOffset undef
1264: 										dup /SubrCount undef
1265: 										/SDBytes undef
1266: 										}
1267: 									if
1268: 									end
1269: 									/cid_SD_BYTES exch def
1270: 									/cid_SUBR_COUNT exch def
1271: 									/cid_SUBR_MAP_OFFSET exch def
1272: 									/cid_SUBRS exch def
1273: 									cid_SUBR_COUNT 0 gt
1274: 										{
1275: 										GlyphData cid_SUBR_MAP_OFFSET cid_SD_BYTES ct_GetInterval
1276: 										0 cid_SD_BYTES ct_cvnsi
1277: 										0 1 cid_SUBR_COUNT 1 sub
1278: 											{
1279: 											exch 1 index
1280: 											1 add
1281: 											cid_SD_BYTES mul cid_SUBR_MAP_OFFSET add
1282: 											GlyphData exch cid_SD_BYTES ct_GetInterval
1283: 											0 cid_SD_BYTES ct_cvnsi
1284: 											cid_SUBRS 4 2 roll
1285: 											GlyphData exch
1286: 											4 index
1287: 											1 index
1288: 											sub
1289: 											ct_GetInterval
1290: 											dup length string copy put
1291: 											}
1292: 										for
1293: 										pop
1294: 										}
1295: 									if
1296: 									}
1297: 									{ pop }
1298: 								ifelse
1299: 								}
1300: 							forall
1301: 							}
1302: 						if
1303: 						cleartomark pop pop
1304: 						end
1305: 					CIDFontName currentdict /CIDFont defineresource pop
1306: 					end end
1307: 					}
1308: 				stopped
1309: 					{ cleartomark /StartData ct_reraise }
1310: 				if
1311: 				} bind def
1312: 			currentdict
1313: 			end def
1314: 		/ct_saveCIDInit
1315: 			{
1316: 			/CIDInit /ProcSet ct_resourcestatus
1317: 				{ true }
1318: 				{ /CIDInitC /ProcSet ct_resourcestatus }
1319: 			ifelse
1320: 				{
1321: 				pop pop
1322: 				/CIDInit /ProcSet findresource
1323: 				ct_UseNativeCapability?
1324: 					{ pop null }
1325: 					{ /CIDInit ct_CIDInit /ProcSet defineresource pop }
1326: 				ifelse
1327: 				}
1328: 				{ /CIDInit ct_CIDInit /ProcSet defineresource pop null }
1329: 			ifelse
1330: 			ct_Vars exch /ct_oldCIDInit exch put
1331: 			} bind def
1332: 		/ct_restoreCIDInit
1333: 			{
1334: 			ct_Vars /ct_oldCIDInit get dup null ne
1335: 				{ /CIDInit exch /ProcSet defineresource pop }
1336: 				{ pop }
1337: 			ifelse
1338: 			} bind def
1339: 		/ct_BuildCharSetUp
1340: 			{
1341: 			1 index
1342: 				begin
1343: 				CIDFont
1344: 					begin
1345: 					Adobe_CoolType_Utility /ct_BuildCharDict get
1346: 						begin
1347: 						/ct_dfCharCode exch def
1348: 						/ct_dfDict exch def
1349: 						CIDFirstByte ct_dfCharCode add
1350: 						dup CIDCount ge
1351: 							{ pop 0 }
1352: 						if
1353: 						/cid exch def
1354: 							{
1355: 							GlyphDirectory cid 2 copy known
1356: 								{ get }
1357: 								{ pop pop nullstring }
1358: 							ifelse
1359: 							dup length FDBytes sub 0 gt
1360: 								{
1361: 								dup
1362: 								FDBytes 0 ne
1363: 									{ 0 FDBytes ct_cvnsi }
1364: 									{ pop 0 }
1365: 								ifelse
1366: 								/fdIndex exch def
1367: 								dup length FDBytes sub FDBytes exch getinterval
1368: 								/charstring exch def
1369: 								exit
1370: 								}
1371: 								{
1372: 								pop
1373: 								cid 0 eq
1374: 									{ /charstring nullstring def exit }
1375: 								if
1376: 								/cid 0 def
1377: 								}
1378: 							ifelse
1379: 							}
1380: 						loop
1381: 			} def
1382: 		/ct_SetCacheDevice
1383: 			{
1384: 			0 0 moveto
1385: 			dup stringwidth
1386: 			3 -1 roll
1387: 			true charpath
1388: 			pathbbox
1389: 			0 -1000
1390: 			7 index 2 div 880
1391: 			setcachedevice2
1392: 			0 0 moveto
1393: 			} def
1394: 		/ct_CloneSetCacheProc
1395: 			{
1396: 			1 eq
1397: 				{
1398: 				stringwidth
1399: 				pop -2 div -880
1400: 				0 -1000 setcharwidth
1401: 				moveto
1402: 				}
1403: 				{
1404: 				usewidths?
1405: 					{
1406: 					currentfont /Widths get cid
1407: 					2 copy known
1408: 						{ get exch pop aload pop }
1409: 						{ pop pop stringwidth }
1410: 					ifelse
1411: 					}
1412: 					{ stringwidth }
1413: 				ifelse
1414: 				setcharwidth
1415: 				0 0 moveto
1416: 				}
1417: 			ifelse
1418: 			} def
1419: 		/ct_Type3ShowCharString
1420: 			{
1421: 			ct_FDDict fdIndex 2 copy known
1422: 				{ get }
1423: 				{
1424: 				currentglobal 3 1 roll
1425: 				1 index gcheck setglobal
1426: 				ct_Type1FontTemplate dup maxlength dict copy
1427: 					begin
1428: 					FDArray fdIndex get
1429: 					dup /FontMatrix 2 copy known
1430: 						{ get }
1431: 						{ pop pop ct_defaultFontMtx }
1432: 					ifelse
1433: 					/FontMatrix exch dup length array copy def
1434: 					/Private get
1435: 					/Private exch def
1436: 					/Widths rootfont /Widths get def
1437: 					/CharStrings 1 dict dup /.notdef
1438: 						<d841272cf18f54fc13> dup length string copy put def
1439: 					currentdict
1440: 					end
1441: 				/ct_Type1Font exch definefont
1442: 				dup 5 1 roll put
1443: 				setglobal
1444: 				}
1445: 			ifelse
1446: 			dup /CharStrings get 1 index /Encoding get
1447: 			ct_dfCharCode get charstring put
1448: 			rootfont /WMode 2 copy known
1449: 				{ get }
1450: 				{ pop pop 0 }
1451: 			ifelse
1452: 			exch
1453: 			1000 scalefont setfont
1454: 			ct_str1 0 ct_dfCharCode put
1455: 			ct_str1 exch ct_dfSetCacheProc
1456: 			ct_SyntheticBold
1457: 				{
1458: 				currentpoint
1459: 				ct_str1 show
1460: 				newpath
1461: 				moveto
1462: 				ct_str1 true charpath
1463: 				ct_StrokeWidth setlinewidth
1464: 				stroke
1465: 				}
1466: 				{ ct_str1 show }
1467: 			ifelse
1468: 			} def
1469: 		/ct_Type4ShowCharString
1470: 			{
1471: 			ct_dfDict ct_dfCharCode charstring
1472: 			FDArray fdIndex get
1473: 			dup /FontMatrix get dup ct_defaultFontMtx ct_matrixeq not
1474: 				{ ct_1000Mtx matrix concatmatrix concat }
1475: 				{ pop }
1476: 			ifelse
1477: 			/Private get
1478: 			Adobe_CoolType_Utility /ct_Level2? get not
1479: 				{
1480: 				ct_dfDict /Private
1481: 				3 -1 roll
1482: 					{ put }
1483: 				1183615869 internaldict /superexec get exec
1484: 				}
1485: 			if
1486: 			1183615869 internaldict
1487: 			Adobe_CoolType_Utility /ct_Level2? get
1488: 				{ 1 index }
1489: 				{ 3 index /Private get mark 6 1 roll }
1490: 			ifelse
1491: 			dup /RunInt known
1492: 				{ /RunInt get }
1493: 				{ pop /CCRun }
1494: 			ifelse
1495: 			get exec
1496: 			Adobe_CoolType_Utility /ct_Level2? get not
1497: 				{ cleartomark }
1498: 			if
1499: 			} bind def
1500: 		/ct_BuildCharIncremental
1501: 			{
1502: 				{
1503: 				Adobe_CoolType_Utility /ct_MakeOCF get begin
1504: 				ct_BuildCharSetUp
1505: 				ct_ShowCharString
1506: 				}
1507: 			stopped
1508: 				{ stop }
1509: 			if
1510: 			end
1511: 			end
1512: 			end
1513: 			end
1514: 			} bind def
1515: 		/BaseFontNameStr (BF00) def
1516: 		/ct_Type1FontTemplate 14 dict
1517: 			begin
1518: 			/FontType 1 def
1519: 			/FontMatrix  [0.001 0 0 0.001 0 0] def
1520: 			/FontBBox  [-250 -250 1250 1250] def
1521: 			/Encoding ct_cHexEncoding def
1522: 			/PaintType 0 def
1523: 			currentdict
1524: 			end def
1525: 		/BaseFontTemplate 11 dict
1526: 			begin
1527: 			/FontMatrix  [0.001 0 0 0.001 0 0] def
1528: 			/FontBBox  [-250 -250 1250 1250] def
1529: 			/Encoding ct_cHexEncoding def
1530: 			/BuildChar /ct_BuildCharIncremental load def
1531: 			ct_Clone?
1532: 				{
1533: 				/FontType 3 def
1534: 				/ct_ShowCharString /ct_Type3ShowCharString load def
1535: 				/ct_dfSetCacheProc /ct_CloneSetCacheProc load def
1536: 				/ct_SyntheticBold false def
1537: 				/ct_StrokeWidth 1 def
1538: 				}
1539: 				{
1540: 				/FontType 4 def
1541: 				/Private 1 dict dup /lenIV 4 put def
1542: 				/CharStrings 1 dict dup /.notdef <d841272cf18f54fc13> put def
1543: 				/PaintType 0 def
1544: 				/ct_ShowCharString /ct_Type4ShowCharString load def
1545: 				}
1546: 			ifelse
1547: 			/ct_str1 1 string def
1548: 			currentdict
1549: 			end def
1550: 		/BaseFontDictSize BaseFontTemplate length 5 add def
1551: 		/ct_matrixeq
1552: 			{
1553: 			true 0 1 5
1554: 				{
1555: 				dup 4 index exch get exch 3 index exch get eq and
1556: 				dup not
1557: 					{ exit }
1558: 				if
1559: 				}
1560: 			for
1561: 			exch pop exch pop
1562: 			} bind def
1563: 		/ct_makeocf
1564: 			{
1565: 			15 dict
1566: 				begin
1567: 				exch /WMode exch def
1568: 				exch /FontName exch def
1569: 				/FontType 0 def
1570: 				/FMapType 2 def
1571: 			dup /FontMatrix known
1572: 				{ dup /FontMatrix get /FontMatrix exch def }
1573: 				{ /FontMatrix matrix def }
1574: 			ifelse
1575: 				/bfCount 1 index /CIDCount get 256 idiv 1 add
1576: 					dup 256 gt { pop 256} if def
1577: 				/Encoding
1578: 					256 array 0 1 bfCount 1 sub { 2 copy dup put pop } for
1579: 					bfCount 1 255 { 2 copy bfCount put pop } for
1580: 					def
1581: 				/FDepVector bfCount dup 256 lt { 1 add } if array def
1582: 				BaseFontTemplate BaseFontDictSize dict copy
1583: 					begin
1584: 					/CIDFont exch def
1585: 					CIDFont /FontBBox known
1586: 						{ CIDFont /FontBBox get /FontBBox exch def }
1587: 					if
1588: 					CIDFont /CDevProc known
1589: 						{ CIDFont /CDevProc get /CDevProc exch def }
1590: 					if
1591: 					currentdict
1592: 					end
1593: 				BaseFontNameStr 3 (0) putinterval
1594: 				0 1 bfCount dup 256 eq { 1 sub } if
1595: 					{
1596: 					FDepVector exch
1597: 					2 index BaseFontDictSize dict copy
1598: 						begin
1599: 						dup /CIDFirstByte exch 256 mul def
1600: 						FontType 3 eq
1601: 							{ /ct_FDDict 2 dict def }
1602: 						if
1603: 						currentdict
1604: 						end
1605: 					1 index  16
1606: 					BaseFontNameStr  2 2 getinterval cvrs pop
1607: 					BaseFontNameStr exch definefont
1608: 					put
1609: 					}
1610: 				for
1611: 				ct_Clone?
1612: 					{ /Widths 1 index /CIDFont get /GlyphDirectory get length dict def }
1613: 				if
1614: 				FontName
1615: 				currentdict
1616: 				end
1617: 			definefont
1618: 			ct_Clone?
1619: 				{
1620: 				gsave
1621: 				dup 1000 scalefont setfont
1622: 				ct_BuildCharDict
1623: 					begin
1624: 					/usewidths? false def
1625: 					currentfont /Widths get
1626: 						begin
1627: 						exch /CIDFont get /GlyphDirectory get
1628: 							{
1629: 							pop
1630: 							dup charcode exch 1 index 0 2 index 256 idiv put
1631: 							1 index exch 1 exch 256 mod put
1632: 							stringwidth 2 array astore def
1633: 							}
1634: 						forall
1635: 						end
1636: 					/usewidths? true def
1637: 					end
1638: 				grestore
1639: 				}
1640: 				{ exch pop }
1641: 			ifelse
1642: 			} bind def
1643: 		/ct_ComposeFont
1644: 			{
1645: 			ct_UseNativeCapability?
1646: 				{
1647: 				2 index /CMap ct_resourcestatus
1648: 					{ pop pop exch pop }
1649: 					{
1650: 					/CIDInit /ProcSet findresource
1651: 						begin
1652: 						12 dict
1653: 							begin
1654: 							begincmap
1655: 							/CMapName 3 index def
1656: 							/CMapVersion 1.000 def
1657: 							/CMapType 1 def
1658: 							exch /WMode exch def
1659: 							/CIDSystemInfo 3 dict dup
1660: 								begin
1661: 								/Registry (Adobe) def
1662: 								/Ordering
1663: 								CMapName ct_mkocfStr100 cvs
1664: 								(Adobe-) search
1665: 									{
1666: 									pop pop
1667: 									(-) search
1668: 										{
1669: 										dup length string copy
1670: 										exch pop exch pop
1671: 										}
1672: 										{ pop (Identity)}
1673: 									ifelse
1674: 									}
1675: 									{ pop  (Identity)  }
1676: 								ifelse
1677: 								def
1678: 								/Supplement 0 def
1679: 								end def
1680: 							1 begincodespacerange
1681: 							<0000> <FFFF>
1682: 							endcodespacerange
1683: 							1 begincidrange
1684: 							<0000> <FFFF> 0
1685: 							endcidrange
1686: 							endcmap
1687: 							CMapName currentdict /CMap defineresource pop
1688: 							end
1689: 						end
1690: 					}
1691: 				ifelse
1692: 				composefont
1693: 				}
1694: 				{
1695: 				3 2 roll pop
1696: 				0 get /CIDFont findresource
1697: 				ct_makeocf
1698: 				}
1699: 			ifelse
1700: 			} bind def
1701: 		/ct_MakeIdentity
1702: 			{
1703: 			ct_UseNativeCapability?
1704: 				{
1705: 				1 index /CMap ct_resourcestatus
1706: 					{ pop pop }
1707: 					{
1708: 					/CIDInit /ProcSet findresource begin
1709: 					12 dict begin
1710: 					begincmap
1711: 					/CMapName 2 index def
1712: 					/CMapVersion 1.000 def
1713: 					/CMapType 1 def
1714: 					/CIDSystemInfo 3 dict dup
1715: 						begin
1716: 						/Registry (Adobe) def
1717: 						/Ordering
1718: 						CMapName ct_mkocfStr100 cvs
1719: 						(Adobe-) search
1720: 							{
1721: 							pop pop
1722: 							(-) search
1723: 								{ dup length string copy exch pop exch pop }
1724: 								{ pop (Identity) }
1725: 							ifelse
1726: 							}
1727: 							{ pop (Identity) }
1728: 						ifelse
1729: 						def
1730: 						/Supplement 0 def
1731: 						end def
1732: 					1 begincodespacerange
1733: 					<0000> <FFFF>
1734: 					endcodespacerange
1735: 					1 begincidrange
1736: 					<0000> <FFFF> 0
1737: 					endcidrange
1738: 					endcmap
1739: 					CMapName currentdict /CMap defineresource pop
1740: 					end
1741: 					end
1742: 					}
1743: 				ifelse
1744: 				composefont
1745: 				}
1746: 				{
1747: 				exch pop
1748: 				0 get /CIDFont findresource
1749: 				ct_makeocf
1750: 				}
1751: 			ifelse
1752: 			} bind def
1753: 		currentdict readonly pop
1754: 		end
1755: 	end
1756: %%EndResource
1757: /currentpacking where{pop currentpacking true setpacking}if
1758: %%BeginResource: procset pdfvars 6.0 1
1759: %%Copyright: Copyright 1987-2002 Adobe Systems Incorporated. All Rights Reserved.
1760: %%Title: definition of dictionary of variables used by PDF & PDFText procsets
1761: userdict /PDF 162 dict put
1762: userdict /PDFVars 89 dict dup begin put
1763: /docSetupDone false def
1764: /InitAll 0 def
1765: /TermAll 0 def
1766: /DocInitAll 0 def
1767: /DocTermAll 0 def
1768: /_pdfEncodings 2 array def
1769: /_pdf_str1 1 string def
1770: /_pdf_i 0 def
1771: /_pdf_na 0 def
1772: /_pdf_showproc 0 def
1773: /_italMtx [1 0 .212557 1 0 0] def
1774: /_italMtx_WMode1 [1 -.212557 0 1 0 0] def
1775: /_italMtxType0 [1 0 .1062785 1 0 0] def
1776: /_italMtx_WMode1Type0 [1 -.1062785 0 1 0 0] def
1777: /_basefont 0 def
1778: /_basefonto 0 def
1779: /_pdf_oldCIDInit null def
1780: /_pdf_FontDirectory 30 dict def
1781: /_categories 10 dict def
1782: /_sa? true def
1783: /_ColorSep5044? false def
1784: /nulldict 0 dict def
1785: /_processColors 0 def
1786: /overprintstack null def
1787: /_defaulttransfer currenttransfer def
1788: /_defaultflatness currentflat def
1789: /_defaulthalftone null def
1790: /_defaultcolortransfer null def
1791: /_defaultblackgeneration null def
1792: /_defaultundercolorremoval null def
1793: /_defaultcolortransfer null def
1794: PDF begin
1795: [/c/cs/cm/d/d0/f/h/i/j/J/l/m/M/n/q/Q/re/ri/S/sc/sh/Tf/w/W
1796: /applyInterpFunc/applystitchFunc/domainClip/encodeInput
1797: /initgs/int/limit/rangeClip
1798: /defineRes/undefineRes/findRes/setSA/pl
1799: /? /! /| /: /+ /GetGlyphDirectory
1800: /pdf_flushFilters /pdf_readstring /pdf_dictOp /pdf_image /pdf_maskedImage
1801: /pdf_shfill /pdf_sethalftone
1802: ] {null def} bind forall
1803: end
1804: end
1805: %%EndResource
1806: PDFVars begin PDF begin
1807: %%BeginResource: procset pdfutil 6.0 1
1808: %%Copyright: Copyright 1993-2001 Adobe Systems Incorporated. All Rights Reserved.
1809: %%Title: Basic utilities used by other PDF procsets
1810: /bd {bind def} bind def
1811: /ld {load def} bd
1812: /bld {
1813: dup length dict begin
1814: { null def } forall
1815: bind
1816: end
1817: def
1818: } bd
1819: /dd { PDFVars 3 1 roll put } bd
1820: /xdd { exch dd } bd
1821: /Level2?
1822: systemdict /languagelevel known
1823: { systemdict /languagelevel get 2 ge } { false } ifelse
1824: def
1825: /Level1? Level2? not def
1826: /Level3?
1827: systemdict /languagelevel known
1828: {systemdict /languagelevel get 3 eq } { false } ifelse
1829: def
1830: /getifknown {
1831: 2 copy known { get true } { pop pop false } ifelse
1832: } bd
1833: /here {
1834: currentdict exch getifknown
1835: } bd
1836: /isdefined? { where { pop true } { false } ifelse } bd
1837: %%EndResource
1838: %%BeginResource: procset l2compat 6.0 1
1839: %%Copyright: Copyright 1987-2003 Adobe Systems Incorporated. All Rights Reserved.
1840: %%Title: Level 1 emulation of level 2 operators
1841: /setcmykcolor isdefined? not
1842: {
1843: /setcmykcolor {
1844: 1 sub 4 1 roll
1845: 3 {
1846: 3 index add neg dup 0 lt { pop 0 } if
1847: 3 1 roll
1848: } repeat
1849: setrgbcolor
1850: pop
1851: } bd
1852: } if
1853: /rectclip isdefined? not
1854: {
1855: /rectclip { newpath re clip newpath } bd
1856: } if
1857: /rectfill isdefined? not
1858: {
1859: /rectfill { gsave newpath re fill grestore } bd
1860: } if
1861: /sethalftone isdefined? not
1862: {
1863: /sethalftone {
1864: begin
1865: HalftoneType 1 eq
1866: { Frequency Angle /SpotFunction load setscreen }
1867: if
1868: end
1869: } bd
1870: } if
1871: Level1?
1872: {
1873: /pdf_show {show} bd
1874: /xshow
1875: {
1876: PDFVars /_pdf_showproc /pdf_show load put
1877: pdf_xshow
1878: } bd
1879: /yshow
1880: {
1881: PDFVars /_pdf_showproc /pdf_show load put
1882: pdf_yshow
1883: } bd
1884: /xyshow
1885: {
1886: PDFVars /_pdf_showproc /pdf_show load put
1887: pdf_xyshow
1888: } bd
1889: } if
1890: /getrampcolor {
1891: cvi
1892: /indx exch def
1893: [
1894: 0 1 NumComp 1 sub {
1895: dup
1896: Samples exch get
1897: dup type /stringtype eq { indx get } if
1898: exch
1899: Scaling exch get aload pop
1900: 3 1 roll
1901: mul add
1902: } for
1903: ]
1904: L1setcolor
1905: } bd
1906: /sssetbackground { L1setcolor } bd
1907: %%EndResource
1908: %%BeginResource: procset pdf 6.0 1
1909: %%Copyright: Copyright 1998-2003 Adobe Systems Incorporated. All Rights Reserved.
1910: %%Title: General operators for PDF, common to all Language Levels.
1911: /cm { matrix astore concat } bd
1912: /d /setdash ld
1913: /f /fill ld
1914: /h /closepath ld
1915: /i {dup 0 eq {pop _defaultflatness} if setflat} bd
1916: /j /setlinejoin ld
1917: /J /setlinecap ld
1918: /M /setmiterlimit ld
1919: /n /newpath ld
1920: /S /stroke ld
1921: /w /setlinewidth ld
1922: /W /clip ld
1923: /sg /setgray ld
1924: /initgs {
1925: 0 setgray
1926: [] 0 d
1927: 0 j
1928: 0 J
1929: 10 M
1930: 1 w
1931: false setSA
1932: /_defaulttransfer load settransfer
1933: 0 i
1934: /RelativeColorimetric ri
1935: newpath
1936: } bd
1937: /int {
1938: dup 2 index sub 3 index 5 index sub div 6 -2 roll sub mul
1939: exch pop add exch pop
1940: } bd
1941: /limit {
1942: dup 2 index le { exch } if pop
1943: dup 2 index ge { exch } if pop
1944: } bd
1945: /domainClip {
1946: Domain aload pop 3 2 roll
1947: limit
1948: } [/Domain] bld
1949: /applyInterpFunc {
1950: 0 1 DimOut 1 sub
1951: {
1952: dup C0 exch get exch
1953: dup C1 exch get exch
1954: 3 1 roll
1955: 1 index sub
1956: 3 index
1957: N exp mul add
1958: exch
1959: currentdict /Range_lo known
1960: {
1961: dup Range_lo exch get exch
1962: Range_hi exch get
1963: 3 2 roll limit
1964: }
1965: {
1966: pop
1967: }
1968: ifelse
1969: exch
1970: } for
1971: pop
1972: } [/DimOut /C0 /C1 /N /Range_lo /Range_hi] bld
1973: /encodeInput {
1974: NumParts 1 sub
1975: 0 1 2 index
1976: {
1977: dup Bounds exch get
1978: 2 index gt
1979: { exit }
1980: { dup
1981: 3 index eq
1982: { exit }
1983: { pop } ifelse
1984: } ifelse
1985: } for
1986: 3 2 roll pop
1987: dup Bounds exch get exch
1988: dup 1 add Bounds exch get exch
1989: 2 mul
1990: dup Encode exch get exch
1991: 1 add Encode exch get
1992: int
1993: } [/NumParts /Bounds /Encode] bld
1994: /rangeClip {
1995: exch dup Range_lo exch get
1996: exch Range_hi exch get
1997: 3 2 roll
1998: limit
1999: } [/Range_lo /Range_hi] bld
2000: /applyStitchFunc {
2001: Functions exch get exec
2002: currentdict /Range_lo known {
2003: 0 1 DimOut 1 sub {
2004: DimOut 1 add -1 roll
2005: rangeClip
2006: } for
2007: } if
2008: } [/Functions /Range_lo /DimOut] bld
2009: /pdf_flushfilters
2010: {
2011: aload length
2012: { dup status
2013: 1 index currentfile ne and
2014: { dup flushfile closefile }
2015: { pop }
2016: ifelse
2017: } repeat
2018: } bd
2019: /pdf_readstring
2020: {
2021: 1 index dup length 1 sub get
2022: exch readstring pop
2023: exch pdf_flushfilters
2024: } bind def
2025: /pdf_dictOp
2026: {
2027: 3 2 roll
2028: 10 dict copy
2029: begin
2030: _Filters dup length 1 sub get def
2031: currentdict exch exec
2032: _Filters pdf_flushfilters
2033: end
2034: } [/_Filters] bld
2035: /pdf_image {{image} /DataSource pdf_dictOp} bd
2036: /pdf_imagemask {{imagemask} /DataSource pdf_dictOp} bd
2037: /pdf_shfill {{sh} /DataSource pdf_dictOp} bd
2038: /pdf_sethalftone {{sethalftone} /Thresholds pdf_dictOp} bd
2039: /pdf_maskedImage
2040: {
2041: 10 dict copy begin
2042: /miDict currentdict def
2043: /DataDict DataDict 10 dict copy def
2044: DataDict begin
2045: /DataSource
2046: _Filters dup length 1 sub get
2047: def
2048: miDict image
2049: _Filters pdf_flushfilters
2050: end
2051: end
2052: } [/miDict /DataDict /_Filters] bld
2053: /RadialShade {
2054: 40 dict begin
2055: /background exch def
2056: /ext1 exch def
2057: /ext0 exch def
2058: /BBox exch def
2059: /r2 exch def
2060: /c2y exch def
2061: /c2x exch def
2062: /r1 exch def
2063: /c1y exch def
2064: /c1x exch def
2065: /rampdict exch def
2066: gsave
2067: BBox length 0 gt {
2068: newpath
2069: BBox 0 get BBox 1 get moveto
2070: BBox 2 get BBox 0 get sub 0 rlineto
2071: 0 BBox 3 get BBox 1 get sub rlineto
2072: BBox 2 get BBox 0 get sub neg 0 rlineto
2073: closepath
2074: clip
2075: newpath
2076: } if
2077: c1x c2x eq
2078: {
2079: c1y c2y lt {/theta 90 def}{/theta 270 def} ifelse
2080: }
2081: {
2082: /slope c2y c1y sub c2x c1x sub div def
2083: /theta slope 1 atan def
2084: c2x c1x lt c2y c1y ge and { /theta theta 180 sub def} if
2085: c2x c1x lt c2y c1y lt and { /theta theta 180 add def} if
2086: }
2087: ifelse
2088: gsave
2089: clippath
2090: c1x c1y translate
2091: theta rotate
2092: -90 rotate
2093: { pathbbox } stopped
2094: { 0 0 0 0 } if
2095: /yMax exch def
2096: /xMax exch def
2097: /yMin exch def
2098: /xMin exch def
2099: grestore
2100: xMax xMin eq yMax yMin eq or
2101: {
2102: grestore
2103: end
2104: }
2105: {
2106: /max { 2 copy gt { pop } {exch pop} ifelse } bind def
2107: /min { 2 copy lt { pop } {exch pop} ifelse } bind def
2108: rampdict begin
2109: 40 dict begin
2110: background length 0 gt { background sssetbackground gsave clippath fill grestore } if
2111: gsave
2112: c1x c1y translate
2113: theta rotate
2114: -90 rotate
2115: /c2y c1x c2x sub dup mul c1y c2y sub dup mul add sqrt def
2116: /c1y 0 def
2117: /c1x 0 def
2118: /c2x 0 def
2119: ext0 {
2120: 0 getrampcolor
2121: c2y r2 add r1 sub 0.0001 lt
2122: {
2123: c1x c1y r1 360 0 arcn
2124: pathbbox
2125: /aymax exch def
2126: /axmax exch def
2127: /aymin exch def
2128: /axmin exch def
2129: /bxMin xMin axmin min def
2130: /byMin yMin aymin min def
2131: /bxMax xMax axmax max def
2132: /byMax yMax aymax max def
2133: bxMin byMin moveto
2134: bxMax byMin lineto
2135: bxMax byMax lineto
2136: bxMin byMax lineto
2137: bxMin byMin lineto
2138: eofill
2139: }
2140: {
2141: c2y r1 add r2 le
2142: {
2143: c1x c1y r1 0 360 arc
2144: fill
2145: }
2146: {
2147: c2x c2y r2 0 360 arc fill
2148: r1 r2 eq
2149: {
2150: /p1x r1 neg def
2151: /p1y c1y def
2152: /p2x r1 def
2153: /p2y c1y def
2154: p1x p1y moveto p2x p2y lineto p2x yMin lineto p1x yMin lineto
2155: fill
2156: }
2157: {
2158: /AA r2 r1 sub c2y div def
2159: AA -1 eq
2160: { /theta 89.99 def}
2161: { /theta AA 1 AA dup mul sub sqrt div 1 atan def}
2162: ifelse
2163: /SS1 90 theta add dup sin exch cos div def
2164: /p1x r1 SS1 SS1 mul SS1 SS1 mul 1 add div sqrt mul neg def
2165: /p1y p1x SS1 div neg def
2166: /SS2 90 theta sub dup sin exch cos div def
2167: /p2x r1 SS2 SS2 mul SS2 SS2 mul 1 add div sqrt mul def
2168: /p2y p2x SS2 div neg def
2169: r1 r2 gt
2170: {
2171: /L1maxX p1x yMin p1y sub SS1 div add def
2172: /L2maxX p2x yMin p2y sub SS2 div add def
2173: }
2174: {
2175: /L1maxX 0 def
2176: /L2maxX 0 def
2177: }ifelse
2178: p1x p1y moveto p2x p2y lineto L2maxX L2maxX p2x sub SS2 mul p2y add lineto
2179: L1maxX L1maxX p1x sub SS1 mul p1y add lineto
2180: fill
2181: }
2182: ifelse
2183: }
2184: ifelse
2185: } ifelse
2186: } if
2187: c1x c2x sub dup mul
2188: c1y c2y sub dup mul
2189: add 0.5 exp
2190: 0 dtransform
2191: dup mul exch dup mul add 0.5 exp 72 div
2192: 0 72 matrix defaultmatrix dtransform dup mul exch dup mul add sqrt
2193: 72 0 matrix defaultmatrix dtransform dup mul exch dup mul add sqrt
2194: 1 index 1 index lt { exch } if pop
2195: /hires exch def
2196: hires mul
2197: /numpix exch def
2198: /numsteps NumSamples def
2199: /rampIndxInc 1 def
2200: /subsampling false def
2201: numpix 0 ne
2202: {
2203: NumSamples numpix div 0.5 gt
2204: {
2205: /numsteps numpix 2 div round cvi dup 1 le { pop 2 } if def
2206: /rampIndxInc NumSamples 1 sub numsteps div def
2207: /subsampling true def
2208: } if
2209: } if
2210: /xInc c2x c1x sub numsteps div def
2211: /yInc c2y c1y sub numsteps div def
2212: /rInc r2 r1 sub numsteps div def
2213: /cx c1x def
2214: /cy c1y def
2215: /radius r1 def
2216: newpath
2217: xInc 0 eq yInc 0 eq rInc 0 eq and and
2218: {
2219: 0 getrampcolor
2220: cx cy radius 0 360 arc
2221: stroke
2222: NumSamples 1 sub getrampcolor
2223: cx cy radius 72 hires div add 0 360 arc
2224: 0 setlinewidth
2225: stroke
2226: }
2227: {
2228: 0
2229: numsteps
2230: {
2231: dup
2232: subsampling { round } if
2233: getrampcolor
2234: cx cy radius 0 360 arc
2235: /cx cx xInc add def
2236: /cy cy yInc add def
2237: /radius radius rInc add def
2238: cx cy radius 360 0 arcn
2239: eofill
2240: rampIndxInc add
2241: }
2242: repeat
2243: pop
2244: } ifelse
2245: ext1 {
2246: c2y r2 add r1 lt
2247: {
2248: c2x c2y r2 0 360 arc
2249: fill
2250: }
2251: {
2252: c2y r1 add r2 sub 0.0001 le
2253: {
2254: c2x c2y r2 360 0 arcn
2255: pathbbox
2256: /aymax exch def
2257: /axmax exch def
2258: /aymin exch def
2259: /axmin exch def
2260: /bxMin xMin axmin min def
2261: /byMin yMin aymin min def
2262: /bxMax xMax axmax max def
2263: /byMax yMax aymax max def
2264: bxMin byMin moveto
2265: bxMax byMin lineto
2266: bxMax byMax lineto
2267: bxMin byMax lineto
2268: bxMin byMin lineto
2269: eofill
2270: }
2271: {
2272: c2x c2y r2 0 360 arc fill
2273: r1 r2 eq
2274: {
2275: /p1x r2 neg def
2276: /p1y c2y def
2277: /p2x r2 def
2278: /p2y c2y def
2279: p1x p1y moveto p2x p2y lineto p2x yMax lineto p1x yMax lineto
2280: fill
2281: }
2282: {
2283: /AA r2 r1 sub c2y div def
2284: AA -1 eq
2285: { /theta 89.99 def}
2286: { /theta AA 1 AA dup mul sub sqrt div 1 atan def}
2287: ifelse
2288: /SS1 90 theta add dup sin exch cos div def
2289: /p1x r2 SS1 SS1 mul SS1 SS1 mul 1 add div sqrt mul neg def
2290: /p1y c2y p1x SS1 div sub def
2291: /SS2 90 theta sub dup sin exch cos div def
2292: /p2x r2 SS2 SS2 mul SS2 SS2 mul 1 add div sqrt mul def
2293: /p2y c2y p2x SS2 div sub def
2294: r1 r2 lt
2295: {
2296: /L1maxX p1x yMax p1y sub SS1 div add def
2297: /L2maxX p2x yMax p2y sub SS2 div add def
2298: }
2299: {
2300: /L1maxX 0 def
2301: /L2maxX 0 def
2302: }ifelse
2303: p1x p1y moveto p2x p2y lineto L2maxX L2maxX p2x sub SS2 mul p2y add lineto
2304: L1maxX L1maxX p1x sub SS1 mul p1y add lineto
2305: fill
2306: }
2307: ifelse
2308: }
2309: ifelse
2310: } ifelse
2311: } if
2312: grestore
2313: grestore
2314: end
2315: end
2316: end
2317: } ifelse
2318: } bd
2319: /GenStrips {
2320: 40 dict begin
2321: /background exch def
2322: /ext1 exch def
2323: /ext0 exch def
2324: /BBox exch def
2325: /y2 exch def
2326: /x2 exch def
2327: /y1 exch def
2328: /x1 exch def
2329: /rampdict exch def
2330: gsave
2331: BBox length 0 gt {
2332: newpath
2333: BBox 0 get BBox 1 get moveto
2334: BBox 2 get BBox 0 get sub 0 rlineto
2335: 0 BBox 3 get BBox 1 get sub rlineto
2336: BBox 2 get BBox 0 get sub neg 0 rlineto
2337: closepath
2338: clip
2339: newpath
2340: } if
2341: x1 x2 eq
2342: {
2343: y1 y2 lt {/theta 90 def}{/theta 270 def} ifelse
2344: }
2345: {
2346: /slope y2 y1 sub x2 x1 sub div def
2347: /theta slope 1 atan def
2348: x2 x1 lt y2 y1 ge and { /theta theta 180 sub def} if
2349: x2 x1 lt y2 y1 lt and { /theta theta 180 add def} if
2350: }
2351: ifelse
2352: gsave
2353: clippath
2354: x1 y1 translate
2355: theta rotate
2356: { pathbbox } stopped
2357: { 0 0 0 0 } if
2358: /yMax exch def
2359: /xMax exch def
2360: /yMin exch def
2361: /xMin exch def
2362: grestore
2363: xMax xMin eq yMax yMin eq or
2364: {
2365: grestore
2366: end
2367: }
2368: {
2369: rampdict begin
2370: 20 dict begin
2371: background length 0 gt { background sssetbackground gsave clippath fill grestore } if
2372: gsave
2373: x1 y1 translate
2374: theta rotate
2375: /xStart 0 def
2376: /xEnd x2 x1 sub dup mul y2 y1 sub dup mul add 0.5 exp def
2377: /ySpan yMax yMin sub def
2378: /numsteps NumSamples def
2379: /rampIndxInc 1 def
2380: /subsampling false def
2381: xStart 0 transform
2382: xEnd 0 transform
2383: 3 -1 roll
2384: sub dup mul
2385: 3 1 roll
2386: sub dup mul
2387: add 0.5 exp 72 div
2388: 0 72 matrix defaultmatrix dtransform dup mul exch dup mul add sqrt
2389: 72 0 matrix defaultmatrix dtransform dup mul exch dup mul add sqrt
2390: 1 index 1 index lt { exch } if pop
2391: mul
2392: /numpix exch def
2393: numpix 0 ne
2394: {
2395: NumSamples numpix div 0.5 gt
2396: {
2397: /numsteps numpix 2 div round cvi dup 1 le { pop 2 } if def
2398: /rampIndxInc NumSamples 1 sub numsteps div def
2399: /subsampling true def
2400: } if
2401: } if
2402: ext0 {
2403: 0 getrampcolor
2404: xMin xStart lt
2405: { xMin yMin xMin neg ySpan rectfill } if
2406: } if
2407: /xInc xEnd xStart sub numsteps div def
2408: /x xStart def
2409: 0
2410: numsteps
2411: {
2412: dup
2413: subsampling { round } if
2414: getrampcolor
2415: x yMin xInc ySpan rectfill
2416: /x x xInc add def
2417: rampIndxInc add
2418: }
2419: repeat
2420: pop
2421: ext1 {
2422: xMax xEnd gt
2423: { xEnd yMin xMax xEnd sub ySpan rectfill } if
2424: } if
2425: grestore
2426: grestore
2427: end
2428: end
2429: end
2430: } ifelse
2431: } bd
2432: /currentdistillerparams where { pop currentdistillerparams /CoreDistVersion get 5000 lt}{true}ifelse
2433: {
2434: /PDFMark5 {cleartomark} bd
2435: }
2436: {
2437: /PDFMark5 {pdfmark} bd
2438: }ifelse
2439: /ReadByPDFMark5
2440: {
2441: 2 dict begin
2442: /makerString exch def string /tmpString exch def
2443: {
2444: currentfile tmpString readline pop
2445: makerString anchorsearch
2446: {
2447: pop pop cleartomark exit
2448: }
2449: {
2450: 3 copy /PUT PDFMark5 pop 2 copy (\n) /PUT PDFMark5
2451: } ifelse
2452: }loop
2453: end
2454: }bd
2455: %%EndResource
2456: %%BeginResource: procset sep_ops 6.0 1
2457: %%Copyright: Copyright 1987-2001 Adobe Systems Incorporated. All Rights Reserved.
2458: %%Title: Support for Separations in Level 1, following the conventions of Tech Note 5044
2459: userdict /sep_ops 50 dict dup begin put
2460: /bdef {bind def} bind def
2461: /xdef {exch def} bdef
2462: /colorimagebuffer {
2463: 0 1 2 index length 1 sub {
2464: dup 2 index exch get 255 exch sub 2 index 3 1 roll put
2465: } for
2466: } bdef
2467: /addprocs {
2468: [ 3 1 roll
2469: /exec load
2470: dup 3 1 roll
2471: ] cvx
2472: } bdef
2473: /L1? {
2474: systemdict /languagelevel known {
2475: systemdict /languagelevel get 2 lt
2476: }{
2477: true
2478: } ifelse
2479: } bdef
2480: /colorexists {
2481: statusdict /processcolors known {
2482: statusdict /processcolors get exec
2483: }{
2484: /deviceinfo where {
2485: pop deviceinfo /Colors known {
2486: deviceinfo /Colors get
2487: statusdict /processcolors {
2488: deviceinfo /Colors known {
2489: deviceinfo /Colors get
2490: }{
2491: 1
2492: } ifelse
2493: } put
2494: }{
2495: 1
2496: } ifelse
2497: }{
2498: 1
2499: } ifelse
2500: } ifelse
2501: 1 gt
2502: } bdef
2503: /colorplate colorexists { 0 } { 5 } ifelse def
2504: /negativecolorplate false def
2505: /setcmykcolor where {
2506: pop
2507: gsave
2508: 1 0 0 0 setcmykcolor systemdict /currentgray get exec 1 exch sub
2509: 0 1 0 0 setcmykcolor systemdict /currentgray get exec 1 exch sub
2510: 0 0 1 0 setcmykcolor systemdict /currentgray get exec 1 exch sub
2511: 0 0 0 1 setcmykcolor systemdict /currentgray get exec 1 exch sub
2512: 4 {4 copy} repeat
2513: grestore
2514: 1 dict begin
2515: /foureq {
2516: 4 index eq 8 1 roll
2517: 4 index eq 8 1 roll
2518: 4 index eq 8 1 roll
2519: 4 index eq 8 1 roll
2520: pop pop pop pop and and and
2521: } def
2522: 1 0 0 0 foureq {/colorplate 1 store} if
2523: 0 1 0 0 foureq {/colorplate 2 store} if
2524: 0 0 1 0 foureq {/colorplate 3 store} if
2525: 0 0 0 1 foureq {/colorplate 4 store} if
2526: 0 0 0 0 foureq {/colorplate 6 store} if
2527: end
2528: } if
2529: 0 systemdict /currenttransfer get exec exec
2530: 1 systemdict /currenttransfer get exec exec
2531: 2 copy
2532: eq
2533: {
2534: /colorplate 6 store
2535: pop
2536: /negativecolorplate exch 0.5 lt store
2537: }
2538: {
2539: gt /negativecolorplate exch store
2540: }
2541: ifelse
2542: /findcmykcustomcolor where { pop }
2543: {
2544: /findcmykcustomcolor {
2545: [ 6 1 roll ] readonly
2546: } bdef
2547: } ifelse
2548: /setoverprint where {
2549: pop
2550: }{
2551: /setoverprint {
2552: pop
2553: } bdef
2554: } ifelse
2555: /currentoverprint where {
2556: pop
2557: }{
2558: /currentoverprint {
2559: false
2560: } bdef
2561: } ifelse
2562: /setcustomcolor where {
2563: pop
2564: }{
2565: L1? {
2566: /setcustomcolor {
2567: exch
2568: aload pop pop
2569: 4 { 4 index mul 4 1 roll } repeat
2570: 5 -1 roll pop
2571: setcmykcolor
2572: } bdef
2573: }{
2574: /setcustomcolor {
2575: exch
2576: [ exch /Separation exch dup 4 get exch /DeviceCMYK exch
2577: 0 4 getinterval
2578: [ exch /dup load exch cvx {mul exch dup}
2579: /forall load /pop load dup] cvx
2580: ] setcolorspace setcolor
2581: } bdef
2582: } ifelse
2583: } ifelse
2584: /ik 0 def
2585: /iy 0 def
2586: /im 0 def
2587: /ic 0 def
2588: /imagetint {
2589: ic .3 mul
2590: im .59 mul
2591: iy .11 mul
2592: ik add add add dup
2593: 1 gt {pop 1} if
2594: } bdef
2595: /setcmykcolor where {
2596: pop
2597: }{
2598: /setcmykcolor {
2599: /ik xdef /iy xdef /im xdef /ic xdef
2600: imagetint
2601: 1 exch sub setgray
2602: } bdef
2603: } ifelse
2604: /customcolorimage where {
2605: pop
2606: }{
2607: L1? {
2608: /customcolorimage{
2609: gsave
2610: colorexists {
2611: aload pop pop
2612: /ik xdef /iy xdef /im xdef /ic xdef
2613: currentcolortransfer
2614: {ik mul ik sub 1 add} addprocs
2615: 4 1 roll {iy mul iy sub 1 add} addprocs
2616: 4 1 roll {im mul im sub 1 add} addprocs
2617: 4 1 roll {ic mul ic sub 1 add} addprocs
2618: 4 1 roll setcolortransfer
2619: /magentabuf 0 string def
2620: /yellowbuf 0 string def
2621: /blackbuf 0 string def
2622: {
2623: colorimagebuffer dup length magentabuf length ne
2624: {
2625: dup length dup dup
2626: /magentabuf exch string def
2627: /yellowbuf exch string def
2628: /blackbuf exch string def
2629: } if
2630: dup magentabuf copy yellowbuf copy
2631: blackbuf copy pop
2632: } addprocs
2633: {magentabuf}{yellowbuf}{blackbuf} true 4 colorimage
2634: }{
2635: aload pop pop /ik xdef /iy xdef /im xdef /ic xdef /tint
2636: imagetint def
2637: currenttransfer
2638: {tint mul 1 tint sub add} addprocs settransfer image
2639: } ifelse
2640: grestore
2641: } bdef
2642: }{
2643: /customcolorimage {
2644: gsave
2645: [ exch /Separation exch dup 4 get exch /DeviceCMYK exch
2646: 0 4 getinterval
2647: [ exch /dup load exch cvx {mul exch dup}
2648: /forall load /pop load dup] cvx
2649: ] setcolorspace
2650: 10 dict begin
2651: /ImageType 1 def
2652: /DataSource exch def
2653: /ImageMatrix exch def
2654: /BitsPerComponent exch def
2655: /Height exch def
2656: /Width exch def
2657: /Decode [1 0] def
2658: currentdict end
2659: image
2660: grestore
2661: } bdef
2662: } ifelse
2663: } ifelse
2664: /setseparationgray where {
2665: pop
2666: }{
2667: L1? {
2668: /setseparationgray { 1 exch sub dup dup dup setcmykcolor } bdef
2669: }{
2670: /setseparationgray {
2671: [/Separation /All /DeviceCMYK {dup dup dup}] setcolorspace
2672: 1 exch sub setcolor
2673: } bdef
2674: } ifelse
2675: } ifelse
2676: /separationimage where { pop }
2677: {
2678: /separationimage {
2679: gsave
2680: 1 1 1 1 (All)
2681: findcmykcustomcolor customcolorimage
2682: grestore
2683: } bdef
2684: } ifelse
2685: currentdict readonly pop end
2686: %%EndResource
2687: %%BeginResource: procset pdflev15044 6.0 1
2688: %%Copyright: Copyright 1987-2002 Adobe Systems Incorporated. All Rights Reserved.
2689: %%Title: PDF operators, Level 1, with emulated separations (TN 5044)
2690: /_ColorSep5044? true dd
2691: /docinitialize {
2692: PDF begin
2693: /_defaulthalftone
2694: /currenthalftone where
2695: { pop currenthalftone }
2696: { 4 dict dup begin
2697: currentscreen
2698: /SpotFunction exch def
2699: /Angle exch def
2700: /Frequency exch def
2701: /HalftoneType 1 def
2702: end }
2703: ifelse
2704: dd
2705: /currentcolortransfer where
2706: { pop /_defaultcolortransfer [ currentcolortransfer ] dd }
2707: { /_defaultcolortransfer [currenttransfer dup dup dup] dd }
2708: ifelse
2709: end
2710: } bd
2711: /initialize {
2712: /overprintstack null dd
2713: sep_ops begin
2714: 50 dict begin
2715: _defaulthalftone sethalftone
2716: } bd
2717: /terminate {
2718: end end
2719: } bd
2720: /currentcolortransfer where
2721: { pop }
2722: {
2723: /setcolortransfer
2724: {
2725: settransfer pop pop pop
2726: } bd
2727: } ifelse
2728: /pl {
2729: transform
2730: 0.25 sub round 0.25 add exch
2731: 0.25 sub round 0.25 add exch
2732: itransform
2733: } bd
2734: /m { _sa? { pl } if moveto } bd
2735: /l { _sa? { pl } if lineto } bd
2736: /c
2737: {
2738: _sa? {3 {pl 6 2 roll} repeat} if
2739: curveto
2740: } bd
2741: /ri/pop ld
2742: /setSA { /_sa? xdd } bd
2743: /re
2744: {
2745: _sa?
2746: {
2747: 8 dict begin
2748: /:h exch def
2749: /:w exch def
2750: /:y exch def
2751: /:x exch def
2752: :x :y pl
2753: /:ymin exch def /:xmin exch def
2754: :x :w add :y :h add pl
2755: /:ymax exch def /:xmax exch def
2756: :xmin :ymin moveto
2757: :xmax :ymin lineto
2758: :xmax :ymax lineto
2759: :xmin :ymax lineto
2760: closepath
2761: end
2762: }
2763: {
2764: 4 2 roll moveto
2765: 1 index 0 rlineto
2766: 0 exch rlineto
2767: neg 0 rlineto
2768: closepath
2769: } ifelse
2770: } bd
2771: /q
2772: {
2773: gsave
2774: [currentoverprint overprintstack] /overprintstack xdd
2775: }
2776: [/overprintstack] bld
2777: /Q
2778: {
2779: overprintstack aload pop /overprintstack xdd setoverprint
2780: grestore
2781: }
2782: [/overprintstack] bld
2783: /AlmostFull?
2784: { dup maxlength exch length sub 2 le
2785: } bd
2786: /Expand
2787: { 1 index maxlength mul cvi dict
2788: dup begin exch { def } forall end
2789: } bd
2790: /xput
2791: { 3 2 roll
2792: dup 3 index known not
2793: { dup AlmostFull? { 1.5 Expand } if
2794: } if
2795: dup 4 2 roll put
2796: } bd
2797: /defineRes
2798: { _categories 1 index known not
2799: { /_categories _categories 2 index 10 dict xput store
2800: } if
2801: _categories exch 2 copy get 5 -1 roll 4 index xput put
2802: } bd
2803: /undefineRes {
2804: null exch
2805: defineRes
2806: } bd
2807: /findRes {
2808: _categories exch get exch get
2809: } bd
2810: /L1setcolor {
2811: aload length
2812: dup 0 eq
2813: { pop .5 setgray }
2814: { dup 1 eq
2815: { pop setgray }
2816: { 3 eq
2817: { setrgbcolor }
2818: { setcmykcolor }
2819: ifelse }
2820: ifelse }
2821: ifelse
2822: } bind dd
2823: /concattransferfuncs {
2824: [ 3 1 roll /exec load exch /exec load ] cvx
2825: } bd
2826: /concatandsettransfer {
2827: /_defaulttransfer load concattransferfuncs settransfer
2828: } bd
2829: /concatandsetcolortransfer {
2830: colorplate 0 eq
2831: {
2832: _defaultcolortransfer aload pop
2833: 8 -1 roll 5 -1 roll concattransferfuncs 7 1 roll
2834: 6 -1 roll 4 -1 roll concattransferfuncs 5 1 roll
2835: 4 -1 roll 3 -1 roll concattransferfuncs 3 1 roll
2836: concattransferfuncs
2837: setcolortransfer
2838: } if
2839: colorplate 1 ge colorplate 4 le and
2840: {
2841: 4 colorplate sub index 4 { exch pop } repeat
2842: concatandsettransfer
2843: } if
2844: colorplate 5 ge
2845: {
2846: 0 index 4 { exch pop } repeat
2847: concatandsettransfer
2848: } if
2849: } bd
2850: /tn5044sethalftone
2851: {
2852: begin
2853: HalftoneType 5 eq
2854: { [/Default /Cyan /Magenta /Yellow /Black /Default /Default /Default]
2855: colorplate get
2856: here not {
2857: /Default here not { currentdict } if
2858: } if
2859: }
2860: { currentdict }
2861: ifelse
2862: end
2863: begin
2864: /TransferFunction here
2865: {
2866: concatandsettransfer
2867: currentdict dup length dict
2868: begin
2869: {
2870: 1 index /TransferFunction ne { def } { pop pop } ifelse
2871: } forall
2872: currentdict
2873: end
2874: }
2875: {
2876: currentdict
2877: } ifelse
2878: end
2879: sethalftone
2880: } bd
2881: /paintimage
2882: {
2883: colorplate 0 eq
2884: {
2885: { {currentfile cyanstr readstring pop}
2886: {currentfile magentastr readstring pop}
2887: {currentfile yellowstr readstring pop}
2888: {currentfile blackstr readstring pop
2889: currentfile graystr readstring pop pop}
2890: }
2891: { {currentfile cyanstr readhexstring pop}
2892: {currentfile magentastr readhexstring pop}
2893: {currentfile yellowstr readhexstring pop}
2894: {currentfile blackstr readhexstring pop
2895: currentfile graystr readhexstring pop pop}
2896: } ifelse
2897: true 4 colorimage
2898: }
2899: {
2900: 3 dict begin
2901: /binaryOK exch def
2902: [
2903: 1 1 5 {
2904: dup
2905: /currentfile cvx
2906: [ /cyanstr /magentastr /yellowstr /blackstr /graystr ]
2907: 3 -1 roll 1 sub get cvx
2908: binaryOK { /readstring } { /readhexstring } ifelse cvx
2909: /pop cvx
2910: 5 -1 roll
2911: colorplate dup 5 gt { pop 5 } if
2912: eq not { /pop cvx } if
2913: } for
2914: ] cvx bind
2915: end
2916: [
2917: colorplate 6 eq {
2918: /pop cvx
2919: negativecolorplate { 0 } { 1 } ifelse
2920: } if
2921: colorplate 4 le
2922: {
2923: 1 /exch cvx /sub cvx
2924: } if
2925: colorplate 6 ne
2926: {
2927: systemdict /currenttransfer get exec
2928: aload pop
2929: } if
2930: ] cvx
2931: gsave
2932: systemdict /settransfer get exec
2933: systemdict /image get exec
2934: grestore
2935: } ifelse
2936: } bd
2937: %%EndResource
2938: %%BeginResource: procset pdftext 6.0 1
2939: %%Copyright: Copyright 1987-2001 Adobe Systems Incorporated. All Rights Reserved.
2940: %%Title: Text operators for PDF
2941: PDF /PDFText 78 dict dup begin put
2942: /docinitialize
2943: {
2944: /resourcestatus where {
2945: pop
2946: /CIDParams /ProcSet resourcestatus {
2947: pop pop
2948: false /CIDParams /ProcSet findresource /SetBuildCompatible get exec
2949: } if
2950: } if
2951: PDF begin
2952: PDFText /_pdfDefineIdentity-H known
2953: { PDFText /_pdfDefineIdentity-H get exec}
2954: if
2955: end
2956: } bd
2957: /initialize {
2958: PDFText begin
2959: } bd
2960: /terminate { end } bd
2961: Level2?
2962: {
2963: /_safeput
2964: {
2965: 3 -1 roll load 3 1 roll put
2966: }
2967: bd
2968: }
2969: {
2970: /_safeput
2971: {
2972: 2 index load dup dup length exch maxlength ge
2973: { dup length 5 add dict copy
2974: 3 index xdd
2975: }
2976: { pop }
2977: ifelse
2978: 3 -1 roll load 3 1 roll put
2979: }
2980: bd
2981: }
2982: ifelse
2983: /pdf_has_composefont? systemdict /composefont known def
2984: /CopyFont {
2985: {
2986: 1 index /FID ne 2 index /UniqueID ne and
2987: { def } { pop pop } ifelse
2988: } forall
2989: } bd
2990: /Type0CopyFont
2991: {
2992: exch
2993: dup length dict
2994: begin
2995: CopyFont
2996: [
2997: exch
2998: FDepVector
2999: {
3000: dup /FontType get 0 eq
3001: {
3002: 1 index Type0CopyFont
3003: /_pdfType0 exch definefont
3004: }
3005: {
3006: /_pdfBaseFont exch
3007: 2 index exec
3008: }
3009: ifelse
3010: exch
3011: }
3012: forall
3013: pop
3014: ]
3015: /FDepVector exch def
3016: currentdict
3017: end
3018: } bd
3019: Level2? {currentglobal true setglobal} if
3020: /cHexEncoding
3021: [/c00/c01/c02/c03/c04/c05/c06/c07/c08/c09/c0A/c0B/c0C/c0D/c0E/c0F/c10/c11/c12
3022: /c13/c14/c15/c16/c17/c18/c19/c1A/c1B/c1C/c1D/c1E/c1F/c20/c21/c22/c23/c24/c25
3023: /c26/c27/c28/c29/c2A/c2B/c2C/c2D/c2E/c2F/c30/c31/c32/c33/c34/c35/c36/c37/c38
3024: /c39/c3A/c3B/c3C/c3D/c3E/c3F/c40/c41/c42/c43/c44/c45/c46/c47/c48/c49/c4A/c4B
3025: /c4C/c4D/c4E/c4F/c50/c51/c52/c53/c54/c55/c56/c57/c58/c59/c5A/c5B/c5C/c5D/c5E
3026: /c5F/c60/c61/c62/c63/c64/c65/c66/c67/c68/c69/c6A/c6B/c6C/c6D/c6E/c6F/c70/c71
3027: /c72/c73/c74/c75/c76/c77/c78/c79/c7A/c7B/c7C/c7D/c7E/c7F/c80/c81/c82/c83/c84
3028: /c85/c86/c87/c88/c89/c8A/c8B/c8C/c8D/c8E/c8F/c90/c91/c92/c93/c94/c95/c96/c97
3029: /c98/c99/c9A/c9B/c9C/c9D/c9E/c9F/cA0/cA1/cA2/cA3/cA4/cA5/cA6/cA7/cA8/cA9/cAA
3030: /cAB/cAC/cAD/cAE/cAF/cB0/cB1/cB2/cB3/cB4/cB5/cB6/cB7/cB8/cB9/cBA/cBB/cBC/cBD
3031: /cBE/cBF/cC0/cC1/cC2/cC3/cC4/cC5/cC6/cC7/cC8/cC9/cCA/cCB/cCC/cCD/cCE/cCF/cD0
3032: /cD1/cD2/cD3/cD4/cD5/cD6/cD7/cD8/cD9/cDA/cDB/cDC/cDD/cDE/cDF/cE0/cE1/cE2/cE3
3033: /cE4/cE5/cE6/cE7/cE8/cE9/cEA/cEB/cEC/cED/cEE/cEF/cF0/cF1/cF2/cF3/cF4/cF5/cF6
3034: /cF7/cF8/cF9/cFA/cFB/cFC/cFD/cFE/cFF] def
3035: Level2? {setglobal} if
3036: /modEnc {
3037: /_enc xdd
3038: /_icode 0 dd
3039: counttomark 1 sub -1 0
3040: {
3041: index
3042: dup type /nametype eq
3043: {
3044: _enc _icode 3 -1 roll put
3045: _icode 1 add
3046: }
3047: if
3048: /_icode xdd
3049: } for
3050: cleartomark
3051: _enc
3052: } bd
3053: /trEnc {
3054: /_enc xdd
3055: 255 -1 0 {
3056: exch dup -1 eq
3057: { pop /.notdef }
3058: { Encoding exch get }
3059: ifelse
3060: _enc 3 1 roll put
3061: } for
3062: pop
3063: _enc
3064: } bd
3065: /TE {
3066: /_i xdd
3067: StandardEncoding 256 array copy modEnc
3068: _pdfEncodings exch _i exch put
3069: } bd
3070: Level2?
3071: {
3072: /pdfPatchCStrings
3073: {
3074: currentdict /CharStrings known currentdict /FontType known and
3075: {
3076: FontType 1 eq CharStrings type /dicttype eq and
3077: {
3078: CharStrings /mu known CharStrings /mu1 known not and CharStrings wcheck and
3079: {
3080: CharStrings /mu get
3081: type /stringtype eq
3082: {
3083: currentglobal
3084: CharStrings /mu1
3085: CharStrings /mu get
3086: dup gcheck setglobal
3087: dup length string copy
3088: put
3089: setglobal
3090: } if
3091: } if
3092: } if
3093: } if
3094: } bd
3095: }
3096: { /pdfPatchCStrings {} bd }
3097: ifelse
3098: /TZ
3099: {
3100: /_usePDFEncoding xdd
3101: findfont
3102: dup length 6 add dict
3103: begin
3104: {
3105: 1 index /FID ne { def } { pop pop } ifelse
3106: } forall
3107: pdfPatchCStrings
3108: /pdf_origFontName FontName def
3109: /FontName exch def
3110: currentdict /PaintType known
3111: { PaintType 2 eq {/PaintType 0 def} if }
3112: if
3113: _usePDFEncoding 0 ge
3114: {
3115: /Encoding _pdfEncodings _usePDFEncoding get def
3116: pop
3117: }
3118: {
3119: _usePDFEncoding -1 eq
3120: {
3121: counttomark 0 eq
3122: { pop }
3123: {
3124: Encoding 256 array copy
3125: modEnc /Encoding exch def
3126: }
3127: ifelse
3128: }
3129: {
3130: 256 array
3131: trEnc /Encoding exch def
3132: }
3133: ifelse
3134: }
3135: ifelse
3136: pdf_EuroProcSet pdf_origFontName known
3137: {
3138: pdf_origFontName pdf_AddEuroGlyphProc
3139: } if
3140: Level2?
3141: {
3142: currentdict /pdf_origFontName undef
3143: } if
3144: FontName currentdict
3145: end
3146: definefont pop
3147: }
3148: bd
3149: Level2?
3150: {
3151: /TZG
3152: {
3153: currentglobal true setglobal
3154: 2 index _pdfFontStatus
3155: {
3156: 2 index findfont
3157: false setglobal
3158: 3 index findfont
3159: true setglobal
3160: ne
3161: {
3162: 2 index findfont dup rcheck
3163: {
3164: dup length dict begin
3165: {
3166: 1 index /FID ne { def } { pop pop } ifelse
3167: } forall
3168: pdfPatchCStrings
3169: currentdict end
3170: }
3171: if
3172: 3 index exch definefont pop
3173: }
3174: if
3175: } if
3176: setglobal
3177: TZ
3178: } bd
3179: }
3180: {
3181: /TZG {TZ} bd
3182: } ifelse
3183: Level2?
3184: {
3185: currentglobal false setglobal
3186: userdict /pdftext_data 5 dict put
3187: pdftext_data
3188: begin
3189: /saveStacks
3190: {
3191: pdftext_data
3192: begin
3193: /vmmode currentglobal def
3194: false setglobal
3195: count array astore /os exch def
3196: end
3197: countdictstack array dictstack pdftext_data exch /ds exch put
3198: cleardictstack pdftext_data /dscount countdictstack put
3199: pdftext_data /vmmode get setglobal
3200: } bind def
3201: /restoreStacks
3202: {
3203: pdftext_data /vmmode currentglobal put false setglobal
3204: clear cleardictstack
3205: pdftext_data /ds get dup
3206: pdftext_data /dscount get 1 2 index length 1 sub
3207: { get begin dup } for
3208: pop pop
3209: pdftext_data /os get aload pop
3210: pdftext_data /vmmode get setglobal
3211: } bind def
3212: /testForClonePrinterBug
3213: {
3214: currentglobal true setglobal
3215: /undefinedCategory /Generic /Category findresource
3216: dup length dict copy /Category defineresource pop
3217: setglobal
3218: pdftext_data /saveStacks get exec
3219: pdftext_data /vmmode currentglobal put false setglobal
3220: /undefined /undefinedCategory { resourcestatus } stopped
3221: pdftext_data exch /bugFound exch put
3222: pdftext_data /vmmode get setglobal
3223: pdftext_data /restoreStacks get exec
3224: pdftext_data /bugFound get
3225: } bind def
3226: end
3227: setglobal
3228: /pdf_resourcestatus
3229: pdftext_data /testForClonePrinterBug get exec
3230: {
3231: {
3232: pdftext_data /saveStacks get exec
3233: pdftext_data /os get dup dup length 1 sub
3234: dup 1 sub dup 0 lt { pop 0 } if
3235: exch 1 exch { get exch dup } for
3236: pop pop
3237: { resourcestatus }
3238: stopped
3239: {
3240: clear cleardictstack pdftext_data /restoreStacks get exec
3241: { pop pop } stopped pop false
3242: }
3243: {
3244: count array astore pdftext_data exch /results exch put
3245: pdftext_data /restoreStacks get exec pop pop
3246: pdftext_data /results get aload pop
3247: }
3248: ifelse
3249: }
3250: }
3251: { { resourcestatus } }
3252: ifelse
3253: bd
3254: }
3255: if
3256: Level2?
3257: {
3258: /_pdfUndefineResource
3259: {
3260: currentglobal 3 1 roll
3261: _pdf_FontDirectory 2 index 2 copy known
3262: {undef}
3263: {pop pop}
3264: ifelse
3265: 1 index (pdf) exch _pdfConcatNames 1 index
3266: 1 index 1 _pdfConcatNames 1 index
3267: 5 index 1 _pdfConcatNames 1 index
3268: 4
3269: {
3270: 2 copy pdf_resourcestatus
3271: {
3272: pop 2 lt
3273: {2 copy findresource gcheck setglobal undefineresource}
3274: {pop pop}
3275: ifelse
3276: }
3277: { pop pop}
3278: ifelse
3279: } repeat
3280: setglobal
3281: } bd
3282: }
3283: {
3284: /_pdfUndefineResource { pop pop} bd
3285: }
3286: ifelse
3287: Level2?
3288: {
3289: /_pdfFontStatus
3290: {
3291: currentglobal exch
3292: /Font pdf_resourcestatus
3293: {pop pop true}
3294: {false}
3295: ifelse
3296: exch setglobal
3297: } bd
3298: }
3299: {
3300: /_pdfFontStatusString 50 string def
3301: _pdfFontStatusString 0 (fonts/) putinterval
3302: /_pdfFontStatus
3303: {
3304: FontDirectory 1 index known
3305: { pop true }
3306: {
3307: _pdfFontStatusString 6 42 getinterval
3308: cvs length 6 add
3309: _pdfFontStatusString exch 0 exch getinterval
3310: { status } stopped
3311: {pop false}
3312: {
3313: { pop pop pop pop true}
3314: { false }
3315: ifelse
3316: }
3317: ifelse
3318: }
3319: ifelse
3320: } bd
3321: }
3322: ifelse
3323: Level2?
3324: {
3325: /_pdfCIDFontStatus
3326: {
3327: /CIDFont /Category pdf_resourcestatus
3328: {
3329: pop pop
3330: /CIDFont pdf_resourcestatus
3331: {pop pop true}
3332: {false}
3333: ifelse
3334: }
3335: { pop false }
3336: ifelse
3337: } bd
3338: }
3339: if
3340: /_pdfString100 100 string def
3341: /_pdfComposeFontName
3342: {
3343: dup length 1 eq
3344: {
3345: 0 get
3346: 1 index
3347: type /nametype eq
3348: {
3349: _pdfString100 cvs
3350: length dup dup _pdfString100 exch (-) putinterval
3351: _pdfString100 exch 1 add dup _pdfString100 length exch sub getinterval
3352: 2 index exch cvs length
3353: add 1 add _pdfString100 exch 0 exch getinterval
3354: exch pop
3355: true
3356: }
3357: {
3358: pop pop
3359: false
3360: }
3361: ifelse
3362: }
3363: {
3364: false
3365: }
3366: ifelse
3367: dup {exch cvn exch} if
3368: } bd
3369: /_pdfConcatNames
3370: {
3371: exch
3372: _pdfString100 cvs
3373: length dup dup _pdfString100 exch (-) putinterval
3374: _pdfString100 exch 1 add dup _pdfString100 length exch sub getinterval
3375: 3 -1 roll exch cvs length
3376: add 1 add _pdfString100 exch 0 exch getinterval
3377: cvn
3378: } bind def
3379: /_pdfTextTempString 50 string def
3380: /_pdfRegOrderingArray [(Adobe-Japan1) (Adobe-CNS1) (Adobe-Korea1) (Adobe-GB1)] def
3381: /_pdf_CheckCIDSystemInfo
3382: {
3383: 1 index _pdfTextTempString cvs
3384: (Identity) anchorsearch
3385: {
3386: pop pop pop pop true
3387: }
3388: {
3389: false
3390: _pdfRegOrderingArray
3391: {
3392: 2 index exch
3393: anchorsearch
3394: { pop pop pop true exit}
3395: { pop }
3396: ifelse
3397: }
3398: forall
3399: exch pop
3400: exch /CIDFont findresource
3401: /CIDSystemInfo get
3402: 3 -1 roll /CMap findresource
3403: /CIDSystemInfo get
3404: exch
3405: 3 -1 roll
3406: {
3407: 2 copy
3408: /Supplement get
3409: exch
3410: dup type /dicttype eq
3411: {/Supplement get}
3412: {pop 0 }
3413: ifelse
3414: ge
3415: }
3416: { true }
3417: ifelse
3418: {
3419: dup /Registry get
3420: 2 index /Registry get eq
3421: {
3422: /Ordering get
3423: exch /Ordering get
3424: dup type /arraytype eq
3425: {
3426: 1 index type /arraytype eq
3427: {
3428: true
3429: 1 index length 1 sub -1 0
3430: {
3431: dup 2 index exch get exch 3 index exch get ne
3432: { pop false exit}
3433: if
3434: } for
3435: exch pop exch pop
3436: }
3437: { pop pop false }
3438: ifelse
3439: }
3440: {
3441: eq
3442: }
3443: ifelse
3444: }
3445: { pop pop false }
3446: ifelse
3447: }
3448: { pop pop false }
3449: ifelse
3450: }
3451: ifelse
3452: } bind def
3453: pdf_has_composefont?
3454: {
3455: /_pdfComposeFont
3456: {
3457: 2 copy _pdfComposeFontName not
3458: {
3459: 2 index
3460: }
3461: if
3462: (pdf) exch _pdfConcatNames
3463: dup _pdfFontStatus
3464: { dup findfont 5 2 roll pop pop pop true}
3465: {
3466: 4 1 roll
3467: 1 index /CMap pdf_resourcestatus
3468: {
3469: pop pop
3470: true
3471: }
3472: {false}
3473: ifelse
3474: 1 index true exch
3475: {
3476: _pdfCIDFontStatus not
3477: {pop false exit}
3478: if
3479: }
3480: forall
3481: and
3482: {
3483: 1 index 1 index 0 get _pdf_CheckCIDSystemInfo
3484: {
3485: 3 -1 roll pop
3486: 2 index 3 1 roll
3487: composefont true
3488: }
3489: {
3490: pop pop exch pop false
3491: }
3492: ifelse
3493: }
3494: {
3495: _pdfComposeFontName
3496: {
3497: dup _pdfFontStatus
3498: {
3499: exch pop
3500: 1 index exch
3501: findfont definefont true
3502: }
3503: {
3504: pop exch pop
3505: false
3506: }
3507: ifelse
3508: }
3509: {
3510: exch pop
3511: false
3512: }
3513: ifelse
3514: }
3515: ifelse
3516: { true }
3517: {
3518: dup _pdfFontStatus
3519: { dup findfont true }
3520: { pop false }
3521: ifelse
3522: }
3523: ifelse
3524: }
3525: ifelse
3526: } bd
3527: }
3528: {
3529: /_pdfComposeFont
3530: {
3531: _pdfComposeFontName not
3532: {
3533: dup
3534: }
3535: if
3536: dup
3537: _pdfFontStatus
3538: {exch pop dup findfont true}
3539: {
3540: 1 index
3541: dup type /nametype eq
3542: {pop}
3543: {cvn}
3544: ifelse
3545: eq
3546: {pop false}
3547: {
3548: dup _pdfFontStatus
3549: {dup findfont true}
3550: {pop false}
3551: ifelse
3552: }
3553: ifelse
3554: }
3555: ifelse
3556: } bd
3557: }
3558: ifelse
3559: /_pdfStyleDicts 4 dict dup begin
3560: /Adobe-Japan1 4 dict dup begin
3561: Level2?
3562: {
3563: /Serif
3564: /HeiseiMin-W3-83pv-RKSJ-H _pdfFontStatus
3565: {/HeiseiMin-W3}
3566: {
3567: /HeiseiMin-W3 _pdfCIDFontStatus
3568: {/HeiseiMin-W3}
3569: {/Ryumin-Light}
3570: ifelse
3571: }
3572: ifelse
3573: def
3574: /SansSerif
3575: /HeiseiKakuGo-W5-83pv-RKSJ-H _pdfFontStatus
3576: {/HeiseiKakuGo-W5}
3577: {
3578: /HeiseiKakuGo-W5 _pdfCIDFontStatus
3579: {/HeiseiKakuGo-W5}
3580: {/GothicBBB-Medium}
3581: ifelse
3582: }
3583: ifelse
3584: def
3585: /HeiseiMaruGo-W4-83pv-RKSJ-H _pdfFontStatus
3586: {/HeiseiMaruGo-W4}
3587: {
3588: /HeiseiMaruGo-W4 _pdfCIDFontStatus
3589: {/HeiseiMaruGo-W4}
3590: {
3591: /Jun101-Light-RKSJ-H _pdfFontStatus
3592: { /Jun101-Light }
3593: { SansSerif }
3594: ifelse
3595: }
3596: ifelse
3597: }
3598: ifelse
3599: /RoundSansSerif exch def
3600: /Default Serif def
3601: }
3602: {
3603: /Serif /Ryumin-Light def
3604: /SansSerif /GothicBBB-Medium def
3605: {
3606: (fonts/Jun101-Light-83pv-RKSJ-H) status
3607: }stopped
3608: {pop}{
3609: { pop pop pop pop /Jun101-Light }
3610: { SansSerif }
3611: ifelse
3612: /RoundSansSerif exch def
3613: }ifelse
3614: /Default Serif def
3615: }
3616: ifelse
3617: end
3618: def
3619: /Adobe-Korea1 4 dict dup begin
3620: /Serif /HYSMyeongJo-Medium def
3621: /SansSerif /HYGoThic-Medium def
3622: /RoundSansSerif SansSerif def
3623: /Default Serif def
3624: end
3625: def
3626: /Adobe-GB1 4 dict dup begin
3627: /Serif /STSong-Light def
3628: /SansSerif /STHeiti-Regular def
3629: /RoundSansSerif SansSerif def
3630: /Default Serif def
3631: end
3632: def
3633: /Adobe-CNS1 4 dict dup begin
3634: /Serif /MKai-Medium def
3635: /SansSerif /MHei-Medium def
3636: /RoundSansSerif SansSerif def
3637: /Default Serif def
3638: end
3639: def
3640: end
3641: def
3642: /TZzero
3643: {
3644: /_wmode xdd
3645: /_styleArr xdd
3646: /_regOrdering xdd
3647: 3 copy
3648: _pdfComposeFont
3649: {
3650: 5 2 roll pop pop pop
3651: }
3652: {
3653: [
3654: 0 1 _styleArr length 1 sub
3655: {
3656: _styleArr exch get
3657: _pdfStyleDicts _regOrdering 2 copy known
3658: {
3659: get
3660: exch 2 copy known not
3661: { pop /Default }
3662: if
3663: get
3664: }
3665: {
3666: pop pop pop /Unknown
3667: }
3668: ifelse
3669: }
3670: for
3671: ]
3672: exch pop
3673: 2 index 3 1 roll
3674: _pdfComposeFont
3675: {3 -1 roll pop}
3676: {
3677: findfont dup /FontName get exch
3678: }
3679: ifelse
3680: }
3681: ifelse
3682: dup /WMode 2 copy known
3683: { get _wmode ne }
3684: { pop pop _wmode 1 eq}
3685: ifelse
3686: {
3687: exch _wmode _pdfConcatNames
3688: dup _pdfFontStatus
3689: { exch pop dup findfont false}
3690: { exch true }
3691: ifelse
3692: }
3693: {
3694: dup /FontType get 0 ne
3695: }
3696: ifelse
3697: {
3698: dup /FontType get 3 eq _wmode 1 eq and
3699: {
3700: _pdfVerticalRomanT3Font dup length 10 add dict copy
3701: begin
3702: /_basefont exch
3703: dup length 3 add dict
3704: begin
3705: {1 index /FID ne {def}{pop pop} ifelse }
3706: forall
3707: /Encoding Encoding dup length array copy
3708: dup 16#27 /quotesingle put
3709: dup 16#60 /grave put
3710: _regOrdering /Adobe-Japan1 eq
3711: {dup 16#5c /yen put dup 16#a5 /yen put dup 16#b4 /yen put}
3712: if
3713: def
3714: FontName
3715: currentdict
3716: end
3717: definefont
3718: def
3719: /Encoding _basefont /Encoding get def
3720: /_fauxfont true def
3721: }
3722: {
3723: dup length 3 add dict
3724: begin
3725: {1 index /FID ne {def}{pop pop} ifelse }
3726: forall
3727: FontType 0 ne
3728: {
3729: /Encoding Encoding dup length array copy
3730: dup 16#27 /quotesingle put
3731: dup 16#60 /grave put
3732: _regOrdering /Adobe-Japan1 eq
3733: {dup 16#5c /yen put}
3734: if
3735: def
3736: /_fauxfont true def
3737: } if
3738: } ifelse
3739: /WMode _wmode def
3740: dup dup /FontName exch def
3741: currentdict
3742: end
3743: definefont pop
3744: }
3745: {
3746: pop
3747: }
3748: ifelse
3749: /_pdf_FontDirectory 3 1 roll _safeput
3750: }
3751: bd
3752: Level2?
3753: {
3754: /Tf {
3755: _pdf_FontDirectory 2 index 2 copy known
3756: {get exch 3 -1 roll pop}
3757: {pop pop}
3758: ifelse
3759: selectfont
3760: } bd
3761: }
3762: {
3763: /Tf {
3764: _pdf_FontDirectory 2 index 2 copy known
3765: {get exch 3 -1 roll pop}
3766: {pop pop}
3767: ifelse
3768: exch findfont exch
3769: dup type /arraytype eq
3770: {makefont}
3771: {scalefont}
3772: ifelse
3773: setfont
3774: } bd
3775: }
3776: ifelse
3777: /cshow where
3778: {
3779: pop /pdf_cshow /cshow load dd
3780: /pdf_remove2 {pop pop} dd
3781: }
3782: {
3783: /pdf_cshow {exch forall} dd
3784: /pdf_remove2 {} dd
3785: } ifelse
3786: /pdf_xshow
3787: {
3788: /_pdf_na xdd
3789: /_pdf_i 0 dd
3790: currentpoint
3791: /_pdf_y xdd
3792: /_pdf_x xdd
3793: {
3794: pdf_remove2
3795: _pdf_str1 exch 0 exch put
3796: _pdf_str1 /_pdf_showproc load exec
3797: {_pdf_na _pdf_i get} stopped
3798: { pop pop }
3799: {
3800: _pdf_x _pdf_y moveto
3801: 0
3802: rmoveto
3803: }
3804: ifelse
3805: _pdf_i 1 add /_pdf_i xdd
3806: currentpoint
3807: /_pdf_y xdd
3808: /_pdf_x xdd
3809: }
3810: exch
3811: pdf_cshow
3812: } bd
3813: /pdf_yshow
3814: {
3815: /_pdf_na xdd
3816: /_pdf_i 0 dd
3817: currentpoint
3818: /_pdf_y xdd
3819: /_pdf_x xdd
3820: {
3821: pdf_remove2
3822: _pdf_str1 exch 0 exch put
3823: _pdf_str1 /_pdf_showproc load exec
3824: {_pdf_na _pdf_i get} stopped
3825: { pop pop }
3826: {
3827: _pdf_x _pdf_y moveto
3828: 0 exch
3829: rmoveto
3830: }
3831: ifelse
3832: _pdf_i 1 add /_pdf_i xdd
3833: currentpoint
3834: /_pdf_y xdd
3835: /_pdf_x xdd
3836: }
3837: exch
3838: pdf_cshow
3839: } bd
3840: /pdf_xyshow
3841: {
3842: /_pdf_na xdd
3843: /_pdf_i 0 dd
3844: currentpoint
3845: /_pdf_y xdd
3846: /_pdf_x xdd
3847: {
3848: pdf_remove2
3849: _pdf_str1 exch 0 exch put
3850: _pdf_str1 /_pdf_showproc load exec
3851: {_pdf_na _pdf_i get} stopped
3852: { pop pop }
3853: {
3854: {_pdf_na _pdf_i 1 add get} stopped
3855: { pop pop pop}
3856: {
3857: _pdf_x _pdf_y moveto
3858: rmoveto
3859: }
3860: ifelse
3861: }
3862: ifelse
3863: _pdf_i 2 add /_pdf_i xdd
3864: currentpoint
3865: /_pdf_y xdd
3866: /_pdf_x xdd
3867: }
3868: exch
3869: pdf_cshow
3870: } bd
3871: /pdfl1xs {/_pdf_showproc /show load dd pdf_xshow} bd
3872: /pdfl1ys {/_pdf_showproc /show load dd pdf_yshow} bd
3873: /pdfl1xys {/_pdf_showproc /show load dd pdf_xyshow} bd
3874: Level2? _ColorSep5044? not and
3875: {
3876: /pdfxs {{xshow} stopped {pdfl1xs} if} bd
3877: /pdfys {{yshow} stopped {pdfl1ys} if} bd
3878: /pdfxys {{xyshow} stopped {pdfl1xys} if} bd
3879: }
3880: {
3881: /pdfxs /pdfl1xs load dd
3882: /pdfys /pdfl1ys load dd
3883: /pdfxys /pdfl1xys load dd
3884: } ifelse
3885: /pdf_charpath {false charpath} bd
3886: /pdf_xcharpath {/_pdf_showproc /pdf_charpath load dd pdf_xshow} bd
3887: /pdf_ycharpath {/_pdf_showproc /pdf_charpath load dd pdf_yshow} bd
3888: /pdf_xycharpath {/_pdf_showproc /pdf_charpath load dd pdf_xyshow} bd
3889: /pdf_strokepath
3890: {
3891: {
3892: pdf_remove2
3893: _pdf_str1 exch 0 exch put
3894: _pdf_str1 false charpath
3895: currentpoint S moveto
3896: } bind
3897: exch pdf_cshow
3898: } bd
3899: /pdf_xstrokepath {/_pdf_showproc {pdf_charpath S} dd pdf_xshow} bd
3900: /pdf_ystrokepath {/_pdf_showproc {pdf_charpath S} dd pdf_yshow} bd
3901: /pdf_xystrokepath {/_pdf_showproc {pdf_charpath S} dd pdf_xyshow} bd
3902: Level2? {currentglobal true setglobal} if
3903: /d0/setcharwidth ld
3904: /nND {{/.notdef} repeat} bd
3905: /T3Defs {
3906: /BuildChar
3907: {
3908: 1 index /Encoding get exch get
3909: 1 index /BuildGlyph get exec
3910: }
3911: def
3912: /BuildGlyph {
3913: exch begin
3914: GlyphProcs exch get exec
3915: end
3916: } def
3917: /_pdfT3Font true def
3918: } bd
3919: /_pdfBoldRomanWidthProc
3920: {
3921: stringwidth 1 index 0 ne { exch .03 add exch }if setcharwidth
3922: 0 0
3923: } bd
3924: /_pdfType0WidthProc
3925: {
3926: dup stringwidth 0 0 moveto
3927: 2 index true charpath pathbbox
3928: 0 -1
3929: 7 index 2 div .88
3930: setcachedevice2
3931: pop
3932: 0 0
3933: } bd
3934: /_pdfType0WMode1WidthProc
3935: {
3936: dup stringwidth
3937: pop 2 div neg -0.88
3938: 2 copy
3939: moveto
3940: 0 -1
3941: 5 -1 roll true charpath pathbbox
3942: setcachedevice
3943: } bd
3944: /_pdfBoldBaseFont
3945: 11 dict begin
3946: /FontType 3 def
3947: /FontMatrix[1 0 0 1 0 0]def
3948: /FontBBox[0 0 1 1]def
3949: /Encoding cHexEncoding def
3950: /_setwidthProc /_pdfBoldRomanWidthProc load def
3951: /_bcstr1 1 string def
3952: /BuildChar
3953: {
3954: exch begin
3955: _basefont setfont
3956: _bcstr1 dup 0 4 -1 roll put
3957: dup
3958: _setwidthProc
3959: 3 copy
3960: moveto
3961: show
3962: _basefonto setfont
3963: moveto
3964: show
3965: end
3966: }bd
3967: currentdict
3968: end
3969: def
3970: pdf_has_composefont?
3971: {
3972: /_pdfBoldBaseCIDFont
3973: 11 dict begin
3974: /CIDFontType 1 def
3975: /CIDFontName /_pdfBoldBaseCIDFont def
3976: /FontMatrix[1 0 0 1 0 0]def
3977: /FontBBox[0 0 1 1]def
3978: /_setwidthProc /_pdfType0WidthProc load def
3979: /_bcstr2 2 string def
3980: /BuildGlyph
3981: {
3982: exch begin
3983: _basefont setfont
3984: _bcstr2 1 2 index 256 mod put
3985: _bcstr2 0 3 -1 roll 256 idiv put
3986: _bcstr2 dup _setwidthProc
3987: 3 copy
3988: moveto
3989: show
3990: _basefonto setfont
3991: moveto
3992: show
3993: end
3994: }bd
3995: currentdict
3996: end
3997: def
3998: /_pdfDefineIdentity-H
3999: {
4000: /Identity-H /CMap PDFText /pdf_resourcestatus get exec
4001: {
4002: pop pop
4003: }
4004: {
4005: /CIDInit/ProcSet findresource begin 12 dict begin
4006: begincmap
4007: /CIDSystemInfo
4008: 3 dict begin
4009: /Registry (Adobe) def
4010: /Ordering (Identity) def
4011: /Supplement 0 def
4012: currentdict
4013: end
4014: def
4015: /CMapName /Identity-H def
4016: /CMapVersion 1 def
4017: /CMapType 1 def
4018: 1 begincodespacerange
4019: <0000> <ffff>
4020: endcodespacerange
4021: 1 begincidrange
4022: <0000> <ffff> 0
4023: endcidrange
4024: endcmap
4025: CMapName currentdict/CMap defineresource pop
4026: end
4027: end
4028: } ifelse
4029: } def
4030: } if
4031: /_pdfVerticalRomanT3Font
4032: 10 dict begin
4033: /FontType 3 def
4034: /FontMatrix[1 0 0 1 0 0]def
4035: /FontBBox[0 0 1 1]def
4036: /_bcstr1 1 string def
4037: /BuildChar
4038: {
4039: exch begin
4040: _basefont setfont
4041: _bcstr1 dup 0 4 -1 roll put
4042: dup
4043: _pdfType0WidthProc
4044: moveto
4045: show
4046: end
4047: }bd
4048: currentdict
4049: end
4050: def
4051: Level2? {setglobal} if
4052: /MakeBoldFont
4053: {
4054: dup /ct_SyntheticBold known
4055: {
4056: dup length 3 add dict begin
4057: CopyFont
4058: /ct_StrokeWidth .03 0 FontMatrix idtransform pop def
4059: /ct_SyntheticBold true def
4060: currentdict
4061: end
4062: definefont
4063: }
4064: {
4065: dup dup length 3 add dict
4066: begin
4067: CopyFont
4068: /PaintType 2 def
4069: /StrokeWidth .03 0 FontMatrix idtransform pop def
4070: /dummybold currentdict
4071: end
4072: definefont
4073: dup /FontType get dup 9 ge exch 11 le and
4074: {
4075: _pdfBoldBaseCIDFont
4076: dup length 3 add dict copy begin
4077: dup /CIDSystemInfo get /CIDSystemInfo exch def
4078: /_Type0Identity /Identity-H 3 -1 roll [ exch ] composefont
4079: /_basefont exch def
4080: /_Type0Identity /Identity-H 3 -1 roll [ exch ] composefont
4081: /_basefonto exch def
4082: currentdict
4083: end
4084: /CIDFont defineresource
4085: }
4086: {
4087: _pdfBoldBaseFont
4088: dup length 3 add dict copy begin
4089: /_basefont exch def
4090: /_basefonto exch def
4091: currentdict
4092: end
4093: definefont
4094: }
4095: ifelse
4096: }
4097: ifelse
4098: } bd
4099: /MakeBold {
4100: 1 index
4101: _pdf_FontDirectory 2 index 2 copy known
4102: {get}
4103: {exch pop}
4104: ifelse
4105: findfont
4106: dup
4107: /FontType get 0 eq
4108: {
4109: dup /WMode known {dup /WMode get 1 eq }{false} ifelse
4110: version length 4 ge
4111: and
4112: {version 0 4 getinterval cvi 2015 ge }
4113: {true}
4114: ifelse
4115: {/_pdfType0WidthProc}
4116: {/_pdfType0WMode1WidthProc}
4117: ifelse
4118: _pdfBoldBaseFont /_setwidthProc 3 -1 roll load put
4119: {MakeBoldFont} Type0CopyFont definefont
4120: }
4121: {
4122: dup /_fauxfont known not 1 index /SubstMaster known not and
4123: {
4124: _pdfBoldBaseFont /_setwidthProc /_pdfBoldRomanWidthProc load put
4125: MakeBoldFont
4126: }
4127: {
4128: 2 index 2 index eq
4129: { exch pop }
4130: {
4131: dup length dict begin
4132: CopyFont
4133: currentdict
4134: end
4135: definefont
4136: }
4137: ifelse
4138: }
4139: ifelse
4140: }
4141: ifelse
4142: pop pop
4143: dup /dummybold ne
4144: {/_pdf_FontDirectory exch dup _safeput }
4145: { pop }
4146: ifelse
4147: }bd
4148: /MakeItalic {
4149: _pdf_FontDirectory exch 2 copy known
4150: {get}
4151: {exch pop}
4152: ifelse
4153: dup findfont
4154: dup /FontInfo 2 copy known
4155: {
4156: get
4157: /ItalicAngle 2 copy known
4158: {get 0 eq }
4159: { pop pop true}
4160: ifelse
4161: }
4162: { pop pop true}
4163: ifelse
4164: {
4165: exch pop
4166: dup /FontType get 0 eq Level2? not and
4167: { dup /FMapType get 6 eq }
4168: { false }
4169: ifelse
4170: {
4171: dup /WMode 2 copy known
4172: {
4173: get 1 eq
4174: { _italMtx_WMode1Type0 }
4175: { _italMtxType0 }
4176: ifelse
4177: }
4178: { pop pop _italMtxType0 }
4179: ifelse
4180: }
4181: {
4182: dup /WMode 2 copy known
4183: {
4184: get 1 eq
4185: { _italMtx_WMode1 }
4186: { _italMtx }
4187: ifelse
4188: }
4189: { pop pop _italMtx }
4190: ifelse
4191: }
4192: ifelse
4193: makefont
4194: dup /FontType get 42 eq Level2? not or
4195: {
4196: dup length dict begin
4197: CopyFont
4198: currentdict
4199: end
4200: }
4201: if
4202: 1 index exch
4203: definefont pop
4204: /_pdf_FontDirectory exch dup _safeput
4205: }
4206: {
4207: pop
4208: 2 copy ne
4209: {
4210: /_pdf_FontDirectory 3 1 roll _safeput
4211: }
4212: { pop pop }
4213: ifelse
4214: }
4215: ifelse
4216: }bd
4217: /MakeBoldItalic {
4218: /dummybold exch
4219: MakeBold
4220: /dummybold
4221: MakeItalic
4222: }bd
4223: Level2?
4224: {
4225: /pdf_CopyDict
4226: {1 index length add dict copy}
4227: def
4228: }
4229: {
4230: /pdf_CopyDict
4231: {
4232: 1 index length add dict
4233: 1 index wcheck
4234: { copy }
4235: { begin
4236: {def} forall
4237: currentdict
4238: end
4239: }
4240: ifelse
4241: }
4242: def
4243: }
4244: ifelse
4245: /pdf_AddEuroGlyphProc
4246: {
4247: currentdict /CharStrings known
4248: {
4249: CharStrings /Euro known not
4250: {
4251: dup
4252: /CharStrings
4253: CharStrings 1 pdf_CopyDict
4254: begin
4255: /Euro pdf_EuroProcSet 4 -1 roll get def
4256: currentdict
4257: end
4258: def
4259: /pdf_PSBuildGlyph /pdf_PSBuildGlyph load def
4260: /pdf_PathOps /pdf_PathOps load def
4261: /Symbol eq Encoding 160 get /.notdef eq and
4262: {
4263: /Encoding Encoding dup length array copy
4264: dup 160 /Euro put def
4265: }
4266: if
4267: }
4268: { pop
4269: }
4270: ifelse
4271: }
4272: { pop
4273: }
4274: ifelse
4275: }
4276: def
4277: Level2? {currentglobal true setglobal} if
4278: /pdf_PathOps 4 dict dup begin
4279: /m {moveto} def
4280: /l {lineto} def
4281: /c {curveto} def
4282: /cp {closepath} def
4283: end
4284: def
4285: /pdf_PSBuildGlyph
4286: {
4287: gsave
4288: 8 -1 roll pop
4289: 7 1 roll
4290: currentdict /PaintType 2 copy known {get 2 eq}{pop pop false} ifelse
4291: dup 9 1 roll
4292: {
4293: currentdict /StrokeWidth 2 copy known
4294: {
4295: get 2 div
4296: 5 1 roll
4297: 4 -1 roll 4 index sub
4298: 4 1 roll
4299: 3 -1 roll 4 index sub
4300: 3 1 roll
4301: exch 4 index add exch
4302: 4 index add
4303: 5 -1 roll pop
4304: }
4305: {
4306: pop pop
4307: }
4308: ifelse
4309: }
4310: if
4311: setcachedevice
4312: pdf_PathOps begin
4313: exec
4314: end
4315: {
4316: currentdict /StrokeWidth 2 copy known
4317: { get }
4318: { pop pop 0 }
4319: ifelse
4320: setlinewidth stroke
4321: }
4322: {
4323: fill
4324: }
4325: ifelse
4326: grestore
4327: } def
4328: /pdf_EuroProcSet 13 dict def
4329: pdf_EuroProcSet
4330: begin
4331: /Courier-Bold
4332: {
4333: 600 0 6 -12 585 612
4334: {
4335: 385 274 m
4336: 180 274 l
4337: 179 283 179 293 179 303 c
4338: 179 310 179 316 180 323 c
4339: 398 323 l
4340: 423 404 l
4341: 197 404 l
4342: 219 477 273 520 357 520 c
4343: 409 520 466 490 487 454 c
4344: 487 389 l
4345: 579 389 l
4346: 579 612 l
4347: 487 612 l
4348: 487 560 l
4349: 449 595 394 612 349 612 c
4350: 222 612 130 529 98 404 c
4351: 31 404 l
4352: 6 323 l
4353: 86 323 l
4354: 86 304 l
4355: 86 294 86 284 87 274 c
4356: 31 274 l
4357: 6 193 l
4358: 99 193 l
4359: 129 77 211 -12 359 -12 c
4360: 398 -12 509 8 585 77 c
4361: 529 145 l
4362: 497 123 436 80 356 80 c
4363: 285 80 227 122 198 193 c
4364: 360 193 l
4365: cp
4366: 600 0 m
4367: }
4368: pdf_PSBuildGlyph
4369: } def
4370: /Courier-BoldOblique /Courier-Bold load def
4371: /Courier
4372: {
4373: 600 0 17 -12 578 584
4374: {
4375: 17 204 m
4376: 97 204 l
4377: 126 81 214 -12 361 -12 c
4378: 440 -12 517 17 578 62 c
4379: 554 109 l
4380: 501 70 434 43 366 43 c
4381: 266 43 184 101 154 204 c
4382: 380 204 l
4383: 400 259 l
4384: 144 259 l
4385: 144 270 143 281 143 292 c
4386: 143 299 143 307 144 314 c
4387: 418 314 l
4388: 438 369 l
4389: 153 369 l
4390: 177 464 249 529 345 529 c
4391: 415 529 484 503 522 463 c
4392: 522 391 l
4393: 576 391 l
4394: 576 584 l
4395: 522 584 l
4396: 522 531 l
4397: 473 566 420 584 348 584 c
4398: 216 584 122 490 95 369 c
4399: 37 369 l
4400: 17 314 l
4401: 87 314 l
4402: 87 297 l
4403: 87 284 88 272 89 259 c
4404: 37 259 l
4405: cp
4406: 600 0 m
4407: }
4408: pdf_PSBuildGlyph
4409: } def
4410: /Courier-Oblique /Courier load def
4411: /Helvetica
4412: {
4413: 556 0 24 -19 541 703
4414: {
4415: 541 628 m
4416: 510 669 442 703 354 703 c
4417: 201 703 117 607 101 444 c
4418: 50 444 l
4419: 25 372 l
4420: 97 372 l
4421: 97 301 l
4422: 49 301 l
4423: 24 229 l
4424: 103 229 l
4425: 124 67 209 -19 350 -19 c
4426: 435 -19 501 25 509 32 c
4427: 509 131 l
4428: 492 105 417 60 343 60 c
4429: 267 60 204 127 197 229 c
4430: 406 229 l
4431: 430 301 l
4432: 191 301 l
4433: 191 372 l
4434: 455 372 l
4435: 479 444 l
4436: 194 444 l
4437: 201 531 245 624 348 624 c
4438: 433 624 484 583 509 534 c
4439: cp
4440: 556 0 m
4441: }
4442: pdf_PSBuildGlyph
4443: } def
4444: /Helvetica-Oblique /Helvetica load def
4445: /Helvetica-Bold
4446: {
4447: 556 0 12 -19 563 710
4448: {
4449: 563 621 m
4450: 537 659 463 710 363 710 c
4451: 216 710 125 620 101 462 c
4452: 51 462 l
4453: 12 367 l
4454: 92 367 l
4455: 92 346 l
4456: 92 337 93 328 93 319 c
4457: 52 319 l
4458: 12 224 l
4459: 102 224 l
4460: 131 58 228 -19 363 -19 c
4461: 417 -19 471 -12 517 18 c
4462: 517 146 l
4463: 481 115 426 93 363 93 c
4464: 283 93 254 166 246 224 c
4465: 398 224 l
4466: 438 319 l
4467: 236 319 l
4468: 236 367 l
4469: 457 367 l
4470: 497 462 l
4471: 244 462 l
4472: 259 552 298 598 363 598 c
4473: 425 598 464 570 486 547 c
4474: 507 526 513 517 517 509 c
4475: cp
4476: 556 0 m
4477: }
4478: pdf_PSBuildGlyph
4479: } def
4480: /Helvetica-BoldOblique /Helvetica-Bold load def
4481: /Symbol
4482: {
4483: 750 0 20 -12 714 685
4484: {
4485: 714 581 m
4486: 650 645 560 685 465 685 c
4487: 304 685 165 580 128 432 c
4488: 50 432 l
4489: 20 369 l
4490: 116 369 l
4491: 115 356 115 347 115 337 c
4492: 115 328 115 319 116 306 c
4493: 50 306 l
4494: 20 243 l
4495: 128 243 l
4496: 165 97 300 -12 465 -12 c
4497: 560 -12 635 25 685 65 c
4498: 685 155 l
4499: 633 91 551 51 465 51 c
4500: 340 51 238 131 199 243 c
4501: 555 243 l
4502: 585 306 l
4503: 184 306 l
4504: 183 317 182 326 182 336 c
4505: 182 346 183 356 184 369 c
4506: 614 369 l 644 432 l
4507: 199 432 l
4508: 233 540 340 622 465 622 c
4509: 555 622 636 580 685 520 c
4510: cp
4511: 750 0 m
4512: }
4513: pdf_PSBuildGlyph
4514: } def
4515: /Times-Bold
4516: {
4517: 500 0 16 -14 478 700
4518: {
4519: 367 308 m
4520: 224 308 l
4521: 224 368 l
4522: 375 368 l
4523: 380 414 l
4524: 225 414 l
4525: 230 589 257 653 315 653 c
4526: 402 653 431 521 444 457 c
4527: 473 457 l
4528: 473 698 l
4529: 444 697 l
4530: 441 679 437 662 418 662 c
4531: 393 662 365 700 310 700 c
4532: 211 700 97 597 73 414 c
4533: 21 414 l
4534: 16 368 l
4535: 69 368 l
4536: 69 359 68 350 68 341 c
4537: 68 330 68 319 69 308 c
4538: 21 308 l
4539: 16 262 l
4540: 73 262 l
4541: 91 119 161 -14 301 -14 c
4542: 380 -14 443 50 478 116 c
4543: 448 136 l
4544: 415 84 382 40 323 40 c
4545: 262 40 231 77 225 262 c
4546: 362 262 l
4547: cp
4548: 500 0 m
4549: }
4550: pdf_PSBuildGlyph
4551: } def
4552: /Times-BoldItalic
4553: {
4554: 500 0 9 -20 542 686
4555: {
4556: 542 686 m
4557: 518 686 l
4558: 513 673 507 660 495 660 c
4559: 475 660 457 683 384 683 c
4560: 285 683 170 584 122 430 c
4561: 58 430 l
4562: 34 369 l
4563: 105 369 l
4564: 101 354 92 328 90 312 c
4565: 34 312 l
4566: 9 251 l
4567: 86 251 l
4568: 85 238 84 223 84 207 c
4569: 84 112 117 -14 272 -14 c
4570: 326 -14 349 9 381 9 c
4571: 393 9 393 -10 394 -20 c
4572: 420 -20 l
4573: 461 148 l
4574: 429 148 l
4575: 416 109 362 15 292 15 c
4576: 227 15 197 55 197 128 c
4577: 197 162 204 203 216 251 c
4578: 378 251 l
4579: 402 312 l
4580: 227 312 l
4581: 229 325 236 356 241 369 c
4582: 425 369 l
4583: 450 430 l
4584: 255 430 l
4585: 257 435 264 458 274 488 c
4586: 298 561 337 654 394 654 c
4587: 437 654 484 621 484 530 c
4588: 484 516 l
4589: 516 516 l
4590: cp
4591: 500 0 m
4592: }
4593: pdf_PSBuildGlyph
4594: } def
4595: /Times-Italic
4596: {
4597: 500 0 23 -10 595 692
4598: {
4599: 399 317 m
4600: 196 317 l
4601: 199 340 203 363 209 386 c
4602: 429 386 l
4603: 444 424 l
4604: 219 424 l
4605: 246 514 307 648 418 648 c
4606: 448 648 471 638 492 616 c
4607: 529 576 524 529 527 479 c
4608: 549 475 l
4609: 595 687 l
4610: 570 687 l
4611: 562 674 558 664 542 664 c
4612: 518 664 474 692 423 692 c
4613: 275 692 162 551 116 424 c
4614: 67 424 l
4615: 53 386 l
4616: 104 386 l
4617: 98 363 93 340 90 317 c
4618: 37 317 l
4619: 23 279 l
4620: 86 279 l
4621: 85 266 85 253 85 240 c
4622: 85 118 137 -10 277 -10 c
4623: 370 -10 436 58 488 128 c
4624: 466 149 l
4625: 424 101 375 48 307 48 c
4626: 212 48 190 160 190 234 c
4627: 190 249 191 264 192 279 c
4628: 384 279 l
4629: cp
4630: 500 0 m
4631: }
4632: pdf_PSBuildGlyph
4633: } def
4634: /Times-Roman
4635: {
4636: 500 0 10 -12 484 692
4637: {
4638: 347 298 m
4639: 171 298 l
4640: 170 310 170 322 170 335 c
4641: 170 362 l
4642: 362 362 l
4643: 374 403 l
4644: 172 403 l
4645: 184 580 244 642 308 642 c
4646: 380 642 434 574 457 457 c
4647: 481 462 l
4648: 474 691 l
4649: 449 691 l
4650: 433 670 429 657 410 657 c
4651: 394 657 360 692 299 692 c
4652: 204 692 94 604 73 403 c
4653: 22 403 l
4654: 10 362 l
4655: 70 362 l
4656: 69 352 69 341 69 330 c
4657: 69 319 69 308 70 298 c
4658: 22 298 l
4659: 10 257 l
4660: 73 257 l
4661: 97 57 216 -12 295 -12 c
4662: 364 -12 427 25 484 123 c
4663: 458 142 l
4664: 425 101 384 37 316 37 c
4665: 256 37 189 84 173 257 c
4666: 335 257 l
4667: cp
4668: 500 0 m
4669: }
4670: pdf_PSBuildGlyph
4671: } def
4672: end
4673: Level2? {setglobal} if
4674: currentdict readonly pop end
4675: %%EndResource
4676: PDFText begin
4677: [39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis
4678: /Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute
4679: /egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde
4680: /oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex
4681: /udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls
4682: /registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash
4683: /.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef
4684: /.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash
4685: /questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef
4686: /guillemotleft/guillemotright/ellipsis/space/Agrave/Atilde/Otilde/OE/oe
4687: /endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide
4688: /.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright
4689: /fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand
4690: /Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex
4691: /Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex
4692: /Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla
4693: /hungarumlaut/ogonek/caron
4694: 0 TE
4695: [1/dotlessi/caron 39/quotesingle 96/grave 
4696: 127/bullet/Euro/bullet/quotesinglbase/florin/quotedblbase/ellipsis
4697: /dagger/daggerdbl/circumflex/perthousand/Scaron/guilsinglleft/OE
4698: /bullet/Zcaron/bullet/bullet/quoteleft/quoteright/quotedblleft
4699: /quotedblright/bullet/endash/emdash/tilde/trademark/scaron
4700: /guilsinglright/oe/bullet/zcaron/Ydieresis/space/exclamdown/cent/sterling
4701: /currency/yen/brokenbar/section/dieresis/copyright/ordfeminine
4702: /guillemotleft/logicalnot/hyphen/registered/macron/degree/plusminus
4703: /twosuperior/threesuperior/acute/mu/paragraph/periodcentered/cedilla
4704: /onesuperior/ordmasculine/guillemotright/onequarter/onehalf/threequarters
4705: /questiondown/Agrave/Aacute/Acircumflex/Atilde/Adieresis/Aring/AE/Ccedilla
4706: /Egrave/Eacute/Ecircumflex/Edieresis/Igrave/Iacute/Icircumflex/Idieresis
4707: /Eth/Ntilde/Ograve/Oacute/Ocircumflex/Otilde/Odieresis/multiply/Oslash
4708: /Ugrave/Uacute/Ucircumflex/Udieresis/Yacute/Thorn/germandbls/agrave
4709: /aacute/acircumflex/atilde/adieresis/aring/ae/ccedilla/egrave/eacute
4710: /ecircumflex/edieresis/igrave/iacute/icircumflex/idieresis/eth/ntilde
4711: /ograve/oacute/ocircumflex/otilde/odieresis/divide/oslash/ugrave/uacute
4712: /ucircumflex/udieresis/yacute/thorn/ydieresis
4713: 1 TE
4714: end
4715: %%BeginResource: procset pdfasc.prc 6.0 1
4716: %%Copyright: Copyright 1992-2003 Adobe Systems Incorporated. All Rights Reserved.
4717: /ASR {
4718: 13 dict begin
4719: /mirV? exch def
4720: /mirH? exch def
4721: /center? exch def
4722: /autorotate? exch def
4723: /angle exch def
4724: /shrink exch def
4725: /Pury exch def
4726: /Purx exch def
4727: /Plly exch def
4728: /Pllx exch def
4729: /Dury exch def
4730: /Durx exch def
4731: /Dlly exch def
4732: /Dllx exch def
4733: Dury 0 eq Durx 0 eq and Dlly 0 eq Dllx 0 eq and and
4734: { shrink 0 gt { GClipBBox } { GPageBBox } ifelse }
4735: { ITransDBBox }
4736: ifelse
4737: /PHt Pury Plly sub def
4738: /PW Purx Pllx sub def
4739: /DHt Dury Dlly sub def
4740: /DW Durx Dllx sub def
4741: angle 90 eq angle 270 eq or
4742: {
4743: PHt /PHt PW def /PW exch def
4744: } if
4745: autorotate? PHt PW ne and DHt DW ne and
4746: {
4747: DHt DW ge
4748: PHt PW ge
4749: ne
4750: { /angle angle 90 add def
4751: PHt /PHt PW def /PW exch def
4752: }
4753: if
4754: } if
4755: angle 0 ne
4756: {
4757: /angle angle 360 mod def
4758: angle rotate
4759: angle 90 eq
4760: { 0 DW neg translate }
4761: if
4762: angle 180 eq
4763: { DW neg DHt neg translate }
4764: if
4765: angle 270 eq
4766: { DHt neg 0 translate }
4767: if
4768: } if
4769: center?
4770: {
4771: ITransBBox
4772: Durx Dllx add 2 div Dury Dlly add 2 div
4773: Purx Pllx add -2 div Pury Plly add -2 div
4774: 3 -1 roll add exch
4775: 3 -1 roll add exch
4776: translate
4777: }
4778: {
4779: ITransBBox
4780: angle 0 eq
4781: {Dllx Pllx sub Dury Pury sub}
4782: if
4783: angle 90 eq
4784: {Durx Purx sub Dury Pury sub}
4785: if
4786: angle 180 eq
4787: {Durx Purx sub Dlly Plly sub}
4788: if
4789: angle 270 eq
4790: {Dllx Pllx sub Dlly Plly sub}
4791: if
4792: translate
4793: }
4794: ifelse
4795: mirH? mirV? or
4796: {
4797: ITransBBox
4798: mirH?
4799: {
4800: -1 1 scale
4801: Durx Dllx add neg 0 translate
4802: } if
4803: mirV?
4804: {
4805: 1 -1 scale
4806: 0 Dury Dlly add neg translate
4807: } if
4808: } if
4809: shrink 0 ne
4810: {
4811: ITransBBox
4812: Dury Dlly sub Pury Plly sub div
4813: Durx Dllx sub Purx Pllx sub div
4814: 2 copy gt { exch } if pop
4815: shrink 1 eq
4816: {
4817: Durx Dllx add 2 div Dury Dlly add 2 div translate
4818: dup scale
4819: Purx Pllx add -2 div Pury Plly add -2 div translate
4820: }
4821: {
4822: shrink 2 eq 1 index 1.0 lt and
4823: {
4824: Durx Dllx add 2 div Dury Dlly add 2 div translate
4825: dup scale
4826: Purx Pllx add -2 div Pury Plly add -2 div translate
4827: }
4828: { pop }
4829: ifelse
4830: }
4831: ifelse
4832: } if
4833: end
4834: } [/autorotate? /shrink? /mirH? /mirV? /angle /Pury /Purx /Plly /Pllx /Durx /Dury /Dllx /Dlly /PW /PHt /DW /DHt
4835: /Devurx /Devury /Devllx /Devlly /pdfHt /pdfW]
4836: bld
4837: /GClipBBox
4838: {
4839: gsave newpath clippath pathbbox newpath grestore
4840: /Dury exch def
4841: /Durx exch def
4842: /Dlly exch def
4843: /Dllx exch def
4844: ITransDBBox
4845: } [/Durx /Dury /Dllx /Dlly]
4846: bld
4847: /GPageBBox
4848: {
4849: {
4850: currentpagedevice /PageSize get aload pop
4851: /Devury exch def /Devurx exch def
4852: /Devllx 0 def /Devlly 0 def
4853: ITransBBox
4854: }
4855: stopped
4856: { GClipBBox }
4857: if
4858: } [/Devurx /Devury /Devllx /Devlly ]
4859: bld
4860: /ITransDBBox
4861: {
4862: Durx Dury transform matrix defaultmatrix itransform
4863: /Devury exch def
4864: /Devurx exch def
4865: Dllx Dlly transform matrix defaultmatrix itransform
4866: /Devlly exch def
4867: /Devllx exch def
4868: Devury Devlly lt {/Devlly Devury /Devury Devlly def def} if
4869: Devurx Devllx lt {/Devllx Devurx /Devurx Devllx def def} if
4870: } [/Durx /Dury /Dllx /Dlly /Devurx /Devury /Devllx /Devlly ]
4871: bld
4872: /ITransBBox
4873: {
4874: /um matrix currentmatrix matrix defaultmatrix matrix invertmatrix matrix concatmatrix def
4875: Devllx Devlly um itransform
4876: Devurx Devury um itransform
4877: /Dury exch def
4878: /Durx exch def
4879: /Dlly exch def
4880: /Dllx exch def
4881: Dury Dlly lt {/Dlly Dury /Dury Dlly def def} if
4882: Durx Dllx lt {/Dllx Durx /Durx Dllx def def} if
4883: } [ /um /Durx /Dury /Dllx /Dlly /Devurx /Devury /Devllx /Devlly ]
4884: bld
4885: %%EndResource
4886: currentdict readonly pop
4887: end end
4888: /currentpacking where {pop setpacking}if
4889: PDFVars/DocInitAll{[PDF PDFText]{/docinitialize get exec}forall }put
4890: PDFVars/InitAll{[PDF PDFText]{/initialize get exec}forall initgs}put
4891: PDFVars/TermAll{[PDFText PDF]{/terminate get exec}forall}put
4892: PDFVars begin PDF begin
4893: PDFVars/DocInitAll get exec PDFVars/InitAll get exec
4894: 
4895: [/NamespacePush PDFMark5
4896: [/_objdef {Metadata_In_EPS} /type /stream /OBJ PDFMark5
4897: [{Metadata_In_EPS} 1184 (% &end XMP packet& %) ReadByPDFMark5
4898: <?xpacket begin='' id='W5M0MpCehiHzreSzNTczkc9d'?>
4899: <?adobe-xap-filters esc="CRLF"?>
4900: <x:xmpmeta xmlns:x='adobe:ns:meta/' x:xmptk='XMP toolkit 2.9.1-13, framework 1.6'>
4901: <rdf:RDF xmlns:rdf='http://www.w3.org/1999/02/22-rdf-syntax-ns#' xmlns:iX='http://ns.adobe.com/iX/1.0/'>
4902: <rdf:Description rdf:about='uuid:ee7b7dc5-087c-4cfe-883e-3a8a04883956' xmlns:pdf='http://ns.adobe.com/pdf/1.3/' pdf:Producer='Acrobat Distiller 6.0 (Windows)'></rdf:Description>
4903: <rdf:Description rdf:about='uuid:ee7b7dc5-087c-4cfe-883e-3a8a04883956' xmlns:xap='http://ns.adobe.com/xap/1.0/' xap:CreateDate='2005-10-31T17:28:33-04:00' xap:CreatorTool='PScript5.dll Version 5.2' xap:ModifyDate='2005-10-31T17:28:33-04:00'></rdf:Description>
4904: <rdf:Description rdf:about='uuid:ee7b7dc5-087c-4cfe-883e-3a8a04883956' xmlns:xapMM='http://ns.adobe.com/xap/1.0/mm/' xapMM:DocumentID='uuid:011d4100-3128-46b9-a740-6bb890fbc03b'/>
4905: <rdf:Description rdf:about='uuid:ee7b7dc5-087c-4cfe-883e-3a8a04883956' xmlns:dc='http://purl.org/dc/elements/1.1/' dc:format='application/pdf'><dc:title><rdf:Alt><rdf:li xml:lang='x-default'>Graph4</rdf:li></rdf:Alt></dc:title><dc:creator><rdf:Seq><rdf:li>Guest</rdf:li></rdf:Seq></dc:creator></rdf:Description>
4906: </rdf:RDF>
4907: </x:xmpmeta>
4908:                                                                                                                                 
4909:                                                                                                                                 
4910:                                                                                                                                 
4911:                                                                                                                                 
4912:                                                                                                                                 
4913:                                                                                                                                 
4914:                                                                                                                                 
4915:                                                                                                                                 
4916:                                                                                                                                 
4917:                                                                                                                                 
4918:                                                                                                                                 
4919:                                                                                                                                 
4920:                                                                                                                                 
4921:                                                                                                                                 
4922:                                                                                                                                 
4923:                                                                                                                                 
4924: <?xpacket end='w'?>
4925: 
4926: 
4927: % &end XMP packet& %
4928: 
4929: [{Metadata_In_EPS} 2 dict begin /Type /Metadata def /Subtype /XML def currentdict end /PUT PDFMark5
4930: [/Document 1 dict begin /Metadata {Metadata_In_EPS} def currentdict end /BDC PDFMark5
4931: [/NamespacePop PDFMark5
4932: 
4933: PDFVars/TermAll get exec end end
4934: 
4935: %%EndSetup
4936: PDFVars begin PDF begin PDFVars/InitAll get exec
4937: 0 0 842 595 rectclip
4938: [ 0 -1 1 0 0 595 ] concat
4939: %ADOBeginSubsetFont: NHCKJC+ArialMT Initial
4940: ct_T42Dict begin
4941: -0.664 -0.324 2.027 1.004
4942:  256 array 0 1 255 {1 index exch /.notdef put} for  /NHCKJC+ArialMT
4943: Type42DictBegin
4944: [<00010000000c000c000c000c4f532f320cdf326b000000cc000000566376
4945: 74209670d27600000124000006306670676d19aae80b000007540000065a
4946: 676c7966dcb4dc980000482c00001a0c68656164cb7cec0400000db00000
4947: 003668686561126d11aa00000de800000024686d7478caa2734000000e0c
4948: 000014a06c6f6361008128ec000022ac000014a46d61787009e30c950000
4949: 3750000000206e616d65ec66441800003770000005bb7072657052fec4e9
4950: 00003d2c00000aff67646972000000000000000000000000000103880190
4951: 00050000059a05330000011b059a0533000003d1006602120805020b0604
4952: 02020202020400007a878000000000000008000000004d6f6e6f00400020
4953: fffc05d3fe510133073e01b2400001ffffff00003e0105ba001905ba001a
4954: 05a70019042600180000ffe70000ffe80000ffe7fe69ffe805ba0019fe69
4955: ffe802ea000000b8000000b80000000000a800ad016900ad00bf00c201f0
4956: 001800af00b900b400c800170044009c007c009400870006005a00c80089
4957: 005200520005004400940119ffb4002f00a1000300a100cd00170057007e
4958: 00ba00160118ffe9007f008503d300870085000d002200410050006f008d
4959: 014cff75005c00df04830037004c006e00700180ff58ff8eff92ffa400a5
4960: 00b903c8fffd000b001a0063006300cdffee05d8ffdc002d005c00950099
4961: 00df019209b500400057008000b9039d0072009a035d0401ff67fffa0003
4962: 0021007700cd0004004d00cd01c0022b004c006500e70118017c034305d8
4963: ffa3ffb0ffc40003001c005d0068009a00ba013501470221055cff4dffcd
4964: 0016002d00780080009900b200b600b600b800bd00da010c05f0ffa4fff0
4965: 0019002c0049007f00b400ce01c003fefd81fe3f00000005001800290039
4966: 0049006f00be00c700d0012301c1026f050c05320540057affd400140031
4967: 0055005700a700b400e601f7027e027e027f03c60446ff42000e00850091
4968: 00bf00c200c500e1011a012f014f01560229026f029e03720008002c0031
4969: 0031006400690089009800c700de012b01b6020c02cf03a304ab04fb061d
4970: fee0ff0e00060026009b009d00c1010d011801200173018201d601e30243
4971: 025f029b02e2039404a904d20761001c005e006d008d00ab00f701120138
4972: 0151015b0168017c01870191019901cd01d001e802410254026b02ef0368
4973: 037103bd044204420453047304830586058b06e8fe58fec4fed1fef7ff32
4974: ff860051007c008100910095009e00b400b900cf00d900d900df00e20105
4975: 010b010e010e012001210155017b017b017e018d01a201a801a901b401d0
4976: 01d001e201e901f201f501fb020002000206021b02210222022202230272
4977: 02770294029c02cf02cf02d002ec02f903170322032b0335033c0359036f
4978: 037103870390039003b503e1041a04cf04ff053205320596059f05a805ab
4979: 05c205f0060c0782080008ccfca3fd2afddefe00fe88fe96feb2feb4ffe1
4980: 00150019001a001c001f003c005100610061006a0078009600a500af00d3
4981: 010c0118011a012a013e014c0151015f016a0171017801820184019a01a5
4982: 01a801a901ae01bc01cd01d701ef0200020d021c02210222022e02350242
4983: 024f024f025e026502710290029202b402d602fa0307030b030f0315032a
4984: 0347035d036503740379039603b003cc03dd03e203f603fc03fc03ff040a
4985: 041f04220426042b0447045f0475049e04e704e7055c05cb05e5060a066d
4986: 068606b806f10736073e07500751075d078f07b607d4086000b600c300b5
4987: 00b700000000000000000000000001e00381034503b5008e0233041902ce
4988: 02ce002d005f0064034d023f000002a80188027d01b402240578063b023b
4989: 014e00f00426029402c6029f02f6023b034d014b0153006a023100000000
4990: 0000061404aa0000003c04c300ed04bc026502ce03b50078060c017e02ef
4991: 060c00b201000239000001c50330042b03cb00da03df010704a100db040a
4992: 011701ed02a70350010b01bd043e05580021039c00ae0371017d00b50245
4993: 00000afb088c012b014e01aa00870054013201f803ff0003024e00b40037
4994: 03e30083006b02d800ed00770088009701640467008e0033017c00e700a6
4995: 029e0329056e062a061501c90269048a021301b4000204a9000002390124
4996: 010305140084015d039a06ef02d9007500cf040a00de03ac04bc02cf02ae
4997: 034d04f005520168006d007d00860071ff810079055804d2016700030156
4998: 002504e00094007c033204210094007f0072005c002f00b6001800ba00b8
4999: 0041034d00720018001f004c016a01550099009a009a009800b200040078
5000: 006900140057006e00ce00b4065402b80067050e016500e7000004cbfe52
5001: 005affa60099ff67006eff92002dffd40087ff7c00b800a800e5008f00a8
5002: 0185fe7b0070001e00d900de014c054602cf0546ff2d028a02d902530296
5003: 00b700000000000000000000000000000125011800ea00ea00ae0046003e
5004: 05bb008a04d70053003fff8cffd500150028002200990062004a00e4006d
5005: 00ee00e5004803c00033fe4e02b1ff460370007905df0051ffa7ff1f010a
5006: 0068ff6c004f00bc00a507050061072b4043555441403f3e3d3c3b3a3938
5007: 373534333231302f2e2d2c2b2a292827262524232221201f1e1d1c1b1a19
5008: 1817161514131211100f0e0d0c0b0a090807060504030201002c45234660
5009: 20b02660b004262348482d2c452346236120b02661b004262348482d2c45
5010: 234660b0206120b04660b004262348482d2c4523462361b0206020b02661
5011: b02061b004262348482d2c45234660b0406120b06660b004262348482d2c
5012: 4523462361b0406020b02661b04061b004262348482d2c0110203c003c2d
5013: 2c20452320b0cd442320b8015a51582320b08d44235920b0ed51582320b0
5014: 4d44235920b09051582320b00d44235921212d2c20204518684420b00160
5015: 2045b04676688a4560442d2c01b10b0a432343650a2d2c00b10a0b432343
5016: 0b2d2c00b0172370b101173e01b0172370b10217453ab10200080d2d2c45
5017: b01a234445b01923442d2c2045b00325456164b050515845441b2121592d
5018: 2cb00143632362b0002342b00f2b2d2c2045b0004360442d2c01b00643b0
5019: 0743650a2d2c2069b04061b0008b20b12cc08a8cb8100062602b0c642364
5020: 615c58b00361592d2c45b0112bb0172344b0177ae4182d2c45b0112bb017
5021: 23442d2cb01243588745b0112bb0172344b0177ae41b038a45186920b017
5022: 23448a8a8720b0a05158b0112bb0172344b0177ae41b21b0177ae4595918
5023: 2d2c2d2cb0022546608a46b040618c482d2c4b53205c58b002855958b001
5024: 85592d2c20b0032545b019234445b01a23444565234520b00325606a20b0
5025: 09234223688a6a606120b01a8ab000527921b21a1a40b9ffe0001a45208a
5026: 54582321b03f1b235961441cb114008a5279b31940201945208a54582321
5027: b03f1b235961442d2cb110114323430b2d2cb10e0f4323430b2d2cb10c0d
5028: 4323430b2d2cb10c0d432343650b2d2cb10e0f432343650b2d2cb1101143
5029: 2343650b2d2c4b525845441b2121592d2c0120b003252349b04060b02063
5030: 20b000525823b002253823b002256538008a63381b212121212159012d2c
5031: 4bb06451584569b00943608a103a1b212121592d2c01b005251023208af5
5032: 00b0016023edec2d2c01b005251023208af500b0016123edec2d2c01b006
5033: 2510f500edec2d2c20b001600110203c003c2d2c20b001610110203c003c
5034: 2d2cb02b2bb02a2a2d2c00b00743b006430b2d2c3eb02a2a2d2c352d2c76
5035: b8022323701020b802234520b0005058b00161593a2f182d2c21210c6423
5036: 648bb84000622d2c21b08051580c6423648bb82000621bb200402f2b59b0
5037: 02602d2c21b0c051580c6423648bb81555621bb200802f2b59b002602d2c
5038: 0c6423648bb84000626023212d2cb4000100000015b00826b00826b00826
5039: b008260f10161345683ab001162d2cb4000100000015b00826b00826b008
5040: 26b008260f1016134568653ab001162d2c4b53234b515a5820458a60441b
5041: 2121592d2c4b545820458a60441b2121592d2c4b53234b515a58381b2121
5042: 592d2c4b5458381b2121592d2cb0134358031b02592d2cb0134358021b03
5043: 592d2c4b54b012435c5a58381b2121592d2cb012435c580cb00425b00425
5044: 060c6423646164b807085158b00425b00425012046b01060482046b01060
5045: 48590a21211b2121592d2cb012435c580cb00425b00425060c6423646164
5046: b807085158b00425b00425012046b8fff060482046b8fff06048590a2121
5047: 1b2121592d2c4b53234b515a58b03a2b1b2121592d2c4b53234b515a58b0
5048: 3b2b1b2121592d2c4b53234b515ab012435c5a58381b2121592d2c0c8a03
5049: 4b54b00426024b545a8a8a0ab012435c5a58381b2121592d2c4b5258b004
5050: 25b0042549b00425b00425496120b0005458212043b0005558b00325b003
5051: 25b8ffc038b8ffc038591bb04054582043b0005458b00225b8ffc038591b
5052: 2043b0005458b00325b00325b8ffc038b8ffc0381bb00325b8ffc0385959
5053: 5959212121212d2c462346608a8a462320468a608a61b8ff806223201023
5054: 8ab902c202c28a70456020b0005058b00161b8ffba8b1bb0468c59b01060
5055: 68013a2d2cb1020042b123018851b1400188535a58b910000020885458b2
5056: 02010243604259b12401885158b920000040885458b202020243604259b1
5057: 2401885458b2022002436042004b014b5258b2020802436042591bb94000
5058: 0080885458b202040243604259b94000008063b80100885458b202080243
5059: 604259b94000010063b80200885458b2021002436042595959592d2cb002
5060: 4354584b53234b515a58381b2121591b21212121592d0000000100000002
5061: e667658001065f0f3cf5081b080000000000a2e3272a00000000b6809401
5062: faaffd67103a080c00000009000100010000ccfe00010000073efe4e0043
5063: 1000faaffe33103a00010000000000000000000000000000052806000100
5064: 000000000239000002390000023900b002d7005e0473001504730049071d
5065: 0077055600580187005a02aa007c02aa007c031d004004ac0072023900aa
5066: 02aa0041023900ba0239000004730055047300df0473003c047300560473
5067: 001a047300550473004d047300610473005304730055023900b9023900aa
5068: 04ac007004ac007204ac00700473005a081f006f0556fffd0556009605c7
5069: 006605c7009e055600a204e300a80639006d05c700a4023900bf04000037
5070: 055600960473009606aa009805c7009c063900630556009e0639005805c7
5071: 00a10556005c04e3003005c700a105560009078d00190556000905560006
5072: 04e300290239008b023900000239002703c100360473ffe102aa00590473
5073: 004a0473008604000050047300460473004b023900130473004204730087
5074: 01c7008801c7ffa20400008801c7008306aa008704730087047300440473
5075: 00870473004802aa00850400003f02390024047300830400001a05c70006
5076: 0400000f040000210400002802ac0039021400bc02ac002f04ac00570556
5077: fffd0556fffd05c70068055600a205c7009c0639006305c700a10473004a
5078: 0473004a0473004a0473004a0473004a0473004a040000500473004b0473
5079: 004b0473004b0473004b023900bd023900230239ffe50239000904730087
5080: 047300440473004404730044047300440473004404730083047300830473
5081: 00830473008304730049033300800473006b0473001b0473005102cd006d
5082: 044c000104e3009905e5000305e50003080000e102aa00de02aa003d0464
5083: 004e080000010639005305b4009a0464004e0464004d0464004d0473fffd
5084: 049c00a003f4003805b4007a069600a1046400000231000002f6002f02ec
5085: 002d0625007f071d004404e3008104e3009e02aa00e804ac007204640054
5086: 0473002e0464003304e5001a047300860473008c080000ef0556fffd0556
5087: fffd0639006308000081078d00520473fffc0800000002aa005302aa0047
5088: 01c7008001c7006c0464004e03f4002f04000021055600060156fe390473
5089: ffe402aa005c02aa005c040000170400001704730049023900b901c7006c
5090: 02aa0047080000250556fffd055600a20556fffd055600a2055600a20239
5091: 008d0239ffe0023900040239001506390063063900630639006305c700a1
5092: 05c700a105c700a1023900c602aa001902aa000602aa001d02aa002e02aa
5093: 00e502aa00a202aa006b02aa003a02aa00b702aa00280473000001c70003
5094: 0556005c0400003f04e3002904000028021400bc05c7fffd047300490556
5095: 0006040000210556009e0473008704ac007204ac00a102aa006b02aa0019
5096: 02aa002106ac006b06ac006b06ac0021047300000639006d047300420239
5097: 00b10556005c0400003f05c700660400005005c700660400005004730046
5098: 046bffe102aa01f10556fffd0473004a0556fffd0473004a05c7009e04eb
5099: 004705c7fffd055600a20473004b055600a20473004b0473009601c70042
5100: 04730096025500880473009a02ac008305c7009c0473008705c7009c0473
5101: 0087063900630473004405c700a102aa008505c700a102aa003c0556005c
5102: 0400003f04e300300239002404e300300300002305c700a10473008305c7
5103: 00a10473008304e300290400002804e3002904000028046800a406390060
5104: 0662005504a00048047400480391006204f000440329002e05300048046b
5105: ffe1040000b002eb005208c000330800004f040000990800004f04000099
5106: 0800004f040000980400009807d5016a05c0009e04ab007204d5009d04ac
5107: 007104d5022204d5010505abffe9050001c905ab027e05abffe905ab027e
5108: 05abffe905ab027e05abffe905abffe905abffe905abffe905abffe905ab
5109: 01c005ab027e05ab01c005ab01c005abffe905abffe905abffe905ab027e
5110: 05ab01c005ab01c005abffe905abffe905abffe905ab027e05ab01c005ab
5111: 01c005abffe905abffe905abffe905abffe905abffe905abffe905abffe9
5112: 05abffe905abffe905abffe905abffe905abffe905abffe905abffe905ab
5113: ffe905abffe905ab02d605ab006605abffea05d5ffff04d5009208000000
5114: 07eb013007eb012007eb013007eb012004d500b204d5008004d5002a082b
5115: 0198086b01b807550010060000f40600006f0440003a0540003704c0003f
5116: 04150040040000250600005505e100bf038d008904d5ffd90180008002d5
5117: 0086071500610296000f04d5009202d6008302d6008304d500b202d60070
5118: 0556fffd0473004a05c700660400005005c7006604000050055600a20473
5119: 004b055600a20473004b055600a20473004b0639006d047300420639006d
5120: 047300420639006d0473004205c700a40473008705c7001f047300060239
5121: ffce0239ffce0239ffe40239ffe40239fff60239fff5023900a301c70066
5122: 0400003701c7ffa20556009604000088040000860473009601c7fffa05c7
5123: 009c0473008705c900a50473008b06390063047300440639006304730044
5124: 05c700a102aa006b0556005c0400003f04e300300239000c05c700a10473
5125: 008305c700a10473008305c700a10473008305c700a104730083078d0019
5126: 05c70006055600060400002101c700890556fffd0473004a08000001071d
5127: 00440639005304e30081023900b9078d001905c70006078d001905c70006
5128: 078d001905c70006055600060400002101c7008a02aaffe10473001b04cd
5129: 005a06ac006b06ac002206ac002206ac004a02aa00e202aa006b02aa00de
5130: 02aaffea0557ffff0646ffa706b4ffa80312ffa80632ffa706d8ffa70605
5131: ffa701c7ff780556fffd055600960558fffe055600a204e3002905c700a4
5132: 023900bf055600960558000b06aa009805c7009c0533006d0639006305c7
5133: 00a40556009e04f2009404e30030055600060556000906af007f05fb0061
5134: 023900040556000604a00048039100620473008b01c7006b04600088049a
5135: 008c04000019038700480473008b0473005c01c700890400008604000018
5136: 049c00a00400001a0395005c04730044048d008303db0056046000880433
5137: 001105b4007a063f005701c7ffc9046000880473004804600088063f0057
5138: 055700a206eb0032045500a105c000640556005c023900bf023900040400
5139: 00370875000d081500a406d5003104a900a10515000a05c000a00556fffd
5140: 054000a705560096045500a1056b0000055600a20763000704d5004e05c0
5141: 00a105c000a104a900a10540001206aa009805c700a40639006305c000a0
5142: 0556009e05c7006604e300300515000a061500520556000905eb009f0555
5143: 0057075500a1078000a106550000071500a8054000a505c00055081500a4
5144: 05c7001a0473004a0495005b0440008802eb008804ab00000473004b055a
5145: fffb03ab003204780087047800870380008604ab00180580008c046b0088
5146: 0473004404550088047300870400005003aa0026040000210695004b0400
5147: 000f0495008a042b0045066b008d0695008d0500002805c0008b042b0084
5148: 04150030060000890455001f0473004b0473000002eb00890415004b0400
5149: 003f01c700880239000901c7ffa207400013068000830473000003800086
5150: 04000021046b008803e900a1034a008808000041089500a00585002d02aa
5151: 010102aa001e02aa003102aa003102aa010102aa007e02aa007e02aa008c
5152: 02aa008c02aa010102aa001002aa010102aa01210310007d02aa008c0233
5153: 00d202aa030b02aaff04023900b90481006904560032033100190411002d
5154: 04d1009601f9009b030f005f04ca009b04b8008c01f9009b0413002803b0
5155: 005003b4003c04ca009b04cf005001f9009b02d2003c0498005a043c0019
5156: 0488006e045f007303b1001903d4000a0466009604130028058e00640524
5157: 002803f2009b03f2009b03f2009b01e3005a0356005a0686009b01f9ffac
5158: 041300280413002803b4ff5703b4ff570448002d058e0064058e0064058e
5159: 0064058e006404810069048100690481006904560032033100190411002d
5160: 04d10096024b0000034a000004b8008c024b00000413002803b0005003b4
5161: 003c04cf005002d2003c0498005a0488006e045f007303d4000a04660096
5162: 04130028058e00640524002801f9009b0456003203b00050045f0073049b
5163: 003c0000ffdc0000ff250000ffdc0000fe51028d00ab028d00a002da0043
5164: 034d007901a80000019c004601e50046019c0046019c004601ad0048019c
5165: 004601b10046015100460435017c0435012e043500b7043500810435012c
5166: 043500be043500af043500810435009a043500db04350085028d00c10435
5167: 00b3060001000600010002420036060001000435009e04350098043500cb
5168: 060001000600010006000100060001000600010001b10046060001000600
5169: 0100060001000600010006000100060001000600010006000100051b0000
5170: 06000100060001000600010005b5008005b5008001f4fffd01f4fffd0600
5171: 01000600010006000100060001000481003604350036043d0000043d0000
5172: 03e9009003e90090067f005a0776005a03270000041e0000067f005a0776
5173: 005a03270000041e0000051b003204b5006a060001000600010006000100
5174: 060001000600010006000100060001000600010006000100060001000600
5175: 0100060001000600010006000100060001000600010001cf003001b10046
5176: 01b1004601b1004001b1004606000100060001000000ffdc0000fe510000
5177: ff160000ff160000ff160000ff160000ff160000ff160000ff160000ff16
5178: 0000ff160000ffdc0000ff160000ffdc0000ff200000ffdc0473004a0800
5179: 000006000100060001000600010006000100060001000600010006000100
5180: 060001000600010006000100060001000600010006000100060001000600
5181: 010006000100060001000600010006000100060001000600010006000100
5182: 060001000600010006000100060001000600010006000100028d007f028d
5183: 005d0600010004ee0015034d007901a8000e01d6002201a8005601d60056
5184: 037500780375007801a8002d01d60059051b003204b5006a01f4000001f4
5185: 000001a8009301d6005905b5008005b5008001f4000001f4000002420000
5186: 0300003d05b5008005b5008001f4000001f4000005b5008005b5008001f4
5187: 000001f400000481003604350036043d0000043d00000481003604350036
5188: 043d0000043d00000481003604350036043d0000043d000002b300a502b3
5189: 00a502b300a502b300a503e9009003e9009003e9009003e9009006920084
5190: 06920084043f0000043f00000692008406920084043f0000043f000008c9
5191: 008408c9008406c5000006c5000008c9008408c9008406c5000006c50000
5192: 04a7000004a7000004a7000004a7000004a7000004a7000004a7000004a7
5193: 0000045a002a039a00360435000003270000045a002a039a003604350000
5194: 03270000064f006d064f006d02240000021a000004a7008c04a7008c0224
5195: 0000021a000004cf007304cf00730327000003270000040d008d040d008d
5196: 01a8000001a8000002b4006902b4006903270000032700000435008b0435
5197: 008b01f4000001f40000024200360300003d039a00000327000003750078
5198: 03750078051b003204b5006a051b003204b5006a01f4000001f40000045a
5199: 004004ce0040045a002604ce0030045a005304ce0041045a005304ce0041
5200: 0600010006000100019c0046019c00460600010006000100060001000151
5201: 004601b10046060001000600010001ad004801e500460600010006000100
5202: 0600010001b1004601b1004601b1004601b1004601b1004001cf00300600
5203: 0100019c0046019c00460600010006000100060001000600010006000100
5204: 060001000600010006000100060001000600010006000100060001000600
5205: 010006000100060001000600010006000100060001000600010006000100
5206: 060001000600010006000100060001000600010006000100060001000600
5207: 010006000100060001000600010006000100060001000600010006000100
5208: 060001000600010006000100060001000600010006000100060001000600
5209: 010006000100060001000600010006000100060001000600010006000100
5210: 06000100060001000600010006000100028d00ca028d00c7028d00c60600
5211: 010006000100060001000600010006000100060001000600010006000100
5212: 060001000600010006000100060001000600010006000100060001000600
5213: 010006000100060001000600010006000100060001000600010006000100
5214: 0600010001000000080000001000000006dc0063053f004406d500a1055b
5215: 00830000fddc0000fc2f0000fca60000fe540000fcd70000fd730000fe29
5216: 0000fe0d0000fd110000fc670000fd9d0000fbf50000fc720000fed50000
5217: fed50000ff02041b00a006ac006b06ac00190000feb60000fd730000fe08
5218: 0000fca60000fe530000fd110000fbc80000faf40000faaf0000fc720000
5219: fbaa0000fb6a0000fcf10000fc7d0000fbdd0000fcc10000fb980000fdea
5220: 0000fe840000fdc20000fcf10000fd5f0000fe760000febc0000fceb0000
5221: fd6c0000fd580000fc900000fd150000fc2c0000fc130000fc120000fb96
5222: 0000fb9601c700880556fffd0473004a0556fffd0473004a0556fffd0473
5223: 004a0556fffd0473004a0556fffd0473004a0556fffd0473004a0556fffd
5224: 0473004a0556fffd0473004a0556fffd0473004a0556fffd0473004a0556
5225: fffd0473004a0556fffd0473004a055600a20473004b055600a20473004b
5226: 055600a20473004b055600a20473004b055600a20473004b055600a20473
5227: 004b055600a20473004b055600a20473004b0239006301c7001f023900ba
5228: 01c7007c0639006304730044063900630473004406390063047300440639
5229: 006304730044063900630473004406390063047300440639006304730044
5230: 06dc0063053f004406dc0063053f004406dc0063053f004406dc0063053f
5231: 004406dc0063053f004405c700a10473008305c700a10473008306d500a1
5232: 055b008306d500a1055b008306d500a1055b008306d500a1055b008306d5
5233: 00a1055b0083055600060400002105560006040000210556000604000021
5234: 0556fffd0473004a0239ffe201c7ffb0063900630473004405c700a10473
5235: 008305c700a10473008305c700a10473008305c700a10473008305c700a1
5236: 047300830000fefe0000fefe0000fefe0000fefe0455fffd02eb000c0763
5237: 0007055afffb04a900a10380008604a900a10380008605c700a4046b0088
5238: 0473fffd040000140473fffd04000014055600090400000f05550057042b
5239: 0045055500a1042b00880605006304730055063900600473004400000000
5240: 0000006c0000006c0000006c0000006c0000006c0000006c0000006c0000
5241: 006c0000006c0000006c0000006c0000006c0000006c0000006c0000006c
5242: 0000006c000000b2000000ee000000ee0000025e00000316000005080000
5243: 066e000007b00000091600000a8a00000b3600000d2600000d2600000d26
5244: 00000d2600000d2600000d2600000d2600000d2600000d2600000d260000
5245: 0d2600000d2600000d2600000d2600000d2600000d2600000d2600000d26
5246: 00000d2600000d2600000d2600000d2600000d2600000d2600000d260000
5247: 0d2600000d2600000d2600000d2600000d2600000d2600000d2600000d26
5248: 00000d2600000d2600000d2600000d2600000d2600000d2600000d260000
5249: 0d2600000f8a00000f8a00000f8a00000f8a0000112000001120000012cc
5250: 000012cc000012cc000012cc000012cc0000139e0000139e0000139e0000
5251: 139e0000139e0000139e0000139e000016c6000016c60000182200001a0c
5252: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5253: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5254: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5255: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5256: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5257: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5258: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5259: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5260: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5261: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5262: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5263: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5264: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5265: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5266: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5267: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5268: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5269: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5270: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5271: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5272: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5273: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5274: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5275: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5276: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5277: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5278: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5279: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5280: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5281: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5282: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5283: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5284: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5285: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5286: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5287: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5288: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5289: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5290: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5291: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5292: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5293: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5294: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5295: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5296: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5297: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5298: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5299: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5300: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5301: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5302: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5303: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5304: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5305: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5306: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5307: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5308: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5309: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5310: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5311: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5312: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5313: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5314: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5315: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5316: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5317: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5318: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5319: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5320: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5321: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5322: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5323: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5324: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5325: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5326: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5327: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5328: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5329: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5330: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5331: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5332: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5333: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5334: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5335: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5336: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5337: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5338: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5339: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5340: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5341: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5342: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5343: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5344: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5345: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5346: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5347: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5348: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5349: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5350: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5351: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5352: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5353: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5354: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5355: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5356: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5357: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5358: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5359: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5360: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5361: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5362: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5363: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5364: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5365: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5366: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5367: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5368: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5369: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5370: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5371: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5372: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5373: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5374: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5375: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5376: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5377: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5378: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5379: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5380: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5381: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5382: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5383: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5384: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5385: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5386: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5387: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5388: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5389: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5390: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5391: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5392: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5393: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5394: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5395: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5396: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5397: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5398: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5399: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5400: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5401: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5402: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5403: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5404: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5405: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5406: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5407: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5408: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5409: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5410: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5411: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5412: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5413: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5414: 00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c0000
5415: 1a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c00001a0c
5416: 0001000005280100003f0063000500020010002f00560000040d0aff0003
5417: 00020000000e00ae000000030000000000fe0000000000030000000700c4
5418: 00fe0001000000000000007f01c20001000000000003000e024100010000
5419: 00000004000e024f0001000000000006000e025d00010000000000070062
5420: 026b000300010409000000fe02cd0003000104090001001c03cb00030001
5421: 04090002000e03e70003000104090003001c03f50003000104090004001c
5422: 04110003000104090006001c042d000300010409000700c4044900540079
5423: 007000650066006100630065002000a900200054006800650020004d006f
5424: 006e006f007400790070006500200043006f00720070006f007200610074
5425: 0069006f006e00200070006c0063002e00200044006100740061002000a9
5426: 00200054006800650020004d006f006e006f007400790070006500200043
5427: 006f00720070006f0072006100740069006f006e00200070006c0063002f
5428: 005400790070006500200053006f006c007500740069006f006e00730020
5429: 0049006e0063002e00200031003900390030002d0031003900390032002e
5430: 00200041006c006c00200052006900670068007400730020005200650073
5431: 006500720076006500640041007200690061006c00ae0020005400720061
5432: 00640065006d00610072006b0020006f006600200054006800650020004d
5433: 006f006e006f007400790070006500200043006f00720070006f00720061
5434: 00740069006f006e00200070006c00630020007200650067006900730074
5435: 006500720065006400200069006e00200074006800650020005500530020
5436: 0050006100740020002600200054004d0020004f00660066002e00200061
5437: 006e006400200065006c0073006500770068006500720065002e54797065
5438: 6661636520a920546865204d6f6e6f7479706520436f72706f726174696f
5439: 6e20706c632e204461746120a920546865204d6f6e6f7479706520436f72
5440: 706f726174696f6e20706c632f5479706520536f6c7574696f6e7320496e
5441: 632e20313939302d313939322e20416c6c20526967687473205265736572
5442: 7665644e48434b4a432b417269616c4d544e48434b4a432b417269616c4d
5443: 544e48434b4a432b417269616c4d54417269616ca82054726164656d6172
5444: 6b206f6620546865204d6f6e6f7479706520436f72706f726174696f6e20
5445: 706c63207265676973746572656420696e20746865205553205061742026
5446: 20544d204f66662e20616e6420656c736577686572652e00540079007000
5447: 650066006100630065002000a900200054006800650020004d006f006e00
5448: 6f007400790070006500200043006f00720070006f007200610074006900
5449: 6f006e00200070006c0063002e00200044006100740061002000a9002000
5450: 54006800650020004d006f006e006f007400790070006500200043006f00
5451: 720070006f0072006100740069006f006e00200070006c0063002f005400
5452: 790070006500200053006f006c007500740069006f006e00730020004900
5453: 6e0063002e00200031003900390030002d0031003900390032002e002000
5454: 41006c006c00200052006900670068007400730020005200650073006500
5455: 72007600650064004e00480043004b004a0043002b004100720069006100
5456: 6c004d00540052006500670075006c00610072004e00480043004b004a00
5457: 43002b0041007200690061006c004d0054004e00480043004b004a004300
5458: 2b0041007200690061006c004d0054004e00480043004b004a0043002b00
5459: 41007200690061006c004d00540041007200690061006c00ae0020005400
5460: 72006100640065006d00610072006b0020006f0066002000540068006500
5461: 20004d006f006e006f007400790070006500200043006f00720070006f00
5462: 72006100740069006f006e00200070006c00630020007200650067006900
5463: 730074006500720065006400200069006e00200074006800650020005500
5464: 5300200050006100740020002600200054004d0020004f00660066002e00
5465: 200061006e006400200065006c0073006500770068006500720065002e00
5466: b1540f4122031700ef031700ff03170003001f0317002f0317004f031700
5467: 5f0317008f0317009f03170006000f0317005f0317006f0317007f031700
5468: bf031700f00317000600400317b2923340b80317b28b3340b80317b36a6c
5469: 3240b80317b2613340b80317b35c5d3240b80317b357593240b80317b34d
5470: 513240b80317b344493240b80317b23a3340b80317b331343240b80317b3
5471: 2e423240b80317b3272c3240b80317b312253280b80317b30a0d32c04116
5472: 031600d00316000200700316000102c4000f0101001f00a0031500b00315
5473: 00020306000f0101001f00400312b32426329fbf03040001030203010064
5474: 001fffc00301b20d1132410a02ff02ef0012001f02ee02ed0064001fffc0
5475: 02edb30e11329f414a02e200af02e200bf02e2000302e202e202e102e100
5476: 7f02e00001001002e0003f02e0009f02e000bf02e000cf02e000ef02e000
5477: 0602e002e002df02df02de02de000f02dd002f02dd003f02dd005f02dd00
5478: 9f02dd00bf02dd00ef02dd000702dd02dd001002dc0001000002dc000100
5479: 1002dc003f02dc000202dc02dc001002db000102db02db000f02da000102
5480: da02daffc002d3b2373932b9ffc002d3b22b2f32b9ffc002d3b21f2532b9
5481: ffc002d3b2171b32b9ffc002d3b2121632b802d2b2f9291fb802e3b3202b
5482: 1fa0413002d400b002d40002000002d4001002d4002002d4005002d40060
5483: 02d4007002d40006006002d6007002d6008002d6009002d600a002d600b0
5484: 02d60006000002d6001002d6002002ca002002cc002002d6003002d60040
5485: 02d6005002d6000802d0b2202b1fb802cfb226421f411602ce02c7001700
5486: 1f02cd02c80017001f02cc02c60017001f02cb02c50017001f02c902c500
5487: 1e001f02ca02c6b21e1f00410b02c6000002c7001002c6001002c7002f02
5488: c5000502c1b324121fff411102bf0001001f02bf002f02bf003f02bf004f
5489: 02bf005f02bf008f02bf000602bf0222b2641f12410b02bb00ca0800001f
5490: 02b200e90800001f02a600a20800406a1f4026434932402043493240263a
5491: 3d3240203a3d329f209f26024026969932402096993240268e923240208e
5492: 92324026848c324020848c3240267a813240207a813240266c763240206c
5493: 76324026646a324020646a3240265a5f3240205a5f3240264f543240204f
5494: 5432b8029eb724271f374f6b0120410f0277003002770040027700500277
5495: 000402770277027700f90400001f029bb22a2a1fb8029a402b292a1f80ba
5496: 0180bc0180520180a201806501807e01808101803c01805e01802b01801c
5497: 01801e0180400180bb0138000100800140b40180400180bb013800010080
5498: 013940180180ca0180ad018073018026018025018024018020013740b802
5499: 21b2493340b80221b2453340b80221b341423240b80221b33d3e320f410f
5500: 0221003f0221007f0221000300bf022100cf022100ff0221000300400221
5501: b320223240b80221b3191e3240b80222b32a3f3240b80221b32e3a326f41
5502: 4802c3007f02c3008f02c300df02c30004002f02c3006002c300cf02c300
5503: 03000f02c3003f02c3005f02c300c002c300ef02c300ff02c3000600df02
5504: 220001008f02220001000f0222002f0222003f0222005f0222007f022200
5505: ef0222000600bf022100ef02210002006f0221007f022100af0221000300
5506: 2f0221003f0221004f0221000302c302c30222022202210221401d101c10
5507: 2b1048038f1c010f1e014f1eff1e023700161600000012110811b8010db6
5508: f70df8f70d00094109028e028f001d001f0290028f001d001f028fb2f91d
5509: 1fb80198b226bb1f41150197001e0401001f013900260125001f01380073
5510: 0401001f0135001c0801001f0134001c02ab001f0132b21c561fb8010fb2
5511: 262c1fba010e001e0401b61ff91ce41fe91cb80201b61fe81cbb1fd720b8
5512: 0401b21fd51cb802abb61fd41c891fc92fb80801b21fbc26b80101b21fba
5513: 20b80201b61fb91c381fadcab80401b21f8126b8019ab21f7e26b8019ab6
5514: 1f7d1c471f6b1cb80401b21f6526b8019ab21f5e73b80401400f1f52265a
5515: 1f481c891f441c621f4073b80801b61f3f1c5e1f3c26b8019ab21f351cb8
5516: 0401b61f301cbb1f2b1cb80401b61f2a1c561f291cb80101b21f231eb804
5517: 01b21f5537b80168402c07960758074f07360732072c0721071f071d071b
5518: 071408120810080e080c080a080808060804080208000814b8ffe0402b00
5519: 000100140610000001000604000001000410000001001002000001000200
5520: 000001000002010802004a00b013034b024b5342014bb0c063004b6220b0
5521: f65323b8010a515ab005234201b0124b004b5442b0382b4bb807ff52b037
5522: 2b4bb007505b58b101018e59b0382bb00288b801005458b801ffb101018e
5523: 851bb0124358b900010111858d1bb900010128858d5959001816763f183f
5524: 123e113946443e113946443e113946443e113946443e11394660443e1139
5525: 4660442b2b2b2b2b2b2b2b2b2b2b182b2b2b2b2b2b2b2b2b2b2b182b1db0
5526: 964b5358b0aa1d59b0324b5358b0ff1d594bb09353205c58b901f201f045
5527: 44b901f101f045445958b9033e01f2455258b901f2033e4459594bb80156
5528: 53205c58b9002001f14544b9002601f145445958b9081e0020455258b900
5529: 20081e4459594bb8019a53205c58b9002501f24544b9002401f245445958
5530: b909090025455258b9002509094459594bb8040153205c58b173244544b1
5531: 242445445958b917200073455258b9007317204459594bb8040153205c58
5532: b1ca254544b1252545445958b9168000ca455258b900ca16804459594bb0
5533: 3e53205c58b11c1c4544b11e1c45445958b9011a001c455258b9001c011a
5534: 4459594bb05653205c58b11c1c4544b12f1c45445958b90189001c455258
5535: b9001c01894459594bb8030153205c58b11c1c4544b11c1c45445958b90d
5536: e0001c455258b9001c0de04459592b2b2b2b2b2b2b2b2b2b2b2b2b2b2b2b
5537: 2b2b2b2b2b2b2b2b2b2b2b2b2b2b2b2b2b2b2b2b2b2b2b2b2b65422b2b01
5538: b33b59635c456523456023456560234560b08b766818b080622020b16359
5539: 4565234520b003266062636820b003266165b059236544b063234420b13b
5540: 5c4565234520b003266062636820b003266165b05c236544b03b2344b100
5541: 5c455458b15c406544b23b403b4523614459b34750343745652345602345
5542: 6560234560b089766818b080622020b134504565234520b0032660626368
5543: 20b003266165b050236544b034234420b147374565234520b00326606263
5544: 6820b003266165b037236544b0472344b10037455458b137406544b24740
5545: 474523614459004b5342014b5058b108004259435c58b108004259b3020b
5546: 0a124358601b2159421610703eb0124358b93b21187e1bba040001a8000b
5547: 2b59b00c2342b00d2342b0124358b92d412d411bba04000400000b2b59b0
5548: 0e2342b00f2342b0124358b9187e3b211bba01a80400000b2b59b0102342
5549: b0112342002b747573750018456944456944456944737373737475737475
5550: 2b2b2b2b74752b2b2b2b2b73737373737373737373737373737373737373
5551: 7373737373732b2b2b45b0406144737400004bb02a534bb03f515a58b107
5552: 0745b040604459004bb03a534bb03f515a58b10b0b45b8ffc0604459004b
5553: b02e534bb03a515a58b1030345b040604459004bb02e534bb03c515a58b1
5554: 090945b8ffc06044592b2b2b2b2b2b2b2b2b2b2b2b2b2b2b2b2b2b752b2b
5555: 2b2b2b2b2b435c58b9008002bbb301401e017400735903b01e4b5402b012
5556: 4b545ab012435c5a58ba009f02220001007359002b7473012b01732b2b2b
5557: 2b2b2b2b2b737373732b002b2b2b2b2b2b00456944734569447345694473
5558: 7475456944734569444569444569447374456944456944732b2b2b2b2b73
5559: 2b002b732b74752b2b2b2b2b2b2b2b2b2b2b2b2b2b7374752b0000>
5560: [6669 ] AllocGlyphStorage
5561: ]def 
5562: 124 60 
5563: PrepFor2015
5564: Type42DictEnd
5565: end
5566: %ADOEndSubsetFont
5567: [/N22/NHCKJC+ArialMT 1 TZ
5568: %ADOBeginSubsetFont: NHCKKC+SymbolMT-Identity-H Initial
5569: Adobe_CoolType_Utility begin ct_MakeOCF begin ct_saveCIDInit
5570: %ADOt1write: (1.0.21)
5571: %%Copyright: Copyright 2005 Adobe System Incorporated. All rights reserved.
5572: %%DocumentNeededResources: ProcSet (CIDInit)
5573: %%IncludeResource: ProcSet (CIDInit)
5574: %%BeginResource: CIDFont (NHCKKC+SymbolMT)
5575: %%Title: (NHCKKC+SymbolMT Adobe Identity 0)
5576: %%Version: 0
5577: /CIDInit /ProcSet findresource begin
5578: 14 dict begin
5579: /CIDFontName /NHCKKC+SymbolMT def
5580: /CIDFontType 0 def
5581: /CIDSystemInfo 3 dict dup begin
5582: /Registry (Adobe) def
5583: /Ordering (Identity) def
5584: /Supplement 0 def
5585: end def
5586: /FontBBox {0 -220 1113 1005} def
5587: /FontInfo 4 dict dup begin
5588: /FSType 0 def
5589: end def
5590: /CIDMapOffset 57 def
5591: /FDBytes 1 def
5592: /GDBytes 1 def
5593: /CIDCount 192 def
5594: /CDevProc {pop pop pop pop pop 0 -1000 7 index 2 div 880} def
5595: /FDArray 1 array
5596: dup 0
5597: %ADOBeginFontDict
5598: 4 dict dup begin
5599: /FontType 1 def
5600: /PaintType 0 def
5601: /FontMatrix [0.001 0 0 0.001 0 0] def
5602: %ADOBeginPrivateDict
5603: /Private 7 dict dup begin
5604: /BlueValues [0 0] def
5605: /password 5839 def
5606: /MinFeature {16 16} def
5607: /OtherSubrs[{}{}{}{systemdict/internaldict known not{pop 3}{1183615869
5608: systemdict/internaldict get exec dup/startlock known{/startlock get exec}{dup
5609: /strtlck known{/strtlck get exec}{pop 3}ifelse}ifelse}ifelse}executeonly]def
5610: /SubrMapOffset 0 def
5611: /SDBytes 1 def
5612: /SubrCount 5 def
5613: end def
5614: %ADOEndPrivateDict
5615: end put
5616: %ADOEndFontDict
5617: def
5618: /GlyphDirectory 1 dict def
5619: ct_GlyphDirProcs begin
5620: GlyphDirectory
5621: +
5622: 0 <001C60D8A8C9B7C3C9ED920C533BFCEF627DC3963E487931C80D1235BDD70
5623: 699E096A6312D> |
5624: !
5625: end
5626: ct_AddStdCIDMap
5627: %%EndResource
5628: ct_restoreCIDInit /NHCKKC+SymbolMT-Identity-H /Identity-H 0 [/NHCKKC+SymbolMT] ct_ComposeFont pop end end
5629: %ADOEndSubsetFont
5630: %%BeginResource: encoding
5631: % Identity-H
5632: %PDF_BeginEncoding: N23 (NHCKKC+SymbolMT-Identity-H)
5633: /N23 (NHCKKC+SymbolMT-Identity-H) /Identity-H [ (NHCKKC+SymbolMT) ]
5634:  /NoSubstitution [ /Serif ] 0 TZzero
5635: %%EndResource
5636: 0.0 0.0 595.0 842.0 re
5637: W
5638: n
5639: 1 J
5640: 1 j
5641: 0.3 w
5642: n
5643: 494.399994 117.891006 m
5644: 494.399994 599.570007 l
5645: 67.200005 599.570007 l
5646: 67.200005 117.891006 l
5647: 71.519997 117.891006 l
5648: 494.399994 117.891006 l
5649: h
5650: 0.15686 0.15686 0.15686 setrgbcolor
5651: q
5652: eofill
5653: Q
5654: 1.0 1.0 1.0  setrgbcolor
5655: S
5656: n
5657: 312.300018 117.891006 m
5658: 312.359985 122.751007 l
5659: 312.359985 127.611008 l
5660: 313.139984 130.731003 l
5661: 314.639984 132.471008 l
5662: 313.139984 134.570999 l
5663: 312.539978 137.331009 l
5664: 312.539978 142.19101 l
5665: 313.139984 144.171005 l
5666: 315.600006 147.111008 l
5667: 314.399994 151.971008 l
5668: 315.059998 156.831009 l
5669: 316.380005 161.69101 l
5670: 316.559998 166.55101 l
5671: 316.079987 171.411011 l
5672: 316.200012 176.271011 l
5673: 317.279999 181.131012 l
5674: 316.559998 185.991013 l
5675: 317.459991 189.291016 l
5676: 318.660004 190.851013 l
5677: 319.919983 195.711014 l
5678: 321.0 200.631012 l
5679: 320.160004 205.491013 l
5680: 320.700012 210.351013 l
5681: 320.459991 215.211014 l
5682: 321.059998 220.071014 l
5683: 320.940002 224.931015 l
5684: 321.119995 229.791016 l
5685: 321.779999 230.931015 l
5686: 324.539978 234.651016 l
5687: 324.959991 239.511017 l
5688: 324.779999 244.371017 l
5689: 326.100006 248.511017 l
5690: 326.639984 249.231018 l
5691: 327.300018 254.151016 l
5692: 328.139984 259.009979 l
5693: 328.800018 263.871002 l
5694: 329.100006 268.731018 l
5695: 330.419983 270.771027 l
5696: 333.119995 273.591003 l
5697: 332.700012 278.451019 l
5698: 334.73999 282.951019 l
5699: 334.97998 283.311005 l
5700: 337.200012 288.171021 l
5701: 335.880005 293.031006 l
5702: 338.459991 297.891022 l
5703: 334.73999 301.731018 l
5704: 333.660004 302.751007 l
5705: 334.73999 303.771027 l
5706: 339.059998 305.271027 l
5707: 341.579987 307.671021 l
5708: 343.380005 309.651001 l
5709: 346.139984 312.531006 l
5710: 347.700012 313.851013 l
5711: 350.459991 317.391022 l
5712: 347.700012 320.031006 l
5713: 343.380005 320.091003 l
5714: 339.059998 320.211029 l
5715: 337.200012 322.251007 l
5716: 334.73999 324.951019 l
5717: 330.419983 325.131012 l
5718: 326.100006 325.43103 l
5719: 322.97998 327.111023 l
5720: 321.779999 328.491028 l
5721: 317.459991 328.19101 l
5722: 313.139984 330.051025 l
5723: 308.820007 331.611023 l
5724: 304.559998 331.551025 l
5725: 303.839996 331.971008 l
5726: 300.23999 333.831024 l
5727: 295.919983 334.791016 l
5728: 291.600006 334.791016 l
5729: 287.279999 336.231018 l
5730: 285.059998 336.831024 l
5731: 282.959991 337.611023 l
5732: 278.639984 338.211029 l
5733: 274.320007 339.771027 l
5734: 265.679993 339.771027 l
5735: 261.359985 340.19101 l
5736: 257.040009 340.371002 l
5737: 252.779999 340.43103 l
5738: 251.639999 341.69101 l
5739: 248.459991 344.511017 l
5740: 244.139999 344.511017 l
5741: 239.819992 344.571014 l
5742: 235.5 345.051025 l
5743: 232.019989 346.551025 l
5744: 231.179993 347.211029 l
5745: 226.860001 350.331024 l
5746: 224.580002 346.551025 l
5747: 222.539993 345.291016 l
5748: 218.220001 345.471008 l
5749: 217.259995 346.551025 l
5750: 213.900009 349.551025 l
5751: 209.580002 350.271027 l
5752: 205.259995 349.791016 l
5753: 200.940002 349.671021 l
5754: 196.679993 349.671021 l
5755: 192.360001 349.731018 l
5756: 188.039993 350.451019 l
5757: 187.199997 351.411011 l
5758: 188.039993 354.831024 l
5759: 192.360001 355.19101 l
5760: 200.940002 355.19101 l
5761: 205.259995 355.131012 l
5762: 209.580002 354.231018 l
5763: 213.900009 355.19101 l
5764: 218.220001 354.891022 l
5765: 222.539993 355.19101 l
5766: 226.860001 352.671021 l
5767: 231.179993 355.19101 l
5768: 239.819992 355.19101 l
5769: 244.139999 355.251007 l
5770: 252.779999 355.251007 l
5771: 257.040009 355.311005 l
5772: 261.359985 355.311005 l
5773: 265.679993 355.371002 l
5774: 270.0 355.371002 l
5775: 274.320007 355.43103 l
5776: 278.639984 355.491028 l
5777: 282.959991 355.43103 l
5778: 287.279999 355.311005 l
5779: 291.600006 355.251007 l
5780: 295.919983 355.131012 l
5781: 300.23999 355.131012 l
5782: 304.559998 354.951019 l
5783: 308.820007 354.951019 l
5784: 313.139984 354.831024 l
5785: 317.459991 354.771027 l
5786: 334.73999 354.531006 l
5787: 339.059998 354.531006 l
5788: 347.700012 354.411011 l
5789: 352.019989 354.411011 l
5790: 356.339996 353.93103 l
5791: 360.660004 354.351013 l
5792: 364.919983 354.231018 l
5793: 369.23999 354.291016 l
5794: 373.559998 354.171021 l
5795: 377.880005 354.231018 l
5796: 395.160004 354.231018 l
5797: 399.47998 354.171021 l
5798: 408.119995 354.171021 l
5799: 412.440002 354.051025 l
5800: 416.700012 354.171021 l
5801: 421.019989 354.111023 l
5802: 425.339996 354.171021 l
5803: 429.660004 353.871002 l
5804: 433.97998 354.171021 l
5805: 438.300018 354.171021 l
5806: 442.619995 354.231018 l
5807: 464.220001 354.231018 l
5808: 468.47998 354.291016 l
5809: 481.440002 354.291016 l
5810: 485.759979 354.351013 l
5811: 490.079987 354.351013 l
5812: 494.399994 353.511017 l
5813: 494.399994 599.570007 l
5814: 170.759995 599.570007 l
5815: 67.200005 599.570007 l
5816: 67.200005 117.891006 l
5817: 312.300018 117.891006 l
5818: h
5819: 0.058824 0.058824 0.058824  setrgbcolor
5820: q
5821: eofill
5822: Q
5823: 0.0 0.0 0.0  setrgbcolor
5824: S
5825: n
5826: 309.660004 117.891006 m
5827: 310.259979 122.751007 l
5828: 310.259979 127.611008 l
5829: 310.97998 132.471008 l
5830: 310.5 137.331009 l
5831: 310.619995 142.19101 l
5832: 311.459991 147.111008 l
5833: 311.100006 151.971008 l
5834: 311.399994 156.831009 l
5835: 313.139984 160.731003 l
5836: 313.559998 161.69101 l
5837: 314.279999 166.55101 l
5838: 313.73999 171.411011 l
5839: 313.679993 176.271011 l
5840: 314.820007 181.131012 l
5841: 314.759979 185.991013 l
5842: 315.600006 190.851013 l
5843: 316.800018 195.711014 l
5844: 317.459991 199.911011 l
5845: 317.579987 200.631012 l
5846: 318.059998 205.491013 l
5847: 318.47998 210.351013 l
5848: 318.419983 215.211014 l
5849: 319.139984 220.071014 l
5850: 319.259979 224.931015 l
5851: 319.380005 229.791016 l
5852: 321.779999 234.05101 l
5853: 322.259979 234.651016 l
5854: 323.160004 239.511017 l
5855: 323.160004 244.371017 l
5856: 324.300018 249.231018 l
5857: 324.720001 254.151016 l
5858: 326.100006 258.891022 l
5859: 326.160004 259.009979 l
5860: 327.300018 263.871002 l
5861: 327.720001 268.731018 l
5862: 330.419983 272.871002 l
5863: 331.079987 273.591003 l
5864: 330.660004 278.451019 l
5865: 333.0 283.311005 l
5866: 334.73999 286.431 l
5867: 335.579987 288.171021 l
5868: 334.73999 290.210999 l
5869: 333.359985 293.031006 l
5870: 334.73999 294.591003 l
5871: 336.959991 297.891022 l
5872: 334.73999 300.231018 l
5873: 332.100006 302.751007 l
5874: 334.73999 305.151001 l
5875: 339.059998 306.591003 l
5876: 340.200012 307.671021 l
5877: 343.380005 311.211029 l
5878: 344.639984 312.531006 l
5879: 347.700012 315.171021 l
5880: 349.380005 317.391022 l
5881: 347.700012 319.011017 l
5882: 339.059998 319.251007 l
5883: 336.359985 322.251007 l
5884: 334.73999 323.991028 l
5885: 330.419983 324.291016 l
5886: 326.100006 324.471008 l
5887: 321.779999 326.571014 l
5888: 317.459991 326.69101 l
5889: 317.160004 327.111023 l
5890: 313.139984 329.271027 l
5891: 308.820007 330.411011 l
5892: 304.559998 330.471008 l
5893: 301.919983 331.971008 l
5894: 300.23999 332.871002 l
5895: 295.919983 334.131012 l
5896: 291.600006 334.131012 l
5897: 287.279999 335.211029 l
5898: 282.959991 336.351013 l
5899: 280.859985 336.831024 l
5900: 278.639984 337.251007 l
5901: 274.320007 339.111023 l
5902: 270.0 339.171021 l
5903: 265.679993 339.171021 l
5904: 261.359985 339.531006 l
5905: 257.040009 339.651001 l
5906: 252.779999 339.711029 l
5907: 251.039993 341.69101 l
5908: 248.459991 343.971008 l
5909: 244.139999 343.971008 l
5910: 239.819992 344.031006 l
5911: 235.5 344.451019 l
5912: 231.179993 346.19101 l
5913: 230.159988 346.551025 l
5914: 226.860001 348.651031 l
5915: 225.600006 346.551025 l
5916: 222.539993 344.631012 l
5917: 218.220001 344.811005 l
5918: 216.659988 346.551025 l
5919: 213.900009 349.071014 l
5920: 209.580002 349.611023 l
5921: 205.259995 349.251007 l
5922: 200.940002 349.131012 l
5923: 196.679993 349.131012 l
5924: 192.360001 349.19101 l
5925: 188.039993 349.851013 l
5926: 186.720001 351.411011 l
5927: 183.720001 356.031006 l
5928: 179.400009 353.811005 l
5929: 175.080002 355.131012 l
5930: 172.919998 356.271027 l
5931: 170.759995 357.231018 l
5932: 168.720001 356.271027 l
5933: 166.440002 354.351013 l
5934: 163.019989 356.271027 l
5935: 162.119995 356.571014 l
5936: 161.519989 356.271027 l
5937: 157.800003 355.791016 l
5938: 154.860001 356.271027 l
5939: 153.479996 357.411011 l
5940: 152.279999 356.271027 l
5941: 149.160004 355.731018 l
5942: 146.039993 356.271027 l
5943: 144.900009 357.231018 l
5944: 143.819992 356.271027 l
5945: 140.580002 355.671021 l
5946: 136.259995 354.891022 l
5947: 131.940002 354.831024 l
5948: 127.619995 355.19101 l
5949: 123.300003 354.711029 l
5950: 118.979996 355.131012 l
5951: 114.659996 354.951019 l
5952: 110.339996 355.19101 l
5953: 106.019997 354.891022 l
5954: 101.700005 354.831024 l
5955: 97.379997 354.831024 l
5956: 93.119995 354.771027 l
5957: 88.800003 354.831024 l
5958: 84.479996 354.771027 l
5959: 75.839996 354.771027 l
5960: 71.519997 354.831024 l
5961: 67.200005 354.771027 l
5962: 67.200005 117.891006 l
5963: 309.660004 117.891006 l
5964: h
5965: 1.0 1.0 1.0  setrgbcolor
5966: q
5967: eofill
5968: Q
5969: S
5970: n
5971: 280.800018 599.570007 m
5972: 280.800018 565.48999 l
5973: 280.679993 560.630005 l
5974: 280.679993 555.770996 l
5975: 280.800018 550.911011 l
5976: 280.800018 546.051025 l
5977: 280.679993 541.190002 l
5978: 280.800018 536.331055 l
5979: 280.679993 531.471008 l
5980: 280.679993 516.831055 l
5981: 280.5 511.971039 l
5982: 280.800018 507.111023 l
5983: 280.559998 502.25 l
5984: 280.800018 497.391022 l
5985: 280.800018 492.531036 l
5986: 280.679993 487.671021 l
5987: 280.679993 477.951019 l
5988: 280.800018 473.091034 l
5989: 280.679993 468.231018 l
5990: 280.800018 463.311035 l
5991: 280.679993 458.451019 l
5992: 280.679993 443.871033 l
5993: 280.559998 439.011017 l
5994: 280.800018 434.151031 l
5995: 280.559998 429.291016 l
5996: 280.679993 424.43103 l
5997: 280.679993 419.571014 l
5998: 280.800018 414.711029 l
5999: 280.800018 400.071014 l
6000: 280.679993 395.211029 l
6001: 280.800018 390.351013 l
6002: 280.800018 380.631012 l
6003: 280.679993 375.771027 l
6004: 280.800018 370.911011 l
6005: 280.800018 361.19101 l
6006: 278.639984 360.171021 l
6007: 274.320007 358.911011 l
6008: 270.0 358.851013 l
6009: 265.679993 358.071014 l
6010: 261.359985 358.251007 l
6011: 257.040009 358.131012 l
6012: 252.779999 357.891022 l
6013: 248.459991 357.891022 l
6014: 244.139999 357.651031 l
6015: 239.819992 357.591003 l
6016: 235.5 357.411011 l
6017: 231.179993 357.171021 l
6018: 226.860001 358.251007 l
6019: 222.539993 356.991028 l
6020: 218.220001 356.991028 l
6021: 213.900009 356.631012 l
6022: 209.580002 357.471008 l
6023: 205.440002 356.271027 l
6024: 209.580002 355.911011 l
6025: 213.900009 356.211029 l
6026: 218.220001 356.091003 l
6027: 222.539993 356.151031 l
6028: 226.860001 354.651031 l
6029: 231.179993 356.151031 l
6030: 235.5 356.091003 l
6031: 257.040009 356.091003 l
6032: 265.679993 356.211029 l
6033: 270.0 356.151031 l
6034: 274.320007 356.211029 l
6035: 278.639984 356.211029 l
6036: 282.959991 356.151031 l
6037: 287.279999 356.031006 l
6038: 291.600006 355.971008 l
6039: 295.919983 355.851013 l
6040: 300.23999 355.911011 l
6041: 304.559998 355.671021 l
6042: 308.820007 355.731018 l
6043: 313.139984 355.551025 l
6044: 317.459991 355.43103 l
6045: 321.779999 355.371002 l
6046: 334.73999 355.19101 l
6047: 339.059998 355.19101 l
6048: 347.700012 355.071014 l
6049: 352.019989 355.071014 l
6050: 356.339996 354.831024 l
6051: 360.660004 354.951019 l
6052: 364.919983 355.011017 l
6053: 369.23999 354.891022 l
6054: 373.559998 354.951019 l
6055: 382.200012 354.831024 l
6056: 386.519989 354.831024 l
6057: 390.839996 354.771027 l
6058: 408.119995 354.771027 l
6059: 412.440002 354.711029 l
6060: 425.339996 354.711029 l
6061: 429.660004 354.651031 l
6062: 433.97998 354.711029 l
6063: 464.220001 354.711029 l
6064: 468.47998 354.771027 l
6065: 485.759979 354.771027 l
6066: 490.079987 354.831024 l
6067: 494.399994 354.111023 l
6068: 494.399994 599.570007 l
6069: 280.800018 599.570007 l
6070: h
6071: q
6072: eofill
6073: Q
6074: S
6075: n
6076: 67.200005 355.251007 m
6077: 71.519997 355.251007 l
6078: 75.839996 355.19101 l
6079: 80.159996 355.251007 l
6080: 84.479996 355.251007 l
6081: 88.800003 355.311005 l
6082: 93.119995 355.251007 l
6083: 97.379997 355.371002 l
6084: 101.700005 355.311005 l
6085: 106.019997 355.43103 l
6086: 110.339996 355.731018 l
6087: 114.659996 355.43103 l
6088: 118.979996 355.671021 l
6089: 123.300003 355.19101 l
6090: 127.619995 355.731018 l
6091: 131.940002 355.371002 l
6092: 136.259995 355.43103 l
6093: 140.580002 356.211029 l
6094: 140.87999 356.271027 l
6095: 144.900009 359.871002 l
6096: 149.160004 356.331024 l
6097: 153.479996 360.291016 l
6098: 157.800003 357.051025 l
6099: 162.119995 358.731018 l
6100: 166.440002 358.131012 l
6101: 170.759995 359.091003 l
6102: 175.080002 358.491028 l
6103: 179.400009 359.031006 l
6104: 183.720001 359.151031 l
6105: 188.039993 359.571014 l
6106: 192.360001 359.811005 l
6107: 196.679993 360.111023 l
6108: 200.940002 360.351013 l
6109: 205.259995 360.531006 l
6110: 206.819992 361.19101 l
6111: 209.339996 366.051025 l
6112: 209.580002 367.131012 l
6113: 211.5 370.911011 l
6114: 210.419998 375.771027 l
6115: 209.580002 379.43103 l
6116: 209.339996 380.631012 l
6117: 208.259995 385.491028 l
6118: 207.300003 390.351013 l
6119: 206.220001 395.211029 l
6120: 205.559998 400.071014 l
6121: 205.259995 401.331024 l
6122: 204.300003 404.93103 l
6123: 203.100006 409.791016 l
6124: 202.019989 414.711029 l
6125: 201.300003 419.571014 l
6126: 200.940002 421.19101 l
6127: 200.159988 424.43103 l
6128: 199.019989 429.291016 l
6129: 197.819992 434.151031 l
6130: 197.039993 439.011017 l
6131: 196.679993 440.631012 l
6132: 195.779999 443.871033 l
6133: 194.940002 448.731018 l
6134: 193.619995 453.591034 l
6135: 192.779999 458.451019 l
6136: 192.360001 460.911011 l
6137: 191.87999 463.311035 l
6138: 190.440002 468.231018 l
6139: 189.479996 473.091034 l
6140: 188.519989 477.951019 l
6141: 188.039993 480.351013 l
6142: 187.5 482.811035 l
6143: 186.419998 487.671021 l
6144: 185.339996 492.531036 l
6145: 184.259995 497.391022 l
6146: 183.720001 499.849976 l
6147: 183.23999 502.25 l
6148: 182.100006 507.111023 l
6149: 181.559998 511.971039 l
6150: 180.0 516.831055 l
6151: 179.400009 519.291016 l
6152: 178.860001 521.75 l
6153: 178.139999 526.609985 l
6154: 176.940002 531.471008 l
6155: 175.679993 536.331055 l
6156: 175.619995 541.190002 l
6157: 175.080002 542.809998 l
6158: 173.819992 546.051025 l
6159: 172.919998 550.911011 l
6160: 171.479996 555.770996 l
6161: 171.360001 560.630005 l
6162: 170.759995 562.25 l
6163: 169.559998 565.48999 l
6164: 168.600006 570.351013 l
6165: 167.699997 575.271057 l
6166: 167.039993 580.130005 l
6167: 166.440002 582.531006 l
6168: 165.600006 584.98999 l
6169: 164.279999 589.851013 l
6170: 163.559998 594.710999 l
6171: 162.839996 599.570007 l
6172: 67.200005 599.570007 l
6173: 67.200005 355.251007 l
6174: h
6175: 0.15686 0.15686 0.15686  setrgbcolor
6176: q
6177: eofill
6178: Q
6179: 1.0 1.0 1.0  setrgbcolor
6180: S
6181: n
6182: 494.399994 352.851013 m
6183: 490.079987 353.93103 l
6184: 485.759979 353.871002 l
6185: 481.440002 353.871002 l
6186: 477.119995 353.811005 l
6187: 472.800018 353.811005 l
6188: 468.47998 353.751007 l
6189: 451.259979 353.751007 l
6190: 446.940002 353.69101 l
6191: 433.97998 353.69101 l
6192: 429.660004 353.091003 l
6193: 425.339996 353.631012 l
6194: 421.019989 353.451019 l
6195: 416.700012 353.631012 l
6196: 412.440002 353.391022 l
6197: 408.119995 353.631012 l
6198: 377.880005 353.631012 l
6199: 373.559998 353.391022 l
6200: 369.23999 353.69101 l
6201: 364.919983 353.451019 l
6202: 360.660004 353.69101 l
6203: 356.339996 353.031006 l
6204: 352.019989 353.751007 l
6205: 347.700012 353.811005 l
6206: 343.380005 353.811005 l
6207: 339.059998 353.871002 l
6208: 334.73999 353.871002 l
6209: 330.419983 353.93103 l
6210: 308.820007 354.231018 l
6211: 304.559998 354.291016 l
6212: 300.23999 354.411011 l
6213: 295.919983 354.411011 l
6214: 291.600006 354.531006 l
6215: 287.279999 354.591003 l
6216: 282.959991 354.711029 l
6217: 278.639984 354.711029 l
6218: 265.679993 354.531006 l
6219: 261.359985 354.531006 l
6220: 257.040009 354.471008 l
6221: 252.779999 354.411011 l
6222: 248.459991 354.351013 l
6223: 244.139999 354.351013 l
6224: 239.819992 354.291016 l
6225: 231.179993 354.291016 l
6226: 227.339996 351.411011 l
6227: 231.179993 348.291016 l
6228: 233.400009 346.551025 l
6229: 235.5 345.651031 l
6230: 239.819992 345.111023 l
6231: 244.139999 345.051025 l
6232: 248.459991 345.111023 l
6233: 252.300003 341.69101 l
6234: 252.779999 341.151001 l
6235: 257.040009 341.091003 l
6236: 261.359985 340.911011 l
6237: 265.679993 340.43103 l
6238: 270.0 340.371002 l
6239: 274.320007 340.371002 l
6240: 278.639984 339.231018 l
6241: 282.959991 338.871002 l
6242: 287.279999 337.43103 l
6243: 287.940002 336.831024 l
6244: 291.600006 335.451019 l
6245: 295.919983 335.511017 l
6246: 300.23999 334.851013 l
6247: 304.559998 333.111023 l
6248: 308.820007 333.171021 l
6249: 310.200012 331.971008 l
6250: 313.139984 330.831024 l
6251: 317.459991 329.571014 l
6252: 321.779999 330.471008 l
6253: 324.779999 327.111023 l
6254: 326.100006 326.391022 l
6255: 330.419983 326.031006 l
6256: 334.73999 325.851013 l
6257: 338.100006 322.251007 l
6258: 339.059998 321.171021 l
6259: 343.380005 320.991028 l
6260: 347.700012 320.991028 l
6261: 351.47998 317.391022 l
6262: 347.700012 312.531006 l
6263: 347.639984 312.531006 l
6264: 343.380005 308.091003 l
6265: 342.959991 307.671021 l
6266: 339.059998 303.951019 l
6267: 335.880005 302.751007 l
6268: 339.059998 299.871002 l
6269: 341.100006 297.891022 l
6270: 340.200012 293.031006 l
6271: 339.059998 290.631012 l
6272: 338.820007 288.171021 l
6273: 337.800018 283.311005 l
6274: 334.859985 278.451019 l
6275: 336.539978 273.591003 l
6276: 334.73999 270.891022 l
6277: 331.559998 268.731018 l
6278: 330.419983 266.751007 l
6279: 330.300018 263.871002 l
6280: 330.119995 259.009979 l
6281: 330.179993 254.151016 l
6282: 330.23999 249.231018 l
6283: 330.0 244.371017 l
6284: 330.419983 243.471008 l
6285: 334.73999 244.131012 l
6286: 334.73999 244.371017 l
6287: 334.97998 249.231018 l
6288: 339.059998 253.611008 l
6289: 343.380005 253.671005 l
6290: 347.100006 249.231018 l
6291: 347.700012 244.731018 l
6292: 348.47998 244.371017 l
6293: 352.019989 240.411011 l
6294: 353.700012 239.511017 l
6295: 356.339996 238.071014 l
6296: 360.660004 235.611008 l
6297: 362.339996 234.651016 l
6298: 364.919983 233.031006 l
6299: 369.23999 230.331009 l
6300: 370.319977 229.791016 l
6301: 373.559998 228.171005 l
6302: 377.880005 225.471008 l
6303: 378.959991 224.931015 l
6304: 382.200012 223.131012 l
6305: 386.519989 220.671005 l
6306: 387.600006 220.071014 l
6307: 390.839996 218.211014 l
6308: 395.160004 215.811005 l
6309: 396.23999 215.211014 l
6310: 399.47998 213.351013 l
6311: 403.800018 210.951004 l
6312: 404.880005 210.351013 l
6313: 408.119995 208.251007 l
6314: 412.440002 206.091003 l
6315: 413.279999 205.491013 l
6316: 416.700012 203.031006 l
6317: 421.019989 200.931015 l
6318: 421.200012 205.491013 l
6319: 425.160004 210.351013 l
6320: 425.339996 210.471008 l
6321: 429.660004 211.731003 l
6322: 430.800018 210.351013 l
6323: 432.959991 205.491013 l
6324: 429.660004 200.991013 l
6325: 425.339996 200.631012 l
6326: 422.100006 200.631012 l
6327: 425.339996 198.171005 l
6328: 429.660004 196.431015 l
6329: 430.73999 195.711014 l
6330: 433.97998 193.311005 l
6331: 437.220001 190.851013 l
6332: 438.300018 190.19101 l
6333: 442.619995 188.091003 l
6334: 445.859985 185.991013 l
6335: 446.940002 185.331009 l
6336: 451.259979 183.231003 l
6337: 454.5 181.131012 l
6338: 455.579987 180.471008 l
6339: 459.899994 177.891006 l
6340: 462.779999 176.271011 l
6341: 464.220001 175.491013 l
6342: 468.47998 173.031006 l
6343: 471.359985 171.411011 l
6344: 472.800018 170.571014 l
6345: 477.119995 168.171005 l
6346: 480.0 166.55101 l
6347: 481.440002 165.711014 l
6348: 485.759979 163.311005 l
6349: 488.639984 161.69101 l
6350: 490.079987 160.731003 l
6351: 494.399994 158.451004 l
6352: 494.399994 352.851013 l
6353: h
6354: 0.2549 0.2549 0.2549  setrgbcolor
6355: q
6356: eofill
6357: Q
6358: 1.0 1.0 1.0  setrgbcolor
6359: S
6360: n
6361: 494.399994 352.251007 m
6362: 490.079987 353.511017 l
6363: 477.119995 353.331024 l
6364: 472.800018 353.331024 l
6365: 468.47998 353.271027 l
6366: 464.220001 353.331024 l
6367: 459.899994 353.271027 l
6368: 455.579987 353.271027 l
6369: 451.259979 353.211029 l
6370: 442.619995 353.211029 l
6371: 438.300018 353.151031 l
6372: 433.97998 353.151031 l
6373: 429.660004 352.311005 l
6374: 425.339996 353.091003 l
6375: 421.019989 352.791016 l
6376: 416.700012 353.091003 l
6377: 412.440002 352.731018 l
6378: 408.119995 353.031006 l
6379: 377.880005 353.031006 l
6380: 373.559998 352.611023 l
6381: 369.23999 353.031006 l
6382: 364.919983 352.671021 l
6383: 360.660004 353.091003 l
6384: 356.339996 352.071014 l
6385: 352.019989 353.091003 l
6386: 347.700012 353.151031 l
6387: 343.380005 353.151031 l
6388: 339.059998 353.211029 l
6389: 334.73999 353.211029 l
6390: 330.419983 353.271027 l
6391: 326.100006 353.331024 l
6392: 321.779999 353.331024 l
6393: 308.820007 353.511017 l
6394: 304.559998 353.571014 l
6395: 300.23999 353.69101 l
6396: 295.919983 353.69101 l
6397: 291.600006 353.751007 l
6398: 287.279999 353.871002 l
6399: 282.959991 353.93103 l
6400: 278.639984 353.991028 l
6401: 274.320007 353.871002 l
6402: 270.0 353.871002 l
6403: 265.679993 353.751007 l
6404: 257.040009 353.631012 l
6405: 252.779999 353.571014 l
6406: 235.5 353.331024 l
6407: 231.179993 353.331024 l
6408: 228.600006 351.411011 l
6409: 231.179993 349.311005 l
6410: 234.720001 346.551025 l
6411: 235.5 346.251007 l
6412: 239.819992 345.651031 l
6413: 244.139999 345.591003 l
6414: 248.459991 345.651031 l
6415: 252.779999 342.171021 l
6416: 257.040009 341.991028 l
6417: 258.779999 341.69101 l
6418: 261.359985 341.571014 l
6419: 265.679993 341.031006 l
6420: 270.0 340.971008 l
6421: 274.320007 340.971008 l
6422: 278.639984 340.19101 l
6423: 282.959991 340.131012 l
6424: 287.279999 339.171021 l
6425: 289.73999 336.831024 l
6426: 291.600006 336.171021 l
6427: 295.919983 336.171021 l
6428: 300.23999 335.811005 l
6429: 304.559998 334.851013 l
6430: 308.820007 334.911011 l
6431: 312.23999 331.971008 l
6432: 313.139984 331.611023 l
6433: 317.459991 331.011017 l
6434: 320.639984 331.971008 l
6435: 321.779999 332.93103 l
6436: 322.800018 331.971008 l
6437: 326.100006 328.19101 l
6438: 328.320007 327.111023 l
6439: 330.419983 326.93103 l
6440: 334.73999 326.811005 l
6441: 338.940002 322.251007 l
6442: 339.059998 322.131012 l
6443: 343.380005 321.951019 l
6444: 347.700012 322.011017 l
6445: 352.019989 320.031006 l
6446: 355.019989 317.391022 l
6447: 352.019989 313.131012 l
6448: 351.720001 312.531006 l
6449: 352.019989 310.611023 l
6450: 356.339996 311.451019 l
6451: 360.660004 310.671021 l
6452: 364.919983 309.951019 l
6453: 373.559998 308.511017 l
6454: 377.339996 307.671021 l
6455: 377.880005 307.491028 l
6456: 382.200012 307.071014 l
6457: 386.519989 306.231018 l
6458: 390.839996 305.451019 l
6459: 395.160004 304.671021 l
6460: 399.47998 304.19101 l
6461: 403.380005 302.751007 l
6462: 402.600006 297.891022 l
6463: 403.800018 296.991028 l
6464: 405.179993 297.891022 l
6465: 408.119995 302.631012 l
6466: 412.440002 301.851013 l
6467: 416.700012 301.011017 l
6468: 421.019989 300.351013 l
6469: 425.339996 299.511017 l
6470: 429.660004 298.911011 l
6471: 433.97998 298.251007 l
6472: 435.720001 297.891022 l
6473: 438.300018 297.351013 l
6474: 446.940002 295.911011 l
6475: 451.259979 295.19101 l
6476: 459.899994 293.751007 l
6477: 463.319977 293.031006 l
6478: 464.220001 292.851013 l
6479: 468.47998 292.251007 l
6480: 481.440002 289.911011 l
6481: 485.759979 289.371002 l
6482: 490.079987 288.591003 l
6483: 492.959991 288.171021 l
6484: 494.399994 287.931 l
6485: 494.399994 352.251007 l
6486: h
6487: 0.35294 0.35294 0.35294  setrgbcolor
6488: q
6489: eofill
6490: Q
6491: 0.058824 0.058824 0.058824  setrgbcolor
6492: S
6493: n
6494: 494.399994 351.651031 m
6495: 490.079987 353.031006 l
6496: 485.759979 352.971008 l
6497: 481.440002 352.971008 l
6498: 477.119995 352.851013 l
6499: 472.800018 352.911011 l
6500: 468.47998 352.791016 l
6501: 464.220001 352.851013 l
6502: 455.579987 352.731018 l
6503: 451.259979 352.731018 l
6504: 446.940002 352.671021 l
6505: 442.619995 352.671021 l
6506: 438.300018 352.611023 l
6507: 433.97998 352.611023 l
6508: 429.660004 351.471008 l
6509: 425.339996 352.551025 l
6510: 421.019989 352.19101 l
6511: 416.700012 352.551025 l
6512: 412.440002 352.071014 l
6513: 408.119995 352.491028 l
6514: 403.800018 352.491028 l
6515: 399.47998 352.43103 l
6516: 377.880005 352.43103 l
6517: 373.559998 351.831024 l
6518: 369.23999 352.43103 l
6519: 364.919983 351.951019 l
6520: 360.660004 352.43103 l
6521: 356.940002 351.411011 l
6522: 356.339996 350.571014 l
6523: 355.679993 351.411011 l
6524: 352.019989 352.491028 l
6525: 343.380005 352.491028 l
6526: 339.059998 352.551025 l
6527: 334.73999 352.551025 l
6528: 330.419983 352.611023 l
6529: 326.100006 352.611023 l
6530: 313.139984 352.791016 l
6531: 308.820007 352.731018 l
6532: 304.559998 352.851013 l
6533: 300.23999 352.911011 l
6534: 295.919983 353.031006 l
6535: 291.600006 353.031006 l
6536: 287.279999 353.151031 l
6537: 282.959991 353.211029 l
6538: 278.639984 353.211029 l
6539: 270.0 353.091003 l
6540: 265.679993 352.911011 l
6541: 261.359985 352.911011 l
6542: 257.040009 352.851013 l
6543: 252.779999 352.731018 l
6544: 248.459991 352.671021 l
6545: 244.139999 352.551025 l
6546: 239.819992 352.551025 l
6547: 235.5 352.43103 l
6548: 231.179993 352.371002 l
6549: 229.860001 351.411011 l
6550: 231.179993 350.391022 l
6551: 235.5 347.93103 l
6552: 237.179993 346.551025 l
6553: 239.819992 346.19101 l
6554: 244.139999 346.131012 l
6555: 248.459991 346.19101 l
6556: 252.779999 344.511017 l
6557: 257.040009 344.391022 l
6558: 261.359985 343.971008 l
6559: 265.5 341.69101 l
6560: 265.679993 341.69101 l
6561: 270.0 341.571014 l
6562: 274.320007 341.631012 l
6563: 278.639984 341.211029 l
6564: 282.959991 341.391022 l
6565: 287.279999 340.911011 l
6566: 291.600006 336.831024 l
6567: 295.919983 336.831024 l
6568: 300.23999 336.771027 l
6569: 304.559998 336.591003 l
6570: 308.820007 336.651001 l
6571: 312.899994 336.831024 l
6572: 313.139984 336.891022 l
6573: 313.800018 336.831024 l
6574: 317.459991 336.231018 l
6575: 321.779999 336.711029 l
6576: 326.100006 335.511017 l
6577: 330.419983 335.991028 l
6578: 334.73999 334.911011 l
6579: 339.059998 334.971008 l
6580: 343.380005 334.671021 l
6581: 347.700012 334.371002 l
6582: 352.019989 334.071014 l
6583: 356.339996 333.771027 l
6584: 360.660004 333.411011 l
6585: 364.919983 333.171021 l
6586: 369.23999 332.871002 l
6587: 373.559998 332.571014 l
6588: 377.880005 332.331024 l
6589: 382.200012 332.091003 l
6590: 386.519989 331.731018 l
6591: 390.839996 331.43103 l
6592: 399.47998 330.711029 l
6593: 408.119995 330.111023 l
6594: 412.440002 329.871002 l
6595: 416.700012 329.451019 l
6596: 421.019989 329.211029 l
6597: 425.339996 328.851013 l
6598: 429.660004 328.551025 l
6599: 433.97998 328.251007 l
6600: 438.300018 327.951019 l
6601: 442.619995 327.711029 l
6602: 446.940002 327.411011 l
6603: 451.259979 327.171021 l
6604: 452.100006 327.111023 l
6605: 455.579987 326.811005 l
6606: 459.899994 326.451019 l
6607: 464.220001 326.151001 l
6608: 468.47998 325.791016 l
6609: 472.800018 325.491028 l
6610: 477.119995 325.19101 l
6611: 481.440002 324.831024 l
6612: 490.079987 324.231018 l
6613: 494.399994 324.231018 l
6614: 494.399994 351.651031 l
6615: h
6616: 0.44706 0.44706 0.44706  setrgbcolor
6617: q
6618: eofill
6619: Q
6620: 0.15686 0.15686 0.15686  setrgbcolor
6621: S
6622: n
6623: 494.399994 348.531006 m
6624: 493.559998 351.411011 l
6625: 490.079987 352.611023 l
6626: 481.440002 352.491028 l
6627: 477.119995 352.371002 l
6628: 472.800018 352.43103 l
6629: 468.47998 352.251007 l
6630: 464.220001 352.371002 l
6631: 455.579987 352.251007 l
6632: 451.259979 352.251007 l
6633: 446.940002 352.19101 l
6634: 442.619995 352.19101 l
6635: 433.97998 352.071014 l
6636: 431.459991 351.411011 l
6637: 429.660004 348.771027 l
6638: 427.73999 351.411011 l
6639: 425.339996 352.011017 l
6640: 421.019989 351.531006 l
6641: 416.700012 351.951019 l
6642: 412.73999 351.411011 l
6643: 412.440002 350.93103 l
6644: 412.019989 351.411011 l
6645: 408.119995 351.951019 l
6646: 403.800018 351.891022 l
6647: 395.160004 351.891022 l
6648: 390.839996 351.831024 l
6649: 377.880005 351.831024 l
6650: 375.359985 351.411011 l
6651: 373.559998 349.311005 l
6652: 371.759979 351.411011 l
6653: 369.23999 351.831024 l
6654: 366.47998 351.411011 l
6655: 364.919983 349.491028 l
6656: 363.359985 351.411011 l
6657: 360.660004 351.831024 l
6658: 359.220001 351.411011 l
6659: 356.339996 347.451019 l
6660: 353.399994 351.411011 l
6661: 352.019989 351.831024 l
6662: 343.380005 351.831024 l
6663: 339.059998 351.891022 l
6664: 330.419983 351.891022 l
6665: 326.100006 351.951019 l
6666: 321.779999 351.951019 l
6667: 313.139984 352.071014 l
6668: 308.820007 352.011017 l
6669: 304.559998 352.19101 l
6670: 300.23999 352.19101 l
6671: 295.919983 352.311005 l
6672: 291.600006 352.311005 l
6673: 287.279999 352.43103 l
6674: 282.959991 352.491028 l
6675: 278.639984 352.491028 l
6676: 274.320007 352.371002 l
6677: 270.0 352.311005 l
6678: 265.679993 352.131012 l
6679: 261.359985 352.131012 l
6680: 257.040009 352.011017 l
6681: 252.779999 351.891022 l
6682: 248.459991 351.771027 l
6683: 244.139999 351.651031 l
6684: 239.819992 351.651031 l
6685: 235.5 351.471008 l
6686: 231.179993 351.471008 l
6687: 231.179993 351.411011 l
6688: 235.5 351.171021 l
6689: 239.819992 349.551025 l
6690: 244.139999 348.771027 l
6691: 248.459991 348.411011 l
6692: 252.779999 347.271027 l
6693: 257.040009 347.091003 l
6694: 261.359985 346.911011 l
6695: 265.679993 346.911011 l
6696: 270.0 346.611023 l
6697: 274.320007 346.611023 l
6698: 274.73999 346.551025 l
6699: 278.639984 346.311005 l
6700: 282.959991 346.19101 l
6701: 287.279999 345.831024 l
6702: 291.600006 345.711029 l
6703: 295.919983 345.531006 l
6704: 300.23999 345.291016 l
6705: 304.559998 345.171021 l
6706: 308.820007 344.991028 l
6707: 313.139984 344.811005 l
6708: 317.459991 344.571014 l
6709: 321.779999 344.391022 l
6710: 326.100006 344.271027 l
6711: 339.059998 343.731018 l
6712: 343.380005 343.611023 l
6713: 347.700012 343.43103 l
6714: 352.019989 343.311005 l
6715: 356.339996 344.091003 l
6716: 360.660004 343.011017 l
6717: 364.919983 343.071014 l
6718: 369.23999 342.771027 l
6719: 373.559998 342.831024 l
6720: 377.880005 342.471008 l
6721: 390.839996 342.111023 l
6722: 395.160004 341.93103 l
6723: 399.47998 341.811005 l
6724: 403.800018 341.751007 l
6725: 408.119995 341.571014 l
6726: 412.440002 341.631012 l
6727: 416.700012 341.211029 l
6728: 421.019989 341.151001 l
6729: 425.339996 340.851013 l
6730: 429.660004 340.971008 l
6731: 433.97998 340.491028 l
6732: 438.300018 340.311005 l
6733: 442.619995 340.131012 l
6734: 446.940002 340.011017 l
6735: 451.259979 339.831024 l
6736: 455.579987 339.651001 l
6737: 459.899994 339.531006 l
6738: 464.220001 339.351013 l
6739: 468.47998 339.231018 l
6740: 472.800018 339.051025 l
6741: 477.119995 338.93103 l
6742: 481.440002 338.631012 l
6743: 485.759979 338.391022 l
6744: 490.079987 338.391022 l
6745: 493.919983 341.69101 l
6746: 494.399994 342.171021 l
6747: 494.399994 348.531006 l
6748: h
6749: 0.55294 0.55294 0.55294  setrgbcolor
6750: q
6751: eofill
6752: Q
6753: 0.2549 0.2549 0.2549  setrgbcolor
6754: S
6755: n
6756: 67.200005 355.671021 m
6757: 84.479996 355.671021 l
6758: 88.800003 355.791016 l
6759: 93.119995 355.731018 l
6760: 97.379997 355.851013 l
6761: 101.700005 355.791016 l
6762: 106.019997 355.971008 l
6763: 110.339996 356.211029 l
6764: 114.659996 355.971008 l
6765: 118.979996 356.151031 l
6766: 123.300003 355.731018 l
6767: 127.619995 356.211029 l
6768: 131.940002 355.911011 l
6769: 136.259995 355.971008 l
6770: 138.059998 356.271027 l
6771: 140.580002 360.891022 l
6772: 141.0 361.19101 l
6773: 140.580002 363.771027 l
6774: 136.259995 365.871002 l
6775: 135.959991 366.051025 l
6776: 131.940002 368.151031 l
6777: 127.619995 370.251007 l
6778: 126.18 370.911011 l
6779: 123.300003 372.651031 l
6780: 118.979996 375.351013 l
6781: 118.200005 375.771027 l
6782: 114.659996 377.871033 l
6783: 110.339996 380.211029 l
6784: 109.5 380.631012 l
6785: 106.019997 382.791016 l
6786: 101.700005 385.011017 l
6787: 100.860001 385.491028 l
6788: 97.379997 387.771027 l
6789: 93.119995 390.051025 l
6790: 92.579994 390.351013 l
6791: 88.800003 392.631012 l
6792: 84.479996 394.911011 l
6793: 83.939995 395.211029 l
6794: 80.159996 397.671021 l
6795: 76.379997 400.071014 l
6796: 75.839996 400.43103 l
6797: 71.519997 402.531006 l
6798: 67.739998 404.93103 l
6799: 67.200005 405.351013 l
6800: 67.200005 355.671021 l
6801: h
6802: q
6803: eofill
6804: Q
6805: 1.0 1.0 1.0  setrgbcolor
6806: S
6807: n
6808: 67.200005 356.091003 m
6809: 71.519997 356.151031 l
6810: 75.839996 356.091003 l
6811: 80.159996 356.151031 l
6812: 84.479996 356.151031 l
6813: 88.800003 356.271027 l
6814: 93.119995 356.211029 l
6815: 95.400002 356.271027 l
6816: 93.119995 358.071014 l
6817: 88.800003 357.111023 l
6818: 84.479996 359.151031 l
6819: 80.159996 359.69101 l
6820: 75.839996 360.171021 l
6821: 71.519997 360.471008 l
6822: 67.200005 361.071014 l
6823: 67.200005 356.091003 l
6824: h
6825: 0.35294 0.35294 0.35294  setrgbcolor
6826: q
6827: eofill
6828: Q
6829: 0.058824 0.058824 0.058824  setrgbcolor
6830: S
6831: n
6832: 490.079987 345.411011 m
6833: 491.220001 346.551025 l
6834: 492.23999 351.411011 l
6835: 490.079987 352.19101 l
6836: 481.440002 352.071014 l
6837: 477.119995 351.951019 l
6838: 472.800018 351.951019 l
6839: 468.47998 351.771027 l
6840: 464.220001 351.891022 l
6841: 459.899994 351.831024 l
6842: 455.579987 351.771027 l
6843: 451.259979 351.711029 l
6844: 446.940002 351.711029 l
6845: 438.300018 351.591003 l
6846: 433.97998 351.591003 l
6847: 433.5 351.411011 l
6848: 433.97998 346.911011 l
6849: 436.859985 346.551025 l
6850: 438.300018 346.491028 l
6851: 442.619995 346.371002 l
6852: 446.940002 346.311005 l
6853: 451.259979 346.19101 l
6854: 455.579987 346.131012 l
6855: 459.899994 346.011017 l
6856: 464.220001 346.011017 l
6857: 468.47998 346.19101 l
6858: 472.800018 345.771027 l
6859: 477.119995 345.831024 l
6860: 481.440002 345.591003 l
6861: 485.759979 345.471008 l
6862: 490.079987 345.411011 l
6863: h
6864: 0.64706 0.64706 0.64706  setrgbcolor
6865: q
6866: eofill
6867: Q
6868: 0.35294 0.35294 0.35294  setrgbcolor
6869: S
6870: n
6871: 222.539993 345.951019 m
6872: 223.559998 346.551025 l
6873: 226.37999 351.411011 l
6874: 222.539993 354.171021 l
6875: 218.220001 353.69101 l
6876: 213.900009 354.111023 l
6877: 209.580002 352.611023 l
6878: 205.259995 353.93103 l
6879: 200.940002 354.051025 l
6880: 196.679993 354.051025 l
6881: 192.360001 353.991028 l
6882: 188.039993 352.911011 l
6883: 187.679993 351.411011 l
6884: 188.039993 350.991028 l
6885: 192.360001 350.271027 l
6886: 196.679993 350.211029 l
6887: 200.940002 350.211029 l
6888: 205.259995 350.331024 l
6889: 209.580002 350.991028 l
6890: 213.900009 350.091003 l
6891: 217.860001 346.551025 l
6892: 218.220001 346.131012 l
6893: 222.539993 345.951019 l
6894: h
6895: 0.2549 0.2549 0.2549  setrgbcolor
6896: q
6897: eofill
6898: Q
6899: 1.0 1.0 1.0  setrgbcolor
6900: S
6901: n
6902: 222.539993 346.551025 m
6903: 225.0 351.411011 l
6904: 222.539993 353.211029 l
6905: 218.220001 352.491028 l
6906: 213.900009 353.091003 l
6907: 210.300003 351.411011 l
6908: 213.900009 350.631012 l
6909: 218.220001 347.871002 l
6910: 222.479996 346.551025 l
6911: 222.539993 346.551025 l
6912: h
6913: 0.35294 0.35294 0.35294  setrgbcolor
6914: q
6915: eofill
6916: Q
6917: 0.058824 0.058824 0.058824  setrgbcolor
6918: S
6919: n
6920: 304.559998 351.111023 m
6921: 305.399994 351.411011 l
6922: 304.559998 351.471008 l
6923: 300.23999 351.471008 l
6924: 295.919983 351.591003 l
6925: 291.600006 351.531006 l
6926: 287.279999 351.711029 l
6927: 278.639984 351.711029 l
6928: 274.320007 351.591003 l
6929: 270.0 351.531006 l
6930: 268.139984 351.411011 l
6931: 270.0 350.871002 l
6932: 274.320007 350.631012 l
6933: 278.639984 349.971008 l
6934: 282.959991 350.031006 l
6935: 287.279999 349.971008 l
6936: 291.600006 350.631012 l
6937: 295.919983 350.451019 l
6938: 300.23999 351.291016 l
6939: 304.559998 351.111023 l
6940: h
6941: 0.64706 0.64706 0.64706  setrgbcolor
6942: q
6943: eofill
6944: Q
6945: 0.35294 0.35294 0.35294  setrgbcolor
6946: S
6947: n
6948: 205.259995 350.871002 m
6949: 208.679993 351.411011 l
6950: 205.259995 352.731018 l
6951: 200.940002 352.911011 l
6952: 196.679993 352.911011 l
6953: 192.360001 352.791016 l
6954: 188.759995 351.411011 l
6955: 192.360001 350.811005 l
6956: 196.679993 350.751007 l
6957: 200.940002 350.751007 l
6958: 205.259995 350.871002 l
6959: h
6960: q
6961: eofill
6962: Q
6963: 0.058824 0.058824 0.058824  setrgbcolor
6964: S
6965: n
6966: 490.079987 349.19101 m
6967: 490.97998 351.411011 l
6968: 490.079987 351.711029 l
6969: 481.440002 351.591003 l
6970: 477.119995 351.471008 l
6971: 472.800018 351.531006 l
6972: 471.359985 351.411011 l
6973: 472.800018 350.69101 l
6974: 477.119995 351.231018 l
6975: 481.440002 349.911011 l
6976: 485.759979 349.551025 l
6977: 490.079987 349.19101 l
6978: h
6979: 0.74902 0.74902 0.74902  setrgbcolor
6980: q
6981: eofill
6982: Q
6983: 0.44706 0.44706 0.44706  setrgbcolor
6984: S
6985: n
6986: 226.860001 360.531006 m
6987: 229.199997 361.19101 l
6988: 228.0 366.051025 l
6989: 226.860001 367.551025 l
6990: 225.059998 366.051025 l
6991: 223.800003 361.19101 l
6992: 226.860001 360.531006 l
6993: h
6994: 0.15686 0.15686 0.15686  setrgbcolor
6995: q
6996: eofill
6997: Q
6998: 1.0 1.0 1.0  setrgbcolor
6999: S
7000: n
7001: 218.220001 361.071014 m
7002: 218.940002 361.19101 l
7003: 218.220001 362.871002 l
7004: 213.900009 364.791016 l
7005: 213.600006 361.19101 l
7006: 213.900009 361.071014 l
7007: 218.220001 361.071014 l
7008: h
7009: 0.15686 0.15686 0.15686  setrgbcolor
7010: q
7011: eofill
7012: Q
7013: 1.0 1.0 1.0  setrgbcolor
7014: S
7015: n
7016: 222.539993 349.251007 m
7017: 223.619995 351.411011 l
7018: 222.539993 352.251007 l
7019: 218.819992 351.411011 l
7020: 222.539993 349.251007 l
7021: h
7022: 0.44706 0.44706 0.44706  setrgbcolor
7023: q
7024: eofill
7025: Q
7026: 0.15686 0.15686 0.15686  setrgbcolor
7027: S
7028: n
7029: 162.119995 360.831024 m
7030: 163.679993 361.19101 l
7031: 162.119995 364.311005 l
7032: 159.959991 361.19101 l
7033: 162.119995 360.831024 l
7034: h
7035: 0.2549 0.2549 0.2549  setrgbcolor
7036: q
7037: eofill
7038: Q
7039: 1.0 1.0 1.0  setrgbcolor
7040: S
7041: n
7042: 205.259995 351.411011 m
7043: 205.559998 351.411011 l
7044: 205.259995 351.531006 l
7045: 200.940002 351.771027 l
7046: 196.679993 351.771027 l
7047: 192.360001 351.591003 l
7048: 191.940002 351.411011 l
7049: 192.360001 351.351013 l
7050: 196.679993 351.291016 l
7051: 200.940002 351.291016 l
7052: 205.259995 351.411011 l
7053: h
7054: 0.44706 0.44706 0.44706  setrgbcolor
7055: q
7056: eofill
7057: Q
7058: 0.15686 0.15686 0.15686  setrgbcolor
7059: S
7060: n
7061: 170.759995 360.951019 m
7062: 171.779999 361.19101 l
7063: 170.759995 364.311005 l
7064: 169.440002 361.19101 l
7065: 170.759995 360.951019 l
7066: h
7067: 0.2549 0.2549 0.2549  setrgbcolor
7068: q
7069: eofill
7070: Q
7071: 1.0 1.0 1.0  setrgbcolor
7072: S
7073: n
7074: 213.900009 351.171021 m
7075: 217.440002 351.411011 l
7076: 213.900009 352.011017 l
7077: 212.580002 351.411011 l
7078: 213.900009 351.171021 l
7079: h
7080: 0.44706 0.44706 0.44706  setrgbcolor
7081: q
7082: eofill
7083: Q
7084: 0.15686 0.15686 0.15686  setrgbcolor
7085: S
7086: n
7087: 425.339996 204.591003 m
7088: 426.300018 205.491013 l
7089: 425.339996 206.331009 l
7090: 424.619995 205.491013 l
7091: 425.339996 204.591003 l
7092: h
7093: 0.058824 0.058824 0.058824  setrgbcolor
7094: q
7095: eofill
7096: Q
7097: 0.0 0.0 0.0  setrgbcolor
7098: S
7099: n
7100: 425.339996 348.111023 m
7101: 425.579987 351.411011 l
7102: 425.339996 351.471008 l
7103: 424.859985 351.411011 l
7104: 425.339996 348.111023 l
7105: h
7106: 0.64706 0.64706 0.64706  setrgbcolor
7107: q
7108: eofill
7109: Q
7110: 0.35294 0.35294 0.35294  setrgbcolor
7111: S
7112: n
7113: 123.300003 356.211029 m
7114: 123.779999 356.271027 l
7115: 123.300003 356.93103 l
7116: 122.759995 356.271027 l
7117: 123.300003 356.211029 l
7118: h
7119: q
7120: eofill
7121: Q
7122: 0.058824 0.058824 0.058824  setrgbcolor
7123: S
7124: n
7125: 101.700005 356.271027 m
7126: 102.18 356.271027 l
7127: 101.700005 356.751007 l
7128: 100.800003 356.271027 l
7129: 101.700005 356.271027 l
7130: h
7131: 0.35294 0.35294 0.35294  setrgbcolor
7132: q
7133: eofill
7134: Q
7135: 0.058824 0.058824 0.058824  setrgbcolor
7136: S
7137: 0.0 0.0 0.0  setrgbcolor
7138: 521.400024 105.890503 m
7139: %ADOBeginSubsetFont: NHCKJC+ArialMT AddGlyphs
7140: ct_T42Dict begin
7141: systemdict /gcheck known {currentglobal NHCKJC+ArialMT gcheck setglobal} if
7142: 1 108 16 <0001004101b8026a026d0003002c401970027003024d014d020201230002
7143: 1a05700001001904708d182b4e10e45d10e6002f4ded31300071015d1335
7144: 211541022901b8b5b500>NHCKJC+ArialMT AddT42Char 
7145: 1 606 20 <000100df000002fb05c0000a008c402003400d11346b047f028f02990804
7146: ac04010900060502030905010c0201ca0a00b8ffc0400a21233430000120
7147: 000100b8fff040190f0f065500100c0c065500100d0d0655001a0c05400d
7148: 0f3405b8ffc0400e212334300501200540050205190bba013c018500182b
7149: 4e10e45d712b2b10f62b2b2b5d712b3c4dfd3c003f3f1739011139313001
7150: 5d005d2b212311060607353636373302fbb441d35497e22f74047b3e7c1f
7151: ae47ca5f>NHCKJC+ArialMT AddT42Char 
7152: 1 238 19 <00020055ffe7041105c00010001d010ab10602435458400a1a1e0405141e
7153: 0d0d1709b8fff4b40f0f065509b8ffe6b40d0d065509b8ffee40190b0b06
7154: 55091100100d0d065500100c0c065500100b0b0655002f2b2b2bcd2f2b2b
7155: 2bcd003fed3fed31301bb4062019101cb8fff0b202200bbeffe00016ffe0
7156: 0012ffe0000fffe0406204068702880b880fc90e0509070b180245134c15
7157: 4a19431b54135c155c19521b6b076b0b63136c156b19601b79027706760b
7158: 7a0f870698079610c918da02d606d60bdb0f1a1a1e0405141e0d0d177309
7159: 40212334300901000910090209901f117300b8ffc0400e21233420004000
7160: 0200901ec78b182b10f65d2bed10f65d712bed003fed3fed3130015d7100
7161: 5d0038383838380138383859131012363332161612151002062322272613
7162: 101633323611102623220706556bd3a076b274426ad3a1d47991b9a97c7c
7163: a9a97e7c4a5d02d30104013dac5fb3feffdafefefec3ad98b7019dfe97ef
7164: f00168016aee6986>NHCKJC+ArialMT AddT42Char 
7165: 1 2870 27 <00030053ffe7041905c0001700230030015db10602435458b71e090c0c0c
7166: 065509b8fff4b60d0d0655092b0fb8ffe4b40f0f06550fb8ffe4b60d0d06
7167: 550f1803b8fff0b40f0f065503b8fffc40220d0d06550324150c0c0c0655
7168: 150c0d0d0655150c001b1e2e2e12211e0605281e120d003fed3fed12392f
7169: ed3939012f2b2bcd2f2b2bcd2f2b2bcd2f2b2bcd31301b40373516012916
7170: 49164926e60ce930050930017d007d017c047408710b720c750d7a178b00
7171: 8a018c048608810b840c860d8d17cc11c6131222b8ffe0b21c201ab8ffe0
7172: b220202fb8ffe0b22d2026b8ffe0401e29200c001e18000c1b1e2ea02e01
7173: 2e12211e0605281e120d1e73bf090109b8026740102b730f40202334300f
7174: 01000f100f020fb80191b6321873b0030103b80267b2247315b8ffc0400e
7175: 2123342015401502159031c78b182b10f65d2bedf45ded10f45d712bedf4
7176: 5ded003fed3fed12395d2fed393901111239393130013838383838383838
7177: 015d72710071590126263534363332161514060716161514002322003534
7178: 3613141633323635342623220603141616333236353426232206016a706c
7179: e6bfc0ea6b6d878dfef6d9d9fef69162866b6885896667883a49905381a8
7180: ad827fa7031b29986aa0dadfa06697292cc488bcff000101c08fc1015468
7181: 84835f638784fcff4d904fa68082aaa8>NHCKJC+ArialMT AddT42Char 
7182: 1 2326 25 <0002004dffe7041505c0001d002a00ed402d6b190144074015441944205a
7183: 1254206b03640764086a1264207408751c8508861cd608d4161107200d0d
7184: 065527b8ffe0b40d0d065523b8ffe0400b0d0d065521200d0d065507b8ff
7185: e0b42720232021b8ffe04011281e400d500d020d0d141b01d35f000100b8
7186: 02684009051e1b05221e140d01b80138401200b525731040212334301001
7187: 001010100210b8fff0b70c0c065510902c0aba0138001e013940163f175f
7188: 176f177f170417160c0c065517160d0d065517b80224b32bc78b182b10f6
7189: 2b2b5deded10f62b5d712bedf4ed003fed3fedfd5de41112392f5ded3130
7190: 01383838382b2b2b2b015d005d0107262726232207060607363633321215
7191: 140606232200111037363332160114161633323635342623220603fbb318
7192: 2c496b564155620241bc67b4fd77d084e1fee49d89e8adddfd374f8e4e72
7193: a4a27b7aaa04530e6a304d303eeedc6360fef7d28aed7e014b017c01a9c1
7194: a8c2fcdd5daa59b89e98afaf>NHCKJC+ArialMT AddT42Char 
7195: 1 1646 23 <0002001a0000041005ba000a000d0108403612580c680c9a0ca90cc90c05
7196: 4c034c0d94040312010208000c060307050a0b0307000c0c0d0dca030414
7197: 030304030d00020c0d040703bb02bb0008000201a0400a000404000c0c00
7198: ca0a04b80266b705050a401d1f340ab8ffeeb40d0d06550ab80137400d07
7199: 402223340780213507900f02b8ffc0400b0d14340002100220020302b8ff
7200: e4b60d0d065502b50eb8018cb18b182b10ec2b5d2b10f62b2bf42b2b3c10
7201: e610fd3c003f3f10f43cf63c1139390111123939872e2b047d10c40f0f0f
7202: 313001435c58b9000dffdeb212390db8ffd4400b333903222d3903041d1d
7203: 3c2b2b2b2b595d005d435c5840140c400b390c8050390c4026390c221c39
7204: 0c402d392b2b2b2b2b5921112135013311331523110311010296fd84029d
7205: 93c6c6b4fe35015fa503b6fc4aa5fea102040295fd6b>NHCKJC+ArialMT AddT42Char 
7206: 1 790 21 <0001003c0000040705c0001e018eb10602435458400911100d1813130655
7207: 0db8fff4b4111106550db8ffee4009101006550d1e14051eb8ffe8401713
7208: 1306551e1e111106551e1c0e1006551e0c0d0d06551eb802bb400c020a17
7209: 17201f10110202201f1112392fd4cd1112392fcd002fed2b2b2b2b3fed2b
7210: 2b2bc43231301bb10202435458b611100d1e14051eb802bb400c020a1717
7211: 201f10110202201f1112392fd4cd1112392fcd002fed3fedc43231301b40
7212: 363b053b06bb05bf06bb07c708c91c07490c590c540e6b0c640e7a127a13
7213: 8912bc12e51ae51bf01a0cbf0bb713021b101c101d101e1006befff00007
7214: ffe00008fff00009fff0401a1e0a10080606ca1c1a141c1c1a081c1a0301
7215: 02081a1c030d1e10b802a4b34f110111b80118b50d1e1405001eb802bb40
7216: 0f01020c0a7317d30000014021233401bb0281002000100138400c11b53f
7217: 025f026f027f020402ba0224001f018fb18b182b10f65df4ed10f62b3c10
7218: f4ed003f3cfd3c3fedfd5de4111217390111121739870e2e2b0e7d10c401
7219: 111239313000383838380138383838005d015d7259592515212637363637
7220: 36363534262322060727363633321615140606070606070407fc37021725
7221: a39aefa8997b829c01b913f8d1d3f648a7c2a25c1eadad413c63c07ec4e5
7222: 666b939c8a13cfd9eaad58aabca488613100>NHCKJC+ArialMT AddT42Char 
7223: 1 0 0 <00020100000005000500000300070042b40201e40607b802994013000504
7224: e403000a0704e4010019080605e40203bc023100090199012e00182b10f6
7225: 3cfd3c4e10f43c4dfd3c003f3cfd3c10fc3cfd3c31302111211125211121
7226: 01000400fc2003c0fc400500fb002004c000>NHCKJC+ArialMT AddT42Char 
7227: NHCKJC+ArialMT /CharStrings get begin
7228: /hyphen 16 def
7229: /one 20 def
7230: /zero 19 def
7231: /eight 27 def
7232: /six 25 def
7233: /four 23 def
7234: /two 21 def
7235: end
7236: NHCKJC+ArialMT /Encoding get
7237: dup 45 /hyphen put
7238: dup 49 /one put
7239: dup 48 /zero put
7240: dup 56 /eight put
7241: dup 54 /six put
7242: dup 52 /four put
7243: dup 50 /two put
7244: pop
7245: systemdict /gcheck known {setglobal} if
7246: end
7247: %ADOEndSubsetFont
7248: /N22 [0.0 16.5952 -16.5952 0.0 0.0 0.0] Tf
7249: (-10-8-6-4-20246810)
7250: [5.519439 9.236882 38.037853 5.519439 42.657959 5.519439 42.598213 5.519439 42.657959 5.519439 45.417736 
7251: 48.165905 48.165905 48.165905 48.165905 43.557419 9.236882 48.165905 ] pdfys
7252: 499.620483 79.970459 m
7253: %ADOBeginSubsetFont: NHCKJC+ArialMT AddGlyphs
7254: ct_T42Dict begin
7255: systemdict /gcheck known {currentglobal NHCKJC+ArialMT gcheck setglobal} if
7256: systemdict /gcheck known {setglobal} if
7257: end
7258: %ADOEndSubsetFont
7259: (-10) show
7260: 456.901123 89.210663 m
7261: %ADOBeginSubsetFont: NHCKJC+ArialMT AddGlyphs
7262: ct_T42Dict begin
7263: systemdict /gcheck known {currentglobal NHCKJC+ArialMT gcheck setglobal} if
7264: systemdict /gcheck known {setglobal} if
7265: end
7266: %ADOEndSubsetFont
7267: (-8)
7268: [5.51944 9.220288 ] pdfys
7269: 414.181763 89.210663 m
7270: %ADOBeginSubsetFont: NHCKJC+ArialMT AddGlyphs
7271: ct_T42Dict begin
7272: systemdict /gcheck known {currentglobal NHCKJC+ArialMT gcheck setglobal} if
7273: systemdict /gcheck known {setglobal} if
7274: end
7275: %ADOEndSubsetFont
7276: (-6)
7277: [5.51944 9.220288 ] pdfys
7278: 371.462402 89.210663 m
7279: %ADOBeginSubsetFont: NHCKJC+ArialMT AddGlyphs
7280: ct_T42Dict begin
7281: systemdict /gcheck known {currentglobal NHCKJC+ArialMT gcheck setglobal} if
7282: systemdict /gcheck known {setglobal} if
7283: end
7284: %ADOEndSubsetFont
7285: (-4)
7286: [5.51944 9.220288 ] pdfys
7287: 328.743042 89.210663 m
7288: %ADOBeginSubsetFont: NHCKJC+ArialMT AddGlyphs
7289: ct_T42Dict begin
7290: systemdict /gcheck known {currentglobal NHCKJC+ArialMT gcheck setglobal} if
7291: systemdict /gcheck known {setglobal} if
7292: end
7293: %ADOEndSubsetFont
7294: (-2)
7295: [5.51944 9.220288 ] pdfys
7296: 286.023682 94.730225 m
7297: %ADOBeginSubsetFont: NHCKJC+ArialMT AddGlyphs
7298: ct_T42Dict begin
7299: systemdict /gcheck known {currentglobal NHCKJC+ArialMT gcheck setglobal} if
7300: systemdict /gcheck known {setglobal} if
7301: end
7302: %ADOEndSubsetFont
7303: (0) show
7304: 243.304321 94.730225 m
7305: %ADOBeginSubsetFont: NHCKJC+ArialMT AddGlyphs
7306: ct_T42Dict begin
7307: systemdict /gcheck known {currentglobal NHCKJC+ArialMT gcheck setglobal} if
7308: systemdict /gcheck known {setglobal} if
7309: end
7310: %ADOEndSubsetFont
7311: (2) show
7312: 200.584961 94.730225 m
7313: %ADOBeginSubsetFont: NHCKJC+ArialMT AddGlyphs
7314: ct_T42Dict begin
7315: systemdict /gcheck known {currentglobal NHCKJC+ArialMT gcheck setglobal} if
7316: systemdict /gcheck known {setglobal} if
7317: end
7318: %ADOEndSubsetFont
7319: (4) show
7320: 157.865601 94.730225 m
7321: %ADOBeginSubsetFont: NHCKJC+ArialMT AddGlyphs
7322: ct_T42Dict begin
7323: systemdict /gcheck known {currentglobal NHCKJC+ArialMT gcheck setglobal} if
7324: systemdict /gcheck known {setglobal} if
7325: end
7326: %ADOEndSubsetFont
7327: (6) show
7328: 115.14624 94.730225 m
7329: %ADOBeginSubsetFont: NHCKJC+ArialMT AddGlyphs
7330: ct_T42Dict begin
7331: systemdict /gcheck known {currentglobal NHCKJC+ArialMT gcheck setglobal} if
7332: systemdict /gcheck known {setglobal} if
7333: end
7334: %ADOEndSubsetFont
7335: (8) show
7336: 72.42688 85.490021 m
7337: %ADOBeginSubsetFont: NHCKJC+ArialMT AddGlyphs
7338: ct_T42Dict begin
7339: systemdict /gcheck known {currentglobal NHCKJC+ArialMT gcheck setglobal} if
7340: systemdict /gcheck known {setglobal} if
7341: end
7342: %ADOEndSubsetFont
7343: (10)
7344: [9.236884 9.236884 ] pdfys
7345: 1.56 w
7346: n
7347: 502.619995 117.891006 m
7348: 494.399994 117.891006 l
7349: 498.539978 141.951004 m
7350: 494.399994 141.951004 l
7351: 502.619995 166.071014 m
7352: 494.399994 166.071014 l
7353: 498.539978 190.131012 m
7354: 494.399994 190.131012 l
7355: 502.619995 214.251007 m
7356: 494.399994 214.251007 l
7357: 498.539978 238.311005 m
7358: 494.399994 238.311005 l
7359: 502.619995 262.371002 m
7360: 494.399994 262.371002 l
7361: 498.539978 286.491028 m
7362: 494.399994 286.491028 l
7363: 502.619995 310.551025 m
7364: 494.399994 310.551025 l
7365: 498.539978 334.671021 m
7366: 494.399994 334.671021 l
7367: 502.619995 358.731018 m
7368: 494.399994 358.731018 l
7369: 498.539978 382.791016 m
7370: 494.399994 382.791016 l
7371: 502.619995 406.911011 m
7372: 494.399994 406.911011 l
7373: 498.539978 430.971008 m
7374: 494.399994 430.971008 l
7375: 502.619995 455.091034 m
7376: 494.399994 455.091034 l
7377: 498.539978 479.151031 m
7378: 494.399994 479.151031 l
7379: 502.619995 503.211029 m
7380: 494.399994 503.211029 l
7381: 498.539978 527.331055 m
7382: 494.399994 527.331055 l
7383: 502.619995 551.391052 m
7384: 494.399994 551.391052 l
7385: 498.539978 575.51001 m
7386: 494.399994 575.51001 l
7387: 502.619995 599.570007 m
7388: 494.399994 599.570007 l
7389: 494.399994 117.891006 m
7390: 494.399994 599.570007 l
7391: 494.399994 109.671005 m
7392: 494.399994 117.891006 l
7393: 473.039978 113.751007 m
7394: 473.039978 117.891006 l
7395: 451.679993 109.671005 m
7396: 451.679993 117.891006 l
7397: 430.319977 113.751007 m
7398: 430.319977 117.891006 l
7399: 408.959991 109.671005 m
7400: 408.959991 117.891006 l
7401: 387.600006 113.751007 m
7402: 387.600006 117.891006 l
7403: 366.23999 109.671005 m
7404: 366.23999 117.891006 l
7405: 344.880005 113.751007 m
7406: 344.880005 117.891006 l
7407: 323.519989 109.671005 m
7408: 323.519989 117.891006 l
7409: 302.160004 113.751007 m
7410: 302.160004 117.891006 l
7411: 280.800018 109.671005 m
7412: 280.800018 117.891006 l
7413: 259.440002 113.751007 m
7414: 259.440002 117.891006 l
7415: 238.080002 109.671005 m
7416: 238.080002 117.891006 l
7417: 216.720001 113.751007 m
7418: 216.720001 117.891006 l
7419: 195.360001 109.671005 m
7420: 195.360001 117.891006 l
7421: 174.0 113.751007 m
7422: 174.0 117.891006 l
7423: 152.639999 109.671005 m
7424: 152.639999 117.891006 l
7425: 131.279999 113.751007 m
7426: 131.279999 117.891006 l
7427: 109.919998 109.671005 m
7428: 109.919998 117.891006 l
7429: 88.559998 113.751007 m
7430: 88.559998 117.891006 l
7431: 67.200005 109.671005 m
7432: 67.200005 117.891006 l
7433: 494.399994 117.891006 m
7434: 67.200005 117.891006 l
7435: S
7436: 550.859985 321.830505 m
7437: %ADOBeginSubsetFont: NHCKJC+ArialMT AddGlyphs
7438: ct_T42Dict begin
7439: systemdict /gcheck known {currentglobal NHCKJC+ArialMT gcheck setglobal} if
7440: 1 4384 74 <00020042fe5103ea043e001e002a012c40600b0b05142c0b25144c0b4514
7441: 06091d191d2c0b26142c23390b36144a0b46145607580b680bfa0af5150e
7442: 2e232c273e233e274c27902ca02c07362136293f2c460b46214529542154
7443: 29690763216329602c802cda27e821ee23ef271117160615b802b1b4281c
7444: 130701b802aa401020003000600070008000c000d0000700b8027d402005
7445: 1c1c0f0a45221c0c0a16153325330a251818d01701101740176017801704
7446: 17b8ffea400b0b0b065517121010065517b8ffeeb40c0c065517b8fffc40
7447: 380d0d065517740f012500221f24bf0fcf0fdf0fff0f041f0f3f0f4f0f03
7448: 0f1c0b0b06550f0c0d0d06550f1a0c0c06550f192b2c74213450182b2b4e
7449: f42b2b2b5d714dedf4ed10fd2b2b2b2b5d713c10fde4f63c003fede43fed
7450: fd5de43fede43f3c3130015d71005d711717161716333236373627062322
7451: 023534123633321735331114060623222613141633323635342623220666
7452: af0b3243747d88180e0176b0dbf06ed18dbc7aa665dba0beea99a67d7ca8
7453: ad7a78a8581a512532645a37b08b013cdd9801018c9880fc6af8cf78ab03
7454: 2ad1c0bfccc3c6c3>NHCKJC+ArialMT AddT42Char 
7455: 
7456: 1 0 3 <> NHCKJC+ArialMT AddT42Char 
7457: 1 6178 89 <0001001a000003e80426000a01b7b7350501002211390ab8ffde400d1139
7458: 0916121c340816121c3402b8ffeab3121c3401b8ffeab3121c340ab8ffd8
7459: 40091e213400281e21340ab8ffe8400922253400162225340ab8ffda407e
7460: 282e340020282e340f0c29002809260a3900350a4800470a560156025908
7461: 5809660166026908690978007701770279087809770a8701870286038907
7462: 88088a099d009809910aac00a20abd00b707b10ac900c50ada00d50aec00
7463: e30afb00f40a2c0a00050a1800160a2800260a370a4f00400a0905401216
7464: 3405400b0d34b10602435458400905010008060106000ab8fff4400f0d0d
7465: 06550a000c0d0d065500050908b8fff440120d0d0655080501020c0d0d06
7466: 550205050c0b1112392fdd2bcd10dd2bcd10cd2bcd2b002f3f3f11123931
7467: 301b40370a07080825090a1409090a0003020225010014010100050a0a00
7468: 0a09080802020106070a09030001052f0c010c22084040400980090209b8
7469: 011bb5400580050205b8011b400920024001220bead2182b10f6ed1a19fd
7470: 5dfd5d1a18ede45d11123939123939003f3c103c103c3f3c113987052e2b
7471: 877dc4872e182b877dc4593130002b2b01715d2b2b2b2b2b2b2b2b2b2b2b
7472: 2b005d210133131617363713330101aefe6cbee4251f182becb9fe6e0426
7473: fd84676f54760288fbda>NHCKJC+ArialMT AddT42Char 
7474: 1 3366 68 <0002004affe8041c043e0028003701bf402c090d092a190d1a2a290d2a2a
7475: 390d3615371b3a2a492a5d0d5d2a6a0d692a60308a0d86299a169b1aa90d
7476: 1528b8ffe8b40b0b065527b8ffe840190b0b0655a619aa28b619bb28c419
7477: cf28d215dd28084416011eb8fff440110c0c065512120c0c0655050c0c0c
7478: 065535b8ffe0404f0c0c06551f171f182b2c2a343904392c4904482c5608
7479: 592b6608692b760c870cc90cf90df92b1137340e0104102f243417322114
7480: 185f296f2902291c2f0e3f0e8f0e9f0eff0e059f0eaf0eef0e030eb8fff4
7481: 4015101006550e0c0d0d06550e060f0f06550e0e1c0317b802aab6189514
7482: 1c1c0700b8fff440140c0c06550045270a321c030b2961106100252124b8
7483: fff4b40b0b065524b8ffdc400b1010065524060f0f065524b8fffcb40c0c
7484: 065524b8025b401027400026102620263026af2605263139b8ffc0400d1e
7485: 23343039c03902a039013917b8fff4402910100655172518222f24bf06cf
7486: 06021f063f0602060c0b0b0655060e0d0d065506100c0c065506313810f6
7487: 2b2b2b5d71edf4ed2b105d712bf65dedf42b2b2b2b3cfde5e5003fed3fe4
7488: 2b3fedfde41112392f2b2b2b5d71ed711112391112393901111217393130
7489: 005d2b2b2b2b01715d2b2b00712506062322263534363637363736373635
7490: 34272623220607273e02333216161716151514161723260306070e021514
7491: 16333236373635033c64b96aafbc477348356bda67013345887f791db018
7492: 6ed08988aa5010091722bc1c1762c46f5c326d6968a2261d835546ab854e
7493: 814e140e0d1a24250a6e2d3d597118718b4b40614a2e78f0fb853d3801dd
7494: 281c10284d2f48605b4f3d77>NHCKJC+ArialMT AddT42Char 
7495: 1 4812 79 <000100830000013705ba000300b9b90005ffc0b337383405b8ffc0b33435
7496: 3405b8ffc0b330313405b8ffc0b322253405b8ffc040251517340f051f05
7497: 9f05df05044f05df05f005031f0570058005ff05040100000a0203250100
7498: b8ffc0b337383400b8ffc040213335349f0001c000f0000200002000d000
7499: e0000400140b0b065500081010065500b8fffeb40d0d065500b8ffffb40c
7500: 0c065500b8fffc400a0c0c0655004e044750182b10f62b2b2b2b2b5d7172
7501: 2b2b3cfd3c003f3f3130015d71722b2b2b2b2b3311331183b405bafa4600
7502: >NHCKJC+ArialMT AddT42Char 
7503: 1 5830 88 <00010083ffe803e004260018010cb9001affc0400915173402201316340f
7504: b8fff040211214342b1301240813160c0113160b06000a111c030b003316
7505: 2518174033363417b8fff4400b0b0b065517141010065517b8fff8400b0d
7506: 0d0655170c0f0f065517b8fff6400d0c0c0655ff1701c01701174e1ab8ff
7507: c04015343634b01af01a02701aa01ab01aff1a041a0c2509b8ffc0401633
7508: 3634f0090100092009d009e00904090a0b0b065509b8fff640160f0f0655
7509: 09020c0c065509020d0d0655094e194750182b10f62b2b2b2b5d712bed10
7510: 5d712bf65d712b2b2b2b2b2b3cfde4003fed3f3f3c393901111239313043
7511: 79401a04100e0d0f0d0206070806080508030610040c1b000d08111b0000
7512: 2b012b2a2a81005d012b2b2b213506232226262726351133111417161633
7513: 32363635113311033f7cd55ea34f100bb40b116e51518e3bb49cb4486d4f
7514: 35730292fdb38d314751538f880239fbda00>NHCKJC+ArialMT AddT42Char 
7515: 1 3978 72 <0002004bffe8041e043e0015001d012a40171f001c150255035d055d0955
7516: 0b65036b056f09650b0815b8ffe4b40d0d065511b8ffe440520d0d06551d
7517: 1c0d0d06552712d905fa14f61a0431123a19311c41124d1a411c51125c19
7518: 521c61126d1a611c78067815f602f618100016010f0d1717501660167016
7519: 03161c0f9010a010021010041b1c0a0700ba02aa0001ffc0401010100655
7520: 1001010195131c040b17400db8ffeeb40d0d06550db8ffeab40c0c06550d
7521: b8ffc04009272a34b00d010d1a1fb8ffc0b32526341fb8ffc0402f1e2334
7522: 301f011f163310240740242a341f073f074f0703070e0b0b0655071c0c0c
7523: 065507160d0d065507191e3437182b4e10f42b2b2b5d2b4dfde44e10712b
7524: 2bf6712b2b2b4ded003fedfd5d2be43fed12392f5d3cfd713c0111123939
7525: 12393130015d005d2b2b2b01717201170606232200111000333200111407
7526: 2116163332360121262726232206035eba2ceeb9e9feef0114dcd5010e01
7527: fce80ab285638cfdda02510c3856897ca9015617a3b4011f0103010c0128
7528: fedefef91020afba680195864368a600>NHCKJC+ArialMT AddT42Char 
7529: 1 5022 86 <0001003fffe803b1043e00300298407b042214223a094a09442456226522
7530: 7c098e098424a613ab2cc2030d09171a1817304b2cd617051b0255020210
7531: 32010a185c085c095c0a5c0b5c0c5c0d6a086a096a0a6a0b6a0c6a0db426
7532: b4270f27262427242936245a0a590b64266428742374248024930a9c0c92
7533: 28972c9530a40aa90ca327a428b326c5261628b8fff4b40d0d065522b8ff
7534: f4b40d0d065523b8fff4b40d0d065524b8fff4b40d0d065528b8fff4b40c
7535: 0c065522b8fff4b40c0c065523b8fff4b40c0c065524b8fff4b40c0c0655
7536: 1db8ffde40121e395a0827250c0a041a202615040b2e1d1ab802aa401c1f
7537: 193f194f195f19af19cf19060f191f196f19df19041f198f190219bb0255
7538: 0015000002aa401010014001021001d00102000110010201b8ffc0b31416
7539: 3401b8ffc040100e113401012e5c1d6c1d021d1c150704b8ffe6b4101006
7540: 5504b8ffe6402b0f0f0655041c2e0b1f1a011a2419401318341920101006
7541: 5519200f0f065519100c0c065519160d0d065519b8025bb207242ab8ffc0
7542: b51c39d02a012ab8ffe8b40c0c06552ab8ffeab60d0d06552a1a32b8ffc0
7543: 401b272a346032c032023f3280320232100101012400100d0d06550020b8
7544: fff4b41010065520b8fff440220f0f065520240f0e0c0c06550f0c0d0d06
7545: 550f22df00013f004f00020019313437182b4e10f45d714df42b2bed2b2b
7546: 102bed724e105d712bf62b2b712b4dedf42b2b2b2b2bed72003fed2b2b3f
7547: ed7112392f2b2b5d7172e410fd5d7172e411123911123901111217393130
7548: 43794040272d1e2305142c261110121013100306220d201b000928071b01
7549: 052d071b011e14201b00210e231b0022230d0c08290a1b012827090a062b
7550: 041b001f101d1b01002b2b103c103c2b103c103c2b012b2b2b2b2a2b8181
7551: 81002b2b2b2b2b2b2b2b2b5d71015d72715d133716163332363534272627
7552: 2e023534363736363332161617072626232206151417161716171e021514
7553: 06062322263fb20f897b7c78352593c6994f41382a91537dbd5a11b00c73
7554: 697c6a16162f1b84bf975669c67dcfd9013d1c6b7265443d231825324981
7555: 4e4779281f2b487b6718525c5237231c1d130a2433417c5c5a9f57ac>NHCKJC+ArialMT AddT42Char 
7556: NHCKJC+ArialMT /CharStrings get begin
7557: /g 74 def
7558: /space 3 def
7559: /v 89 def
7560: /a 68 def
7561: /l 79 def
7562: /u 88 def
7563: /e 72 def
7564: /s 86 def
7565: end
7566: NHCKJC+ArialMT /Encoding get
7567: dup 103 /g put
7568: dup 32 /space put
7569: dup 118 /v put
7570: dup 97 /a put
7571: dup 108 /l put
7572: dup 117 /u put
7573: dup 101 /e put
7574: dup 115 /s put
7575: pop
7576: systemdict /gcheck known {setglobal} if
7577: end
7578: %ADOEndSubsetFont
7579: /N22 [0.0 18.421204 -18.421204 0.0 0.0 0.0] Tf
7580: (g values )
7581: [10.256922 5.102672 9.225339 10.256922 4.104247 10.256922 10.256922 9.225339 5.102672 ] pdfys
7582: 327.179993 66.350601 m
7583: %ADOBeginSubsetFont: NHCKKC+SymbolMT-Identity-H AddGlyphs
7584: Adobe_CoolType_Utility begin ct_MakeOCF begin ct_GlyphDirProcs begin
7585: %ADOt1write: (1.0.21)
7586: %%Copyright: Copyright 2005 Adobe System Incorporated. All rights reserved.
7587: /NHCKKC+SymbolMT 1 GetGlyphDirectory
7588: 78 <001C60D8A8C9B79676F435A8C107EC44AD4BF303B85802FA572F94ACD048
7589: 5E33727BE5267D1FF5F7B232C5A9FA1266F15F46D332E678F85563CD393BE3BC
7590: 2AF57495DE64EB585B8D1FEBF8FC129CD0D2BB554463583DC18BAA40B219A6AB
7591: 3C14C9D9C3BBAA90F5D748D53DA539B3D2048FC84D187B6431A99E69BD9CE372
7592: 1DE522D4BBEB6081FB6940E4829DF674CCE7A36B11DC6CC354AC1595F55B1597
7593: 449EE666C5BE0245489E90E43199E172C92C8149AF52CB0078D642> |
7594: !
7595: end
7596: end end
7597: %ADOEndSubsetFont
7598: /N23 -18.267899 Tf
7599: (\000N) show
7600: 317.220001 66.350601 m
7601: %ADOBeginSubsetFont: NHCKJC+ArialMT AddGlyphs
7602: ct_T42Dict begin
7603: systemdict /gcheck known {currentglobal NHCKJC+ArialMT gcheck setglobal} if
7604: systemdict /gcheck known {setglobal} if
7605: end
7606: %ADOEndSubsetFont
7607: /N22 -18.421204 Tf
7608: ( values)
7609: [-5.102672 -9.217971 -10.249554 -4.096878 -10.249554 -10.249554 -9.217971 ] pdfxs
7610: n
7611: 62.639999 603.411011 220.199997 209.700012 re
7612: 1.0 1.0 1.0  setrgbcolor
7613: f
7614: n
7615: 85.860001 623.75 18.479996 37.02002 re
7616: 0.74902 0.74902 0.74902  setrgbcolor
7617: f
7618: 0.0 0.0 0.0  setrgbcolor
7619: 100.860001 660.830505 m
7620: %ADOBeginSubsetFont: NHCKJC+ArialMT AddGlyphs
7621: ct_T42Dict begin
7622: systemdict /gcheck known {currentglobal NHCKJC+ArialMT gcheck setglobal} if
7623: 1 178 17 <000100ba0000018700cd000300254018023c000a023c5f006f007f00af00
7624: 04a0000100a004a198182b10f65d5ded003fed313033353315bacdcdcd00
7625: >NHCKJC+ArialMT AddT42Char 
7626: 1 1288 22 <00010056ffe6041605c0002b00e44028050d160d450d860d044511571176
7627: 1b0352166c106a146416750d7914860d8a14891ba50d0a052003b8ffe040
7628: 0b0b0c0d0e040701230d0c01b802a4b340000100bb01180029000d0135b4
7629: 0c0c150418ba02a4001902684027151e1c05041e290d12735f206f200220
7630: 180d0d0655208007732640212334302601002610260226b8fff4b70d0d06
7631: 5526902d18b80138b219d301ba01380000ffc0400b212334200040000200
7632: 902cb80192b18b182b10f65d2bedf4ed10f62b5d712bedf42b5ded003fed
7633: 3fedfde41112392fed10fd5de411123901111217393130013838015d005d
7634: 017113371616333236353426232207371633323635342623220607273636
7635: 3332161615140607161615140023222656b41f956b7fafa27d334c14120b
7636: 73b8866a698c14b421eaae78ca6b66648290fee8d6c1ff0183189987b082
7637: 7ca1149e02787d6382848420b5c767b2645f9c2e1ebd8ec0fef5e600>NHCKJC+ArialMT AddT42Char 
7638: 1 2698 26 <000100610000041605a7000d0070400ec40d01040d010402080409030d00
7639: b802bb4030020104090c0d73030302402123344f025f026f0203021a0f08
7640: 7309eb004f015f015f02033f015f016f017f010401190eb80192b18b182b
7641: 4e10f45d713c4df4ed4e10f6712b3c4d10ed003f3f3cfd3c391139011112
7642: 39313001715d13352115060003060723361212376103b58cfeed4b360fb9
7643: 0382f38904faad8c95fe12fefbb8dbad01ea01c79c00>NHCKJC+ArialMT AddT42Char 
7644: 1 1968 24 <00010055ffe7042105a6001e01024029120c0d0d06550f0c0d0d06554b1a
7645: 791d8a1d9613a713c30cd60cdb1b080913180e2a1a03093005300bbaffe0
7646: 0003ffe04010130a15121313ca0e0f140e13140e0f0db802a440130e0a1e
7647: 15400ea00e020e0e0f40150115151c12b802bbb70f0401d340000100b801
7648: 184020041e1c0d115f106f107f108f100410800773184021233430180100
7649: 1810180218b8fff4b70d0d065518902012bc0135000f0195000d0138b20e
7650: b501ba01380000ffc0400b212334200040000200901fb80192b18b182b10
7651: f65d2bedf4edf4ed10f62b5d712bedf45d3c003fedfd5de43fed12392f5d
7652: 11392f5d10ed10e487082e2b057d10c4001112393130013838383801715d
7653: 2b2b13371616333236353426232206072713211521033633320015140706
7654: 23222655bd15996c82b4ad8c578c28a98e02d9fdb74f8491c00108748df4
7655: c8fd0180108a8bc4a29ab24f3f1602f1acfe765cfef6d1c791b2e000>NHCKJC+ArialMT AddT42Char 
7656: NHCKJC+ArialMT /CharStrings get begin
7657: /period 17 def
7658: /three 22 def
7659: /seven 26 def
7660: /five 24 def
7661: end
7662: NHCKJC+ArialMT /Encoding get
7663: dup 46 /period put
7664: dup 51 /three put
7665: dup 55 /seven put
7666: dup 53 /five put
7667: pop
7668: systemdict /gcheck known {setglobal} if
7669: end
7670: %ADOEndSubsetFont
7671: /N22 [0.0 16.5952 -16.5952 0.0 0.0 0.0] Tf
7672: ( 4.375  --  5.000)
7673: [4.623421 9.233565 4.620101 9.233565 9.233565 9.233565 4.623421 4.623421 5.532716 5.532716 4.623421 
7674: 4.623421 9.233565 4.620101 9.233565 9.233565 9.233565 ] pdfys
7675: n
7676: 108.360001 623.75 18.479996 37.02002 re
7677: 0.64706 0.64706 0.64706  setrgbcolor
7678: f
7679: 0.0 0.0 0.0  setrgbcolor
7680: 123.360001 660.830505 m
7681: %ADOBeginSubsetFont: NHCKJC+ArialMT AddGlyphs
7682: ct_T42Dict begin
7683: systemdict /gcheck known {currentglobal NHCKJC+ArialMT gcheck setglobal} if
7684: systemdict /gcheck known {setglobal} if
7685: end
7686: %ADOEndSubsetFont
7687: ( 3.750  --  4.375)
7688: [4.623421 9.233565 4.620101 9.233565 9.233565 9.233565 4.623421 4.623421 5.532716 5.532716 4.623421 
7689: 4.623421 9.233565 4.620101 9.233565 9.233565 9.233565 ] pdfys
7690: n
7691: 130.860001 623.75 18.479996 37.02002 re
7692: 0.55294 0.55294 0.55294  setrgbcolor
7693: f
7694: 0.0 0.0 0.0  setrgbcolor
7695: 145.860001 660.830505 m
7696: %ADOBeginSubsetFont: NHCKJC+ArialMT AddGlyphs
7697: ct_T42Dict begin
7698: systemdict /gcheck known {currentglobal NHCKJC+ArialMT gcheck setglobal} if
7699: systemdict /gcheck known {setglobal} if
7700: end
7701: %ADOEndSubsetFont
7702: ( 3.125  --  3.750)
7703: [4.623421 9.233565 4.620101 9.233565 9.233565 9.233565 4.623421 4.623421 5.532716 5.532716 4.623421 
7704: 4.623421 9.233565 4.620101 9.233565 9.233565 9.233565 ] pdfys
7705: n
7706: 153.360001 623.75 18.479996 37.02002 re
7707: 0.44706 0.44706 0.44706  setrgbcolor
7708: f
7709: 0.0 0.0 0.0  setrgbcolor
7710: 168.360001 660.830505 m
7711: %ADOBeginSubsetFont: NHCKJC+ArialMT AddGlyphs
7712: ct_T42Dict begin
7713: systemdict /gcheck known {currentglobal NHCKJC+ArialMT gcheck setglobal} if
7714: systemdict /gcheck known {setglobal} if
7715: end
7716: %ADOEndSubsetFont
7717: ( 2.500  --  3.125)
7718: [4.623421 9.233565 4.620101 9.233565 9.233565 9.233565 4.623421 4.623421 5.532716 5.532716 4.623421 
7719: 4.623421 9.233565 4.620101 9.233565 9.233565 9.233565 ] pdfys
7720: n
7721: 175.860001 623.75 18.479996 37.02002 re
7722: 0.35294 0.35294 0.35294  setrgbcolor
7723: f
7724: 0.0 0.0 0.0  setrgbcolor
7725: 190.860001 660.830505 m
7726: %ADOBeginSubsetFont: NHCKJC+ArialMT AddGlyphs
7727: ct_T42Dict begin
7728: systemdict /gcheck known {currentglobal NHCKJC+ArialMT gcheck setglobal} if
7729: systemdict /gcheck known {setglobal} if
7730: end
7731: %ADOEndSubsetFont
7732: ( 1.875  --  2.500)
7733: [4.623421 9.233565 4.620101 9.233565 9.233565 9.233565 4.623421 4.623421 5.532716 5.532716 4.623421 
7734: 4.623421 9.233565 4.620101 9.233565 9.233565 9.233565 ] pdfys
7735: n
7736: 198.360001 623.75 18.479996 37.02002 re
7737: 0.2549 0.2549 0.2549  setrgbcolor
7738: f
7739: 0.0 0.0 0.0  setrgbcolor
7740: 213.360001 660.830505 m
7741: %ADOBeginSubsetFont: NHCKJC+ArialMT AddGlyphs
7742: ct_T42Dict begin
7743: systemdict /gcheck known {currentglobal NHCKJC+ArialMT gcheck setglobal} if
7744: systemdict /gcheck known {setglobal} if
7745: end
7746: %ADOEndSubsetFont
7747: ( 1.250  --  1.875)
7748: [4.623421 9.233565 4.620101 9.233565 9.233565 9.233565 4.623421 4.623421 5.532716 5.532716 4.623421 
7749: 4.623421 9.233565 4.620101 9.233565 9.233565 9.233565 ] pdfys
7750: n
7751: 220.860001 623.75 18.479996 37.02002 re
7752: 0.15686 0.15686 0.15686  setrgbcolor
7753: f
7754: 0.0 0.0 0.0  setrgbcolor
7755: 235.860001 660.830505 m
7756: %ADOBeginSubsetFont: NHCKJC+ArialMT AddGlyphs
7757: ct_T42Dict begin
7758: systemdict /gcheck known {currentglobal NHCKJC+ArialMT gcheck setglobal} if
7759: systemdict /gcheck known {setglobal} if
7760: end
7761: %ADOEndSubsetFont
7762: ( 0.6250  --  1.250)
7763: [4.623421 9.233565 4.620101 9.233565 9.233565 9.233565 9.233565 4.623421 4.623421 5.532716 5.532716 
7764: 4.623421 4.623421 9.233565 4.620101 9.233565 9.233565 9.233565 ] pdfys
7765: n
7766: 243.360001 623.75 18.479996 37.02002 re
7767: 0.058824 0.058824 0.058824  setrgbcolor
7768: f
7769: 0.0 0.0 0.0  setrgbcolor
7770: 258.359985 660.830505 m
7771: %ADOBeginSubsetFont: NHCKJC+ArialMT AddGlyphs
7772: ct_T42Dict begin
7773: systemdict /gcheck known {currentglobal NHCKJC+ArialMT gcheck setglobal} if
7774: systemdict /gcheck known {setglobal} if
7775: end
7776: %ADOEndSubsetFont
7777: ( 0  --  0.6250)
7778: [4.623421 9.233565 4.623421 4.623421 5.532716 5.532716 4.623421 4.623421 9.233565 4.620101 9.233565 
7779: 9.233565 9.233565 9.233565 ] pdfys
7780: [/EMC PDFMark5
7781: PDFVars/TermAll get exec end end
7782: %%PageTrailer
7783: %%Trailer
7784: %%EOF
7785: 
7786: %%EndDocument
7787:  @endspecial 7970 26930 a Fh(Figure)498 b(1.)681 b Fj(Plot)434
7788: b(for)e(A)g(against)i Fk(g)472 b Fj(and)432 b Fk(\267)g
7789: Fj(for)g Fk(\262)413 b Fj(=)f(0)p Fk(:)p Fj(1,)450 b(where)432
7790: b(the)g(white)h(region)g(indicates)7970 28369 y(absence)369
7791: b(of)h(solution.)2601 33350 y Fg(The)913 b(parameters)g(satisfying)i
7792: (the)d(ab)36 b(o)-36 b(v)g(e)914 b(conditions)f(are)g(tak)-36
7793: b(en)913 b(to)h(b)36 b(e)912 b(ph)-36 b(ysically)0 35121
7794: y(meaningful.)1095 b(One)605 b(can)h(see)f(from)h(Figure)g(\(1\),)649
7795: b(whic)-36 b(h)605 b(plots)h Fn(A)g Fg(against)g Fn(g)653
7796: b Fg(and)605 b Fn(\267)h Fg(that,)648 b(for)0 36893 y
7797: Fn(\262)379 b Fg(=)g(0)p Fn(:)p Fg(1,)442 b(only)e(a)g(few)g(v)-72
7798: b(alues)440 b(of)g Fn(A)g Fg(corresp)36 b(onds)439 b(to)g(a)h(soliton)g
7799: (solution.)597 b(Here,)441 b(w)-36 b(e)440 b(see)f(that)g(the)0
7800: 38664 y(magnitude)474 b(of)h(factor)f(\()p Fn(AD)359
7801: b Fl(\241)323 b Fn(B)67 b Fg(\),)485 b(that)473 b(app)36
7802: b(ears)474 b(in)g(expression)h(\(19\),)485 b(is)474 b(a)h(really)g
7803: (measure)f(of)0 40435 y(the)352 b(smo)36 b(othness)353
7804: b(of)g(the)g(solution.)551 b(Figure)353 b(\(2\))g(sho)-36
7805: b(ws)353 b(the)f(solution)h(for)g(some)g(men)-36 b(tioned)352
7806: b(v)-72 b(alues)0 42206 y(of)434 b(the)f(parameters.)2601
7807: 43977 y(When)586 b Fn(k)673 b Fg(=)628 b(0,)c(for)586
7808: b(driv)-36 b(en)586 b(NLSE,)f(w)-36 b(e)586 b(ha)-36
7809: b(v)g(e)586 b(a)h Ff(non-pr)-66 b(op)g(agating)602 b(eigen)h(soliton)
7810: 586 b Fg(as)g(our)0 45748 y(solution.)623 b(In)448 b(case)g(of)h(driv)
7811: -36 b(en)448 b(HNLSE,)g(for)h Fn(k)439 b Fg(=)393 b(0,)453
7812: b(the)448 b(equation)g(\(12\))h(and)f(equation)g(\(3\))g(ha)-36
7813: b(v)g(e)0 47519 y(same)473 b(co)36 b(e\261cien)-36 b(ts)473
7814: b(and)f(hence)g(the)g(same)h(solutions,)483 b(but)471
7815: b(eigen)i(solitons)g(are)g(only)h(found)e(with)0 49291
7816: y(additional)434 b(an)g(constrain)-36 b(t)433 b(that)g(an)-36
7817: b(y)434 b(one)f(from)h Fn(A)p Fg(,)g Fn(\262)g Fg(and)442
7818: b(~)-659 b Fn(\262)434 b Fg(m)-36 b(ust)432 b(v)-72 b(anish.)2601
7819: 51062 y(W)-108 b(e)434 b(no)-36 b(w)434 b(consider)f(the)g(case)h(when)
7820: f Fn(\262)369 b Fg(=)g(0)434 b(for)g(driv)-36 b(en)433
7821: b(NLSE,)g(from)h(\(3\))g(it)g(giv)-36 b(es)21577 54161
7822: y Fn(!)417 b Fg(=)368 b Fn(k)24905 53613 y Fe(2)25727
7823: 54161 y Fl(\241)295 b Fn(\271)0 57261 y Fg(.)578 b(Using)434
7824: b(this)g(relation)g(with)f(equations)h(\(5\))g(to)g(\(8\))f(one)h
7825: (\257nds)e(that,)7970 60028 y Fn(q)8547 60227 y Fe(1)9073
7826: 60028 y Fg(\()p Fn(\256)10414 59480 y Fe(4)10940 60028
7827: y Fg(\))295 b(+)g Fn(r)13634 60227 y Fe(1)14160 60028
7828: y Fn(\256)14995 59480 y Fe(2)15817 60028 y Fg(+)f Fn(c)369
7829: b Fg(=)g(0)p Fn(;)26658 b Fg(\(20\))0 62795 y(where,)451
7830: b Fn(q)4713 62994 y Fe(1)5631 62795 y Fg(=)393 b(48)p
7831: Fn(A)9311 62313 y Fe(5)9837 62795 y Fn(g)10508 62313
7832: y Fe(2)11338 62795 y Fl(\241)305 b Fg(48)p Fn(A)14951
7833: 62313 y Fe(2)15478 62795 y Fn(g)48 b(\267)p Fg(,)450
7834: b Fn(r)18295 62994 y Fe(1)19214 62795 y Fg(=)392 b(12)p
7835: Fn(A)22893 62313 y Fe(7)23420 62795 y Fn(g)24091 62313
7836: y Fe(3)24921 62795 y Fl(\241)305 b Fg(60)p Fn(A)28534
7837: 62313 y Fe(4)29060 62795 y Fn(g)48 b Fg(2)p Fn(\267)304
7838: b Fg(+)h(48)p Fn(Ag)48 b(\267)36446 62313 y Fe(2)37419
7839: 62795 y Fg(and)447 b Fn(c)392 b Fg(=)h Fl(\241)p Fg(18)p
7840: Fn(A)45627 62313 y Fe(6)46153 62795 y Fn(g)46824 62313
7841: y Fe(3)47350 62795 y Fn(\267)304 b Fg(+)0 64567 y(9)p
7842: Fn(A)1625 64085 y Fe(3)2151 64567 y Fn(g)2822 64085 y
7843: Fe(2)3347 64567 y Fn(\267)4096 64085 y Fe(2)4722 64567
7844: y Fg(+)100 b(9)p Fn(g)48 b(\267)7904 64085 y Fe(3)8430
7845: 64567 y Fg(.)546 b(V)-108 b(ery)338 b(in)-36 b(terestingly)-108
7846: b(,)358 b(all)339 b(of)g(these)f(co)36 b(e\261cien)-36
7847: b(ts)338 b(v)-72 b(anish)338 b(in)g(the)g(view)h(of)g(equation)0
7848: 66338 y(\(5\))328 b(lea)-36 b(ving)330 b Fn(\256)337
7849: b Fg(as)328 b(a)h(free)g(parameter.)543 b(So,)349 b(the)328
7850: b(width)g(of)h(the)f(soliton,)350 b(in)328 b(this)g(case)h(is)g(indep)
7851: 36 b(enden)-36 b(t)0 68109 y(of)461 b(the)g(parameter)f(v)-72
7852: b(alues,)468 b(whic)-36 b(h)461 b(means)g(that)f(the)g(solitons)h(can)g
7853: (ha)-36 b(v)g(e)461 b(an)-36 b(y)461 b(arbitrary)g(size)g(for)0
7854: 69880 y(the)400 b(giv)-36 b(en)401 b(v)-72 b(alues)400
7855: b(of)h Fn(g)448 b Fg(and)400 b Fn(\267)p Fg(.)567 b(Similar)400
7856: b(is)h(the)f(case)g(for)h(driv)-36 b(en)400 b(HNLSE)g(when)409
7857: b(\271)-660 b Fn(\262)401 b Fg(v)-72 b(anishes)400 b(from)0
7858: 71651 y(\(12\).)p eop end end
7859: %%Page: 7 7
7860: TeXDict begin HPSdict begin 7 6 bop 0 221 a Ff(Dark)332
7861: b(and)g(Bright)g(solitons)g(of)f(driven)g(non-line)-66
7862: b(ar)330 b(Schr\304)-664 b(odinger)331 b(and)h(higher)f(or)-66
7863: b(der)332 b(non-line)-66 b(ar)330 b(Schr\304)-664 b(odinger)331
7864: b(e)-66 b(quations)p Fg(7)0 26498 y @beginspecial 0 @llx
7865: 0 @lly 792 @urx 612 @ury 2880 @rwi @setspecial
7866: %%BeginDocument: a2.eps
7867: %!PS-Adobe-3.0 EPSF-3.0
7868: %%Title: (\376\377)
7869: %%Version: 1 2
7870: %%Creator: (\376\377)
7871: %%CreationDate: (D:20050705194713)
7872: %%For: (\376\377)
7873: %%DocumentData: Clean7Bit
7874: %%BoundingBox: 0 0 792 612
7875: %%Pages: 0
7876: %%DocumentProcessColors: Cyan Magenta Yellow Black
7877: %%DocumentNeededResources: (atend)
7878: %%DocumentSuppliedResources:
7879: %%+ procset (Adobe Acrobat - PDF operators) 1.2 0
7880: %%+ procset (Adobe Acrobat - type operators) 1.2 0
7881: %%EndComments
7882: 0 0 moveto 792 0 lineto 792 612 lineto 0 612 lineto closepath clip newpath
7883: %%BeginProlog
7884: %%EndProlog
7885: %%BeginSetup
7886: %%BeginResource: file Pscript_CFF PSVER
7887: userdict/ct_CffDict 6 dict put ct_CffDict begin/F0Subr{systemdict/internaldict
7888: known{1183615869 systemdict/internaldict get exec/FlxProc known{save true}{
7889: false}ifelse}{userdict/internaldict known not{userdict/internaldict{count 0 eq
7890: {/internaldict errordict/invalidaccess get exec}if dup type/integertype ne{
7891: /internaldict errordict/invalidaccess get exec}if dup 1183615869 eq{pop 0}{
7892: /internaldict errordict/invalidaccess get exec}ifelse}dup 14 get 1 25 dict put
7893: bind executeonly put}if 1183615869 userdict/internaldict get exec/FlxProc
7894: known{save true}{false}ifelse}ifelse[systemdict/internaldict known not{100
7895: dict/begin cvx/mtx matrix/def cvx}if systemdict/currentpacking known{
7896: currentpacking true setpacking}if{systemdict/internaldict known{1183615869
7897: systemdict/internaldict get exec dup/$FlxDict known not{dup dup length exch
7898: maxlength eq{pop userdict dup/$FlxDict known not{100 dict begin/mtx matrix def
7899: dup/$FlxDict currentdict put end}if}{100 dict begin/mtx matrix def dup
7900: /$FlxDict currentdict put end}ifelse}if/$FlxDict get begin}if grestore/exdef{
7901: exch def}def/dmin exch abs 100 div def/epX exdef/epY exdef/c4y2 exdef/c4x2
7902: exdef/c4y1 exdef/c4x1 exdef/c4y0 exdef/c4x0 exdef/c3y2 exdef/c3x2 exdef/c3y1
7903: exdef/c3x1 exdef/c3y0 exdef/c3x0 exdef/c1y2 exdef/c1x2 exdef/c2x2 c4x2 def
7904: /c2y2 c4y2 def/yflag c1y2 c3y2 sub abs c1x2 c3x2 sub abs gt def/PickCoords{{
7905: c1x0 c1y0 c1x1 c1y1 c1x2 c1y2 c2x0 c2y0 c2x1 c2y1 c2x2 c2y2}{c3x0 c3y0 c3x1
7906: c3y1 c3x2 c3y2 c4x0 c4y0 c4x1 c4y1 c4x2 c4y2}ifelse/y5 exdef/x5 exdef/y4 exdef
7907: /x4 exdef/y3 exdef/x3 exdef/y2 exdef/x2 exdef/y1 exdef/x1 exdef/y0 exdef/x0
7908: exdef}def mtx currentmatrix pop mtx 0 get abs 1e-05 lt mtx 3 get abs 1e-05 lt
7909: or{/flipXY -1 def}{mtx 1 get abs 1e-05 lt mtx 2 get abs 1e-05 lt or{/flipXY 1
7910: def}{/flipXY 0 def}ifelse}ifelse/erosion 1 def systemdict/internaldict known{
7911: 1183615869 systemdict/internaldict get exec dup/erosion known{/erosion get
7912: /erosion exch def}{pop}ifelse}if yflag{flipXY 0 eq c3y2 c4y2 eq or{false
7913: PickCoords}{/shrink c3y2 c4y2 eq{0}{c1y2 c4y2 sub c3y2 c4y2 sub div abs}ifelse
7914: def/yshrink{c4y2 sub shrink mul c4y2 add}def/c1y0 c3y0 yshrink def/c1y1 c3y1
7915: yshrink def/c2y0 c4y0 yshrink def/c2y1 c4y1 yshrink def/c1x0 c3x0 def/c1x1
7916: c3x1 def/c2x0 c4x0 def/c2x1 c4x1 def/dY 0 c3y2 c1y2 sub round dtransform
7917: flipXY 1 eq{exch}if pop abs def dY dmin lt PickCoords y2 c1y2 sub abs .001 gt{
7918: c1x2 c1y2 transform flipXY 1 eq{exch}if/cx exch def/cy exch def/dY 0 y2 c1y2
7919: sub round dtransform flipXY 1 eq{exch}if pop def dY round dup 0 ne{/dY exdef}{
7920: pop dY 0 lt{-1}{1}ifelse/dY exdef}ifelse/erode PaintType 2 ne erosion .5 ge
7921: and def erode{/cy cy .5 sub def}if/ey cy dY add def/ey ey ceiling ey sub ey
7922: floor add def erode{/ey ey .5 add def}if ey cx flipXY 1 eq{exch}if itransform
7923: exch pop y2 sub/eShift exch def/y1 y1 eShift add def/y2 y2 eShift add def/y3
7924: y3 eShift add def}if}ifelse}{flipXY 0 eq c3x2 c4x2 eq or{false PickCoords}{
7925: /shrink c3x2 c4x2 eq{0}{c1x2 c4x2 sub c3x2 c4x2 sub div abs}ifelse def/xshrink
7926: {c4x2 sub shrink mul c4x2 add}def/c1x0 c3x0 xshrink def/c1x1 c3x1 xshrink def
7927: /c2x0 c4x0 xshrink def/c2x1 c4x1 xshrink def/c1y0 c3y0 def/c1y1 c3y1 def/c2y0
7928: c4y0 def/c2y1 c4y1 def/dX c3x2 c1x2 sub round 0 dtransform flipXY -1 eq{exch}
7929: if pop abs def dX dmin lt PickCoords x2 c1x2 sub abs .001 gt{c1x2 c1y2
7930: transform flipXY -1 eq{exch}if/cy exch def/cx exch def/dX x2 c1x2 sub round 0
7931: dtransform flipXY -1 eq{exch}if pop def dX round dup 0 ne{/dX exdef}{pop dX 0
7932: lt{-1}{1}ifelse/dX exdef}ifelse/erode PaintType 2 ne erosion .5 ge and def
7933: erode{/cx cx .5 sub def}if/ex cx dX add def/ex ex ceiling ex sub ex floor add
7934: def erode{/ex ex .5 add def}if ex cy flipXY -1 eq{exch}if itransform pop x2
7935: sub/eShift exch def/x1 x1 eShift add def/x2 x2 eShift add def/x3 x3 eShift add
7936: def}if}ifelse}ifelse x2 x5 eq y2 y5 eq or{x5 y5 lineto}{x0 y0 x1 y1 x2 y2
7937: curveto x3 y3 x4 y4 x5 y5 curveto}ifelse epY epX}systemdict/currentpacking
7938: known{exch setpacking}if/exec cvx/end cvx]cvx executeonly exch{pop true exch
7939: restore}{systemdict/internaldict known not{1183615869 userdict/internaldict
7940: get exec exch/FlxProc exch put true}{1183615869 systemdict/internaldict get
7941: exec dup length exch maxlength eq{false}{1183615869 systemdict/internaldict
7942: get exec exch/FlxProc exch put true}ifelse}ifelse}ifelse{systemdict
7943: /internaldict known{1183615869 systemdict/internaldict get exec/FlxProc get
7944: exec}{1183615869 userdict/internaldict get exec/FlxProc get exec}ifelse}if}
7945: executeonly def/F1Subr{gsave currentpoint newpath moveto}bind def/F2Subr{
7946: currentpoint grestore gsave currentpoint newpath moveto}bind def/HSSubr{
7947: systemdict/internaldict known not{pop 3}{1183615869 systemdict/internaldict
7948: get exec dup/startlock known{/startlock get exec}{dup/strtlck known{/strtlck
7949: get exec}{pop 3}ifelse}ifelse}ifelse}bind def end
7950: %%EndResource
7951: /currentpacking where{pop currentpacking true setpacking}if
7952: %%BeginResource: procset pdfvars
7953: %%Copyright: Copyright 1987-2001 Adobe Systems Incorporated. All Rights Reserved.
7954: %%Version: 5.0 6
7955: %%Title: definition of dictionary of variables used by PDF & PDFText procsets
7956: userdict /PDF 160 dict put
7957: userdict /PDFVars 89 dict dup begin put
7958: /docSetupDone false def
7959: /InitAll 0 def
7960: /TermAll 0 def
7961: /DocInitAll 0 def
7962: /DocTermAll 0 def
7963: /_pdfEncodings 2 array def
7964: /_pdf_str1 1 string def
7965: /_pdf_i 0 def
7966: /_pdf_na 0 def
7967: /_pdf_showproc 0 def
7968: /_italMtx [1 0 .212557 1 0 0] def
7969: /_italMtx_WMode1 [1 -.212557 0 1 0 0] def
7970: /_italMtxType0 [1 0 .1062785 1 0 0] def
7971: /_italMtx_WMode1Type0 [1 -.1062785 0 1 0 0] def
7972: /_basefont 0 def
7973: /_basefonto 0 def
7974: /_pdf_oldCIDInit null def
7975: /_pdf_FontDirectory 30 dict def
7976: /_categories 10 dict def
7977: /_sa? true def
7978: /_ColorSep5044? false def
7979: /nulldict 0 dict def
7980: /_processColors 0 def
7981: /overprintstack null def
7982: /_defaulttransfer currenttransfer def
7983: /_defaultflatness currentflat def
7984: /_defaulthalftone null def
7985: /_defaultcolortransfer null def
7986: /_defaultblackgeneration null def
7987: /_defaultundercolorremoval null def
7988: /_defaultcolortransfer null def
7989: PDF begin
7990: [/c/cs/cm/d/d0/f/h/i/j/J/l/m/M/n/q/Q/re/ri/S/sc/sh/Tf/w/W
7991: /applyInterpFunc/applystitchFunc/domainClip/encodeInput
7992: /initgs/int/limit/rangeClip
7993: /defineRes/findRes/setSA/pl
7994: %% to keep CoolType entries in GlyphDirProcs safe from collisions with Win PS driver
7995: /? /! /| /: /+ /GetGlyphDirectory
7996: /pdf_flushFilters /pdf_readstring /pdf_dictOp /pdf_image /pdf_maskedImage
7997: /pdf_shfill /pdf_sethalftone
7998: ] {null def} bind forall
7999: end
8000: end
8001: %%EndResource
8002: PDFVars begin PDF begin
8003: %%BeginResource: procset pdfutil
8004: %%Copyright: Copyright 1993-1999 Adobe Systems Incorporated. All Rights Reserved.
8005: %%Version: 4.0 2
8006: %%Title: Basic utilities used by other PDF procsets
8007: /bd {bind def} bind def
8008: /ld {load def} bd
8009: /bld {
8010: dup length dict begin
8011: { null def } forall
8012: bind
8013: end
8014: def
8015: } bd
8016: /dd { PDFVars 3 1 roll put } bd
8017: /xdd { exch dd } bd
8018: /Level2?
8019: systemdict /languagelevel known
8020: { systemdict /languagelevel get 2 ge } { false } ifelse
8021: def
8022: /Level1? Level2? not def
8023: /Level3?
8024: systemdict /languagelevel known
8025: {systemdict /languagelevel get 3 eq } { false } ifelse
8026: def
8027: /getifknown {
8028: 2 copy known { get true } { pop pop false } ifelse
8029: } bd
8030: /here {
8031: currentdict exch getifknown
8032: } bd
8033: /isdefined? { where { pop true } { false } ifelse } bd
8034: %%EndResource
8035: %%BeginResource: l2compat
8036: %%Version: 5.0 9
8037: %%Copyright: Copyright 1987-2001 Adobe Systems Incorporated. All Rights Reserved.
8038: %%LanguageLevel: 1
8039: %%Title: Level 1 emulation of level 2 operators
8040: /setcmykcolor isdefined? not
8041: {
8042: /setcmykcolor {
8043: 1 sub 4 1 roll
8044: 3 {
8045: 3 index add neg dup 0 lt { pop 0 } if
8046: 3 1 roll
8047: } repeat
8048: setrgbcolor
8049: pop
8050: } bd
8051: } if
8052: /rectclip isdefined? not
8053: {
8054: /rectclip { newpath re clip newpath } bd
8055: } if
8056: /rectfill isdefined? not
8057: {
8058: /rectfill { gsave newpath re fill grestore } bd
8059: } if
8060: /sethalftone isdefined? not
8061: {
8062: /sethalftone {
8063: begin
8064: HalftoneType 1 eq
8065: { Frequency Angle /SpotFunction load setscreen }
8066: if
8067: end
8068: } bd
8069: } if
8070: Level1?
8071: {
8072: /pdf_show {show} bd
8073: /xshow
8074: {
8075: PDFVars /_pdf_showproc /pdf_show load put
8076: pdf_xshow
8077: } bd
8078: /yshow
8079: {
8080: PDFVars /_pdf_showproc /pdf_show load put
8081: pdf_yshow
8082: } bd
8083: /xyshow
8084: {
8085: PDFVars /_pdf_showproc /pdf_show load put
8086: pdf_xyshow
8087: } bd
8088: } if
8089: %%EndResource
8090: %%BeginResource: procset pdf
8091: %%Version: 5.0 6
8092: %%Copyright: Copyright 1998-2001 Adobe Systems Incorporated. All Rights Reserved.
8093: %%Title: General operators for PDF, common to all Language Levels.
8094: /cm { matrix astore concat } bd
8095: /d /setdash ld
8096: /f /fill ld
8097: /h /closepath ld
8098: /i {dup 0 eq {pop _defaultflatness} if setflat} bd
8099: /j /setlinejoin ld
8100: /J /setlinecap ld
8101: /M /setmiterlimit ld
8102: /n /newpath ld
8103: /S /stroke ld
8104: /w /setlinewidth ld
8105: /W /clip ld
8106: /initgs {
8107: 0 setgray
8108: [] 0 d
8109: 0 j
8110: 0 J
8111: 10 M
8112: 1 w
8113: false setSA
8114: /_defaulttransfer load settransfer
8115: 0 i
8116: /RelativeColorimetric ri
8117: newpath
8118: } bd
8119: /int {
8120: dup 2 index sub 3 index 5 index sub div 6 -2 roll sub mul
8121: exch pop add exch pop
8122: } bd
8123: /limit {
8124: dup 2 index le { exch } if pop
8125: dup 2 index ge { exch } if pop
8126: } bd
8127: /domainClip {
8128: Domain aload pop 3 2 roll
8129: limit
8130: } [/Domain] bld
8131: /applyInterpFunc {
8132: 0 1 DimOut 1 sub
8133: {
8134: dup C0 exch get exch
8135: dup C1 exch get exch
8136: 3 1 roll
8137: 1 index sub
8138: 3 index
8139: N exp mul add
8140: exch
8141: currentdict /Range_lo known
8142: {
8143: dup Range_lo exch get exch
8144: Range_hi exch get
8145: 3 2 roll limit
8146: }
8147: {
8148: pop
8149: }
8150: ifelse
8151: exch
8152: } for
8153: pop
8154: } [/DimOut /C0 /C1 /N /Range_lo /Range_hi] bld
8155: /encodeInput {
8156: NumParts 1 sub
8157: 0 1 2 index
8158: {
8159: dup Bounds exch get
8160: 2 index gt
8161: { exit }
8162: { dup
8163: 3 index eq
8164: { exit }
8165: { pop } ifelse
8166: } ifelse
8167: } for
8168: 3 2 roll pop
8169: dup Bounds exch get exch
8170: dup 1 add Bounds exch get exch
8171: 2 mul
8172: dup Encode exch get exch
8173: 1 add Encode exch get
8174: int
8175: } [/NumParts /Bounds /Encode] bld
8176: /rangeClip {
8177: exch dup Range_lo exch get
8178: exch Range_hi exch get
8179: 3 2 roll
8180: limit
8181: } [/Range_lo /Range_hi] bld
8182: /applyStitchFunc {
8183: Functions exch get exec
8184: currentdict /Range_lo known {
8185: 0 1 DimOut 1 sub {
8186: DimOut 1 add -1 roll
8187: rangeClip
8188: } for
8189: } if
8190: } [/Functions /Range_lo /DimOut] bld
8191: /pdf_flushfilters
8192: {
8193: aload length
8194: { dup status
8195: 1 index currentfile ne and
8196: { dup flushfile closefile }
8197: { pop }
8198: ifelse
8199: } repeat
8200: } bd
8201: /pdf_readstring
8202: {
8203: 1 index dup length 1 sub get
8204: exch readstring pop
8205: exch pdf_flushfilters
8206: } bind def
8207: /pdf_dictOp
8208: {
8209: 3 2 roll
8210: 10 dict copy
8211: begin
8212: _Filters dup length 1 sub get def
8213: currentdict exch exec
8214: _Filters pdf_flushfilters
8215: end
8216: } [/_Filters] bld
8217: /pdf_image {{image} /DataSource pdf_dictOp} bd
8218: /pdf_imagemask {{imagemask} /DataSource pdf_dictOp} bd
8219: /pdf_shfill {{sh} /DataSource pdf_dictOp} bd
8220: /pdf_sethalftone {{sethalftone} /Thresholds pdf_dictOp} bd
8221: /pdf_maskedImage
8222: {
8223: 10 dict copy begin
8224: /miDict currentdict def
8225: /DataDict DataDict 10 dict copy def
8226: DataDict begin
8227: /DataSource
8228: _Filters dup length 1 sub get
8229: def
8230: miDict image
8231: _Filters pdf_flushfilters
8232: end
8233: end
8234: } [/miDict /DataDict /_Filters] bld
8235: %%EndResource
8236: %%BeginResource: procset sep_ops
8237: %%Version: 4.0 1
8238: %%Copyright: Copyright 1987-1999 Adobe Systems Incorporated. All Rights Reserved.
8239: %%Title: Support for Separations in Level 1, following the conventions of Tech Note 5044
8240: userdict /sep_ops 50 dict dup begin put
8241: /bdef {bind def} bind def
8242: /xdef {exch def} bdef
8243: /colorimagebuffer {
8244: 0 1 2 index length 1 sub {
8245: dup 2 index exch get 255 exch sub 2 index 3 1 roll put
8246: } for
8247: } bdef
8248: /addprocs {
8249: [ 3 1 roll
8250: /exec load
8251: dup 3 1 roll
8252: ] cvx
8253: } bdef
8254: /L1? {
8255: systemdict /languagelevel known {
8256: systemdict /languagelevel get 2 lt
8257: }{
8258: true
8259: } ifelse
8260: } bdef
8261: /colorexists {
8262: statusdict /processcolors known {
8263: statusdict /processcolors get exec
8264: }{
8265: /deviceinfo where {
8266: pop deviceinfo /Colors known {
8267: deviceinfo /Colors get
8268: statusdict /processcolors {
8269: deviceinfo /Colors known {
8270: deviceinfo /Colors get
8271: }{
8272: 1
8273: } ifelse
8274: } put
8275: }{
8276: 1
8277: } ifelse
8278: }{
8279: 1
8280: } ifelse
8281: } ifelse
8282: 1 gt
8283: } bdef
8284: /colorplate colorexists { 0 } { 5 } ifelse def
8285: /negativecolorplate false def
8286: /setcmykcolor where {
8287: pop
8288: gsave
8289: 1 0 0 0 setcmykcolor systemdict /currentgray get exec 1 exch sub
8290: 0 1 0 0 setcmykcolor systemdict /currentgray get exec 1 exch sub
8291: 0 0 1 0 setcmykcolor systemdict /currentgray get exec 1 exch sub
8292: 0 0 0 1 setcmykcolor systemdict /currentgray get exec 1 exch sub
8293: 4 {4 copy} repeat
8294: grestore
8295: 1 dict begin
8296: /foureq {
8297: 4 index eq 8 1 roll
8298: 4 index eq 8 1 roll
8299: 4 index eq 8 1 roll
8300: 4 index eq 8 1 roll
8301: pop pop pop pop and and and
8302: } def
8303: 1 0 0 0 foureq {/colorplate 1 store} if
8304: 0 1 0 0 foureq {/colorplate 2 store} if
8305: 0 0 1 0 foureq {/colorplate 3 store} if
8306: 0 0 0 1 foureq {/colorplate 4 store} if
8307: 0 0 0 0 foureq {/colorplate 6 store} if
8308: end
8309: } if
8310: 0 systemdict /currenttransfer get exec exec
8311: 1 systemdict /currenttransfer get exec exec
8312: 2 copy
8313: eq
8314: {
8315: /colorplate 6 store
8316: pop
8317: /negativecolorplate exch 0.5 lt store
8318: }
8319: {
8320: gt /negativecolorplate exch store
8321: }
8322: ifelse
8323: /findcmykcustomcolor where { pop }
8324: {
8325: /findcmykcustomcolor {
8326: [ 6 1 roll ] readonly
8327: } bdef
8328: } ifelse
8329: /setoverprint where {
8330: pop
8331: }{
8332: /setoverprint {
8333: pop
8334: } bdef
8335: } ifelse
8336: /currentoverprint where {
8337: pop
8338: }{
8339: /currentoverprint {
8340: false
8341: } bdef
8342: } ifelse
8343: /setcustomcolor where {
8344: pop
8345: }{
8346: L1? {
8347: /setcustomcolor {
8348: exch
8349: aload pop pop
8350: 4 { 4 index mul 4 1 roll } repeat
8351: 5 -1 roll pop
8352: setcmykcolor
8353: } bdef
8354: }{
8355: /setcustomcolor {
8356: exch
8357: [ exch /Separation exch dup 4 get exch /DeviceCMYK exch
8358: 0 4 getinterval
8359: [ exch /dup load exch cvx {mul exch dup}
8360: /forall load /pop load dup] cvx
8361: ] setcolorspace setcolor
8362: } bdef
8363: } ifelse
8364: } ifelse
8365: /ik 0 def
8366: /iy 0 def
8367: /im 0 def
8368: /ic 0 def
8369: /imagetint {
8370: ic .3 mul
8371: im .59 mul
8372: iy .11 mul
8373: ik add add add dup
8374: 1 gt {pop 1} if
8375: } bdef
8376: /setcmykcolor where {
8377: pop
8378: }{
8379: /setcmykcolor {
8380: /ik xdef /iy xdef /im xdef /ic xdef
8381: imagetint
8382: 1 exch sub setgray
8383: } bdef
8384: } ifelse
8385: /customcolorimage where {
8386: pop
8387: }{
8388: L1? {
8389: /customcolorimage{
8390: gsave
8391: colorexists {
8392: aload pop pop
8393: /ik xdef /iy xdef /im xdef /ic xdef
8394: currentcolortransfer
8395: {ik mul ik sub 1 add} addprocs
8396: 4 1 roll {iy mul iy sub 1 add} addprocs
8397: 4 1 roll {im mul im sub 1 add} addprocs
8398: 4 1 roll {ic mul ic sub 1 add} addprocs
8399: 4 1 roll setcolortransfer
8400: /magentabuf 0 string def
8401: /yellowbuf 0 string def
8402: /blackbuf 0 string def
8403: {
8404: colorimagebuffer dup length magentabuf length ne
8405: {
8406: dup length dup dup
8407: /magentabuf exch string def
8408: /yellowbuf exch string def
8409: /blackbuf exch string def
8410: } if
8411: dup magentabuf copy yellowbuf copy
8412: blackbuf copy pop
8413: } addprocs
8414: {magentabuf}{yellowbuf}{blackbuf} true 4 colorimage
8415: }{
8416: aload pop pop /ik xdef /iy xdef /im xdef /ic xdef /tint
8417: imagetint def
8418: currenttransfer
8419: {tint mul 1 tint sub add} addprocs settransfer image
8420: } ifelse
8421: grestore
8422: } bdef
8423: }{
8424: /customcolorimage {
8425: gsave
8426: [ exch /Separation exch dup 4 get exch /DeviceCMYK exch
8427: 0 4 getinterval
8428: [ exch /dup load exch cvx {mul exch dup}
8429: /forall load /pop load dup] cvx
8430: ] setcolorspace
8431: 10 dict begin
8432: /ImageType 1 def
8433: /DataSource exch def
8434: /ImageMatrix exch def
8435: /BitsPerComponent exch def
8436: /Height exch def
8437: /Width exch def
8438: /Decode [1 0] def
8439: currentdict end
8440: image
8441: grestore
8442: } bdef
8443: } ifelse
8444: } ifelse
8445: /setseparationgray where {
8446: pop
8447: }{
8448: L1? {
8449: /setseparationgray { 1 exch sub dup dup dup setcmykcolor } bdef
8450: }{
8451: /setseparationgray {
8452: [/Separation /All /DeviceCMYK {dup dup dup}] setcolorspace
8453: 1 exch sub setcolor
8454: } bdef
8455: } ifelse
8456: } ifelse
8457: /separationimage where { pop }
8458: {
8459: /separationimage {
8460: gsave
8461: 1 1 1 1 (All)
8462: findcmykcustomcolor customcolorimage
8463: grestore
8464: } bdef
8465: } ifelse
8466: currentdict readonly pop end
8467: %%EndResource
8468: %%BeginResource: procset pdflev15044
8469: %%Version: 5.0 12
8470: %%Copyright: Copyright 1987-2001 Adobe Systems Incorporated. All Rights Reserved.
8471: %%LanguageLevel: 1
8472: %%Title: PDF operators, Level 1, with emulated separations (TN 5044)
8473: /_ColorSep5044? true dd
8474: /docinitialize {
8475: PDF begin
8476: /_defaulthalftone
8477: /currenthalftone where
8478: { pop currenthalftone }
8479: { 4 dict dup begin
8480: currentscreen
8481: /SpotFunction exch def
8482: /Angle exch def
8483: /Frequency exch def
8484: /HalftoneType 1 def
8485: end }
8486: ifelse
8487: dd
8488: /currentcolortransfer where
8489: { pop /_defaultcolortransfer [ currentcolortransfer ] dd }
8490: { /_defaultcolortransfer [currenttransfer dup dup dup] dd }
8491: ifelse
8492: end
8493: } bd
8494: /initialize {
8495: /overprintstack null dd
8496: sep_ops begin
8497: 50 dict begin
8498: _defaulthalftone sethalftone
8499: } bd
8500: /terminate {
8501: end end
8502: } bd
8503: /currentcolortransfer where
8504: { pop }
8505: {
8506: /setcolortransfer
8507: {
8508: settransfer pop pop pop
8509: } bd
8510: } ifelse
8511: /pl {
8512: transform
8513: 0.25 sub round 0.25 add exch
8514: 0.25 sub round 0.25 add exch
8515: itransform
8516: } bd
8517: /m { _sa? { pl } if moveto } bd
8518: /l { _sa? { pl } if lineto } bd
8519: /c
8520: {
8521: _sa? {3 {pl 6 2 roll} repeat} if
8522: curveto
8523: } bd
8524: /ri/pop ld
8525: /setSA { /_sa? xdd } bd
8526: /re
8527: {
8528: _sa?
8529: {
8530: 8 dict begin
8531: /:h exch def
8532: /:w exch def
8533: /:y exch def
8534: /:x exch def
8535: :x :y pl
8536: /:ymin exch def /:xmin exch def
8537: :x :w add :y :h add pl
8538: /:ymax exch def /:xmax exch def
8539: :xmin :ymin moveto
8540: :xmax :ymin lineto
8541: :xmax :ymax lineto
8542: :xmin :ymax lineto
8543: closepath
8544: end
8545: }
8546: {
8547: 4 2 roll moveto
8548: 1 index 0 rlineto
8549: 0 exch rlineto
8550: neg 0 rlineto
8551: closepath
8552: } ifelse
8553: } bd
8554: /q
8555: {
8556: gsave
8557: [currentoverprint overprintstack] /overprintstack xdd
8558: }
8559: [/overprintstack] bld
8560: /Q
8561: {
8562: overprintstack aload pop /overprintstack xdd setoverprint
8563: grestore
8564: }
8565: [/overprintstack] bld
8566: /AlmostFull?
8567: { dup maxlength exch length sub 2 le
8568: } bd
8569: /Expand
8570: { 1 index maxlength mul cvi dict
8571: dup begin exch { def } forall end
8572: } bd
8573: /xput
8574: { 3 2 roll
8575: dup 3 index known not
8576: { dup AlmostFull? { 1.5 Expand } if
8577: } if
8578: dup 4 2 roll put
8579: } bd
8580: /defineRes
8581: { _categories 1 index known not
8582: { /_categories _categories 2 index 10 dict xput store
8583: } if
8584: _categories exch 2 copy get 5 -1 roll 4 index xput put
8585: } bd
8586: /findRes {
8587: _categories exch get exch get
8588: } bd
8589: /L1setcolor {
8590: aload length
8591: dup 0 eq
8592: { pop .5 setgray }
8593: { dup 1 eq
8594: { pop setgray }
8595: { 3 eq
8596: { setrgbcolor }
8597: { setcmykcolor }
8598: ifelse }
8599: ifelse }
8600: ifelse
8601: } bind dd
8602: /concattransferfuncs {
8603: [ 3 1 roll /exec load exch /exec load ] cvx
8604: } bd
8605: /concatandsettransfer {
8606: /_defaulttransfer load concattransferfuncs settransfer
8607: } bd
8608: /concatandsetcolortransfer {
8609: colorplate 0 eq
8610: {
8611: _defaultcolortransfer aload pop
8612: 8 -1 roll 5 -1 roll concattransferfuncs 7 1 roll
8613: 6 -1 roll 4 -1 roll concattransferfuncs 5 1 roll
8614: 4 -1 roll 3 -1 roll concattransferfuncs 3 1 roll
8615: concattransferfuncs
8616: setcolortransfer
8617: } if
8618: colorplate 1 ge colorplate 4 le and
8619: {
8620: 4 colorplate sub index 4 { exch pop } repeat
8621: concatandsettransfer
8622: } if
8623: colorplate 5 ge
8624: {
8625: 0 index 4 { exch pop } repeat
8626: concatandsettransfer
8627: } if
8628: } bd
8629: /tn5044sethalftone
8630: {
8631: begin
8632: HalftoneType 5 eq
8633: { [/Default /Cyan /Magenta /Yellow /Black /Default /Default /Default]
8634: colorplate get
8635: here not {
8636: /Default here not { currentdict } if
8637: } if
8638: }
8639: { currentdict }
8640: ifelse
8641: end
8642: begin
8643: /TransferFunction here
8644: {
8645: concatandsettransfer
8646: currentdict dup length dict
8647: begin
8648: {
8649: 1 index /TransferFunction ne { def } { pop pop } ifelse
8650: } forall
8651: currentdict
8652: end
8653: }
8654: {
8655: currentdict
8656: } ifelse
8657: end
8658: sethalftone
8659: } bd
8660: /paintimage
8661: {
8662: colorplate 0 eq
8663: {
8664: { {currentfile cyanstr readstring pop}
8665: {currentfile magentastr readstring pop}
8666: {currentfile yellowstr readstring pop}
8667: {currentfile blackstr readstring pop
8668: currentfile graystr readstring pop pop}
8669: }
8670: { {currentfile cyanstr readhexstring pop}
8671: {currentfile magentastr readhexstring pop}
8672: {currentfile yellowstr readhexstring pop}
8673: {currentfile blackstr readhexstring pop
8674: currentfile graystr readhexstring pop pop}
8675: } ifelse
8676: true 4 colorimage
8677: }
8678: {
8679: 3 dict begin
8680: /binaryOK exch def
8681: [
8682: 1 1 5 {
8683: dup
8684: /currentfile cvx
8685: [ /cyanstr /magentastr /yellowstr /blackstr /graystr ]
8686: 3 -1 roll 1 sub get cvx
8687: binaryOK { /readstring } { /readhexstring } ifelse cvx
8688: /pop cvx
8689: 5 -1 roll
8690: colorplate dup 5 gt { pop 5 } if
8691: eq not { /pop cvx } if
8692: } for
8693: ] cvx bind
8694: end
8695: [
8696: colorplate 6 eq {
8697: /pop cvx
8698: negativecolorplate { 0 } { 1 } ifelse
8699: } if
8700: colorplate 4 le
8701: {
8702: 1 /exch cvx /sub cvx
8703: } if
8704: colorplate 6 ne
8705: {
8706: systemdict /currenttransfer get exec
8707: aload pop
8708: } if
8709: ] cvx
8710: gsave
8711: systemdict /settransfer get exec
8712: systemdict /image get exec
8713: grestore
8714: } ifelse
8715: } bd
8716: /getrampcolor {
8717: /indx exch def
8718: [
8719: 0 1 NumComp 1 sub {
8720: dup
8721: Samples exch get
8722: dup type /stringtype eq { indx get } if
8723: exch
8724: Scaling exch get aload pop
8725: 3 1 roll
8726: mul add
8727: } for
8728: ]
8729: L1setcolor
8730: } bd
8731: /GenStrips {
8732: 40 dict begin
8733: /background exch def
8734: /ext1 exch def
8735: /ext0 exch def
8736: /BBox exch def
8737: /y2 exch def
8738: /x2 exch def
8739: /y1 exch def
8740: /x1 exch def
8741: /rampdict exch def
8742: gsave
8743: BBox length 0 gt {
8744: BBox 0 get BBox 1 get
8745: BBox 2 get BBox 0 get sub
8746: BBox 3 get BBox 1 get sub
8747: rectclip
8748: } if
8749: x1 x2 eq
8750: {
8751: y1 y2 lt {/theta 90 def}{/theta 270 def} ifelse
8752: }
8753: {
8754: /slope y2 y1 sub x2 x1 sub div def
8755: /theta slope 1 atan def
8756: x2 x1 lt y2 y1 ge and { /theta theta 180 sub def} if
8757: x2 x1 lt y2 y1 le and { /theta theta 180 add def} if
8758: }
8759: ifelse
8760: gsave
8761: clippath
8762: x1 y1 translate
8763: theta rotate
8764: { pathbbox } stopped
8765: { 0 0 0 0 } if
8766: /yMax exch def
8767: /xMax exch def
8768: /yMin exch def
8769: /xMin exch def
8770: grestore
8771: xMax xMin eq yMax yMin eq or
8772: {
8773: grestore
8774: end
8775: }
8776: {
8777: rampdict begin
8778: 20 dict begin
8779: background length 0 gt { background L1setcolor gsave clippath fill grestore } if
8780: gsave
8781: x1 y1 translate
8782: theta rotate
8783: /xStart 0 def
8784: /xEnd x2 x1 sub dup mul y2 y1 sub dup mul add 0.5 exp def
8785: /ySpan yMax yMin sub def
8786: /numsteps NumSamples def
8787: /rampIndxInc 1 def
8788: /subsampling false def
8789: xStart 0 transform
8790: xEnd 0 transform
8791: 3 -1 roll
8792: sub dup mul
8793: 3 1 roll
8794: sub dup mul
8795: add 0.5 exp 72 div
8796: 0 72 matrix defaultmatrix dtransform dup mul exch dup mul add sqrt
8797: 72 0 matrix defaultmatrix dtransform dup mul exch dup mul add sqrt
8798: 1 index 1 index lt { exch } if pop
8799: mul
8800: /numpix exch def
8801: numpix 0 ne
8802: {
8803: NumSamples numpix div 0.5 gt
8804: {
8805: /numsteps numpix 2 div round cvi dup 1 le { pop 2 } if def
8806: /rampIndxInc NumSamples 1 sub numsteps div def
8807: /subsampling true def
8808: } if
8809: } if
8810: ext0 {
8811: 0 getrampcolor
8812: xMin xStart lt
8813: { xMin yMin xMin neg ySpan rectfill } if
8814: } if
8815: /xInc xEnd xStart sub numsteps div def
8816: /x xStart def
8817: 0
8818: numsteps
8819: {
8820: dup
8821: subsampling { round cvi } if
8822: getrampcolor
8823: x yMin xInc ySpan rectfill
8824: /x x xInc add def
8825: rampIndxInc add
8826: }
8827: repeat
8828: pop
8829: ext1 {
8830: xMax xEnd gt
8831: { xEnd yMin xMax xEnd sub ySpan rectfill } if
8832: } if
8833: grestore
8834: grestore
8835: end
8836: end
8837: end
8838: } ifelse
8839: } bd
8840: /RadialShade {
8841: 40 dict begin
8842: /background exch def
8843: /ext1 exch def
8844: /ext0 exch def
8845: /BBox exch def
8846: /r2 exch def
8847: /c2y exch def
8848: /c2x exch def
8849: /r1 exch def
8850: /c1y exch def
8851: /c1x exch def
8852: /rampdict exch def
8853: gsave
8854: BBox length 0 gt {
8855: BBox 0 get BBox 1 get
8856: BBox 2 get BBox 0 get sub
8857: BBox 3 get BBox 1 get sub
8858: rectclip
8859: } if
8860: gsave
8861: clippath
8862: pathbbox
8863: /BByMax exch def
8864: /BBxMax exch def
8865: /BByMin exch def
8866: /BBxMin exch def
8867: grestore
8868: BBxMax BBxMin eq BByMax BByMin eq or
8869: {
8870: grestore
8871: end
8872: }
8873: {
8874: rampdict begin
8875: 20 dict begin
8876: background length 0 gt { background L1setcolor gsave clippath fill grestore } if
8877: /areaOfConcern
8878: BBxMin BByMin BBxMax BByMax
8879: BBxMin BByMin
8880: BBxMax BBxMin sub 0
8881: 0 BByMax BByMin sub
8882: BBxMin BBxMax sub 0
8883: 12 packedarray
8884: < 0B 00 01 04 04 04 0A>
8885: 2 packedarray
8886: def
8887: c1x c2x sub dup mul
8888: c1y c2y sub dup mul
8889: add 0.5 exp
8890: r1 add
8891: r2 sub
8892: abs
8893: 0 dtransform
8894: dup mul exch dup mul add 0.5 exp 72 div
8895: 0 72 matrix defaultmatrix dtransform dup mul exch dup mul add sqrt
8896: 72 0 matrix defaultmatrix dtransform dup mul exch dup mul add sqrt
8897: 1 index 1 index lt { exch } if pop
8898: /hires exch def
8899: hires mul
8900: /numpix exch def
8901: /numsteps NumSamples def
8902: /rampIndxInc 1 def
8903: /subsampling false def
8904: numpix 0 ne
8905: {
8906: NumSamples numpix div 0.5 gt
8907: {
8908: /numsteps numpix 2 div round cvi dup 1 le { pop 2 } if def
8909: /rampIndxInc NumSamples 1 sub numsteps div def
8910: /subsampling true def
8911: } if
8912: } if
8913: /xInc c2x c1x sub numsteps div def
8914: /yInc c2y c1y sub numsteps div def
8915: /rInc r2 r1 sub numsteps div def
8916: /cx c1x def
8917: /cy c1y def
8918: /radius r1 def
8919: newpath
8920: xInc 0 eq yInc 0 eq rInc 0 eq and and
8921: {
8922: 0 getrampcolor
8923: cx cy radius 0 360 arc
8924: stroke
8925: NumSamples 1 sub getrampcolor
8926: cx cy radius 72 hires div add 0 360 arc
8927: 0 setlinewidth
8928: stroke
8929: }
8930: {
8931: 0
8932: numsteps
8933: {
8934: dup
8935: subsampling { round cvi } if
8936: getrampcolor
8937: cx cy radius 0 360 arc
8938: /cx cx xInc add def
8939: /cy cy yInc add def
8940: /radius radius rInc add def
8941: cx cy radius 360 0 arcn
8942: eofill
8943: rampIndxInc add
8944: }
8945: repeat
8946: pop
8947: } ifelse
8948: grestore
8949: end
8950: end
8951: end
8952: } ifelse
8953: } bd
8954: %%EndResource
8955: %%BeginResource: procset pdftext
8956: %%Version: 5.0 5
8957: %%Copyright: Copyright 1987-2001 Adobe Systems Incorporated. All Rights Reserved.
8958: %%Title: Text operators for PDF
8959: PDF /PDFText 78 dict dup begin put
8960: /docinitialize
8961: {
8962: /resourcestatus where {
8963: pop
8964: /CIDParams /ProcSet resourcestatus {
8965: pop pop
8966: false /CIDParams /ProcSet findresource /SetBuildCompatible get exec
8967: } if
8968: } if
8969: PDF begin
8970: PDFText /_pdfDefineIdentity-H known
8971: { PDFText /_pdfDefineIdentity-H get exec}
8972: if
8973: end
8974: } bd
8975: /initialize {
8976: PDFText begin
8977: } bd
8978: /terminate { end } bd
8979: Level2?
8980: {
8981: /_safeput
8982: {
8983: 3 -1 roll load 3 1 roll put
8984: }
8985: bd
8986: }
8987: {
8988: /_safeput
8989: {
8990: 2 index load dup dup length exch maxlength ge
8991: { dup length 5 add dict copy
8992: 3 index xdd
8993: }
8994: { pop }
8995: ifelse
8996: 3 -1 roll load 3 1 roll put
8997: }
8998: bd
8999: }
9000: ifelse
9001: /pdf_has_composefont? systemdict /composefont known def
9002: /CopyFont {
9003: {
9004: 1 index /FID ne 2 index /UniqueID ne and
9005: { def } { pop pop } ifelse
9006: } forall
9007: } bd
9008: /Type0CopyFont
9009: {
9010: exch
9011: dup length dict
9012: begin
9013: CopyFont
9014: [
9015: exch
9016: FDepVector
9017: {
9018: dup /FontType get 0 eq
9019: {
9020: 1 index Type0CopyFont
9021: /_pdfType0 exch definefont
9022: }
9023: {
9024: /_pdfBaseFont exch
9025: 2 index exec
9026: }
9027: ifelse
9028: exch
9029: }
9030: forall
9031: pop
9032: ]
9033: /FDepVector exch def
9034: currentdict
9035: end
9036: } bd
9037: Level2? {currentglobal true setglobal} if
9038: /cHexEncoding
9039: [/c00/c01/c02/c03/c04/c05/c06/c07/c08/c09/c0A/c0B/c0C/c0D/c0E/c0F/c10/c11/c12
9040: /c13/c14/c15/c16/c17/c18/c19/c1A/c1B/c1C/c1D/c1E/c1F/c20/c21/c22/c23/c24/c25
9041: /c26/c27/c28/c29/c2A/c2B/c2C/c2D/c2E/c2F/c30/c31/c32/c33/c34/c35/c36/c37/c38
9042: /c39/c3A/c3B/c3C/c3D/c3E/c3F/c40/c41/c42/c43/c44/c45/c46/c47/c48/c49/c4A/c4B
9043: /c4C/c4D/c4E/c4F/c50/c51/c52/c53/c54/c55/c56/c57/c58/c59/c5A/c5B/c5C/c5D/c5E
9044: /c5F/c60/c61/c62/c63/c64/c65/c66/c67/c68/c69/c6A/c6B/c6C/c6D/c6E/c6F/c70/c71
9045: /c72/c73/c74/c75/c76/c77/c78/c79/c7A/c7B/c7C/c7D/c7E/c7F/c80/c81/c82/c83/c84
9046: /c85/c86/c87/c88/c89/c8A/c8B/c8C/c8D/c8E/c8F/c90/c91/c92/c93/c94/c95/c96/c97
9047: /c98/c99/c9A/c9B/c9C/c9D/c9E/c9F/cA0/cA1/cA2/cA3/cA4/cA5/cA6/cA7/cA8/cA9/cAA
9048: /cAB/cAC/cAD/cAE/cAF/cB0/cB1/cB2/cB3/cB4/cB5/cB6/cB7/cB8/cB9/cBA/cBB/cBC/cBD
9049: /cBE/cBF/cC0/cC1/cC2/cC3/cC4/cC5/cC6/cC7/cC8/cC9/cCA/cCB/cCC/cCD/cCE/cCF/cD0
9050: /cD1/cD2/cD3/cD4/cD5/cD6/cD7/cD8/cD9/cDA/cDB/cDC/cDD/cDE/cDF/cE0/cE1/cE2/cE3
9051: /cE4/cE5/cE6/cE7/cE8/cE9/cEA/cEB/cEC/cED/cEE/cEF/cF0/cF1/cF2/cF3/cF4/cF5/cF6
9052: /cF7/cF8/cF9/cFA/cFB/cFC/cFD/cFE/cFF] def
9053: Level2? {setglobal} if
9054: /modEnc {
9055: /_enc xdd
9056: /_icode 0 dd
9057: counttomark 1 sub -1 0
9058: {
9059: index
9060: dup type /nametype eq
9061: {
9062: _enc _icode 3 -1 roll put
9063: _icode 1 add
9064: }
9065: if
9066: /_icode xdd
9067: } for
9068: cleartomark
9069: _enc
9070: } bd
9071: /trEnc {
9072: /_enc xdd
9073: 255 -1 0 {
9074: exch dup -1 eq
9075: { pop /.notdef }
9076: { Encoding exch get }
9077: ifelse
9078: _enc 3 1 roll put
9079: } for
9080: pop
9081: _enc
9082: } bd
9083: /TE {
9084: /_i xdd
9085: StandardEncoding 256 array copy modEnc
9086: _pdfEncodings exch _i exch put
9087: } bd
9088: /TZ
9089: {
9090: /_usePDFEncoding xdd
9091: findfont
9092: dup length 6 add dict
9093: begin
9094: {
9095: 1 index /FID ne { def } { pop pop } ifelse
9096: } forall
9097: /pdf_origFontName FontName def
9098: /FontName exch def
9099: currentdict /PaintType known
9100: { PaintType 2 eq {/PaintType 0 def} if }
9101: if
9102: _usePDFEncoding 0 ge
9103: {
9104: /Encoding _pdfEncodings _usePDFEncoding get def
9105: pop
9106: }
9107: {
9108: _usePDFEncoding -1 eq
9109: {
9110: counttomark 0 eq
9111: { pop }
9112: {
9113: Encoding 256 array copy
9114: modEnc /Encoding exch def
9115: }
9116: ifelse
9117: }
9118: {
9119: 256 array
9120: trEnc /Encoding exch def
9121: }
9122: ifelse
9123: }
9124: ifelse
9125: pdf_EuroProcSet pdf_origFontName known
9126: {
9127: pdf_origFontName pdf_AddEuroGlyphProc
9128: } if
9129: Level2?
9130: {
9131: currentdict /pdf_origFontName undef
9132: } if
9133: FontName currentdict
9134: end
9135: definefont pop
9136: }
9137: bd
9138: Level2?
9139: {
9140: /TZG
9141: {
9142: currentglobal true setglobal
9143: 2 index _pdfFontStatus
9144: {
9145: 2 index findfont
9146: false setglobal
9147: 3 index findfont
9148: true setglobal
9149: ne
9150: {
9151: 2 index findfont dup rcheck
9152: {
9153: dup length dict begin
9154: {
9155: 1 index /FID ne { def } { pop pop } ifelse
9156: } forall
9157: currentdict end
9158: }
9159: if
9160: 3 index exch definefont pop
9161: }
9162: if
9163: } if
9164: setglobal
9165: TZ
9166: } bd
9167: }
9168: {
9169: /TZG {TZ} bd
9170: } ifelse
9171: Level2?
9172: {
9173: currentglobal false setglobal
9174: userdict /pdftext_data 5 dict put
9175: pdftext_data
9176: begin
9177: /saveStacks
9178: {
9179: pdftext_data
9180: begin
9181: /vmmode currentglobal def
9182: false setglobal
9183: count array astore /os exch def
9184: end
9185: countdictstack array dictstack pdftext_data exch /ds exch put
9186: cleardictstack pdftext_data /dscount countdictstack put
9187: pdftext_data /vmmode get setglobal
9188: } bind def
9189: /restoreStacks
9190: {
9191: pdftext_data /vmmode currentglobal put false setglobal
9192: clear cleardictstack
9193: pdftext_data /ds get dup
9194: pdftext_data /dscount get 1 2 index length 1 sub
9195: { get begin dup } for
9196: pop pop
9197: pdftext_data /os get aload pop
9198: pdftext_data /vmmode get setglobal
9199: } bind def
9200: /testForClonePrinterBug
9201: {
9202: currentglobal true setglobal
9203: /undefinedCategory /Generic /Category findresource
9204: dup length dict copy /Category defineresource pop
9205: setglobal
9206: pdftext_data /saveStacks get exec
9207: pdftext_data /vmmode currentglobal put false setglobal
9208: /undefined /undefinedCategory { resourcestatus } stopped
9209: pdftext_data exch /bugFound exch put
9210: pdftext_data /vmmode get setglobal
9211: pdftext_data /restoreStacks get exec
9212: pdftext_data /bugFound get
9213: } bind def
9214: end
9215: setglobal
9216: /pdf_resourcestatus
9217: pdftext_data /testForClonePrinterBug get exec
9218: {
9219: {
9220: pdftext_data /saveStacks get exec
9221: pdftext_data /os get dup dup length 1 sub
9222: dup 1 sub dup 0 lt { pop 0 } if
9223: exch 1 exch { get exch dup } for
9224: pop pop
9225: { resourcestatus }
9226: stopped
9227: {
9228: clear cleardictstack pdftext_data /restoreStacks get exec
9229: { pop pop } stopped pop false
9230: }
9231: {
9232: count array astore pdftext_data exch /results exch put
9233: pdftext_data /restoreStacks get exec pop pop
9234: pdftext_data /results get aload pop
9235: }
9236: ifelse
9237: }
9238: }
9239: { { resourcestatus } }
9240: ifelse
9241: bd
9242: }
9243: if
9244: Level2?
9245: {
9246: /_pdfUndefineResource
9247: {
9248: currentglobal 3 1 roll
9249: _pdf_FontDirectory 2 index 2 copy known
9250: {undef}
9251: {pop pop}
9252: ifelse
9253: 1 index (pdf) exch _pdfConcatNames 1 index
9254: 1 index 1 _pdfConcatNames 1 index
9255: 5 index 1 _pdfConcatNames 1 index
9256: 4
9257: {
9258: 2 copy pdf_resourcestatus
9259: {
9260: pop 2 lt
9261: {2 copy findresource gcheck setglobal undefineresource}
9262: {pop pop}
9263: ifelse
9264: }
9265: { pop pop}
9266: ifelse
9267: } repeat
9268: setglobal
9269: } bd
9270: }
9271: {
9272: /_pdfUndefineResource { pop pop} bd
9273: }
9274: ifelse
9275: Level2?
9276: {
9277: /_pdfFontStatus
9278: {
9279: currentglobal exch
9280: /Font pdf_resourcestatus
9281: {pop pop true}
9282: {false}
9283: ifelse
9284: exch setglobal
9285: } bd
9286: }
9287: {
9288: /_pdfFontStatusString 50 string def
9289: _pdfFontStatusString 0 (fonts/) putinterval
9290: /_pdfFontStatus
9291: {
9292: FontDirectory 1 index known
9293: { pop true }
9294: {
9295: _pdfFontStatusString 6 42 getinterval
9296: cvs length 6 add
9297: _pdfFontStatusString exch 0 exch getinterval
9298: { status } stopped
9299: {pop false}
9300: {
9301: { pop pop pop pop true}
9302: { false }
9303: ifelse
9304: }
9305: ifelse
9306: }
9307: ifelse
9308: } bd
9309: }
9310: ifelse
9311: Level2?
9312: {
9313: /_pdfCIDFontStatus
9314: {
9315: /CIDFont /Category pdf_resourcestatus
9316: {
9317: pop pop
9318: /CIDFont pdf_resourcestatus
9319: {pop pop true}
9320: {false}
9321: ifelse
9322: }
9323: { pop false }
9324: ifelse
9325: } bd
9326: }
9327: if
9328: /_pdfString100 100 string def
9329: /_pdfComposeFontName
9330: {
9331: dup length 1 eq
9332: {
9333: 0 get
9334: 1 index
9335: type /nametype eq
9336: {
9337: _pdfString100 cvs
9338: length dup dup _pdfString100 exch (-) putinterval
9339: _pdfString100 exch 1 add dup _pdfString100 length exch sub getinterval
9340: 2 index exch cvs length
9341: add 1 add _pdfString100 exch 0 exch getinterval
9342: exch pop
9343: true
9344: }
9345: {
9346: pop pop
9347: false
9348: }
9349: ifelse
9350: }
9351: {
9352: false
9353: }
9354: ifelse
9355: dup {exch cvn exch} if
9356: } bd
9357: /_pdfConcatNames
9358: {
9359: exch
9360: _pdfString100 cvs
9361: length dup dup _pdfString100 exch (-) putinterval
9362: _pdfString100 exch 1 add dup _pdfString100 length exch sub getinterval
9363: 3 -1 roll exch cvs length
9364: add 1 add _pdfString100 exch 0 exch getinterval
9365: cvn
9366: } bind def
9367: /_pdfTextTempString 50 string def
9368: /_pdfRegOrderingArray [(Adobe-Japan1) (Adobe-CNS1) (Adobe-Korea1) (Adobe-GB1)] def
9369: /_pdf_CheckCIDSystemInfo
9370: {
9371: 1 index _pdfTextTempString cvs
9372: (Identity) anchorsearch
9373: {
9374: pop pop pop pop true
9375: }
9376: {
9377: false
9378: _pdfRegOrderingArray
9379: {
9380: 2 index exch
9381: anchorsearch
9382: { pop pop pop true exit}
9383: { pop }
9384: ifelse
9385: }
9386: forall
9387: exch pop
9388: exch /CIDFont findresource
9389: /CIDSystemInfo get
9390: 3 -1 roll /CMap findresource
9391: /CIDSystemInfo get
9392: exch
9393: 3 -1 roll
9394: {
9395: 2 copy
9396: /Supplement get
9397: exch
9398: dup type /dicttype eq
9399: {/Supplement get}
9400: {pop 0 }
9401: ifelse
9402: ge
9403: }
9404: { true }
9405: ifelse
9406: {
9407: dup /Registry get
9408: 2 index /Registry get eq
9409: {
9410: /Ordering get
9411: exch /Ordering get
9412: dup type /arraytype eq
9413: {
9414: 1 index type /arraytype eq
9415: {
9416: true
9417: 1 index length 1 sub -1 0
9418: {
9419: dup 2 index exch get exch 3 index exch get ne
9420: { pop false exit}
9421: if
9422: } for
9423: exch pop exch pop
9424: }
9425: { pop pop false }
9426: ifelse
9427: }
9428: {
9429: eq
9430: }
9431: ifelse
9432: }
9433: { pop pop false }
9434: ifelse
9435: }
9436: { pop pop false }
9437: ifelse
9438: }
9439: ifelse
9440: } bind def
9441: pdf_has_composefont?
9442: {
9443: /_pdfComposeFont
9444: {
9445: 2 copy _pdfComposeFontName not
9446: {
9447: 2 index
9448: }
9449: if
9450: (pdf) exch _pdfConcatNames
9451: dup _pdfFontStatus
9452: { dup findfont 5 2 roll pop pop pop true}
9453: {
9454: 4 1 roll
9455: 1 index /CMap pdf_resourcestatus
9456: {
9457: pop pop
9458: true
9459: }
9460: {false}
9461: ifelse
9462: 1 index true exch
9463: {
9464: _pdfCIDFontStatus not
9465: {pop false exit}
9466: if
9467: }
9468: forall
9469: and
9470: {
9471: 1 index 1 index 0 get _pdf_CheckCIDSystemInfo
9472: {
9473: 3 -1 roll pop
9474: 2 index 3 1 roll
9475: composefont true
9476: }
9477: {
9478: pop pop exch pop false
9479: }
9480: ifelse
9481: }
9482: {
9483: _pdfComposeFontName
9484: {
9485: dup _pdfFontStatus
9486: {
9487: exch pop
9488: 1 index exch
9489: findfont definefont true
9490: }
9491: {
9492: pop exch pop
9493: false
9494: }
9495: ifelse
9496: }
9497: {
9498: exch pop
9499: false
9500: }
9501: ifelse
9502: }
9503: ifelse
9504: { true }
9505: {
9506: dup _pdfFontStatus
9507: { dup findfont true }
9508: { pop false }
9509: ifelse
9510: }
9511: ifelse
9512: }
9513: ifelse
9514: } bd
9515: }
9516: {
9517: /_pdfComposeFont
9518: {
9519: _pdfComposeFontName not
9520: {
9521: dup
9522: }
9523: if
9524: dup
9525: _pdfFontStatus
9526: {exch pop dup findfont true}
9527: {
9528: 1 index
9529: dup type /nametype eq
9530: {pop}
9531: {cvn}
9532: ifelse
9533: eq
9534: {pop false}
9535: {
9536: dup _pdfFontStatus
9537: {dup findfont true}
9538: {pop false}
9539: ifelse
9540: }
9541: ifelse
9542: }
9543: ifelse
9544: } bd
9545: }
9546: ifelse
9547: /_pdfStyleDicts 4 dict dup begin
9548: /Adobe-Japan1 4 dict dup begin
9549: Level2?
9550: {
9551: /Serif
9552: /HeiseiMin-W3-83pv-RKSJ-H _pdfFontStatus
9553: {/HeiseiMin-W3}
9554: {
9555: /HeiseiMin-W3 _pdfCIDFontStatus
9556: {/HeiseiMin-W3}
9557: {/Ryumin-Light}
9558: ifelse
9559: }
9560: ifelse
9561: def
9562: /SansSerif
9563: /HeiseiKakuGo-W5-83pv-RKSJ-H _pdfFontStatus
9564: {/HeiseiKakuGo-W5}
9565: {
9566: /HeiseiKakuGo-W5 _pdfCIDFontStatus
9567: {/HeiseiKakuGo-W5}
9568: {/GothicBBB-Medium}
9569: ifelse
9570: }
9571: ifelse
9572: def
9573: /HeiseiMaruGo-W4-83pv-RKSJ-H _pdfFontStatus
9574: {/HeiseiMaruGo-W4}
9575: {
9576: /HeiseiMaruGo-W4 _pdfCIDFontStatus
9577: {/HeiseiMaruGo-W4}
9578: {
9579: /Jun101-Light-RKSJ-H _pdfFontStatus
9580: { /Jun101-Light }
9581: { SansSerif }
9582: ifelse
9583: }
9584: ifelse
9585: }
9586: ifelse
9587: /RoundSansSerif exch def
9588: /Default Serif def
9589: }
9590: {
9591: /Serif /Ryumin-Light def
9592: /SansSerif /GothicBBB-Medium def
9593: {
9594: (fonts/Jun101-Light-83pv-RKSJ-H) status
9595: }stopped
9596: {pop}{
9597: { pop pop pop pop /Jun101-Light }
9598: { SansSerif }
9599: ifelse
9600: /RoundSansSerif exch def
9601: }ifelse
9602: /Default Serif def
9603: }
9604: ifelse
9605: end
9606: def
9607: /Adobe-Korea1 4 dict dup begin
9608: /Serif /HYSMyeongJo-Medium def
9609: /SansSerif /HYGoThic-Medium def
9610: /RoundSansSerif SansSerif def
9611: /Default Serif def
9612: end
9613: def
9614: /Adobe-GB1 4 dict dup begin
9615: /Serif /STSong-Light def
9616: /SansSerif /STHeiti-Regular def
9617: /RoundSansSerif SansSerif def
9618: /Default Serif def
9619: end
9620: def
9621: /Adobe-CNS1 4 dict dup begin
9622: /Serif /MKai-Medium def
9623: /SansSerif /MHei-Medium def
9624: /RoundSansSerif SansSerif def
9625: /Default Serif def
9626: end
9627: def
9628: end
9629: def
9630: /TZzero
9631: {
9632: /_wmode xdd
9633: /_styleArr xdd
9634: /_regOrdering xdd
9635: 3 copy
9636: _pdfComposeFont
9637: {
9638: 5 2 roll pop pop pop
9639: }
9640: {
9641: [
9642: 0 1 _styleArr length 1 sub
9643: {
9644: _styleArr exch get
9645: _pdfStyleDicts _regOrdering 2 copy known
9646: {
9647: get
9648: exch 2 copy known not
9649: { pop /Default }
9650: if
9651: get
9652: }
9653: {
9654: pop pop pop /Unknown
9655: }
9656: ifelse
9657: }
9658: for
9659: ]
9660: exch pop
9661: 2 index 3 1 roll
9662: _pdfComposeFont
9663: {3 -1 roll pop}
9664: {
9665: findfont dup /FontName get exch
9666: }
9667: ifelse
9668: }
9669: ifelse
9670: dup /WMode 2 copy known
9671: { get _wmode ne }
9672: { pop pop _wmode 1 eq}
9673: ifelse
9674: {
9675: exch _wmode _pdfConcatNames
9676: dup _pdfFontStatus
9677: { exch pop dup findfont false}
9678: { exch true }
9679: ifelse
9680: }
9681: {
9682: dup /FontType get 0 ne
9683: }
9684: ifelse
9685: {
9686: dup /FontType get 3 eq _wmode 1 eq and
9687: {
9688: _pdfVerticalRomanT3Font dup length 10 add dict copy
9689: begin
9690: /_basefont exch
9691: dup length 3 add dict
9692: begin
9693: {1 index /FID ne {def}{pop pop} ifelse }
9694: forall
9695: /Encoding Encoding dup length array copy
9696: dup 16#27 /quotesingle put
9697: dup 16#60 /grave put
9698: _regOrdering /Adobe-Japan1 eq
9699: {dup 16#5c /yen put dup 16#a5 /yen put dup 16#b4 /yen put}
9700: if
9701: def
9702: FontName
9703: currentdict
9704: end
9705: definefont
9706: def
9707: /Encoding _basefont /Encoding get def
9708: /_fauxfont true def
9709: }
9710: {
9711: dup length 3 add dict
9712: begin
9713: {1 index /FID ne {def}{pop pop} ifelse }
9714: forall
9715: FontType 0 ne
9716: {
9717: /Encoding Encoding dup length array copy
9718: dup 16#27 /quotesingle put
9719: dup 16#60 /grave put
9720: _regOrdering /Adobe-Japan1 eq
9721: {dup 16#5c /yen put}
9722: if
9723: def
9724: /_fauxfont true def
9725: } if
9726: } ifelse
9727: /WMode _wmode def
9728: dup dup /FontName exch def
9729: currentdict
9730: end
9731: definefont pop
9732: }
9733: {
9734: pop
9735: }
9736: ifelse
9737: /_pdf_FontDirectory 3 1 roll _safeput
9738: }
9739: bd
9740: Level2?
9741: {
9742: /Tf {
9743: _pdf_FontDirectory 2 index 2 copy known
9744: {get exch 3 -1 roll pop}
9745: {pop pop}
9746: ifelse
9747: selectfont
9748: } bd
9749: }
9750: {
9751: /Tf {
9752: _pdf_FontDirectory 2 index 2 copy known
9753: {get exch 3 -1 roll pop}
9754: {pop pop}
9755: ifelse
9756: exch findfont exch
9757: dup type /arraytype eq
9758: {makefont}
9759: {scalefont}
9760: ifelse
9761: setfont
9762: } bd
9763: }
9764: ifelse
9765: /cshow where
9766: {
9767: pop /pdf_cshow /cshow load dd
9768: /pdf_remove2 {pop pop} dd
9769: }
9770: {
9771: /pdf_cshow {exch forall} dd
9772: /pdf_remove2 {} dd
9773: } ifelse
9774: /pdf_xshow
9775: {
9776: /_pdf_na xdd
9777: /_pdf_i 0 dd
9778: currentpoint
9779: /_pdf_y xdd
9780: /_pdf_x xdd
9781: {
9782: pdf_remove2
9783: _pdf_str1 exch 0 exch put
9784: _pdf_str1 /_pdf_showproc load exec
9785: {_pdf_na _pdf_i get} stopped
9786: { pop pop }
9787: {
9788: _pdf_x _pdf_y moveto
9789: 0
9790: rmoveto
9791: }
9792: ifelse
9793: _pdf_i 1 add /_pdf_i xdd
9794: currentpoint
9795: /_pdf_y xdd
9796: /_pdf_x xdd
9797: }
9798: exch
9799: pdf_cshow
9800: } bd
9801: /pdf_yshow
9802: {
9803: /_pdf_na xdd
9804: /_pdf_i 0 dd
9805: currentpoint
9806: /_pdf_y xdd
9807: /_pdf_x xdd
9808: {
9809: pdf_remove2
9810: _pdf_str1 exch 0 exch put
9811: _pdf_str1 /_pdf_showproc load exec
9812: {_pdf_na _pdf_i get} stopped
9813: { pop pop }
9814: {
9815: _pdf_x _pdf_y moveto
9816: 0 exch
9817: rmoveto
9818: }
9819: ifelse
9820: _pdf_i 1 add /_pdf_i xdd
9821: currentpoint
9822: /_pdf_y xdd
9823: /_pdf_x xdd
9824: }
9825: exch
9826: pdf_cshow
9827: } bd
9828: /pdf_xyshow
9829: {
9830: /_pdf_na xdd
9831: /_pdf_i 0 dd
9832: currentpoint
9833: /_pdf_y xdd
9834: /_pdf_x xdd
9835: {
9836: pdf_remove2
9837: _pdf_str1 exch 0 exch put
9838: _pdf_str1 /_pdf_showproc load exec
9839: {_pdf_na _pdf_i get} stopped
9840: { pop pop }
9841: {
9842: {_pdf_na _pdf_i 1 add get} stopped
9843: { pop pop pop}
9844: {
9845: _pdf_x _pdf_y moveto
9846: rmoveto
9847: }
9848: ifelse
9849: }
9850: ifelse
9851: _pdf_i 2 add /_pdf_i xdd
9852: currentpoint
9853: /_pdf_y xdd
9854: /_pdf_x xdd
9855: }
9856: exch
9857: pdf_cshow
9858: } bd
9859: /pdfl1xs {/_pdf_showproc /show load dd pdf_xshow} bd
9860: /pdfl1ys {/_pdf_showproc /show load dd pdf_yshow} bd
9861: /pdfl1xys {/_pdf_showproc /show load dd pdf_xyshow} bd
9862: Level2? _ColorSep5044? not and
9863: {
9864: /pdfxs {{xshow} stopped {pdfl1xs} if} bd
9865: /pdfys {{yshow} stopped {pdfl1ys} if} bd
9866: /pdfxys {{xyshow} stopped {pdfl1xys} if} bd
9867: }
9868: {
9869: /pdfxs /pdfl1xs load dd
9870: /pdfys /pdfl1ys load dd
9871: /pdfxys /pdfl1xys load dd
9872: } ifelse
9873: /pdf_charpath {false charpath} bd
9874: /pdf_xcharpath {/_pdf_showproc /pdf_charpath load dd pdf_xshow} bd
9875: /pdf_ycharpath {/_pdf_showproc /pdf_charpath load dd pdf_yshow} bd
9876: /pdf_xycharpath {/_pdf_showproc /pdf_charpath load dd pdf_xyshow} bd
9877: /pdf_strokepath
9878: {
9879: {
9880: pdf_remove2
9881: _pdf_str1 exch 0 exch put
9882: _pdf_str1 false charpath
9883: currentpoint S moveto
9884: } bind
9885: exch pdf_cshow
9886: } bd
9887: /pdf_xstrokepath {/_pdf_showproc {pdf_charpath S} dd pdf_xshow} bd
9888: /pdf_ystrokepath {/_pdf_showproc {pdf_charpath S} dd pdf_yshow} bd
9889: /pdf_xystrokepath {/_pdf_showproc {pdf_charpath S} load dd pdf_xyshow} bd
9890: Level2? {currentglobal true setglobal} if
9891: /d0/setcharwidth ld
9892: /nND {{/.notdef} repeat} bd
9893: /T3Defs {
9894: /BuildChar
9895: {
9896: 1 index /Encoding get exch get
9897: 1 index /BuildGlyph get exec
9898: }
9899: def
9900: /BuildGlyph {
9901: exch begin
9902: GlyphProcs exch get exec
9903: end
9904: } def
9905: /_pdfT3Font true def
9906: } bd
9907: /_pdfBoldRomanWidthProc
9908: {
9909: stringwidth 1 index 0 ne { exch .03 add exch }if setcharwidth
9910: 0 0
9911: } bd
9912: /_pdfType0WidthProc
9913: {
9914: dup stringwidth 0 0 moveto
9915: 2 index true charpath pathbbox
9916: 0 -1
9917: 7 index 2 div .88
9918: setcachedevice2
9919: pop
9920: 0 0
9921: } bd
9922: /_pdfType0WMode1WidthProc
9923: {
9924: dup stringwidth
9925: pop 2 div neg -0.88
9926: 2 copy
9927: moveto
9928: 0 -1
9929: 5 -1 roll true charpath pathbbox
9930: setcachedevice
9931: } bd
9932: /_pdfBoldBaseFont
9933: 11 dict begin
9934: /FontType 3 def
9935: /FontMatrix[1 0 0 1 0 0]def
9936: /FontBBox[0 0 1 1]def
9937: /Encoding cHexEncoding def
9938: /_setwidthProc /_pdfBoldRomanWidthProc load def
9939: /_bcstr1 1 string def
9940: /BuildChar
9941: {
9942: exch begin
9943: _basefont setfont
9944: _bcstr1 dup 0 4 -1 roll put
9945: dup
9946: _setwidthProc
9947: 3 copy
9948: moveto
9949: show
9950: _basefonto setfont
9951: moveto
9952: show
9953: end
9954: }bd
9955: currentdict
9956: end
9957: def
9958: pdf_has_composefont?
9959: {
9960: /_pdfBoldBaseCIDFont
9961: 11 dict begin
9962: /CIDFontType 1 def
9963: /CIDFontName /_pdfBoldBaseCIDFont def
9964: /FontMatrix[1 0 0 1 0 0]def
9965: /FontBBox[0 0 1 1]def
9966: /_setwidthProc /_pdfType0WidthProc load def
9967: /_bcstr2 2 string def
9968: /BuildGlyph
9969: {
9970: exch begin
9971: _basefont setfont
9972: _bcstr2 1 2 index 256 mod put
9973: _bcstr2 0 3 -1 roll 256 idiv put
9974: _bcstr2 dup _setwidthProc
9975: 3 copy
9976: moveto
9977: show
9978: _basefonto setfont
9979: moveto
9980: show
9981: end
9982: }bd
9983: currentdict
9984: end
9985: def
9986: /_pdfDefineIdentity-H
9987: {
9988: /Identity-H /CMap PDFText /pdf_resourcestatus get exec
9989: {
9990: pop pop
9991: }
9992: {
9993: /CIDInit/ProcSet findresource begin 12 dict begin
9994: begincmap
9995: /CIDSystemInfo
9996: 3 dict begin
9997: /Registry (Adobe) def
9998: /Ordering (Identity) def
9999: /Supplement 0 def
10000: currentdict
10001: end
10002: def
10003: /CMapName /Identity-H def
10004: /CMapVersion 1 def
10005: /CMapType 1 def
10006: 1 begincodespacerange
10007: <0000> <ffff>
10008: endcodespacerange
10009: 1 begincidrange
10010: <0000> <ffff> 0
10011: endcidrange
10012: endcmap
10013: CMapName currentdict/CMap defineresource pop
10014: end
10015: end
10016: } ifelse
10017: } def
10018: } if
10019: /_pdfVerticalRomanT3Font
10020: 10 dict begin
10021: /FontType 3 def
10022: /FontMatrix[1 0 0 1 0 0]def
10023: /FontBBox[0 0 1 1]def
10024: /_bcstr1 1 string def
10025: /BuildChar
10026: {
10027: exch begin
10028: _basefont setfont
10029: _bcstr1 dup 0 4 -1 roll put
10030: dup
10031: _pdfType0WidthProc
10032: moveto
10033: show
10034: end
10035: }bd
10036: currentdict
10037: end
10038: def
10039: Level2? {setglobal} if
10040: /MakeBoldFont
10041: {
10042: dup /ct_SyntheticBold known
10043: {
10044: dup length 3 add dict begin
10045: CopyFont
10046: /ct_StrokeWidth .03 0 FontMatrix idtransform pop def
10047: /ct_SyntheticBold true def
10048: currentdict
10049: end
10050: definefont
10051: }
10052: {
10053: dup dup length 3 add dict
10054: begin
10055: CopyFont
10056: /PaintType 2 def
10057: /StrokeWidth .03 0 FontMatrix idtransform pop def
10058: /dummybold currentdict
10059: end
10060: definefont
10061: dup /FontType get dup 9 ge exch 11 le and
10062: {
10063: _pdfBoldBaseCIDFont
10064: dup length 3 add dict copy begin
10065: dup /CIDSystemInfo get /CIDSystemInfo exch def
10066: /_Type0Identity /Identity-H 3 -1 roll [ exch ] composefont
10067: /_basefont exch def
10068: /_Type0Identity /Identity-H 3 -1 roll [ exch ] composefont
10069: /_basefonto exch def
10070: currentdict
10071: end
10072: /CIDFont defineresource
10073: }
10074: {
10075: _pdfBoldBaseFont
10076: dup length 3 add dict copy begin
10077: /_basefont exch def
10078: /_basefonto exch def
10079: currentdict
10080: end
10081: definefont
10082: }
10083: ifelse
10084: }
10085: ifelse
10086: } bd
10087: /MakeBold {
10088: 1 index
10089: _pdf_FontDirectory 2 index 2 copy known
10090: {get}
10091: {exch pop}
10092: ifelse
10093: findfont
10094: dup
10095: /FontType get 0 eq
10096: {
10097: dup /WMode known {dup /WMode get 1 eq }{false} ifelse
10098: version length 4 ge
10099: and
10100: {version 0 4 getinterval cvi 2015 ge }
10101: {true}
10102: ifelse
10103: {/_pdfType0WidthProc}
10104: {/_pdfType0WMode1WidthProc}
10105: ifelse
10106: _pdfBoldBaseFont /_setwidthProc 3 -1 roll load put
10107: {MakeBoldFont} Type0CopyFont definefont
10108: }
10109: {
10110: dup /_fauxfont known not 1 index /SubstMaster known not and
10111: {
10112: _pdfBoldBaseFont /_setwidthProc /_pdfBoldRomanWidthProc load put
10113: MakeBoldFont
10114: }
10115: {
10116: 2 index 2 index eq
10117: { exch pop }
10118: {
10119: dup length dict begin
10120: CopyFont
10121: currentdict
10122: end
10123: definefont
10124: }
10125: ifelse
10126: }
10127: ifelse
10128: }
10129: ifelse
10130: pop pop
10131: dup /dummybold ne
10132: {/_pdf_FontDirectory exch dup _safeput }
10133: { pop }
10134: ifelse
10135: }bd
10136: /MakeItalic {
10137: _pdf_FontDirectory exch 2 copy known
10138: {get}
10139: {exch pop}
10140: ifelse
10141: dup findfont
10142: dup /FontInfo 2 copy known
10143: {
10144: get
10145: /ItalicAngle 2 copy known
10146: {get 0 eq }
10147: { pop pop true}
10148: ifelse
10149: }
10150: { pop pop true}
10151: ifelse
10152: {
10153: exch pop
10154: dup /FontType get 0 eq Level2? not and
10155: { dup /FMapType get 6 eq }
10156: { false }
10157: ifelse
10158: {
10159: dup /WMode 2 copy known
10160: {
10161: get 1 eq
10162: { _italMtx_WMode1Type0 }
10163: { _italMtxType0 }
10164: ifelse
10165: }
10166: { pop pop _italMtxType0 }
10167: ifelse
10168: }
10169: {
10170: dup /WMode 2 copy known
10171: {
10172: get 1 eq
10173: { _italMtx_WMode1 }
10174: { _italMtx }
10175: ifelse
10176: }
10177: { pop pop _italMtx }
10178: ifelse
10179: }
10180: ifelse
10181: makefont
10182: dup /FontType get 42 eq Level2? not or
10183: {
10184: dup length dict begin
10185: CopyFont
10186: currentdict
10187: end
10188: }
10189: if
10190: 1 index exch
10191: definefont pop
10192: /_pdf_FontDirectory exch dup _safeput
10193: }
10194: {
10195: pop
10196: 2 copy ne
10197: {
10198: /_pdf_FontDirectory 3 1 roll _safeput
10199: }
10200: { pop pop }
10201: ifelse
10202: }
10203: ifelse
10204: }bd
10205: /MakeBoldItalic {
10206: /dummybold exch
10207: MakeBold
10208: /dummybold
10209: MakeItalic
10210: }bd
10211: Level2?
10212: {
10213: /pdf_CopyDict
10214: {1 index length add dict copy}
10215: def
10216: }
10217: {
10218: /pdf_CopyDict
10219: {
10220: 1 index length add dict
10221: 1 index wcheck
10222: { copy }
10223: { begin
10224: {def} forall
10225: currentdict
10226: end
10227: }
10228: ifelse
10229: }
10230: def
10231: }
10232: ifelse
10233: /pdf_AddEuroGlyphProc
10234: {
10235: currentdict /CharStrings known
10236: {
10237: CharStrings /Euro known not
10238: {
10239: dup
10240: /CharStrings
10241: CharStrings 1 pdf_CopyDict
10242: begin
10243: /Euro pdf_EuroProcSet 4 -1 roll get def
10244: currentdict
10245: end
10246: def
10247: /pdf_PSBuildGlyph /pdf_PSBuildGlyph load def
10248: /pdf_PathOps /pdf_PathOps load def
10249: /Symbol eq
10250: {
10251: /Encoding Encoding dup length array copy
10252: dup 160 /Euro put def
10253: }
10254: if
10255: }
10256: { pop
10257: }
10258: ifelse
10259: }
10260: { pop
10261: }
10262: ifelse
10263: }
10264: def
10265: Level2? {currentglobal true setglobal} if
10266: /pdf_PathOps 4 dict dup begin
10267: /m {moveto} def
10268: /l {lineto} def
10269: /c {curveto} def
10270: /cp {closepath} def
10271: end
10272: def
10273: /pdf_PSBuildGlyph
10274: {
10275: gsave
10276: 8 -1 roll pop
10277: 7 1 roll
10278: currentdict /PaintType 2 copy known {get 2 eq}{pop pop false} ifelse
10279: dup 9 1 roll
10280: {
10281: currentdict /StrokeWidth 2 copy known
10282: {
10283: get 2 div
10284: 5 1 roll
10285: 4 -1 roll 4 index sub
10286: 4 1 roll
10287: 3 -1 roll 4 index sub
10288: 3 1 roll
10289: exch 4 index add exch
10290: 4 index add
10291: 5 -1 roll pop
10292: }
10293: {
10294: pop pop
10295: }
10296: ifelse
10297: }
10298: if
10299: setcachedevice
10300: pdf_PathOps begin
10301: exec
10302: end
10303: {
10304: currentdict /StrokeWidth 2 copy known
10305: { get }
10306: { pop pop 0 }
10307: ifelse
10308: setlinewidth stroke
10309: }
10310: {
10311: fill
10312: }
10313: ifelse
10314: grestore
10315: } def
10316: /pdf_EuroProcSet 13 dict def
10317: pdf_EuroProcSet
10318: begin
10319: /Courier-Bold
10320: {
10321: 600 0 6 -12 585 612
10322: {
10323: 385 274 m
10324: 180 274 l
10325: 179 283 179 293 179 303 c
10326: 179 310 179 316 180 323 c
10327: 398 323 l
10328: 423 404 l
10329: 197 404 l
10330: 219 477 273 520 357 520 c
10331: 409 520 466 490 487 454 c
10332: 487 389 l
10333: 579 389 l
10334: 579 612 l
10335: 487 612 l
10336: 487 560 l
10337: 449 595 394 612 349 612 c
10338: 222 612 130 529 98 404 c
10339: 31 404 l
10340: 6 323 l
10341: 86 323 l
10342: 86 304 l
10343: 86 294 86 284 87 274 c
10344: 31 274 l
10345: 6 193 l
10346: 99 193 l
10347: 129 77 211 -12 359 -12 c
10348: 398 -12 509 8 585 77 c
10349: 529 145 l
10350: 497 123 436 80 356 80 c
10351: 285 80 227 122 198 193 c
10352: 360 193 l
10353: cp
10354: 600 0 m
10355: }
10356: pdf_PSBuildGlyph
10357: } def
10358: /Courier-BoldOblique /Courier-Bold load def
10359: /Courier
10360: {
10361: 600 0 17 -12 578 584
10362: {
10363: 17 204 m
10364: 97 204 l
10365: 126 81 214 -12 361 -12 c
10366: 440 -12 517 17 578 62 c
10367: 554 109 l
10368: 501 70 434 43 366 43 c
10369: 266 43 184 101 154 204 c
10370: 380 204 l
10371: 400 259 l
10372: 144 259 l
10373: 144 270 143 281 143 292 c
10374: 143 299 143 307 144 314 c
10375: 418 314 l
10376: 438 369 l
10377: 153 369 l
10378: 177 464 249 529 345 529 c
10379: 415 529 484 503 522 463 c
10380: 522 391 l
10381: 576 391 l
10382: 576 584 l
10383: 522 584 l
10384: 522 531 l
10385: 473 566 420 584 348 584 c
10386: 216 584 122 490 95 369 c
10387: 37 369 l
10388: 17 314 l
10389: 87 314 l
10390: 87 297 l
10391: 87 284 88 272 89 259 c
10392: 37 259 l
10393: cp
10394: 600 0 m
10395: }
10396: pdf_PSBuildGlyph
10397: } def
10398: /Courier-Oblique /Courier load def
10399: /Helvetica
10400: {
10401: 556 0 24 -19 541 703
10402: {
10403: 541 628 m
10404: 510 669 442 703 354 703 c
10405: 201 703 117 607 101 444 c
10406: 50 444 l
10407: 25 372 l
10408: 97 372 l
10409: 97 301 l
10410: 49 301 l
10411: 24 229 l
10412: 103 229 l
10413: 124 67 209 -19 350 -19 c
10414: 435 -19 501 25 509 32 c
10415: 509 131 l
10416: 492 105 417 60 343 60 c
10417: 267 60 204 127 197 229 c
10418: 406 229 l
10419: 430 301 l
10420: 191 301 l
10421: 191 372 l
10422: 455 372 l
10423: 479 444 l
10424: 194 444 l
10425: 201 531 245 624 348 624 c
10426: 433 624 484 583 509 534 c
10427: cp
10428: 556 0 m
10429: }
10430: pdf_PSBuildGlyph
10431: } def
10432: /Helvetica-Oblique /Helvetica load def
10433: /Helvetica-Bold
10434: {
10435: 556 0 12 -19 563 710
10436: {
10437: 563 621 m
10438: 537 659 463 710 363 710 c
10439: 216 710 125 620 101 462 c
10440: 51 462 l
10441: 12 367 l
10442: 92 367 l
10443: 92 346 l
10444: 92 337 93 328 93 319 c
10445: 52 319 l
10446: 12 224 l
10447: 102 224 l
10448: 131 58 228 -19 363 -19 c
10449: 417 -19 471 -12 517 18 c
10450: 517 146 l
10451: 481 115 426 93 363 93 c
10452: 283 93 254 166 246 224 c
10453: 398 224 l
10454: 438 319 l
10455: 236 319 l
10456: 236 367 l
10457: 457 367 l
10458: 497 462 l
10459: 244 462 l
10460: 259 552 298 598 363 598 c
10461: 425 598 464 570 486 547 c
10462: 507 526 513 517 517 509 c
10463: cp
10464: 556 0 m
10465: }
10466: pdf_PSBuildGlyph
10467: } def
10468: /Helvetica-BoldOblique /Helvetica-Bold load def
10469: /Symbol
10470: {
10471: 750 0 20 -12 714 685
10472: {
10473: 714 581 m
10474: 650 645 560 685 465 685 c
10475: 304 685 165 580 128 432 c
10476: 50 432 l
10477: 20 369 l
10478: 116 369 l
10479: 115 356 115 347 115 337 c
10480: 115 328 115 319 116 306 c
10481: 50 306 l
10482: 20 243 l
10483: 128 243 l
10484: 165 97 300 -12 465 -12 c
10485: 560 -12 635 25 685 65 c
10486: 685 155 l
10487: 633 91 551 51 465 51 c
10488: 340 51 238 131 199 243 c
10489: 555 243 l
10490: 585 306 l
10491: 184 306 l
10492: 183 317 182 326 182 336 c
10493: 182 346 183 356 184 369 c
10494: 614 369 l 644 432 l
10495: 199 432 l
10496: 233 540 340 622 465 622 c
10497: 555 622 636 580 685 520 c
10498: cp
10499: 750 0 m
10500: }
10501: pdf_PSBuildGlyph
10502: } def
10503: /Times-Bold
10504: {
10505: 500 0 16 -14 478 700
10506: {
10507: 367 308 m
10508: 224 308 l
10509: 224 368 l
10510: 375 368 l
10511: 380 414 l
10512: 225 414 l
10513: 230 589 257 653 315 653 c
10514: 402 653 431 521 444 457 c
10515: 473 457 l
10516: 473 698 l
10517: 444 697 l
10518: 441 679 437 662 418 662 c
10519: 393 662 365 700 310 700 c
10520: 211 700 97 597 73 414 c
10521: 21 414 l
10522: 16 368 l
10523: 69 368 l
10524: 69 359 68 350 68 341 c
10525: 68 330 68 319 69 308 c
10526: 21 308 l
10527: 16 262 l
10528: 73 262 l
10529: 91 119 161 -14 301 -14 c
10530: 380 -14 443 50 478 116 c
10531: 448 136 l
10532: 415 84 382 40 323 40 c
10533: 262 40 231 77 225 262 c
10534: 362 262 l
10535: cp
10536: 500 0 m
10537: }
10538: pdf_PSBuildGlyph
10539: } def
10540: /Times-BoldItalic
10541: {
10542: 500 0 9 -20 542 686
10543: {
10544: 542 686 m
10545: 518 686 l
10546: 513 673 507 660 495 660 c
10547: 475 660 457 683 384 683 c
10548: 285 683 170 584 122 430 c
10549: 58 430 l
10550: 34 369 l
10551: 105 369 l
10552: 101 354 92 328 90 312 c
10553: 34 312 l
10554: 9 251 l
10555: 86 251 l
10556: 85 238 84 223 84 207 c
10557: 84 112 117 -14 272 -14 c
10558: 326 -14 349 9 381 9 c
10559: 393 9 393 -10 394 -20 c
10560: 420 -20 l
10561: 461 148 l
10562: 429 148 l
10563: 416 109 362 15 292 15 c
10564: 227 15 197 55 197 128 c
10565: 197 162 204 203 216 251 c
10566: 378 251 l
10567: 402 312 l
10568: 227 312 l
10569: 229 325 236 356 241 369 c
10570: 425 369 l
10571: 450 430 l
10572: 255 430 l
10573: 257 435 264 458 274 488 c
10574: 298 561 337 654 394 654 c
10575: 437 654 484 621 484 530 c
10576: 484 516 l
10577: 516 516 l
10578: cp
10579: 500 0 m
10580: }
10581: pdf_PSBuildGlyph
10582: } def
10583: /Times-Italic
10584: {
10585: 500 0 23 -10 595 692
10586: {
10587: 399 317 m
10588: 196 317 l
10589: 199 340 203 363 209 386 c
10590: 429 386 l
10591: 444 424 l
10592: 219 424 l
10593: 246 514 307 648 418 648 c
10594: 448 648 471 638 492 616 c
10595: 529 576 524 529 527 479 c
10596: 549 475 l
10597: 595 687 l
10598: 570 687 l
10599: 562 674 558 664 542 664 c
10600: 518 664 474 692 423 692 c
10601: 275 692 162 551 116 424 c
10602: 67 424 l
10603: 53 386 l
10604: 104 386 l
10605: 98 363 93 340 90 317 c
10606: 37 317 l
10607: 23 279 l
10608: 86 279 l
10609: 85 266 85 253 85 240 c
10610: 85 118 137 -10 277 -10 c
10611: 370 -10 436 58 488 128 c
10612: 466 149 l
10613: 424 101 375 48 307 48 c
10614: 212 48 190 160 190 234 c
10615: 190 249 191 264 192 279 c
10616: 384 279 l
10617: cp
10618: 500 0 m
10619: }
10620: pdf_PSBuildGlyph
10621: } def
10622: /Times-Roman
10623: {
10624: 500 0 10 -12 484 692
10625: {
10626: 347 298 m
10627: 171 298 l
10628: 170 310 170 322 170 335 c
10629: 170 362 l
10630: 362 362 l
10631: 374 403 l
10632: 172 403 l
10633: 184 580 244 642 308 642 c
10634: 380 642 434 574 457 457 c
10635: 481 462 l
10636: 474 691 l
10637: 449 691 l
10638: 433 670 429 657 410 657 c
10639: 394 657 360 692 299 692 c
10640: 204 692 94 604 73 403 c
10641: 22 403 l
10642: 10 362 l
10643: 70 362 l
10644: 69 352 69 341 69 330 c
10645: 69 319 69 308 70 298 c
10646: 22 298 l
10647: 10 257 l
10648: 73 257 l
10649: 97 57 216 -12 295 -12 c
10650: 364 -12 427 25 484 123 c
10651: 458 142 l
10652: 425 101 384 37 316 37 c
10653: 256 37 189 84 173 257 c
10654: 335 257 l
10655: cp
10656: 500 0 m
10657: }
10658: pdf_PSBuildGlyph
10659: } def
10660: end
10661: Level2? {setglobal} if
10662: currentdict readonly pop end
10663: %%EndResource
10664: PDFText begin
10665: [39/quotesingle 96/grave 128/Adieresis/Aring/Ccedilla/Eacute/Ntilde/Odieresis
10666: /Udieresis/aacute/agrave/acircumflex/adieresis/atilde/aring/ccedilla/eacute
10667: /egrave/ecircumflex/edieresis/iacute/igrave/icircumflex/idieresis/ntilde
10668: /oacute/ograve/ocircumflex/odieresis/otilde/uacute/ugrave/ucircumflex
10669: /udieresis/dagger/degree/cent/sterling/section/bullet/paragraph/germandbls
10670: /registered/copyright/trademark/acute/dieresis/.notdef/AE/Oslash
10671: /.notdef/plusminus/.notdef/.notdef/yen/mu/.notdef/.notdef
10672: /.notdef/.notdef/.notdef/ordfeminine/ordmasculine/.notdef/ae/oslash
10673: /questiondown/exclamdown/logicalnot/.notdef/florin/.notdef/.notdef
10674: /guillemotleft/guillemotright/ellipsis/space/Agrave/Atilde/Otilde/OE/oe
10675: /endash/emdash/quotedblleft/quotedblright/quoteleft/quoteright/divide
10676: /.notdef/ydieresis/Ydieresis/fraction/currency/guilsinglleft/guilsinglright
10677: /fi/fl/daggerdbl/periodcentered/quotesinglbase/quotedblbase/perthousand
10678: /Acircumflex/Ecircumflex/Aacute/Edieresis/Egrave/Iacute/Icircumflex
10679: /Idieresis/Igrave/Oacute/Ocircumflex/.notdef/Ograve/Uacute/Ucircumflex
10680: /Ugrave/dotlessi/circumflex/tilde/macron/breve/dotaccent/ring/cedilla
10681: /hungarumlaut/ogonek/caron
10682: 0 TE
10683: [1/dotlessi/caron 39/quotesingle 96/grave 
10684: 127/bullet/Euro/bullet/quotesinglbase/florin/quotedblbase/ellipsis
10685: /dagger/daggerdbl/circumflex/perthousand/Scaron/guilsinglleft/OE
10686: /bullet/Zcaron/bullet/bullet/quoteleft/quoteright/quotedblleft
10687: /quotedblright/bullet/endash/emdash/tilde/trademark/scaron
10688: /guilsinglright/oe/bullet/zcaron/Ydieresis/space/exclamdown/cent/sterling
10689: /currency/yen/brokenbar/section/dieresis/copyright/ordfeminine
10690: /guillemotleft/logicalnot/hyphen/registered/macron/degree/plusminus
10691: /twosuperior/threesuperior/acute/mu/paragraph/periodcentered/cedilla
10692: /onesuperior/ordmasculine/guillemotright/onequarter/onehalf/threequarters
10693: /questiondown/Agrave/Aacute/Acircumflex/Atilde/Adieresis/Aring/AE/Ccedilla
10694: /Egrave/Eacute/Ecircumflex/Edieresis/Igrave/Iacute/Icircumflex/Idieresis
10695: /Eth/Ntilde/Ograve/Oacute/Ocircumflex/Otilde/Odieresis/multiply/Oslash
10696: /Ugrave/Uacute/Ucircumflex/Udieresis/Yacute/Thorn/germandbls/agrave
10697: /aacute/acircumflex/atilde/adieresis/aring/ae/ccedilla/egrave/eacute
10698: /ecircumflex/edieresis/igrave/iacute/icircumflex/idieresis/eth/ntilde
10699: /ograve/oacute/ocircumflex/otilde/odieresis/divide/oslash/ugrave/uacute
10700: /ucircumflex/udieresis/yacute/thorn/ydieresis
10701: 1 TE
10702: end
10703: currentdict readonly pop
10704: end end
10705: /currentpacking where {pop setpacking}if
10706: PDFVars/DocInitAll{[PDF PDFText]{/docinitialize get exec}forall }put
10707: PDFVars/InitAll{[PDF PDFText]{/initialize get exec}forall initgs}put
10708: PDFVars/TermAll{[PDFText PDF]{/terminate get exec}forall}put
10709: PDFVars begin PDF begin
10710: PDFVars/DocInitAll get exec PDFVars/InitAll get exec
10711: %%IncludeResource Symbol
10712: [/N10/Symbol -1 TZ
10713: %%IncludeResource Arial
10714: [/N6/Arial 1 TZ
10715: PDFVars/TermAll get exec end end
10716: 
10717: %%EndSetup
10718: PDFVars begin PDF begin PDFVars/InitAll get exec
10719: 0 0 792 612 rectclip
10720: 0.75 w
10721: 1 J
10722: 1 j
10723: n
10724: 153.75 525 m
10725: 667.5 525 l
10726: 0 0 0 setrgbcolor
10727: S
10728: n
10729: 667.5 525 m
10730: 667.5 110.25 l
10731: S
10732: n
10733: 667.5 110.25 m
10734: 153.75 110.25 l
10735: S
10736: n
10737: 153.75 110.25 m
10738: 153.75 525 l
10739: S
10740: 198 88.5 m
10741: /N6 16.7832 Tf
10742: (-4)
10743: [5.25358 8.99636 ] pdfxs
10744: 300.75 88.5 m
10745: (-2)
10746: [5.25358 8.99636 ] pdfxs
10747: 509.25 88.5 m
10748: (2) show
10749: 612 88.5 m
10750: (4) show
10751: 135.75 183 m
10752: (2) show
10753: 135.75 234.75 m
10754: (4) show
10755: 135.75 286.5 m
10756: (6) show
10757: 135.75 338.25 m
10758: (8) show
10759: 126.75 390 m
10760: (10)
10761: [8.99996 8.99996 ] pdfxs
10762: 126.75 441.75 m
10763: (12)
10764: [8.99996 8.99996 ] pdfxs
10765: 126.75 493.5 m
10766: (14)
10767: [8.99996 8.99996 ] pdfxs
10768: 1.5 w
10769: n
10770: 153.75 110.25 m
10771: 153.75 110.25 l
10772: S
10773: n
10774: 205.5 110.25 m
10775: 205.5 118.5 l
10776: S
10777: n
10778: 256.5 110.25 m
10779: 256.5 110.25 l
10780: S
10781: n
10782: 308.25 110.25 m
10783: 308.25 118.5 l
10784: S
10785: n
10786: 359.25 110.25 m
10787: 359.25 110.25 l
10788: S
10789: n
10790: 462 110.25 m
10791: 462 110.25 l
10792: S
10793: n
10794: 513.75 110.25 m
10795: 513.75 118.5 l
10796: S
10797: n
10798: 564.75 110.25 m
10799: 564.75 110.25 l
10800: S
10801: n
10802: 616.5 110.25 m
10803: 616.5 118.5 l
10804: S
10805: n
10806: 667.5 110.25 m
10807: 667.5 110.25 l
10808: S
10809: n
10810: 153.75 110.25 m
10811: 667.5 110.25 l
10812: S
10813: n
10814: 153.75 136.5 m
10815: 667.5 136.5 l
10816: S
10817: n
10818: 153.75 110.25 m
10819: 153.75 110.25 l
10820: S
10821: n
10822: 153.75 162 m
10823: 153.75 162 l
10824: S
10825: n
10826: 153.75 188.25 m
10827: 162 188.25 l
10828: S
10829: n
10830: 153.75 213.75 m
10831: 153.75 213.75 l
10832: S
10833: n
10834: 153.75 240 m
10835: 162 240 l
10836: S
10837: n
10838: 153.75 265.5 m
10839: 153.75 265.5 l
10840: S
10841: n
10842: 153.75 291.75 m
10843: 162 291.75 l
10844: S
10845: n
10846: 153.75 317.25 m
10847: 153.75 317.25 l
10848: S
10849: n
10850: 153.75 343.5 m
10851: 162 343.5 l
10852: S
10853: n
10854: 153.75 369.75 m
10855: 153.75 369.75 l
10856: S
10857: n
10858: 153.75 395.25 m
10859: 162 395.25 l
10860: S
10861: n
10862: 153.75 421.5 m
10863: 153.75 421.5 l
10864: S
10865: n
10866: 153.75 447 m
10867: 162 447 l
10868: S
10869: n
10870: 153.75 473.25 m
10871: 153.75 473.25 l
10872: S
10873: n
10874: 153.75 498.75 m
10875: 162 498.75 l
10876: S
10877: n
10878: 153.75 525 m
10879: 153.75 525 l
10880: S
10881: n
10882: 153.75 110.25 m
10883: 153.75 525 l
10884: S
10885: n
10886: 411 110.25 m
10887: 411 525 l
10888: S
10889: q
10890: n
10891: 153.75 133.5 3 5.25 re
10892: h
10893: W
10894: n
10895: 2.25 w
10896: n
10897: 153.75 136.5 m
10898: 153.75 136.5 l
10899: S
10900: Q
10901: q
10902: n
10903: 153.75 133.5 3.75 5.25 re
10904: h
10905: W
10906: n
10907: 2.25 w
10908: n
10909: 153.75 136.5 m
10910: 154.5 136.5 l
10911: S
10912: Q
10913: q
10914: n
10915: 153.75 133.5 4.5 5.25 re
10916: h
10917: W
10918: n
10919: 2.25 w
10920: n
10921: 154.5 136.5 m
10922: 155.25 136.5 l
10923: S
10924: Q
10925: q
10926: n
10927: 153.75 133.5 5.25 5.25 re
10928: h
10929: W
10930: n
10931: 2.25 w
10932: n
10933: 155.25 136.5 m
10934: 156 136.5 l
10935: S
10936: Q
10937: 2.25 w
10938: n
10939: 156 136.5 m
10940: 156.75 136.5 l
10941: S
10942: n
10943: 156.75 136.5 m
10944: 157.5 136.5 l
10945: S
10946: n
10947: 157.5 136.5 m
10948: 158.25 136.5 l
10949: S
10950: n
10951: 158.25 136.5 m
10952: 159 136.5 l
10953: S
10954: n
10955: 159 136.5 m
10956: 159.75 136.5 l
10957: S
10958: n
10959: 159.75 136.5 m
10960: 160.5 136.5 l
10961: S
10962: n
10963: 160.5 136.5 m
10964: 161.25 136.5 l
10965: S
10966: n
10967: 161.25 136.5 m
10968: 162 136.5 l
10969: S
10970: n
10971: 162 136.5 m
10972: 162.75 136.5 l
10973: S
10974: n
10975: 167.25 136.5 m
10976: 167.25 136.5 l
10977: S
10978: n
10979: 167.25 136.5 m
10980: 168 136.5 l
10981: S
10982: n
10983: 168 136.5 m
10984: 168.75 136.5 l
10985: S
10986: n
10987: 174 136.5 m
10988: 174 136.5 l
10989: S
10990: n
10991: 174 136.5 m
10992: 174.75 136.5 l
10993: S
10994: n
10995: 174.75 136.5 m
10996: 175.5 136.5 l
10997: S
10998: n
10999: 175.5 136.5 m
11000: 176.25 136.5 l
11001: S
11002: n
11003: 176.25 136.5 m
11004: 177 136.5 l
11005: S
11006: n
11007: 177 136.5 m
11008: 177.75 136.5 l
11009: S
11010: n
11011: 177.75 136.5 m
11012: 178.5 136.5 l
11013: S
11014: n
11015: 178.5 136.5 m
11016: 179.25 136.5 l
11017: S
11018: n
11019: 179.25 136.5 m
11020: 180 136.5 l
11021: S
11022: n
11023: 180 136.5 m
11024: 180.75 136.5 l
11025: S
11026: n
11027: 180.75 136.5 m
11028: 181.5 136.5 l
11029: S
11030: n
11031: 181.5 136.5 m
11032: 182.25 136.5 l
11033: S
11034: n
11035: 182.25 136.5 m
11036: 183 136.5 l
11037: S
11038: n
11039: 187.5 136.5 m
11040: 187.5 136.5 l
11041: S
11042: n
11043: 187.5 136.5 m
11044: 188.25 136.5 l
11045: S
11046: n
11047: 188.25 136.5 m
11048: 189 136.5 l
11049: S
11050: n
11051: 194.25 137.25 m
11052: 194.25 137.25 l
11053: S
11054: n
11055: 194.25 137.25 m
11056: 195 137.25 l
11057: S
11058: n
11059: 195 137.25 m
11060: 195.75 137.25 l
11061: S
11062: n
11063: 195.75 137.25 m
11064: 196.5 137.25 l
11065: S
11066: n
11067: 196.5 137.25 m
11068: 197.25 137.25 l
11069: S
11070: n
11071: 197.25 137.25 m
11072: 198 137.25 l
11073: S
11074: n
11075: 198 137.25 m
11076: 198.75 137.25 l
11077: S
11078: n
11079: 198.75 137.25 m
11080: 199.5 137.25 l
11081: S
11082: n
11083: 199.5 137.25 m
11084: 200.25 137.25 l
11085: S
11086: n
11087: 200.25 137.25 m
11088: 201 137.25 l
11089: S
11090: n
11091: 201 137.25 m
11092: 201.75 137.25 l
11093: S
11094: n
11095: 201.75 137.25 m
11096: 202.5 137.25 l
11097: S
11098: n
11099: 202.5 137.25 m
11100: 203.25 137.25 l
11101: S
11102: n
11103: 207.75 137.25 m
11104: 207.75 137.25 l
11105: S
11106: n
11107: 207.75 137.25 m
11108: 208.5 137.25 l
11109: S
11110: n
11111: 208.5 137.25 m
11112: 209.25 137.25 l
11113: S
11114: n
11115: 214.5 137.25 m
11116: 214.5 137.25 l
11117: S
11118: n
11119: 214.5 137.25 m
11120: 215.25 137.25 l
11121: S
11122: n
11123: 215.25 137.25 m
11124: 216 137.25 l
11125: S
11126: n
11127: 216 137.25 m
11128: 216.75 137.25 l
11129: S
11130: n
11131: 216.75 137.25 m
11132: 217.5 137.25 l
11133: S
11134: n
11135: 217.5 137.25 m
11136: 218.25 137.25 l
11137: S
11138: n
11139: 218.25 137.25 m
11140: 219 137.25 l
11141: S
11142: n
11143: 219 137.25 m
11144: 219.75 137.25 l
11145: S
11146: n
11147: 219.75 137.25 m
11148: 220.5 137.25 l
11149: S
11150: n
11151: 220.5 137.25 m
11152: 221.25 137.25 l
11153: S
11154: n
11155: 221.25 137.25 m
11156: 222 137.25 l
11157: S
11158: n
11159: 222 137.25 m
11160: 222.75 137.25 l
11161: S
11162: n
11163: 222.75 137.25 m
11164: 223.5 137.25 l
11165: S
11166: n
11167: 228 137.25 m
11168: 228 137.25 l
11169: S
11170: n
11171: 228 137.25 m
11172: 228.75 137.25 l
11173: S
11174: n
11175: 228.75 137.25 m
11176: 229.5 137.25 l
11177: S
11178: n
11179: 234.75 137.25 m
11180: 234.75 137.25 l
11181: S
11182: n
11183: 234.75 137.25 m
11184: 235.5 137.25 l
11185: S
11186: n
11187: 235.5 137.25 m
11188: 236.25 137.25 l
11189: S
11190: n
11191: 236.25 137.25 m
11192: 237 137.25 l
11193: S
11194: n
11195: 237 137.25 m
11196: 237.75 137.25 l
11197: S
11198: n
11199: 237.75 137.25 m
11200: 238.5 137.25 l
11201: S
11202: n
11203: 238.5 137.25 m
11204: 239.25 137.25 l
11205: S
11206: n
11207: 239.25 137.25 m
11208: 240 137.25 l
11209: S
11210: n
11211: 240 137.25 m
11212: 240.75 137.25 l
11213: S
11214: n
11215: 240.75 137.25 m
11216: 241.5 137.25 l
11217: S
11218: n
11219: 241.5 137.25 m
11220: 242.25 137.25 l
11221: S
11222: n
11223: 242.25 137.25 m
11224: 243 137.25 l
11225: S
11226: n
11227: 243 137.25 m
11228: 243.75 137.25 l
11229: S
11230: n
11231: 248.25 137.25 m
11232: 248.25 137.25 l
11233: S
11234: n
11235: 248.25 137.25 m
11236: 249 137.25 l
11237: S
11238: n
11239: 249 137.25 m
11240: 249.75 137.25 l
11241: S
11242: n
11243: 255 137.25 m
11244: 255 137.25 l
11245: S
11246: n
11247: 255 137.25 m
11248: 255.75 137.25 l
11249: S
11250: n
11251: 255.75 137.25 m
11252: 256.5 137.25 l
11253: S
11254: n
11255: 256.5 137.25 m
11256: 257.25 137.25 l
11257: S
11258: n
11259: 257.25 137.25 m
11260: 258 138 l
11261: S
11262: n
11263: 258 138 m
11264: 258.75 138 l
11265: S
11266: n
11267: 258.75 138 m
11268: 259.5 138 l
11269: S
11270: n
11271: 259.5 138 m
11272: 260.25 138 l
11273: S
11274: n
11275: 260.25 138 m
11276: 261 138 l
11277: S
11278: n
11279: 261 138 m
11280: 261.75 138 l
11281: S
11282: n
11283: 261.75 138 m
11284: 262.5 138 l
11285: S
11286: n
11287: 262.5 138 m
11288: 263.25 138 l
11289: S
11290: n
11291: 263.25 138 m
11292: 264 138 l
11293: S
11294: n
11295: 268.5 138 m
11296: 268.5 138 l
11297: S
11298: n
11299: 268.5 138 m
11300: 269.25 138 l
11301: S
11302: n
11303: 269.25 138 m
11304: 270 138 l
11305: S
11306: n
11307: 275.25 138.75 m
11308: 275.25 138.75 l
11309: S
11310: n
11311: 275.25 138.75 m
11312: 276 138.75 l
11313: S
11314: n
11315: 276 138.75 m
11316: 276.75 138.75 l
11317: S
11318: n
11319: 276.75 138.75 m
11320: 277.5 138.75 l
11321: S
11322: n
11323: 277.5 138.75 m
11324: 278.25 138.75 l
11325: S
11326: n
11327: 278.25 138.75 m
11328: 279 138.75 l
11329: S
11330: n
11331: 279 138.75 m
11332: 279.75 138.75 l
11333: S
11334: n
11335: 279.75 138.75 m
11336: 280.5 138.75 l
11337: S
11338: n
11339: 280.5 138.75 m
11340: 281.25 138.75 l
11341: S
11342: n
11343: 281.25 138.75 m
11344: 282 138.75 l
11345: S
11346: n
11347: 282 138.75 m
11348: 282.75 138.75 l
11349: S
11350: n
11351: 282.75 138.75 m
11352: 283.5 138.75 l
11353: S
11354: n
11355: 283.5 138.75 m
11356: 284.25 138.75 l
11357: S
11358: n
11359: 288.75 139.5 m
11360: 288.75 139.5 l
11361: S
11362: n
11363: 288.75 139.5 m
11364: 289.5 139.5 l
11365: S
11366: n
11367: 289.5 139.5 m
11368: 290.25 139.5 l
11369: S
11370: n
11371: 294.75 140.25 m
11372: 294.75 140.25 l
11373: S
11374: n
11375: 294.75 140.25 m
11376: 295.5 140.25 l
11377: S
11378: n
11379: 295.5 140.25 m
11380: 296.25 140.25 l
11381: S
11382: n
11383: 296.25 140.25 m
11384: 297 140.25 l
11385: S
11386: n
11387: 297 140.25 m
11388: 297.75 141 l
11389: S
11390: n
11391: 297.75 141 m
11392: 298.5 141 l
11393: S
11394: n
11395: 298.5 141 m
11396: 299.25 141 l
11397: S
11398: n
11399: 299.25 141 m
11400: 300 141 l
11401: S
11402: n
11403: 300 141 m
11404: 300.75 141 l
11405: S
11406: n
11407: 300.75 141 m
11408: 301.5 141 l
11409: S
11410: n
11411: 301.5 141 m
11412: 302.25 141.75 l
11413: S
11414: n
11415: 302.25 141.75 m
11416: 303 141.75 l
11417: S
11418: n
11419: 303 141.75 m
11420: 303.75 141.75 l
11421: S
11422: n
11423: 308.25 142.5 m
11424: 308.25 142.5 l
11425: S
11426: n
11427: 308.25 142.5 m
11428: 309 142.5 l
11429: S
11430: n
11431: 309 142.5 m
11432: 309.75 143.25 l
11433: S
11434: n
11435: 315 144 m
11436: 315 144 l
11437: S
11438: n
11439: 315 144 m
11440: 315 144.75 l
11441: S
11442: n
11443: 315 144.75 m
11444: 315.75 144.75 l
11445: S
11446: n
11447: 315.75 144.75 m
11448: 316.5 144.75 l
11449: S
11450: n
11451: 316.5 144.75 m
11452: 317.25 144.75 l
11453: S
11454: n
11455: 317.25 144.75 m
11456: 318 145.5 l
11457: S
11458: n
11459: 318 145.5 m
11460: 318.75 145.5 l
11461: S
11462: n
11463: 318.75 145.5 m
11464: 319.5 145.5 l
11465: S
11466: n
11467: 319.5 145.5 m
11468: 319.5 146.25 l
11469: S
11470: n
11471: 319.5 146.25 m
11472: 320.25 146.25 l
11473: S
11474: n
11475: 320.25 146.25 m
11476: 321 146.25 l
11477: S
11478: n
11479: 321 146.25 m
11480: 321.75 146.25 l
11481: S
11482: n
11483: 321.75 146.25 m
11484: 321.75 147 l
11485: S
11486: n
11487: 326.25 148.5 m
11488: 326.25 148.5 l
11489: S
11490: n
11491: 326.25 148.5 m
11492: 327 149.25 l
11493: S
11494: n
11495: 327 149.25 m
11496: 327.75 149.25 l
11497: S
11498: n
11499: 331.5 151.5 m
11500: 331.5 151.5 l
11501: S
11502: n
11503: 331.5 151.5 m
11504: 332.25 151.5 l
11505: S
11506: n
11507: 332.25 151.5 m
11508: 333 152.25 l
11509: S
11510: n
11511: 333 152.25 m
11512: 333.75 152.25 l
11513: S
11514: n
11515: 333.75 152.25 m
11516: 334.5 153 l
11517: S
11518: n
11519: 334.5 153 m
11520: 335.25 153.75 l
11521: S
11522: n
11523: 335.25 153.75 m
11524: 336 153.75 l
11525: S
11526: n
11527: 336 153.75 m
11528: 336 154.5 l
11529: S
11530: n
11531: 336 154.5 m
11532: 336.75 154.5 l
11533: S
11534: n
11535: 336.75 154.5 m
11536: 337.5 155.25 l
11537: S
11538: n
11539: 337.5 155.25 m
11540: 338.25 156 l
11541: S
11542: n
11543: 338.25 156 m
11544: 339 156 l
11545: S
11546: n
11547: 339 156 m
11548: 339.75 156.75 l
11549: S
11550: n
11551: 343.5 159.75 m
11552: 343.5 159.75 l
11553: S
11554: n
11555: 343.5 159.75 m
11556: 344.25 160.5 l
11557: S
11558: n
11559: 344.25 160.5 m
11560: 345 161.25 l
11561: S
11562: n
11563: 349.5 165.75 m
11564: 349.5 165.75 l
11565: S
11566: n
11567: 349.5 165.75 m
11568: 350.25 166.5 l
11569: S
11570: n
11571: 350.25 166.5 m
11572: 351 167.25 l
11573: S
11574: n
11575: 351 167.25 m
11576: 351 168 l
11577: S
11578: n
11579: 351 168 m
11580: 351.75 168.75 l
11581: S
11582: n
11583: 351.75 168.75 m
11584: 352.5 168.75 l
11585: S
11586: n
11587: 352.5 168.75 m
11588: 352.5 169.5 l
11589: S
11590: n
11591: 352.5 169.5 m
11592: 353.25 170.25 l
11593: S
11594: n
11595: 353.25 170.25 m
11596: 354 171 l
11597: S
11598: n
11599: 354 171 m
11600: 354 171.75 l
11601: S
11602: n
11603: 354 171.75 m
11604: 354.75 172.5 l
11605: S
11606: n
11607: 354.75 172.5 m
11608: 355.5 173.25 l
11609: S
11610: n
11611: 355.5 173.25 m
11612: 355.5 174 l
11613: S
11614: n
11615: 359.25 178.5 m
11616: 359.25 178.5 l
11617: S
11618: n
11619: 359.25 178.5 m
11620: 359.25 179.25 l
11621: S
11622: n
11623: 359.25 179.25 m
11624: 360 180 l
11625: S
11626: n
11627: 363 185.25 m
11628: 363 185.25 l
11629: S
11630: n
11631: 363 185.25 m
11632: 363.75 186.75 l
11633: S
11634: n
11635: 363.75 186.75 m
11636: 363.75 187.5 l
11637: S
11638: n
11639: 363.75 187.5 m
11640: 364.5 188.25 l
11641: S
11642: n
11643: 364.5 188.25 m
11644: 365.25 189.75 l
11645: S
11646: n
11647: 365.25 189.75 m
11648: 366 190.5 l
11649: S
11650: n
11651: 366 190.5 m
11652: 366 191.25 l
11653: S
11654: n
11655: 366 191.25 m
11656: 366.75 192.75 l
11657: S
11658: n
11659: 366.75 192.75 m
11660: 367.5 193.5 l
11661: S
11662: n
11663: 367.5 193.5 m
11664: 367.5 194.25 l
11665: S
11666: n
11667: 369.75 198.75 m
11668: 369.75 199.5 l
11669: S
11670: n
11671: 369.75 199.5 m
11672: 370.5 200.25 l
11673: S
11674: n
11675: 372 205.5 m
11676: 372 205.5 l
11677: S
11678: n
11679: 372 205.5 m
11680: 372.75 207 l
11681: S
11682: n
11683: 372.75 207 m
11684: 373.5 207.75 l
11685: S
11686: n
11687: 373.5 207.75 m
11688: 373.5 209.25 l
11689: S
11690: n
11691: 373.5 209.25 m
11692: 374.25 210.75 l
11693: S
11694: n
11695: 374.25 210.75 m
11696: 375 212.25 l
11697: S
11698: n
11699: 375 212.25 m
11700: 375.75 213.75 l
11701: S
11702: n
11703: 375.75 213.75 m
11704: 375.75 214.5 l
11705: S
11706: n
11707: 377.25 219 m
11708: 377.25 219 l
11709: S
11710: n
11711: 377.25 219 m
11712: 378 220.5 l
11713: S
11714: n
11715: 380.25 225.75 m
11716: 380.25 226.5 l
11717: S
11718: n
11719: 380.25 226.5 m
11720: 380.25 228 l
11721: S
11722: n
11723: 380.25 228 m
11724: 381 229.5 l
11725: S
11726: n
11727: 381 229.5 m
11728: 381.75 231 l
11729: S
11730: n
11731: 381.75 231 m
11732: 381.75 232.5 l
11733: S
11734: n
11735: 381.75 232.5 m
11736: 382.5 234 l
11737: S
11738: n
11739: 382.5 234 m
11740: 383.25 234.75 l
11741: S
11742: n
11743: 384 239.25 m
11744: 384 239.25 l
11745: S
11746: n
11747: 384 239.25 m
11748: 384.75 240.75 l
11749: S
11750: n
11751: 387 246 m
11752: 387 247.5 l
11753: S
11754: n
11755: 387 247.5 m
11756: 387 249 l
11757: S
11758: n
11759: 387 249 m
11760: 387.75 250.5 l
11761: S
11762: n
11763: 387.75 250.5 m
11764: 388.5 252 l
11765: S
11766: n
11767: 388.5 252 m
11768: 388.5 253.5 l
11769: S
11770: n
11771: 388.5 253.5 m
11772: 389.25 255 l
11773: S
11774: n
11775: 390.75 259.5 m
11776: 390.75 260.25 l
11777: S
11778: n
11779: 390.75 260.25 m
11780: 391.5 261 l
11781: S
11782: n
11783: 393 266.25 m
11784: 393 267 l
11785: S
11786: n
11787: 393 267 m
11788: 393.75 268.5 l
11789: S
11790: n
11791: 393.75 268.5 m
11792: 393.75 270 l
11793: S
11794: n
11795: 393.75 270 m
11796: 394.5 271.5 l
11797: S
11798: n
11799: 394.5 271.5 m
11800: 395.25 273 l
11801: S
11802: n
11803: 395.25 273 m
11804: 395.25 274.5 l
11805: S
11806: n
11807: 395.25 274.5 m
11808: 396 275.25 l
11809: S
11810: n
11811: 397.5 279.75 m
11812: 397.5 279.75 l
11813: S
11814: n
11815: 397.5 279.75 m
11816: 398.25 281.25 l
11817: S
11818: n
11819: 399.75 286.5 m
11820: 399.75 286.5 l
11821: S
11822: n
11823: 399.75 286.5 m
11824: 400.5 287.25 l
11825: S
11826: n
11827: 400.5 287.25 m
11828: 401.25 288.75 l
11829: S
11830: n
11831: 401.25 288.75 m
11832: 402 289.5 l
11833: S
11834: n
11835: 402 289.5 m
11836: 402 290.25 l
11837: S
11838: n
11839: 402 290.25 m
11840: 402.75 291.75 l
11841: S
11842: n
11843: 402.75 291.75 m
11844: 403.5 292.5 l
11845: S
11846: n
11847: 403.5 292.5 m
11848: 403.5 293.25 l
11849: S
11850: n
11851: 403.5 293.25 m
11852: 404.25 294 l
11853: S
11854: n
11855: 404.25 294 m
11856: 405 294.75 l
11857: S
11858: n
11859: 405 294.75 m
11860: 405 295.5 l
11861: S
11862: n
11863: 408.75 298.5 m
11864: 408.75 298.5 l
11865: S
11866: n
11867: 408.75 298.5 m
11868: 409.5 298.5 l
11869: S
11870: n
11871: 409.5 298.5 m
11872: 409.5 299.25 l
11873: S
11874: n
11875: 413.25 297.75 m
11876: 413.25 297.75 l
11877: S
11878: n
11879: 413.25 297.75 m
11880: 414 297.75 l
11881: S
11882: n
11883: 414 297.75 m
11884: 414.75 297 l
11885: S
11886: n
11887: 414.75 297 m
11888: 415.5 296.25 l
11889: S
11890: n
11891: 415.5 296.25 m
11892: 416.25 295.5 l
11893: S
11894: n
11895: 416.25 295.5 m
11896: 416.25 294.75 l
11897: S
11898: n
11899: 416.25 294.75 m
11900: 417 294 l
11901: S
11902: n
11903: 417 294 m
11904: 417.75 293.25 l
11905: S
11906: n
11907: 417.75 293.25 m
11908: 417.75 291.75 l
11909: S
11910: n
11911: 417.75 291.75 m
11912: 418.5 291 l
11913: S
11914: n
11915: 418.5 291 m
11916: 419.25 290.25 l
11917: S
11918: n
11919: 419.25 290.25 m
11920: 419.25 289.5 l
11921: S
11922: n
11923: 421.5 285 m
11924: 421.5 284.25 l
11925: S
11926: n
11927: 421.5 284.25 m
11928: 422.25 283.5 l
11929: S
11930: n
11931: 424.5 278.25 m
11932: 424.5 277.5 l
11933: S
11934: n
11935: 424.5 277.5 m
11936: 424.5 276 l
11937: S
11938: n
11939: 424.5 276 m
11940: 425.25 274.5 l
11941: S
11942: n
11943: 425.25 274.5 m
11944: 426 273 l
11945: S
11946: n
11947: 426 273 m
11948: 426 271.5 l
11949: S
11950: n
11951: 426 271.5 m
11952: 426.75 270 l
11953: S
11954: n
11955: 426.75 270 m
11956: 427.5 269.25 l
11957: S
11958: n
11959: 429 264.75 m
11960: 429 264.75 l
11961: S
11962: n
11963: 429 264.75 m
11964: 429 263.25 l
11965: S
11966: n
11967: 431.25 258 m
11968: 431.25 257.25 l
11969: S
11970: n
11971: 431.25 257.25 m
11972: 432 255 l
11973: S
11974: n
11975: 432 255 m
11976: 432 253.5 l
11977: S
11978: n
11979: 432 253.5 m
11980: 432.75 252 l
11981: S
11982: n
11983: 432.75 252 m
11984: 432.75 250.5 l
11985: S
11986: n
11987: 432.75 250.5 m
11988: 433.5 249 l
11989: S
11990: n
11991: 435 244.5 m
11992: 435 243.75 l
11993: S
11994: n
11995: 435 243.75 m
11996: 435.75 243 l
11997: S
11998: n
11999: 437.25 237.75 m
12000: 437.25 237 l
12001: S
12002: n
12003: 437.25 237 m
12004: 437.25 235.5 l
12005: S
12006: n
12007: 437.25 235.5 m
12008: 438 234 l
12009: S
12010: n
12011: 438 234 m
12012: 438.75 232.5 l
12013: S
12014: n
12015: 438.75 232.5 m
12016: 439.5 231 l
12017: S
12018: n
12019: 439.5 231 m
12020: 439.5 229.5 l
12021: S
12022: n
12023: 439.5 229.5 m
12024: 440.25 228.75 l
12025: S
12026: n
12027: 441.75 224.25 m
12028: 441.75 223.5 l
12029: S
12030: n
12031: 441.75 223.5 m
12032: 442.5 222.75 l
12033: S
12034: n
12035: 444 217.5 m
12036: 444 217.5 l
12037: S
12038: n
12039: 444 217.5 m
12040: 444 216 l
12041: S
12042: n
12043: 444 216 m
12044: 444.75 215.25 l
12045: S
12046: n
12047: 444.75 215.25 m
12048: 445.5 213.75 l
12049: S
12050: n
12051: 445.5 213.75 m
12052: 445.5 212.25 l
12053: S
12054: n
12055: 445.5 212.25 m
12056: 446.25 210.75 l
12057: S
12058: n
12059: 446.25 210.75 m
12060: 447 209.25 l
12061: S
12062: n
12063: 447 209.25 m
12064: 447.75 208.5 l
12065: S
12066: n
12067: 449.25 204 m
12068: 449.25 203.25 l
12069: S
12070: n
12071: 449.25 203.25 m
12072: 450 202.5 l
12073: S
12074: n
12075: 452.25 197.25 m
12076: 452.25 197.25 l
12077: S
12078: n
12079: 452.25 197.25 m
12080: 452.25 196.5 l
12081: S
12082: n
12083: 452.25 196.5 m
12084: 453 195 l
12085: S
12086: n
12087: 453 195 m
12088: 453.75 194.25 l
12089: S
12090: n
12091: 453.75 194.25 m
12092: 453.75 192.75 l
12093: S
12094: n
12095: 453.75 192.75 m
12096: 454.5 192 l
12097: S
12098: n
12099: 454.5 192 m
12100: 455.25 191.25 l
12101: S
12102: n
12103: 455.25 191.25 m
12104: 455.25 189.75 l
12105: S
12106: n
12107: 455.25 189.75 m
12108: 456 189 l
12109: S
12110: n
12111: 456 189 m
12112: 456.75 188.25 l
12113: S
12114: n
12115: 459 183.75 m
12116: 459 183.75 l
12117: S
12118: n
12119: 459 183.75 m
12120: 459.75 182.25 l
12121: S
12122: n
12123: 463.5 177 m
12124: 463.5 177 l
12125: S
12126: n
12127: 463.5 177 m
12128: 463.5 176.25 l
12129: S
12130: n
12131: 463.5 176.25 m
12132: 464.25 175.5 l
12133: S
12134: n
12135: 464.25 175.5 m
12136: 465 174.75 l
12137: S
12138: n
12139: 465 174.75 m
12140: 465.75 174 l
12141: S
12142: n
12143: 465.75 174 m
12144: 465.75 173.25 l
12145: S
12146: n
12147: 465.75 173.25 m
12148: 466.5 172.5 l
12149: S
12150: n
12151: 466.5 172.5 m
12152: 467.25 171.75 l
12153: S
12154: n
12155: 467.25 171.75 m
12156: 467.25 171 l
12157: S
12158: n
12159: 467.25 171 m
12160: 468 170.25 l
12161: S
12162: n
12163: 468.75 169.5 m
12164: 468.75 169.5 l
12165: S
12166: n
12167: 468.75 169.5 m
12168: 468.75 168.75 l
12169: S
12170: n
12171: 468.75 168.75 m
12172: 469.5 168.75 l
12173: S
12174: n
12175: 469.5 168.75 m
12176: 470.25 168 l
12177: S
12178: n
12179: 470.25 168 m
12180: 470.25 167.25 l
12181: S
12182: n
12183: 470.25 167.25 m
12184: 471 166.5 l
12185: S
12186: n
12187: 471 166.5 m
12188: 471.75 165.75 l
12189: S
12190: n
12191: 471.75 165.75 m
12192: 472.5 165 l
12193: S
12194: n
12195: 472.5 165 m
12196: 473.25 164.25 l
12197: S
12198: n
12199: 473.25 164.25 m
12200: 473.25 163.5 l
12201: S
12202: n
12203: 473.25 163.5 m
12204: 474 163.5 l
12205: S
12206: n
12207: 474 163.5 m
12208: 474.75 162.75 l
12209: S
12210: n
12211: 474.75 162.75 m
12212: 475.5 162 l
12213: S
12214: n
12215: 480 158.25 m
12216: 480 158.25 l
12217: S
12218: n
12219: 480 158.25 m
12220: 480 157.5 l
12221: S
12222: n
12223: 480 157.5 m
12224: 480.75 157.5 l
12225: S
12226: n
12227: 485.25 153.75 m
12228: 485.25 153.75 l
12229: S
12230: n
12231: 485.25 153.75 m
12232: 486 153.75 l
12233: S
12234: n
12235: 486 153.75 m
12236: 486.75 153 l
12237: S
12238: n
12239: 486.75 153 m
12240: 487.5 152.25 l
12241: S
12242: n
12243: 487.5 152.25 m
12244: 488.25 152.25 l
12245: S
12246: n
12247: 488.25 152.25 m
12248: 489 151.5 l
12249: S
12250: n
12251: 489 151.5 m
12252: 489.75 151.5 l
12253: S
12254: n
12255: 489.75 151.5 m
12256: 489.75 150.75 l
12257: S
12258: n
12259: 489.75 150.75 m
12260: 490.5 150.75 l
12261: S
12262: n
12263: 490.5 150.75 m
12264: 491.25 150.75 l
12265: S
12266: n
12267: 491.25 150.75 m
12268: 491.25 150 l
12269: S
12270: n
12271: 491.25 150 m
12272: 492 150 l
12273: S
12274: n
12275: 492 150 m
12276: 492.75 150 l
12277: S
12278: n
12279: 497.25 147.75 m
12280: 497.25 147.75 l
12281: S
12282: n
12283: 497.25 147.75 m
12284: 498 147 l
12285: S
12286: n
12287: 498 147 m
12288: 498.75 147 l
12289: S
12290: n
12291: 502.5 145.5 m
12292: 502.5 145.5 l
12293: S
12294: n
12295: 502.5 145.5 m
12296: 503.25 145.5 l
12297: S
12298: n
12299: 503.25 145.5 m
12300: 504 144.75 l
12301: S
12302: n
12303: 504 144.75 m
12304: 504.75 144.75 l
12305: S
12306: n
12307: 504.75 144.75 m
12308: 505.5 144.75 l
12309: S
12310: n
12311: 505.5 144.75 m
12312: 506.25 144.75 l
12313: S
12314: n
12315: 506.25 144.75 m
12316: 506.25 144 l
12317: S
12318: n
12319: 506.25 144 m
12320: 507 144 l
12321: S
12322: n
12323: 507 144 m
12324: 507.75 144 l
12325: S
12326: n
12327: 507.75 144 m
12328: 508.5 144 l
12329: S
12330: n
12331: 508.5 144 m
12332: 509.25 143.25 l
12333: S
12334: n
12335: 509.25 143.25 m
12336: 510 143.25 l
12337: S
12338: n
12339: 510 143.25 m
12340: 510.75 143.25 l
12341: S
12342: n
12343: 515.25 142.5 m
12344: 515.25 142.5 l
12345: S
12346: n
12347: 515.25 142.5 m
12348: 516 141.75 l
12349: S
12350: n
12351: 516 141.75 m
12352: 516.75 141.75 l
12353: S
12354: n
12355: 522 141 m
12356: 522 141 l
12357: S
12358: n
12359: 522 141 m
12360: 522.75 141 l
12361: S
12362: n
12363: 522.75 141 m
12364: 523.5 141 l
12365: S
12366: n
12367: 523.5 141 m
12368: 524.25 140.25 l
12369: S
12370: n
12371: 524.25 140.25 m
12372: 525 140.25 l
12373: S
12374: n
12375: 525 140.25 m
12376: 525.75 140.25 l
12377: S
12378: n
12379: 525.75 140.25 m
12380: 526.5 140.25 l
12381: S
12382: n
12383: 526.5 140.25 m
12384: 527.25 140.25 l
12385: S
12386: n
12387: 527.25 140.25 m
12388: 528 140.25 l
12389: S
12390: n
12391: 528 140.25 m
12392: 528.75 140.25 l
12393: S
12394: n
12395: 528.75 140.25 m
12396: 529.5 140.25 l
12397: S
12398: n
12399: 529.5 140.25 m
12400: 529.5 139.5 l
12401: S
12402: n
12403: 529.5 139.5 m
12404: 530.25 139.5 l
12405: S
12406: n
12407: 534.75 139.5 m
12408: 534.75 139.5 l
12409: S
12410: n
12411: 534.75 139.5 m
12412: 535.5 139.5 l
12413: S
12414: n
12415: 535.5 139.5 m
12416: 536.25 139.5 l
12417: S
12418: n
12419: 541.5 138.75 m
12420: 541.5 138.75 l
12421: S
12422: n
12423: 541.5 138.75 m
12424: 542.25 138.75 l
12425: S
12426: n
12427: 542.25 138.75 m
12428: 543 138.75 l
12429: S
12430: n
12431: 543 138.75 m
12432: 543.75 138.75 l
12433: S
12434: n
12435: 543.75 138.75 m
12436: 544.5 138.75 l
12437: S
12438: n
12439: 544.5 138.75 m
12440: 545.25 138.75 l
12441: S
12442: n
12443: 545.25 138.75 m
12444: 546 138.75 l
12445: S
12446: n
12447: 546 138.75 m
12448: 546.75 138.75 l
12449: S
12450: n
12451: 546.75 138.75 m
12452: 547.5 138 l
12453: S
12454: n
12455: 547.5 138 m
12456: 548.25 138 l
12457: S
12458: n
12459: 548.25 138 m
12460: 549 138 l
12461: S
12462: n
12463: 549 138 m
12464: 549.75 138 l
12465: S
12466: n
12467: 549.75 138 m
12468: 550.5 138 l
12469: S
12470: n
12471: 555 138 m
12472: 555 138 l
12473: S
12474: n
12475: 555 138 m
12476: 555.75 138 l
12477: S
12478: n
12479: 555.75 138 m
12480: 556.5 138 l
12481: S
12482: n
12483: 561.75 138 m
12484: 561.75 138 l
12485: S
12486: n
12487: 561.75 138 m
12488: 562.5 138 l
12489: S
12490: n
12491: 562.5 138 m
12492: 563.25 138 l
12493: S
12494: n
12495: 563.25 138 m
12496: 564 137.25 l
12497: S
12498: n
12499: 564 137.25 m
12500: 564.75 137.25 l
12501: S
12502: n
12503: 564.75 137.25 m
12504: 565.5 137.25 l
12505: S
12506: n
12507: 565.5 137.25 m
12508: 566.25 137.25 l
12509: S
12510: n
12511: 566.25 137.25 m
12512: 567 137.25 l
12513: S
12514: n
12515: 567 137.25 m
12516: 567.75 137.25 l
12517: S
12518: n
12519: 567.75 137.25 m
12520: 568.5 137.25 l
12521: S
12522: n
12523: 568.5 137.25 m
12524: 569.25 137.25 l
12525: S
12526: n
12527: 569.25 137.25 m
12528: 570 137.25 l
12529: S
12530: n
12531: 570 137.25 m
12532: 570.75 137.25 l
12533: S
12534: n
12535: 575.25 137.25 m
12536: 575.25 137.25 l
12537: S
12538: n
12539: 575.25 137.25 m
12540: 576 137.25 l
12541: S
12542: n
12543: 576 137.25 m
12544: 576.75 137.25 l
12545: S
12546: n
12547: 582 137.25 m
12548: 582 137.25 l
12549: S
12550: n
12551: 582 137.25 m
12552: 582.75 137.25 l
12553: S
12554: n
12555: 582.75 137.25 m
12556: 583.5 137.25 l
12557: S
12558: n
12559: 583.5 137.25 m
12560: 584.25 137.25 l
12561: S
12562: n
12563: 584.25 137.25 m
12564: 585 137.25 l
12565: S
12566: n
12567: 585 137.25 m
12568: 585.75 137.25 l
12569: S
12570: n
12571: 585.75 137.25 m
12572: 586.5 137.25 l
12573: S
12574: n
12575: 586.5 137.25 m
12576: 587.25 137.25 l
12577: S
12578: n
12579: 587.25 137.25 m
12580: 588 137.25 l
12581: S
12582: n
12583: 588 137.25 m
12584: 588.75 137.25 l
12585: S
12586: n
12587: 588.75 137.25 m
12588: 589.5 137.25 l
12589: S
12590: n
12591: 589.5 137.25 m
12592: 590.25 137.25 l
12593: S
12594: n
12595: 590.25 137.25 m
12596: 591 137.25 l
12597: S
12598: n
12599: 595.5 137.25 m
12600: 595.5 137.25 l
12601: S
12602: n
12603: 595.5 137.25 m
12604: 596.25 137.25 l
12605: S
12606: n
12607: 596.25 137.25 m
12608: 597 137.25 l
12609: S
12610: n
12611: 602.25 137.25 m
12612: 602.25 137.25 l
12613: S
12614: n
12615: 602.25 137.25 m
12616: 603 137.25 l
12617: S
12618: n
12619: 603 137.25 m
12620: 603.75 137.25 l
12621: S
12622: n
12623: 603.75 137.25 m
12624: 604.5 137.25 l
12625: S
12626: n
12627: 604.5 137.25 m
12628: 605.25 137.25 l
12629: S
12630: n
12631: 605.25 137.25 m
12632: 606 137.25 l
12633: S
12634: n
12635: 606 137.25 m
12636: 606.75 137.25 l
12637: S
12638: n
12639: 606.75 137.25 m
12640: 607.5 137.25 l
12641: S
12642: n
12643: 607.5 137.25 m
12644: 608.25 137.25 l
12645: S
12646: n
12647: 608.25 137.25 m
12648: 609 137.25 l
12649: S
12650: n
12651: 609 137.25 m
12652: 609.75 137.25 l
12653: S
12654: n
12655: 609.75 137.25 m
12656: 610.5 137.25 l
12657: S
12658: n
12659: 610.5 137.25 m
12660: 611.25 137.25 l
12661: S
12662: n
12663: 615.75 137.25 m
12664: 615.75 137.25 l
12665: S
12666: n
12667: 615.75 137.25 m
12668: 616.5 137.25 l
12669: S
12670: n
12671: 616.5 137.25 m
12672: 617.25 137.25 l
12673: S
12674: n
12675: 622.5 137.25 m
12676: 622.5 137.25 l
12677: S
12678: n
12679: 622.5 137.25 m
12680: 623.25 137.25 l
12681: S
12682: n
12683: 623.25 137.25 m
12684: 624 137.25 l
12685: S
12686: n
12687: 624 137.25 m
12688: 624.75 137.25 l
12689: S
12690: n
12691: 624.75 137.25 m
12692: 625.5 137.25 l
12693: S
12694: n
12695: 625.5 137.25 m
12696: 626.25 137.25 l
12697: S
12698: n
12699: 626.25 137.25 m
12700: 627 137.25 l
12701: S
12702: n
12703: 627 137.25 m
12704: 627.75 137.25 l
12705: S
12706: n
12707: 627.75 137.25 m
12708: 628.5 137.25 l
12709: S
12710: n
12711: 628.5 137.25 m
12712: 629.25 137.25 l
12713: S
12714: n
12715: 629.25 137.25 m
12716: 630 137.25 l
12717: S
12718: n
12719: 630 137.25 m
12720: 630.75 137.25 l
12721: S
12722: n
12723: 630.75 137.25 m
12724: 631.5 137.25 l
12725: S
12726: n
12727: 636 136.5 m
12728: 636 136.5 l
12729: S
12730: n
12731: 636 136.5 m
12732: 636.75 136.5 l
12733: S
12734: n
12735: 636.75 136.5 m
12736: 637.5 136.5 l
12737: S
12738: n
12739: 642.75 136.5 m
12740: 642.75 136.5 l
12741: S
12742: n
12743: 642.75 136.5 m
12744: 643.5 136.5 l
12745: S
12746: n
12747: 643.5 136.5 m
12748: 644.25 136.5 l
12749: S
12750: n
12751: 644.25 136.5 m
12752: 645 136.5 l
12753: S
12754: n
12755: 645 136.5 m
12756: 645.75 136.5 l
12757: S
12758: n
12759: 645.75 136.5 m
12760: 646.5 136.5 l
12761: S
12762: n
12763: 646.5 136.5 m
12764: 647.25 136.5 l
12765: S
12766: n
12767: 647.25 136.5 m
12768: 648 136.5 l
12769: S
12770: n
12771: 648 136.5 m
12772: 648.75 136.5 l
12773: S
12774: n
12775: 648.75 136.5 m
12776: 649.5 136.5 l
12777: S
12778: n
12779: 649.5 136.5 m
12780: 650.25 136.5 l
12781: S
12782: n
12783: 650.25 136.5 m
12784: 651 136.5 l
12785: S
12786: n
12787: 651 136.5 m
12788: 651.75 136.5 l
12789: S
12790: n
12791: 656.25 136.5 m
12792: 656.25 136.5 l
12793: S
12794: n
12795: 656.25 136.5 m
12796: 657 136.5 l
12797: S
12798: n
12799: 657 136.5 m
12800: 657.75 136.5 l
12801: S
12802: n
12803: 663 136.5 m
12804: 663 136.5 l
12805: S
12806: n
12807: 663 136.5 m
12808: 663.75 136.5 l
12809: S
12810: n
12811: 663.75 136.5 m
12812: 664.5 136.5 l
12813: S
12814: n
12815: 664.5 136.5 m
12816: 665.25 136.5 l
12817: S
12818: q
12819: n
12820: 663 133.5 5.25 5.25 re
12821: h
12822: W
12823: n
12824: n
12825: 665.25 136.5 m
12826: 666 136.5 l
12827: S
12828: Q
12829: q
12830: n
12831: 663.75 133.5 4.5 5.25 re
12832: h
12833: W
12834: n
12835: n
12836: 666 136.5 m
12837: 666.75 136.5 l
12838: S
12839: Q
12840: q
12841: n
12842: 153.75 134.25 308.25 364.5 re
12843: h
12844: W
12845: n
12846: 1.5 w
12847: n
12848: 153.75 136.5 m
12849: 174 136.5 l
12850: 174.75 136.5 l
12851: 221.25 136.5 l
12852: 222 137.25 l
12853: 249 137.25 l
12854: 249.75 138 l
12855: 262.5 138 l
12856: 262.5 138.75 l
12857: 270.75 138.75 l
12858: 270.75 139.5 l
12859: 277.5 139.5 l
12860: 277.5 140.25 l
12861: 282 140.25 l
12862: 282.75 141 l
12863: 286.5 141 l
12864: 287.25 141.75 l
12865: 290.25 141.75 l
12866: 290.25 142.5 l
12867: 294 142.5 l
12868: 294 143.25 l
12869: 296.25 143.25 l
12870: 297 144 l
12871: 298.5 144 l
12872: 299.25 144.75 l
12873: 301.5 144.75 l
12874: 301.5 145.5 l
12875: 303.75 145.5 l
12876: 303.75 146.25 l
12877: 305.25 146.25 l
12878: 306 147 l
12879: 306.75 147 l
12880: 307.5 147.75 l
12881: 308.25 147.75 l
12882: 309 148.5 l
12883: 310.5 148.5 l
12884: 311.25 149.25 l
12885: 312 149.25 l
12886: 312.75 150 l
12887: 313.5 150 l
12888: 313.5 150.75 l
12889: 315 150.75 l
12890: 315 151.5 l
12891: 315.75 151.5 l
12892: 316.5 152.25 l
12893: 317.25 152.25 l
12894: 318.75 153.75 l
12895: 319.5 153.75 l
12896: 319.5 154.5 l
12897: 320.25 154.5 l
12898: 321 155.25 l
12899: 321.75 155.25 l
12900: 321.75 156 l
12901: 322.5 156 l
12902: 324 157.5 l
12903: 324.75 157.5 l
12904: 324.75 158.25 l
12905: 325.5 159 l
12906: 326.25 159 l
12907: 326.25 159.75 l
12908: 327 159.75 l
12909: 327.75 160.5 l
12910: 327.75 161.25 l
12911: 328.5 161.25 l
12912: 331.5 164.25 l
12913: 331.5 165 l
12914: 332.25 165 l
12915: 333 165.75 l
12916: 333 166.5 l
12917: 334.5 168 l
12918: 334.5 168.75 l
12919: 335.25 168.75 l
12920: 336 169.5 l
12921: 336 170.25 l
12922: 337.5 171.75 l
12923: 337.5 172.5 l
12924: 339.75 174.75 l
12925: 339.75 175.5 l
12926: 341.25 177 l
12927: 341.25 177.75 l
12928: 342 179.25 l
12929: 342.75 180 l
12930: 342.75 180.75 l
12931: 344.25 182.25 l
12932: 344.25 183.75 l
12933: 345.75 185.25 l
12934: 345.75 186 l
12935: 346.5 187.5 l
12936: 347.25 188.25 l
12937: 348 189.75 l
12938: 348 190.5 l
12939: 348.75 192 l
12940: 349.5 192.75 l
12941: 349.5 194.25 l
12942: 350.25 195 l
12943: 351 196.5 l
12944: 351 197.25 l
12945: 352.5 200.25 l
12946: 352.5 201.75 l
12947: 353.25 202.5 l
12948: 354 204 l
12949: 354 205.5 l
12950: 355.5 208.5 l
12951: 355.5 210 l
12952: 357.75 214.5 l
12953: 357.75 216 l
12954: 359.25 219 l
12955: 359.25 221.25 l
12956: 360.75 224.25 l
12957: 360.75 226.5 l
12958: 361.5 228 l
12959: 362.25 230.25 l
12960: 362.25 231.75 l
12961: 363 234 l
12962: 363.75 235.5 l
12963: 363.75 237.75 l
12964: 364.5 240 l
12965: 365.25 241.5 l
12966: 366 243.75 l
12967: 366 246 l
12968: 367.5 250.5 l
12969: 367.5 252.75 l
12970: 369 257.25 l
12971: 369 260.25 l
12972: 370.5 264.75 l
12973: 370.5 267.75 l
12974: 371.25 270 l
12975: 372 273 l
12976: 372 275.25 l
12977: 373.5 281.25 l
12978: 373.5 283.5 l
12979: 375.75 292.5 l
12980: 375.75 295.5 l
12981: 377.25 301.5 l
12982: 377.25 304.5 l
12983: 378 307.5 l
12984: 378.75 311.25 l
12985: 378.75 314.25 l
12986: 379.5 318 l
12987: 380.25 321 l
12988: 380.25 324.75 l
12989: 381 327.75 l
12990: 381.75 331.5 l
12991: 381.75 335.25 l
12992: 382.5 338.25 l
12993: 384 345.75 l
12994: 384 349.5 l
12995: 385.5 357 l
12996: 385.5 360.75 l
12997: 387 368.25 l
12998: 387 372 l
12999: 388.5 379.5 l
13000: 388.5 383.25 l
13001: 389.25 387.75 l
13002: 390 391.5 l
13003: 390 395.25 l
13004: 391.5 402.75 l
13005: 391.5 406.5 l
13006: 392.25 411 l
13007: 393.75 418.5 l
13008: 393.75 422.25 l
13009: 395.25 429.75 l
13010: 395.25 433.5 l
13011: 396 437.25 l
13012: 396.75 440.25 l
13013: 396.75 444 l
13014: 397.5 447.75 l
13015: 398.25 450.75 l
13016: 398.25 454.5 l
13017: 399.75 460.5 l
13018: 399.75 463.5 l
13019: 402 472.5 l
13020: 402 474.75 l
13021: 403.5 479.25 l
13022: 403.5 481.5 l
13023: 405 486 l
13024: 405 487.5 l
13025: 406.5 490.5 l
13026: 406.5 492 l
13027: 407.25 493.5 l
13028: 408 494.25 l
13029: 408 495 l
13030: 410.25 497.25 l
13031: 411 497.25 l
13032: 413.25 495 l
13033: 413.25 494.25 l
13034: 414 493.5 l
13035: 414.75 492 l
13036: 414.75 490.5 l
13037: 416.25 487.5 l
13038: 416.25 486 l
13039: 417.75 481.5 l
13040: 417.75 479.25 l
13041: 419.25 474.75 l
13042: 419.25 472.5 l
13043: 421.5 463.5 l
13044: 421.5 460.5 l
13045: 423 454.5 l
13046: 423 450.75 l
13047: 423.75 447.75 l
13048: 424.5 444 l
13049: 424.5 440.25 l
13050: 425.25 437.25 l
13051: 426 433.5 l
13052: 426 429.75 l
13053: 427.5 422.25 l
13054: 427.5 418.5 l
13055: 429 411 l
13056: 429.75 406.5 l
13057: 429.75 402.75 l
13058: 431.25 395.25 l
13059: 431.25 391.5 l
13060: 432 387.75 l
13061: 432.75 383.25 l
13062: 432.75 379.5 l
13063: 434.25 372 l
13064: 434.25 368.25 l
13065: 435.75 360.75 l
13066: 435.75 357 l
13067: 437.25 349.5 l
13068: 437.25 345.75 l
13069: 438.75 338.25 l
13070: 439.5 335.25 l
13071: 439.5 331.5 l
13072: 440.25 327.75 l
13073: 441 324.75 l
13074: 441 321 l
13075: 441.75 318 l
13076: 442.5 314.25 l
13077: 442.5 311.25 l
13078: 443.25 307.5 l
13079: 444 304.5 l
13080: 444 301.5 l
13081: 445.5 295.5 l
13082: 445.5 292.5 l
13083: 447.75 283.5 l
13084: 447.75 281.25 l
13085: 449.25 275.25 l
13086: 449.25 273 l
13087: 450 270 l
13088: 450.75 267.75 l
13089: 450.75 264.75 l
13090: 452.25 260.25 l
13091: 452.25 257.25 l
13092: 453.75 252.75 l
13093: 453.75 250.5 l
13094: 455.25 246 l
13095: 455.25 243.75 l
13096: 456 241.5 l
13097: 456.75 240 l
13098: 457.5 237.75 l
13099: 457.5 235.5 l
13100: 458.25 234 l
13101: 459 231.75 l
13102: 459 230.25 l
13103: 459.75 228 l
13104: S
13105: Q
13106: q
13107: n
13108: 458.25 134.25 210 95.25 re
13109: h
13110: W
13111: n
13112: 1.5 w
13113: n
13114: 459.75 228 m
13115: 460.5 226.5 l
13116: 460.5 224.25 l
13117: 462 221.25 l
13118: 462 219 l
13119: 463.5 216 l
13120: 463.5 214.5 l
13121: 465.75 210 l
13122: 465.75 208.5 l
13123: 467.25 205.5 l
13124: 467.25 204 l
13125: 468 202.5 l
13126: 468.75 201.75 l
13127: 468.75 200.25 l
13128: 470.25 197.25 l
13129: 470.25 196.5 l
13130: 471 195 l
13131: 471.75 194.25 l
13132: 471.75 192.75 l
13133: 472.5 192 l
13134: 473.25 190.5 l
13135: 473.25 189.75 l
13136: 474 188.25 l
13137: 474.75 187.5 l
13138: 475.5 186 l
13139: 475.5 185.25 l
13140: 477 183.75 l
13141: 477 182.25 l
13142: 478.5 180.75 l
13143: 478.5 180 l
13144: 479.25 179.25 l
13145: 480 177.75 l
13146: 480 177 l
13147: 481.5 175.5 l
13148: 481.5 174.75 l
13149: 483.75 172.5 l
13150: 483.75 171.75 l
13151: 485.25 170.25 l
13152: 485.25 169.5 l
13153: 486 168.75 l
13154: 486.75 168.75 l
13155: 486.75 168 l
13156: 488.25 166.5 l
13157: 488.25 165.75 l
13158: 489 165 l
13159: 489.75 165 l
13160: 489.75 164.25 l
13161: 492.75 161.25 l
13162: 493.5 161.25 l
13163: 493.5 160.5 l
13164: 494.25 159.75 l
13165: 495 159.75 l
13166: 495 159 l
13167: 495.75 159 l
13168: 496.5 158.25 l
13169: 496.5 157.5 l
13170: 497.25 157.5 l
13171: 498.75 156 l
13172: 499.5 156 l
13173: 499.5 155.25 l
13174: 500.25 155.25 l
13175: 501 154.5 l
13176: 501.75 154.5 l
13177: 501.75 153.75 l
13178: 502.5 153.75 l
13179: 504 152.25 l
13180: 504.75 152.25 l
13181: 505.5 151.5 l
13182: 506.25 151.5 l
13183: 506.25 150.75 l
13184: 507.75 150.75 l
13185: 507.75 150 l
13186: 508.5 150 l
13187: 509.25 149.25 l
13188: 510 149.25 l
13189: 510.75 148.5 l
13190: 512.25 148.5 l
13191: 513 147.75 l
13192: 513.75 147.75 l
13193: 514.5 147 l
13194: 515.25 147 l
13195: 516 146.25 l
13196: 517.5 146.25 l
13197: 517.5 145.5 l
13198: 519.75 145.5 l
13199: 519.75 144.75 l
13200: 522 144.75 l
13201: 522.75 144 l
13202: 524.25 144 l
13203: 525 143.25 l
13204: 527.25 143.25 l
13205: 527.25 142.5 l
13206: 531 142.5 l
13207: 531 141.75 l
13208: 534 141.75 l
13209: 534.75 141 l
13210: 538.5 141 l
13211: 539.25 140.25 l
13212: 543.75 140.25 l
13213: 543.75 139.5 l
13214: 550.5 139.5 l
13215: 550.5 138.75 l
13216: 558.75 138.75 l
13217: 558.75 138 l
13218: 571.5 138 l
13219: 572.25 137.25 l
13220: 599.25 137.25 l
13221: 600 136.5 l
13222: 667.5 136.5 l
13223: S
13224: Q
13225: q
13226: n
13227: 153.75 193.5 2.25 3.75 re
13228: h
13229: W
13230: n
13231: 1.5 w
13232: n
13233: 153.75 195.75 m
13234: 153.75 195.75 l
13235: S
13236: Q
13237: q
13238: n
13239: 153.75 193.5 3 3.75 re
13240: h
13241: W
13242: n
13243: 1.5 w
13244: n
13245: 153.75 195.75 m
13246: 154.5 195.75 l
13247: S
13248: Q
13249: q
13250: n
13251: 153.75 193.5 3.75 3.75 re
13252: h
13253: W
13254: n
13255: 1.5 w
13256: n
13257: 154.5 195.75 m
13258: 155.25 195.75 l
13259: S
13260: Q
13261: 1.5 w
13262: n
13263: 155.25 195.75 m
13264: 156 195.75 l
13265: S
13266: n
13267: 156 195.75 m
13268: 156.75 195.75 l
13269: S
13270: n
13271: 156.75 195.75 m
13272: 157.5 195.75 l
13273: S
13274: n
13275: 157.5 195.75 m
13276: 158.25 195.75 l
13277: S
13278: n
13279: 164.25 195.75 m
13280: 164.25 195.75 l
13281: S
13282: n
13283: 164.25 195.75 m
13284: 165 195.75 l
13285: S
13286: n
13287: 165 195.75 m
13288: 165.75 195.75 l
13289: S
13290: n
13291: 165.75 195.75 m
13292: 166.5 195.75 l
13293: S
13294: n
13295: 166.5 195.75 m
13296: 167.25 195.75 l
13297: S
13298: n
13299: 167.25 195.75 m
13300: 168 195.75 l
13301: S
13302: n
13303: 168 195.75 m
13304: 168.75 195.75 l
13305: S
13306: n
13307: 174.75 195.75 m
13308: 174.75 195.75 l
13309: S
13310: n
13311: 174.75 195.75 m
13312: 175.5 195.75 l
13313: S
13314: n
13315: 175.5 195.75 m
13316: 176.25 195.75 l
13317: S
13318: n
13319: 176.25 195.75 m
13320: 177 195.75 l
13321: S
13322: n
13323: 177 195.75 m
13324: 177.75 195.75 l
13325: S
13326: n
13327: 177.75 195.75 m
13328: 178.5 195.75 l
13329: S
13330: n
13331: 178.5 195.75 m
13332: 179.25 195.75 l
13333: S
13334: n
13335: 185.25 195.75 m
13336: 185.25 195.75 l
13337: S
13338: n
13339: 185.25 195.75 m
13340: 186 195.75 l
13341: S
13342: n
13343: 186 195.75 m
13344: 186.75 195.75 l
13345: S
13346: n
13347: 186.75 195.75 m
13348: 187.5 195.75 l
13349: S
13350: n
13351: 187.5 195.75 m
13352: 188.25 195.75 l
13353: S
13354: n
13355: 188.25 195.75 m
13356: 189 195.75 l
13357: S
13358: n
13359: 189 195.75 m
13360: 189.75 195.75 l
13361: S
13362: n
13363: 195.75 195.75 m
13364: 195.75 195.75 l
13365: S
13366: n
13367: 195.75 195.75 m
13368: 196.5 195.75 l
13369: S
13370: n
13371: 196.5 195.75 m
13372: 197.25 195.75 l
13373: S
13374: n
13375: 197.25 195.75 m
13376: 198 195.75 l
13377: S
13378: n
13379: 198 195.75 m
13380: 198.75 195.75 l
13381: S
13382: n
13383: 198.75 195.75 m
13384: 199.5 195.75 l
13385: S
13386: n
13387: 199.5 195.75 m
13388: 200.25 195.75 l
13389: S
13390: n
13391: 206.25 195 m
13392: 206.25 195 l
13393: S
13394: n
13395: 206.25 195 m
13396: 207 195 l
13397: S
13398: n
13399: 207 195 m
13400: 207.75 195 l
13401: S
13402: n
13403: 207.75 195 m
13404: 208.5 195 l
13405: S
13406: n
13407: 208.5 195 m
13408: 209.25 195 l
13409: S
13410: n
13411: 209.25 195 m
13412: 210 195 l
13413: S
13414: n
13415: 210 195 m
13416: 210.75 195 l
13417: S
13418: n
13419: 216.75 195 m
13420: 216.75 195 l
13421: S
13422: n
13423: 216.75 195 m
13424: 217.5 195 l
13425: S
13426: n
13427: 217.5 195 m
13428: 218.25 195 l
13429: S
13430: n
13431: 218.25 195 m
13432: 219 195 l
13433: S
13434: n
13435: 219 195 m
13436: 219.75 195 l
13437: S
13438: n
13439: 219.75 195 m
13440: 220.5 195 l
13441: S
13442: n
13443: 220.5 195 m
13444: 221.25 195 l
13445: S
13446: n
13447: 226.5 194.25 m
13448: 226.5 194.25 l
13449: S
13450: n
13451: 226.5 194.25 m
13452: 227.25 194.25 l
13453: S
13454: n
13455: 227.25 194.25 m
13456: 228 194.25 l
13457: S
13458: n
13459: 228 194.25 m
13460: 228.75 194.25 l
13461: S
13462: n
13463: 228.75 194.25 m
13464: 229.5 194.25 l
13465: S
13466: n
13467: 229.5 194.25 m
13468: 230.25 194.25 l
13469: S
13470: n
13471: 230.25 194.25 m
13472: 231 194.25 l
13473: S
13474: n
13475: 237 193.5 m
13476: 237 193.5 l
13477: S
13478: n
13479: 237 193.5 m
13480: 237.75 193.5 l
13481: S
13482: n
13483: 237.75 193.5 m
13484: 238.5 193.5 l
13485: S
13486: n
13487: 238.5 193.5 m
13488: 239.25 193.5 l
13489: S
13490: n
13491: 239.25 193.5 m
13492: 240 193.5 l
13493: S
13494: n
13495: 240 193.5 m
13496: 240 192.75 l
13497: S
13498: n
13499: 240 192.75 m
13500: 240.75 192.75 l
13501: S
13502: n
13503: 246 192 m
13504: 246 192 l
13505: S
13506: n
13507: 246 192 m
13508: 246.75 192 l
13509: S
13510: n
13511: 246.75 192 m
13512: 247.5 192 l
13513: S
13514: n
13515: 247.5 192 m
13516: 248.25 192 l
13517: S
13518: n
13519: 248.25 192 m
13520: 249 192 l
13521: S
13522: n
13523: 249 192 m
13524: 249.75 192 l
13525: S
13526: n
13527: 249.75 192 m
13528: 250.5 192 l
13529: S
13530: n
13531: 255.75 191.25 m
13532: 255.75 191.25 l
13533: S
13534: n
13535: 255.75 191.25 m
13536: 255.75 190.5 l
13537: S
13538: n
13539: 255.75 190.5 m
13540: 256.5 190.5 l
13541: S
13542: n
13543: 256.5 190.5 m
13544: 257.25 190.5 l
13545: S
13546: n
13547: 257.25 190.5 m
13548: 258 190.5 l
13549: S
13550: n
13551: 258 190.5 m
13552: 258.75 190.5 l
13553: S
13554: n
13555: 258.75 190.5 m
13556: 259.5 190.5 l
13557: S
13558: n
13559: 264.75 189 m
13560: 264.75 189 l
13561: S
13562: n
13563: 264.75 189 m
13564: 265.5 189 l
13565: S
13566: n
13567: 265.5 189 m
13568: 266.25 188.25 l
13569: S
13570: n
13571: 266.25 188.25 m
13572: 267 188.25 l
13573: S
13574: n
13575: 267 188.25 m
13576: 267.75 188.25 l
13577: S
13578: n
13579: 267.75 188.25 m
13580: 268.5 188.25 l
13581: S
13582: n
13583: 268.5 188.25 m
13584: 269.25 188.25 l
13585: S
13586: n
13587: 273.75 186.75 m
13588: 273.75 186.75 l
13589: S
13590: n
13591: 273.75 186.75 m
13592: 274.5 186.75 l
13593: S
13594: n
13595: 274.5 186.75 m
13596: 275.25 186 l
13597: S
13598: n
13599: 275.25 186 m
13600: 276 186 l
13601: S
13602: n
13603: 276 186 m
13604: 276.75 186 l
13605: S
13606: n
13607: 276.75 186 m
13608: 277.5 185.25 l
13609: S
13610: n
13611: 277.5 185.25 m
13612: 278.25 185.25 l
13613: S
13614: n
13615: 284.25 183 m
13616: 284.25 183 l
13617: S
13618: n
13619: 284.25 183 m
13620: 285 183 l
13621: S
13622: n
13623: 285 183 m
13624: 285.75 183 l
13625: S
13626: n
13627: 285.75 183 m
13628: 286.5 182.25 l
13629: S
13630: n
13631: 286.5 182.25 m
13632: 287.25 182.25 l
13633: S
13634: n
13635: 287.25 182.25 m
13636: 288 182.25 l
13637: S
13638: n
13639: 288 182.25 m
13640: 288.75 181.5 l
13641: S
13642: n
13643: 294 180 m
13644: 294 180 l
13645: S
13646: n
13647: 294 180 m
13648: 294 179.25 l
13649: S
13650: n
13651: 294 179.25 m
13652: 294.75 179.25 l
13653: S
13654: n
13655: 294.75 179.25 m
13656: 295.5 179.25 l
13657: S
13658: n
13659: 295.5 179.25 m
13660: 295.5 178.5 l
13661: S
13662: n
13663: 295.5 178.5 m
13664: 296.25 178.5 l
13665: S
13666: n
13667: 296.25 178.5 m
13668: 297 178.5 l
13669: S
13670: n
13671: 303 175.5 m
13672: 303 175.5 l
13673: S
13674: n
13675: 303 175.5 m
13676: 303.75 175.5 l
13677: S
13678: n
13679: 303.75 175.5 m
13680: 304.5 175.5 l
13681: S
13682: n
13683: 304.5 175.5 m
13684: 305.25 174.75 l
13685: S
13686: n
13687: 305.25 174.75 m
13688: 306 174.75 l
13689: S
13690: n
13691: 306 174.75 m
13692: 306.75 174 l
13693: S
13694: n
13695: 306.75 174 m
13696: 307.5 174 l
13697: S
13698: n
13699: 312 171.75 m
13700: 312 171.75 l
13701: S
13702: n
13703: 312 171.75 m
13704: 312.75 171.75 l
13705: S
13706: n
13707: 312.75 171.75 m
13708: 313.5 171.75 l
13709: S
13710: n
13711: 313.5 171.75 m
13712: 313.5 171 l
13713: S
13714: n
13715: 313.5 171 m
13716: 314.25 171 l
13717: S
13718: n
13719: 314.25 171 m
13720: 315 171 l
13721: S
13722: n
13723: 315 171 m
13724: 315 170.25 l
13725: S
13726: n
13727: 321 168 m
13728: 321 168 l
13729: S
13730: n
13731: 321 168 m
13732: 321.75 168 l
13733: S
13734: n
13735: 321.75 168 m
13736: 322.5 168 l
13737: S
13738: n
13739: 322.5 168 m
13740: 323.25 167.25 l
13741: S
13742: n
13743: 323.25 167.25 m
13744: 324 167.25 l
13745: S
13746: n
13747: 324 167.25 m
13748: 324.75 167.25 l
13749: S
13750: n
13751: 324.75 167.25 m
13752: 324.75 166.5 l
13753: S
13754: n
13755: 330 165 m
13756: 330 165 l
13757: S
13758: n
13759: 330 165 m
13760: 330.75 165 l
13761: S
13762: n
13763: 330.75 165 m
13764: 331.5 164.25 l
13765: S
13766: n
13767: 331.5 164.25 m
13768: 332.25 164.25 l
13769: S
13770: n
13771: 332.25 164.25 m
13772: 333 164.25 l
13773: S
13774: n
13775: 333 164.25 m
13776: 333 163.5 l
13777: S
13778: n
13779: 333 163.5 m
13780: 333.75 163.5 l
13781: S
13782: n
13783: 339 162 m
13784: 339 162 l
13785: S
13786: n
13787: 339 162 m
13788: 339.75 162 l
13789: S
13790: n
13791: 339.75 162 m
13792: 340.5 161.25 l
13793: S
13794: n
13795: 340.5 161.25 m
13796: 341.25 161.25 l
13797: S
13798: n
13799: 341.25 161.25 m
13800: 342 161.25 l
13801: S
13802: n
13803: 342 161.25 m
13804: 342.75 161.25 l
13805: S
13806: n
13807: 342.75 161.25 m
13808: 342.75 160.5 l
13809: S
13810: n
13811: 348 159.75 m
13812: 348 159.75 l
13813: S
13814: n
13815: 348 159.75 m
13816: 348.75 159.75 l
13817: S
13818: n
13819: 348.75 159.75 m
13820: 349.5 159 l
13821: S
13822: n
13823: 349.5 159 m
13824: 350.25 159 l
13825: S
13826: n
13827: 350.25 159 m
13828: 351 159 l
13829: S
13830: n
13831: 351 159 m
13832: 351.75 159 l
13833: S
13834: n
13835: 351.75 159 m
13836: 352.5 158.25 l
13837: S
13838: n
13839: 358.5 157.5 m
13840: 358.5 157.5 l
13841: S
13842: n
13843: 358.5 157.5 m
13844: 359.25 157.5 l
13845: S
13846: n
13847: 359.25 157.5 m
13848: 360 157.5 l
13849: S
13850: n
13851: 360 157.5 m
13852: 360.75 156.75 l
13853: S
13854: n
13855: 360.75 156.75 m
13856: 361.5 156.75 l
13857: S
13858: n
13859: 361.5 156.75 m
13860: 362.25 156.75 l
13861: S
13862: n
13863: 362.25 156.75 m
13864: 363 156.75 l
13865: S
13866: n
13867: 369 156 m
13868: 369 156 l
13869: S
13870: n
13871: 369 156 m
13872: 369.75 156 l
13873: S
13874: n
13875: 369.75 156 m
13876: 370.5 156 l
13877: S
13878: n
13879: 370.5 156 m
13880: 371.25 155.25 l
13881: S
13882: n
13883: 371.25 155.25 m
13884: 372 155.25 l
13885: S
13886: n
13887: 372 155.25 m
13888: 372.75 155.25 l
13889: S
13890: n
13891: 372.75 155.25 m
13892: 373.5 155.25 l
13893: S
13894: n
13895: 378.75 154.5 m
13896: 378.75 154.5 l
13897: S
13898: n
13899: 378.75 154.5 m
13900: 379.5 154.5 l
13901: S
13902: n
13903: 379.5 154.5 m
13904: 380.25 154.5 l
13905: S
13906: n
13907: 380.25 154.5 m
13908: 381 154.5 l
13909: S
13910: n
13911: 381 154.5 m
13912: 381.75 154.5 l
13913: S
13914: n
13915: 381.75 154.5 m
13916: 382.5 154.5 l
13917: S
13918: n
13919: 382.5 154.5 m
13920: 383.25 154.5 l
13921: S
13922: n
13923: 389.25 154.5 m
13924: 389.25 154.5 l
13925: S
13926: n
13927: 389.25 154.5 m
13928: 390 154.5 l
13929: S
13930: n
13931: 390 154.5 m
13932: 390 153.75 l
13933: S
13934: n
13935: 390 153.75 m
13936: 390.75 153.75 l
13937: S
13938: n
13939: 390.75 153.75 m
13940: 391.5 153.75 l
13941: S
13942: n
13943: 391.5 153.75 m
13944: 392.25 153.75 l
13945: S
13946: n
13947: 392.25 153.75 m
13948: 393 153.75 l
13949: S
13950: n
13951: 399 153.75 m
13952: 399 153.75 l
13953: S
13954: n
13955: 399 153.75 m
13956: 399.75 153.75 l
13957: S
13958: n
13959: 399.75 153.75 m
13960: 400.5 153.75 l
13961: S
13962: n
13963: 400.5 153.75 m
13964: 401.25 153.75 l
13965: S
13966: n
13967: 401.25 153.75 m
13968: 402 153.75 l
13969: S
13970: n
13971: 402 153.75 m
13972: 402.75 153.75 l
13973: S
13974: n
13975: 402.75 153.75 m
13976: 403.5 153.75 l
13977: S
13978: n
13979: 409.5 153.75 m
13980: 409.5 153.75 l
13981: S
13982: n
13983: 409.5 153.75 m
13984: 410.25 153.75 l
13985: S
13986: n
13987: 410.25 153.75 m
13988: 411 153.75 l
13989: S
13990: n
13991: 411 153.75 m
13992: 411.75 153.75 l
13993: S
13994: n
13995: 411.75 153.75 m
13996: 412.5 153.75 l
13997: S
13998: n
13999: 412.5 153.75 m
14000: 413.25 153.75 l
14001: S
14002: n
14003: 413.25 153.75 m
14004: 414 153.75 l
14005: S
14006: n
14007: 420 153.75 m
14008: 420 153.75 l
14009: S
14010: n
14011: 420 153.75 m
14012: 420.75 153.75 l
14013: S
14014: n
14015: 420.75 153.75 m
14016: 421.5 153.75 l
14017: S
14018: n
14019: 421.5 153.75 m
14020: 422.25 153.75 l
14021: S
14022: n
14023: 422.25 153.75 m
14024: 423 153.75 l
14025: S
14026: n
14027: 423 153.75 m
14028: 423.75 153.75 l
14029: S
14030: n
14031: 423.75 153.75 m
14032: 424.5 153.75 l
14033: S
14034: n
14035: 430.5 153.75 m
14036: 430.5 153.75 l
14037: S
14038: n
14039: 430.5 153.75 m
14040: 431.25 153.75 l
14041: S
14042: n
14043: 431.25 153.75 m
14044: 431.25 154.5 l
14045: S
14046: n
14047: 431.25 154.5 m
14048: 432 154.5 l
14049: S
14050: n
14051: 432 154.5 m
14052: 432.75 154.5 l
14053: S
14054: n
14055: 432.75 154.5 m
14056: 433.5 154.5 l
14057: S
14058: n
14059: 433.5 154.5 m
14060: 434.25 154.5 l
14061: S
14062: n
14063: 440.25 154.5 m
14064: 440.25 154.5 l
14065: S
14066: n
14067: 440.25 154.5 m
14068: 441 154.5 l
14069: S
14070: n
14071: 441 154.5 m
14072: 441.75 154.5 l
14073: S
14074: n
14075: 441.75 154.5 m
14076: 442.5 154.5 l
14077: S
14078: n
14079: 442.5 154.5 m
14080: 442.5 155.25 l
14081: S
14082: n
14083: 442.5 155.25 m
14084: 443.25 155.25 l
14085: S
14086: n
14087: 443.25 155.25 m
14088: 444 155.25 l
14089: S
14090: n
14091: 450 155.25 m
14092: 450 155.25 l
14093: S
14094: n
14095: 450 155.25 m
14096: 450.75 156 l
14097: S
14098: n
14099: 450.75 156 m
14100: 451.5 156 l
14101: S
14102: n
14103: 451.5 156 m
14104: 452.25 156 l
14105: S
14106: n
14107: 452.25 156 m
14108: 453 156 l
14109: S
14110: n
14111: 453 156 m
14112: 453.75 156 l
14113: S
14114: n
14115: 453.75 156 m
14116: 454.5 156 l
14117: S
14118: n
14119: 460.5 156.75 m
14120: 460.5 156.75 l
14121: S
14122: n
14123: 460.5 156.75 m
14124: 461.25 157.5 l
14125: S
14126: n
14127: 461.25 157.5 m
14128: 462 157.5 l
14129: S
14130: n
14131: 462 157.5 m
14132: 462.75 157.5 l
14133: S
14134: n
14135: 462.75 157.5 m
14136: 463.5 157.5 l
14137: S
14138: n
14139: 463.5 157.5 m
14140: 464.25 157.5 l
14141: S
14142: n
14143: 464.25 157.5 m
14144: 465 157.5 l
14145: S
14146: n
14147: 471 159 m
14148: 471 159 l
14149: S
14150: n
14151: 471 159 m
14152: 471.75 159 l
14153: S
14154: n
14155: 471.75 159 m
14156: 472.5 159.75 l
14157: S
14158: n
14159: 472.5 159.75 m
14160: 473.25 159.75 l
14161: S
14162: n
14163: 473.25 159.75 m
14164: 474 159.75 l
14165: S
14166: n
14167: 474 159.75 m
14168: 474.75 159.75 l
14169: S
14170: n
14171: 474.75 159.75 m
14172: 475.5 159.75 l
14173: S
14174: n
14175: 480 161.25 m
14176: 480 161.25 l
14177: S
14178: n
14179: 480 161.25 m
14180: 480.75 161.25 l
14181: S
14182: n
14183: 480.75 161.25 m
14184: 481.5 162 l
14185: S
14186: n
14187: 481.5 162 m
14188: 482.25 162 l
14189: S
14190: n
14191: 482.25 162 m
14192: 483 162 l
14193: S
14194: n
14195: 483 162 m
14196: 483.75 162 l
14197: S
14198: n
14199: 483.75 162 m
14200: 483.75 162.75 l
14201: S
14202: n
14203: 489 164.25 m
14204: 489 164.25 l
14205: S
14206: n
14207: 489 164.25 m
14208: 489.75 164.25 l
14209: S
14210: n
14211: 489.75 164.25 m
14212: 490.5 165 l
14213: S
14214: n
14215: 490.5 165 m
14216: 491.25 165 l
14217: S
14218: n
14219: 491.25 165 m
14220: 492 165 l
14221: S
14222: n
14223: 492 165 m
14224: 492.75 165 l
14225: S
14226: n
14227: 492.75 165 m
14228: 493.5 165.75 l
14229: S
14230: n
14231: 498 167.25 m
14232: 498 167.25 l
14233: S
14234: n
14235: 498 167.25 m
14236: 498.75 168 l
14237: S
14238: n
14239: 498.75 168 m
14240: 499.5 168 l
14241: S
14242: n
14243: 499.5 168 m
14244: 500.25 168 l
14245: S
14246: n
14247: 500.25 168 m
14248: 501 168.75 l
14249: S
14250: n
14251: 501 168.75 m
14252: 501.75 168.75 l
14253: S
14254: n
14255: 501.75 168.75 m
14256: 502.5 168.75 l
14257: S
14258: n
14259: 504.75 170.25 m
14260: 504.75 170.25 l
14261: S
14262: n
14263: 504.75 170.25 m
14264: 505.5 170.25 l
14265: S
14266: n
14267: 505.5 170.25 m
14268: 506.25 170.25 l
14269: S
14270: n
14271: 506.25 170.25 m
14272: 506.25 171 l
14273: S
14274: n
14275: 506.25 171 m
14276: 507 171 l
14277: S
14278: n
14279: 507 171 m
14280: 507.75 171 l
14281: S
14282: n
14283: 507.75 171 m
14284: 507.75 171.75 l
14285: S
14286: n
14287: 513 173.25 m
14288: 513 173.25 l
14289: S
14290: n
14291: 513 173.25 m
14292: 513 174 l
14293: S
14294: n
14295: 513 174 m
14296: 513.75 174 l
14297: S
14298: n
14299: 513.75 174 m
14300: 514.5 174 l
14301: S
14302: n
14303: 514.5 174 m
14304: 515.25 174.75 l
14305: S
14306: n
14307: 515.25 174.75 m
14308: 516 174.75 l
14309: S
14310: n
14311: 516 174.75 m
14312: 516.75 175.5 l
14313: S
14314: n
14315: 522.75 177.75 m
14316: 522.75 177.75 l
14317: S
14318: n
14319: 522.75 177.75 m
14320: 523.5 177.75 l
14321: S
14322: n
14323: 523.5 177.75 m
14324: 524.25 178.5 l
14325: S
14326: n
14327: 524.25 178.5 m
14328: 525 178.5 l
14329: S
14330: n
14331: 525 178.5 m
14332: 525.75 178.5 l
14333: S
14334: n
14335: 525.75 178.5 m
14336: 525.75 179.25 l
14337: S
14338: n
14339: 525.75 179.25 m
14340: 526.5 179.25 l
14341: S
14342: n
14343: 531 180.75 m
14344: 531 180.75 l
14345: S
14346: n
14347: 531 180.75 m
14348: 531.75 181.5 l
14349: S
14350: n
14351: 531.75 181.5 m
14352: 532.5 181.5 l
14353: S
14354: n
14355: 532.5 181.5 m
14356: 533.25 182.25 l
14357: S
14358: n
14359: 533.25 182.25 m
14360: 534 182.25 l
14361: S
14362: n
14363: 534 182.25 m
14364: 534.75 182.25 l
14365: S
14366: n
14367: 534.75 182.25 m
14368: 535.5 183 l
14369: S
14370: n
14371: 541.5 184.5 m
14372: 541.5 184.5 l
14373: S
14374: n
14375: 541.5 184.5 m
14376: 542.25 185.25 l
14377: S
14378: n
14379: 542.25 185.25 m
14380: 543 185.25 l
14381: S
14382: n
14383: 543 185.25 m
14384: 543.75 185.25 l
14385: S
14386: n
14387: 543.75 185.25 m
14388: 544.5 186 l
14389: S
14390: n
14391: 544.5 186 m
14392: 545.25 186 l
14393: S
14394: n
14395: 545.25 186 m
14396: 546 186 l
14397: S
14398: n
14399: 551.25 187.5 m
14400: 551.25 187.5 l
14401: S
14402: n
14403: 551.25 187.5 m
14404: 552 187.5 l
14405: S
14406: n
14407: 552 187.5 m
14408: 552 188.25 l
14409: S
14410: n
14411: 552 188.25 m
14412: 552.75 188.25 l
14413: S
14414: n
14415: 552.75 188.25 m
14416: 553.5 188.25 l
14417: S
14418: n
14419: 553.5 188.25 m
14420: 554.25 188.25 l
14421: S
14422: n
14423: 554.25 188.25 m
14424: 555 188.25 l
14425: S
14426: n
14427: 561 189.75 m
14428: 561 189.75 l
14429: S
14430: n
14431: 561 189.75 m
14432: 561.75 189.75 l
14433: S
14434: n
14435: 561.75 189.75 m
14436: 561.75 190.5 l
14437: S
14438: n
14439: 561.75 190.5 m
14440: 562.5 190.5 l
14441: S
14442: n
14443: 562.5 190.5 m
14444: 563.25 190.5 l
14445: S
14446: n
14447: 563.25 190.5 m
14448: 564 190.5 l
14449: S
14450: n
14451: 564 190.5 m
14452: 564.75 190.5 l
14453: S
14454: n
14455: 570 191.25 m
14456: 570 191.25 l
14457: S
14458: n
14459: 570 191.25 m
14460: 570 192 l
14461: S
14462: n
14463: 570 192 m
14464: 570.75 192 l
14465: S
14466: n
14467: 570.75 192 m
14468: 571.5 192 l
14469: S
14470: n
14471: 571.5 192 m
14472: 572.25 192 l
14473: S
14474: n
14475: 572.25 192 m
14476: 573 192 l
14477: S
14478: n
14479: 573 192 m
14480: 573.75 192 l
14481: S
14482: n
14483: 579 192.75 m
14484: 579 192.75 l
14485: S
14486: n
14487: 579 192.75 m
14488: 579.75 192.75 l
14489: S
14490: n
14491: 579.75 192.75 m
14492: 580.5 192.75 l
14493: S
14494: n
14495: 580.5 192.75 m
14496: 581.25 192.75 l
14497: S
14498: n
14499: 581.25 192.75 m
14500: 581.25 193.5 l
14501: S
14502: n
14503: 581.25 193.5 m
14504: 582 193.5 l
14505: S
14506: n
14507: 582 193.5 m
14508: 582.75 193.5 l
14509: S
14510: n
14511: 588.75 193.5 m
14512: 588.75 193.5 l
14513: S
14514: n
14515: 588.75 193.5 m
14516: 589.5 194.25 l
14517: S
14518: n
14519: 589.5 194.25 m
14520: 590.25 194.25 l
14521: S
14522: n
14523: 590.25 194.25 m
14524: 591 194.25 l
14525: S
14526: n
14527: 591 194.25 m
14528: 591.75 194.25 l
14529: S
14530: n
14531: 591.75 194.25 m
14532: 592.5 194.25 l
14533: S
14534: n
14535: 592.5 194.25 m
14536: 593.25 194.25 l
14537: S
14538: n
14539: 599.25 194.25 m
14540: 599.25 194.25 l
14541: S
14542: n
14543: 599.25 194.25 m
14544: 599.25 195 l
14545: S
14546: n
14547: 599.25 195 m
14548: 600 195 l
14549: S
14550: n
14551: 600 195 m
14552: 600.75 195 l
14553: S
14554: n
14555: 600.75 195 m
14556: 601.5 195 l
14557: S
14558: n
14559: 601.5 195 m
14560: 602.25 195 l
14561: S
14562: n
14563: 602.25 195 m
14564: 603 195 l
14565: S
14566: n
14567: 609 195 m
14568: 609 195 l
14569: S
14570: n
14571: 609 195 m
14572: 609.75 195 l
14573: S
14574: n
14575: 609.75 195 m
14576: 610.5 195 l
14577: S
14578: n
14579: 610.5 195 m
14580: 611.25 195 l
14581: S
14582: n
14583: 611.25 195 m
14584: 612 195 l
14585: S
14586: n
14587: 612 195 m
14588: 612.75 195 l
14589: S
14590: n
14591: 612.75 195 m
14592: 613.5 195 l
14593: S
14594: n
14595: 619.5 195.75 m
14596: 619.5 195.75 l
14597: S
14598: n
14599: 619.5 195.75 m
14600: 620.25 195.75 l
14601: S
14602: n
14603: 620.25 195.75 m
14604: 621 195.75 l
14605: S
14606: n
14607: 621 195.75 m
14608: 621.75 195.75 l
14609: S
14610: n
14611: 621.75 195.75 m
14612: 622.5 195.75 l
14613: S
14614: n
14615: 622.5 195.75 m
14616: 623.25 195.75 l
14617: S
14618: n
14619: 623.25 195.75 m
14620: 624 195.75 l
14621: S
14622: n
14623: 630 195.75 m
14624: 630 195.75 l
14625: S
14626: n
14627: 630 195.75 m
14628: 630.75 195.75 l
14629: S
14630: n
14631: 630.75 195.75 m
14632: 631.5 195.75 l
14633: S
14634: n
14635: 631.5 195.75 m
14636: 632.25 195.75 l
14637: S
14638: n
14639: 632.25 195.75 m
14640: 633 195.75 l
14641: S
14642: n
14643: 633 195.75 m
14644: 633.75 195.75 l
14645: S
14646: n
14647: 633.75 195.75 m
14648: 634.5 195.75 l
14649: S
14650: n
14651: 640.5 195.75 m
14652: 640.5 195.75 l
14653: S
14654: n
14655: 640.5 195.75 m
14656: 641.25 195.75 l
14657: S
14658: n
14659: 641.25 195.75 m
14660: 642 195.75 l
14661: S
14662: n
14663: 642 195.75 m
14664: 642.75 195.75 l
14665: S
14666: n
14667: 642.75 195.75 m
14668: 643.5 195.75 l
14669: S
14670: n
14671: 643.5 195.75 m
14672: 644.25 195.75 l
14673: S
14674: n
14675: 644.25 195.75 m
14676: 645 195.75 l
14677: S
14678: n
14679: 651 195.75 m
14680: 651 195.75 l
14681: S
14682: n
14683: 651 195.75 m
14684: 651.75 195.75 l
14685: S
14686: n
14687: 651.75 195.75 m
14688: 652.5 195.75 l
14689: S
14690: n
14691: 652.5 195.75 m
14692: 653.25 195.75 l
14693: S
14694: n
14695: 653.25 195.75 m
14696: 654 195.75 l
14697: S
14698: n
14699: 654 195.75 m
14700: 654.75 195.75 l
14701: S
14702: n
14703: 654.75 195.75 m
14704: 655.5 195.75 l
14705: S
14706: n
14707: 661.5 195.75 m
14708: 661.5 195.75 l
14709: S
14710: n
14711: 661.5 195.75 m
14712: 662.25 195.75 l
14713: S
14714: n
14715: 662.25 195.75 m
14716: 663 195.75 l
14717: S
14718: n
14719: 663 195.75 m
14720: 663.75 195.75 l
14721: S
14722: n
14723: 663.75 195.75 m
14724: 664.5 195.75 l
14725: S
14726: n
14727: 664.5 195.75 m
14728: 665.25 195.75 l
14729: S
14730: n
14731: 665.25 195.75 m
14732: 666 195.75 l
14733: S
14734: 87 297.75 m
14735: /N10 22.6513 Tf
14736: (r) show
14737: 98.25 297.75 m
14738: /N6 22.1538 Tf
14739: (\() show
14740: 105.75 297.75 m
14741: /N10 22.6513 Tf
14742: (x) show
14743: 116.25 297.75 m
14744: /N6 22.1538 Tf
14745: (\)) show
14746: 402 54.75 m
14747: /N10 22.6513 Tf
14748: (x) show
14749: PDFVars/TermAll get exec end end
14750: %%PageTrailer
14751: %%EndPage
14752: %%Trailer
14753: %%DocumentNeededResources:
14754: %%+ font Arial
14755: %%+ font Symbol
14756: %%EOF
14757: 
14758: %%EndDocument
14759:  @endspecial 7970 29044 a Fh(Figure)426 b(2.)492 b Fj(Densit)-31
14760: b(y)369 b(pro\257le)h(of)f(some)h(solitons)h(of)e(driv)-31
14761: b(en)370 b(NLSE.)7970 30483 y(i\))g(dark)f(soliton)i(\(dashed\),)g
14762: (with)f Fk(g)347 b Fj(=)308 b(0)p Fk(:)p Fj(7,)371 b
14763: Fk(\267)307 b Fj(=)h Fi(\241)p Fj(0)p Fk(:)p Fj(7)370
14764: b(and)f Fk(\262)308 b Fj(=)g Fi(\241)p Fj(1)p Fk(:)p
14765: Fj(4;)7970 31923 y(ii\)brigh)-31 b(t)372 b(soliton)f(\(solid\),)g(with)
14766: g Fk(g)347 b Fj(=)307 b Fi(\241)p Fj(0)p Fk(:)p Fj(5,)371
14767: b Fk(\267)308 b Fj(=)f(0)p Fk(:)p Fj(1)370 b(and)g Fk(\262)308
14768: b Fj(=)f Fi(\241)p Fj(0)p Fk(:)p Fj(4;)7970 33362 y(iii\))371
14769: b(brigh)-31 b(t)370 b(soliton)h(\(dash-dotted\),)h(with)f
14770: Fk(g)347 b Fj(=)307 b Fi(\241)p Fj(0)p Fk(:)p Fj(4,)371
14771: b Fk(\267)307 b Fj(=)h(0)p Fk(:)p Fj(1)370 b(and)g Fk(\262)308
14772: b Fj(=)f Fi(\241)p Fj(0)p Fk(:)p Fj(4.)0 38620 y Fo(4.)664
14773: b(NLSE)499 b(with)g(a)g(generalized)g(source)g(term)0
14774: 41706 y Fg(Instead)542 b(of)h(the)f(source)g(term)g(of)h(the)f(t)-36
14775: b(yp)36 b(e)542 b(w)-36 b(e)543 b(ha)-36 b(v)g(e)543
14776: b(considered)e(previously)-108 b(,)571 b(w)-36 b(e)542
14777: b(can)h(ha)-36 b(v)g(e)542 b(a)0 43477 y(term)433 b(with)h(more)f
14778: (generalit)-36 b(y)-108 b(,)435 b(whic)-36 b(h)433 b(giv)-36
14779: b(es)435 b(equation)f(as)g(b)36 b(elo)-36 b(w,)7970 46794
14780: y Fn(i)8547 45895 y(@)72 b(\303)p 8547 46484 1653 45
14781: v 8759 47705 a(@)g(t)10627 46794 y Fg(+)12066 45895 y
14782: Fn(@)12825 45413 y Fe(2)13351 45895 y Fn(\303)p 12066
14783: 46484 2178 45 v 12143 47705 a(@)g(x)13641 47321 y Fe(2)14672
14784: 46794 y Fg(+)295 b Fn(g)417 b Fl(j)369 b Fn(\303)416
14785: b Fl(j)19388 46245 y Fe(2)20283 46794 y Fn(\303)342 b
14786: Fg(+)295 b Fn(\271\303)416 b Fg(=)368 b Fn(\267e)27555
14787: 46245 y Fd(i)p Fe(\()p Fd(\302)p Fe(\()p Fd(\273)35 b
14788: Fe(\))p Fc(\241)p Fd(!)d(t)p Fe(\))32115 46794 y Fn(;)14626
14789: b Fg(\(21\))0 49808 y(where)433 b Fn(\302)p Fg(\()p Fn(\273)64
14790: b Fg(\))434 b(is)g(some)g(function.)578 b(W)-108 b(e)433
14791: b(consider)h(the)f(ansatz)g(as,)7970 52576 y Fn(\303)48
14792: b Fg(\()p Fn(x;)221 b(t)p Fg(\))368 b(=)h(exp[)p Fn(i)p
14793: Fg(\()p Fn(\302)p Fg(\()p Fn(\273)64 b Fg(\))295 b Fl(\241)g
14794: Fn(!)48 b(t)p Fg(\)])p Fn(\275)p Fg(\()p Fn(\273)64 b(;)221
14795: b(t)p Fg(\))p Fn(;)20383 b Fg(\(22\))0 55343 y(whic)-36
14796: b(h)370 b(when)f(substituted)f(in)i(equation)g(\(21\))g(giv)-36
14797: b(es)371 b(a)g(complex)f(equation)h(in)e Fn(\275)h Fg(and)f
14798: Fn(\302)p Fg(.)557 b(Equating)0 57114 y(the)433 b(imaginary)i(part)e
14799: (to)h(zero,)g(w)-36 b(e)434 b(get,)7970 59882 y Fn(\302)8785
14800: 59333 y Fc(0)9464 59882 y Fg(=)11383 58983 y Fn(v)p 10978
14801: 59572 1487 45 v 10978 60793 a Fg(2)p Fn(\256)12892 59882
14802: y Fg(+)14650 58983 y Fn(c)p 14332 59572 1197 45 v 14332
14803: 60793 a(\275)15003 60409 y Fe(2)15661 59882 y Fg(;)31080
14804: b(\(23\))0 63081 y(One)379 b(can)h(clearly)i(see)e(that)f(the)h(ab)36
14805: b(o)-36 b(v)g(e)381 b(equation)f(suggests)g(phase-amplitude)f(coupling)
14806: h(for)h Fn(c)p Fl(6)p Fg(=)o(0.)0 64852 y(W)-108 b(e)387
14807: b(see)f(from)i(relation)f(\(23\))g(an)f(in)-36 b(teresting)386
14808: b(case)i(of)f(the)f(phase)g(singularit)-36 b(y)388 b(of)f(the)f
14809: (soliton)i(with)0 66623 y(phase-amplitude)432 b(coupling)i(only)-108
14810: b(.)0 68394 y(Substituting)341 b(this)i(relation)g(in)g(the)f(real)h
14811: (part)f(of)i(equation)f(\(21\))g(w)-36 b(e)343 b(get)g(a)g(non)g
14812: (linear)g(di\256eren)-36 b(tial)0 70165 y(equation)434
14813: b(of)g(the)f(form,)7970 73482 y Fn(\256)8805 72933 y
14814: Fe(2)9332 73482 y Fn(\275)10003 72933 y Fc(00)10863 73482
14815: y Fg(+)295 b Fn(g)48 b(\275)13512 72933 y Fe(3)14333
14816: 73482 y Fg(+)294 b Fn(\262\275)369 b Fg(=)g Fn(\267)295
14817: b Fg(+)21069 72583 y Fn(\256)21904 72101 y Fe(2)22430
14818: 72583 y Fn(c)22990 72101 y Fe(2)p 21069 73172 2448 45
14819: v 21694 74393 a Fn(\275)22365 74009 y Fe(3)23649 73482
14820: y Fn(;)23092 b Fg(\(24\))p eop end end
14821: %%Page: 8 8
14822: TeXDict begin HPSdict begin 8 7 bop 0 221 a Ff(Dark)332
14823: b(and)g(Bright)g(solitons)g(of)f(driven)g(non-line)-66
14824: b(ar)330 b(Schr\304)-664 b(odinger)331 b(and)h(higher)f(or)-66
14825: b(der)332 b(non-line)-66 b(ar)330 b(Schr\304)-664 b(odinger)331
14826: b(e)-66 b(quations)p Fg(8)0 3099 y(where)456 b Fn(\262)409
14827: b Fg(=)e(\()p Fn(!)359 b Fg(+)310 b Fn(\271)g Fg(+)11679
14828: 2576 y Fd(v)12169 2264 y Fb(2)p 11679 2790 952 45 v 11919
14829: 3558 a Fe(4)12763 3099 y Fg(\).)647 b(One)456 b(can)g(see)h(that)f(ab)
14830: 36 b(o)-36 b(v)g(e)457 b(equation)g(can)f(b)36 b(e)457
14831: b(reduced)e(b)-36 b(y)457 b(follo)-36 b(wing)0 4871 y(FT)434
14832: b(to)f(elliptic)i(equation,)7970 8232 y Fn(\275)p Fg(\()p
14833: Fn(\273)64 b Fg(\))369 b(=)12167 7333 y Fn(A)296 b Fg(+)e
14834: Fn(B)67 b(f)142 b Fg(\()p Fn(\273)64 b Fl(j)p Fn(m)p
14835: Fg(\))19733 6851 y Fd(\261)p 12167 7922 8071 45 v 12299
14836: 9143 a Fg(1)296 b(+)f Fn(D)36 b(f)142 b Fg(\()p Fn(\273)64
14837: b Fl(j)p Fn(m)p Fg(\))19602 8759 y Fd(\261)20371 8232
14838: y Fn(;)26370 b Fg(\(25\))0 11504 y(where)674 b Fn(\261)828
14839: b Fg(=)779 b(2)674 b(is)h(the)e(only)i(case)g(where)f(solitonic)h
14840: (solutions)f(are)h(found.)1300 b(This)674 b(giv)-36 b(es)675
14841: b(the)0 13275 y(consistency)434 b(conditions:)7970 17814
14842: y Fn(g)48 b(A)9616 17265 y Fe(6)10437 17814 y Fg(+)294
14843: b Fn(\262A)13243 17265 y Fe(4)14065 17814 y Fl(\241)h
14844: Fg(\(2)p Fn(\256)17384 17265 y Fe(2)17911 17814 y Fg(\()p
14845: Fn(AD)331 b Fl(\241)295 b Fn(B)67 b Fg(\)\(1)295 b Fl(\241)h
14846: Fn(m)p Fg(\))e(+)h Fn(\267)p Fg(\))p Fn(A)31947 17265
14847: y Fe(3)32842 17814 y Fg(=)368 b Fn(\256)35057 17265 y
14848: Fe(2)35584 17814 y Fn(c)36144 17265 y Fe(2)47102 17814
14849: y Fg(\(26\))7970 23349 y(6)p Fn(A)9595 22800 y Fe(5)10121
14850: 23349 y Fn(B)67 b(g)343 b Fg(+)295 b(4)p Fn(\262A)15599
14851: 22800 y Fe(3)16125 23349 y Fn(B)363 b Fg(+)294 b(2)p
14852: Fn(\262A)20932 22800 y Fe(4)21459 23349 y Fn(D)331 b
14853: Fl(\241)295 b Fg(3)p Fn(\267A)26572 22800 y Fe(2)27098
14854: 23349 y Fn(B)363 b Fl(\241)295 b Fg(3)p Fn(\267A)32151
14855: 22800 y Fe(3)32677 23349 y Fn(D)331 b Fg(+)295 b(6)p
14856: Fn(\256)36880 22800 y Fe(2)37407 23349 y Fg(\()p Fn(B)362
14857: b Fl(\241)295 b Fn(AD)36 b Fg(\)\(1)296 b Fl(\241)f Fn(m)p
14858: Fg(\))p Fn(A)48587 22800 y Fe(2)49112 23349 y Fn(B)363
14859: b Fg(+)7970 25452 y(6)p Fn(\256)9455 24903 y Fe(2)9982
14860: 25452 y Fg(\()p Fn(AD)331 b Fl(\241)295 b Fn(B)67 b Fg(\)\(1)296
14861: b Fl(\241)f Fn(m)p Fg(\))p Fn(A)21162 24903 y Fe(3)21687
14862: 25452 y Fn(D)332 b Fg(+)294 b(4)p Fn(\256)25890 24903
14863: y Fe(2)26417 25452 y Fg(\(2)p Fn(m)h Fl(\241)h Fg(1\))p
14864: Fn(A)32466 24903 y Fe(3)32992 25452 y Fg(\()p Fn(B)362
14865: b Fl(\241)295 b Fn(AD)36 b Fg(\))369 b(=)g(6)p Fn(\256)42008
14866: 24903 y Fe(2)42535 25452 y Fn(c)43095 24903 y Fe(2)43620
14867: 25452 y Fn(D)4757 b Fg(\(27\))7970 28884 y(6)p Fn(\256)9455
14868: 28335 y Fe(2)9982 28884 y Fg(\()p Fn(B)362 b Fl(\241)295
14869: b Fn(AD)36 b Fg(\)\(1)296 b Fl(\241)f Fn(m)p Fg(\))p
14870: Fn(AB)22217 28335 y Fe(2)23038 28884 y Fg(+)g(18)p Fn(\256)26480
14871: 28335 y Fe(2)27007 28884 y Fg(\()p Fn(AD)331 b Fl(\241)295
14872: b Fn(B)67 b Fg(\)\(1)296 b Fl(\241)f Fn(m)p Fg(\))p Fn(A)38187
14873: 28335 y Fe(2)38712 28884 y Fn(B)67 b(D)332 b Fg(+)7970
14874: 30987 y(12)p Fn(\256)10105 30438 y Fe(2)10632 30987 y
14875: Fg(\()p Fn(B)362 b Fl(\241)296 b Fn(AD)36 b Fg(\)\(2)p
14876: Fn(m)295 b Fl(\241)g Fg(1\))p Fn(A)22462 30438 y Fe(2)22988
14877: 30987 y Fn(B)362 b Fg(+)295 b(4)p Fn(\256)27130 30438
14878: y Fe(2)27657 30987 y Fg(\()p Fn(AD)331 b Fl(\241)296
14879: b Fn(B)67 b Fg(\)\(2)p Fn(m)295 b Fl(\241)g Fg(1\))p
14880: Fn(A)39487 30438 y Fe(3)40013 30987 y Fn(D)331 b Fg(+)7970
14881: 33090 y(6)p Fn(\256)9455 32541 y Fe(2)9982 33090 y Fg(\()p
14882: Fn(AD)g Fl(\241)295 b Fn(B)67 b Fg(\))p Fn(mA)17876 32541
14883: y Fe(3)18697 33090 y Fg(+)295 b(15)p Fn(g)48 b(A)22950
14884: 32541 y Fe(4)23476 33090 y Fn(B)24531 32541 y Fe(2)25352
14885: 33090 y Fg(+)295 b(6)p Fn(\262A)28809 32541 y Fe(2)29335
14886: 33090 y Fn(B)30390 32541 y Fe(2)31211 33090 y Fg(+)g(8)p
14887: Fn(\262A)34668 32541 y Fe(3)35195 33090 y Fn(B)67 b(D)331
14888: b Fg(+)295 b Fn(\262A)40468 32541 y Fe(4)40994 33090
14889: y Fn(D)42110 32541 y Fe(2)7970 35193 y Fl(\241)p Fg(3)p
14890: Fn(\267AB)12432 34645 y Fe(2)13254 35193 y Fl(\241)g
14891: Fg(9)p Fn(\267A)16956 34645 y Fe(2)17482 35193 y Fn(B)67
14892: b(D)331 b Fl(\241)295 b Fg(3)p Fn(\267A)23650 34645 y
14893: Fe(3)24176 35193 y Fn(D)25292 34645 y Fe(2)26187 35193
14894: y Fg(=)369 b(15)p Fn(\256)29703 34645 y Fe(2)30230 35193
14895: y Fn(c)30790 34645 y Fe(2)31316 35193 y Fn(D)32432 34645
14896: y Fe(2)47102 35193 y Fg(\(28\))7970 40396 y(20)p Fn(g)48
14897: b(A)10916 39847 y Fe(3)11442 40396 y Fn(B)12497 39847
14898: y Fe(3)13318 40396 y Fg(+)295 b(4)p Fn(\262AB)17830 39847
14899: y Fe(3)18652 40396 y Fg(+)g(12)p Fn(\262A)22759 39847
14900: y Fe(2)23285 40396 y Fn(B)24340 39847 y Fe(2)24866 40396
14901: y Fn(D)331 b Fg(+)295 b(4)p Fn(\262A)29734 39847 y Fe(3)30261
14902: 40396 y Fn(B)67 b(D)32432 39847 y Fe(2)7970 42499 y Fl(\241)p
14903: Fn(\267B)10807 41951 y Fe(3)11628 42499 y Fl(\241)295
14904: b Fg(9)p Fn(\267AB)16385 41951 y Fe(2)16912 42499 y Fn(D)331
14905: b Fl(\241)295 b Fg(9)p Fn(\267A)22025 41951 y Fe(2)22551
14906: 42499 y Fn(B)67 b(D)24722 41951 y Fe(2)25543 42499 y
14907: Fl(\241)296 b Fn(\267A)28596 41951 y Fe(3)29121 42499
14908: y Fn(D)30237 41951 y Fe(3)31058 42499 y Fg(+)7970 44602
14909: y(18)p Fn(\256)10105 44054 y Fe(2)10632 44602 y Fn(AB)12662
14910: 44054 y Fe(2)13188 44602 y Fn(D)36 b Fg(\()p Fn(AD)331
14911: b Fl(\241)296 b Fn(B)67 b Fg(\)\(1)295 b Fl(\241)g Fn(m)p
14912: Fg(\))g Fl(\241)g Fg(2)p Fn(\256)27617 44054 y Fe(2)28144
14913: 44602 y Fn(B)29199 44054 y Fe(3)29725 44602 y Fg(\()p
14914: Fn(AD)331 b Fl(\241)296 b Fn(B)67 b Fg(\)\(1)295 b Fl(\241)g
14915: Fn(m)p Fg(\))g Fl(\241)7970 46706 y Fg(12)p Fn(\256)10105
14916: 46157 y Fe(2)10632 46706 y Fn(AB)12662 46157 y Fe(2)13188
14917: 46706 y Fg(\()p Fn(AD)331 b Fl(\241)296 b Fn(B)67 b Fg(\)\(2)p
14918: Fn(m)295 b Fl(\241)g Fg(1\))g Fl(\241)h Fg(2)p Fn(\256)27152
14919: 46157 y Fe(2)27679 46706 y Fn(mA)29792 46157 y Fe(3)30317
14920: 46706 y Fn(D)36 b Fg(\()p Fn(AD)331 b Fl(\241)296 b Fn(B)67
14921: b Fg(\))7970 48809 y(+12)p Fn(\256)11117 48260 y Fe(2)11644
14922: 48809 y Fn(A)12619 48260 y Fe(2)13145 48809 y Fn(B)g(D)36
14923: b Fg(\()p Fn(AD)331 b Fl(\241)295 b Fn(B)67 b Fg(\)\(2)p
14924: Fn(m)295 b Fl(\241)h Fg(1\))369 b(=)g(20)p Fn(\256)30056
14925: 48260 y Fe(2)30583 48809 y Fn(c)31143 48260 y Fe(2)31668
14926: 48809 y Fn(D)32784 48260 y Fe(3)47102 48809 y Fg(\(29\))7970
14927: 54344 y(15)p Fn(g)48 b(A)10916 53795 y Fe(2)11442 54344
14928: y Fn(B)12497 53795 y Fe(4)13318 54344 y Fg(+)295 b Fn(\262B)16205
14929: 53795 y Fe(4)17026 54344 y Fg(+)g(8)p Fn(\262AB)21538
14930: 53795 y Fe(3)22065 54344 y Fn(D)331 b Fg(+)295 b(6)p
14931: Fn(\262A)26933 53795 y Fe(2)27459 54344 y Fn(B)28514
14932: 53795 y Fe(2)29040 54344 y Fn(D)30156 53795 y Fe(2)7970
14933: 56447 y Fl(\241)p Fg(3)p Fn(\267B)11457 55898 y Fe(3)11983
14934: 56447 y Fn(D)332 b Fl(\241)295 b Fg(9)p Fn(\267AB)18152
14935: 55898 y Fe(2)18678 56447 y Fn(D)19794 55898 y Fe(2)20615
14936: 56447 y Fl(\241)g Fg(3)p Fn(\267A)24317 55898 y Fe(2)24843
14937: 56447 y Fn(B)67 b(D)27014 55898 y Fe(3)27835 56447 y
14938: Fg(+)295 b(6)p Fn(\256)30627 55898 y Fe(2)31154 56447
14939: y Fn(B)32209 55898 y Fe(3)32735 56447 y Fn(D)36 b Fg(\()p
14940: Fn(AD)331 b Fl(\241)296 b Fn(B)67 b Fg(\)\(1)295 b Fl(\241)g
14941: Fn(m)p Fg(\))7970 58550 y Fl(\241)p Fg(4)p Fn(\256)10488
14942: 58002 y Fe(2)11015 58550 y Fn(B)12070 58002 y Fe(3)12596
14943: 58550 y Fg(\()p Fn(AD)331 b Fl(\241)296 b Fn(B)67 b Fg(\)\(2)p
14944: Fn(m)295 b Fl(\241)g Fg(1\))g(+)g(12)p Fn(\256)27188
14945: 58002 y Fe(2)27715 58550 y Fn(AB)29745 58002 y Fe(2)30271
14946: 58550 y Fn(D)36 b Fg(\()p Fn(AD)331 b Fl(\241)296 b Fn(B)67
14947: b Fg(\)\(2)p Fn(m)295 b Fl(\241)g Fg(1\))g(+)7970 60653
14948: y(18)p Fn(\256)10105 60105 y Fe(2)10632 60653 y Fn(mAB)13800
14949: 60105 y Fe(2)14326 60653 y Fg(\()p Fn(AD)331 b Fl(\241)295
14950: b Fn(B)67 b Fg(\))296 b Fl(\241)f Fg(6)p Fn(\256)23216
14951: 60105 y Fe(2)23743 60653 y Fn(mA)25856 60105 y Fe(2)26381
14952: 60653 y Fn(B)67 b(D)36 b Fg(\()p Fn(AD)332 b Fl(\241)295
14953: b Fn(B)67 b Fg(\))369 b(=)g(15)p Fn(\256)38219 60105
14954: y Fe(2)38746 60653 y Fn(c)39306 60105 y Fe(2)39831 60653
14955: y Fn(D)40947 60105 y Fe(4)47102 60653 y Fg(\(30\))7970
14956: 66188 y(6)p Fn(g)48 b(AB)11321 65640 y Fe(5)12142 66188
14957: y Fg(+)295 b(2)p Fn(\262B)15679 65640 y Fe(4)16205 66188
14958: y Fn(D)332 b Fg(+)294 b(4)p Fn(\262AB)22128 65640 y Fe(3)22655
14959: 66188 y Fn(D)23771 65640 y Fe(2)24592 66188 y Fl(\241)h
14960: Fg(3)p Fn(\267AB)29349 65640 y Fe(2)29875 66188 y Fn(D)30991
14961: 65640 y Fe(3)7970 68291 y Fl(\241)p Fg(3)p Fn(\267B)11457
14962: 67743 y Fe(3)11983 68291 y Fn(D)13099 67743 y Fe(2)13920
14963: 68291 y Fg(+)g(4)p Fn(\256)16712 67743 y Fe(2)17239 68291
14964: y Fg(\()p Fn(B)362 b Fl(\241)296 b Fn(AD)36 b Fg(\)\(1)295
14965: b Fl(\241)g Fg(2)p Fn(m)p Fg(\))p Fn(B)29149 67743 y
14966: Fe(3)29675 68291 y Fn(D)7970 70395 y Fg(+6)p Fn(\256)10467
14967: 69846 y Fe(2)10994 70395 y Fn(m)p Fg(\()p Fn(B)361 b
14968: Fl(\241)296 b Fn(AD)36 b Fg(\))p Fn(AB)19943 69846 y
14969: Fe(2)20469 70395 y Fn(D)331 b Fg(+)295 b(6)p Fn(\256)24672
14970: 69846 y Fe(2)25199 70395 y Fn(m)p Fg(\()p Fn(AD)330 b
14971: Fl(\241)296 b Fn(B)67 b Fg(\))p Fn(B)33173 69846 y Fe(3)34068
14972: 70395 y Fg(=)368 b(6)p Fn(\256)36933 69846 y Fe(2)37460
14973: 70395 y Fn(c)38020 69846 y Fe(2)38546 70395 y Fn(D)39662
14974: 69846 y Fe(5)47102 70395 y Fg(\(31\))7970 73826 y(2)p
14975: Fn(\256)9455 73278 y Fe(2)9982 73826 y Fg(\()p Fn(B)362
14976: b Fl(\241)295 b Fn(AD)36 b Fg(\))p Fn(mB)17956 73278
14977: y Fe(3)18482 73826 y Fn(D)331 b Fg(+)295 b Fn(g)48 b(B)22926
14978: 73278 y Fe(6)23747 73826 y Fg(+)295 b Fn(\262B)26634
14979: 73278 y Fe(4)27160 73826 y Fn(D)28276 73278 y Fe(2)29097
14980: 73826 y Fl(\241)g Fn(\267B)32229 73278 y Fe(3)32755 73826
14981: y Fn(D)33871 73278 y Fe(3)34766 73826 y Fg(=)368 b Fn(\256)36981
14982: 73278 y Fe(2)37508 73826 y Fn(c)38068 73278 y Fe(2)38593
14983: 73826 y Fn(D)39709 73278 y Fe(6)47102 73826 y Fg(\(32\))p
14984: eop end end
14985: %%Page: 9 9
14986: TeXDict begin HPSdict begin 9 8 bop 0 221 a Ff(Dark)332
14987: b(and)g(Bright)g(solitons)g(of)f(driven)g(non-line)-66
14988: b(ar)330 b(Schr\304)-664 b(odinger)331 b(and)h(higher)f(or)-66
14989: b(der)332 b(non-line)-66 b(ar)330 b(Schr\304)-664 b(odinger)331
14990: b(e)-66 b(quations)p Fg(9)2601 3099 y(Since,)601 b(a)568
14991: b(total)g(of)g(sev)-36 b(en)568 b(sim)-36 b(ultaneous)567
14992: b(relations)h(to)g(\257x)g(the)f(indep)36 b(enden)-36
14993: b(t)565 b(parameters)0 4871 y(w)-36 b(e)527 b(can)g(see)g(that)f(these)
14994: h(are)g(highly)g(constrain)-36 b(ted)526 b(solutions.)859
14995: b(One)526 b(can)h(see)g(that)f(the)h(phase-)0 6642 y(amplitude)382
14996: b(coupling)g(only)i(imp)36 b(oses)382 b(constrain)-36
14997: b(ts)382 b(on)h(the)f(solution)h(space,)393 b(but)381
14998: b(do)36 b(es)383 b(not)f(c)-36 b(hange)0 8413 y(the)536
14999: b(pro\257le)g(of)h(the)f(solutions)h(essen)-36 b(tially)-108
15000: b(.)887 b(F)-108 b(rom)536 b(ab)36 b(o)-36 b(v)g(e)537
15001: b(relations)g(one)g(can)f(see)h(that)f Fn(B)611 b Fg(=)543
15002: b(0)0 10184 y(needs)507 b Fn(D)532 b Fg(=)496 b(0)508
15003: b(so)h(that)e(none)h(of)h(them)e(can)i(b)36 b(e)507 b(zero.)803
15004: b(Moreo)-36 b(v)g(er,)527 b Fn(A)p Fl(6)p Fg(=0)508 b(otherwise)h(it)f
15005: (leads)h(to)0 11955 y Fn(c)439 b Fg(=)h(0)475 b(whic)-36
15006: b(h)475 b(is)g(trivial.)705 b(So,)485 b(it)476 b(means)f(that)f(the)h
15007: (solutions)g(exist)h(in)f(a)g(constan)-36 b(t)475 b(bac)-36
15008: b(kground.)0 13726 y(Here,)359 b(w)-36 b(e)341 b(see)g(that)f(only)h
15009: (rational)h(solutions)f(are)f(p)36 b(ossible.)548 b(Moreo)-36
15010: b(v)g(er,)360 b(w)-36 b(e)341 b(see)g(that)f(\(26\))h(is)f(sixth)0
15011: 15497 y(order)i(p)36 b(olynomial,)362 b(in)342 b(con)-36
15012: b(trast)342 b(to)g(all)h(previous)g(relations)g(these)e(relations)i
15013: (are)f Ff(not)g Fg(analytically)0 17269 y(soluble,)349
15014: b(and)326 b(so)h(the)g(n)-36 b(umerical)327 b(analysis)h(is)f(the)f
15015: (only)i(to)36 b(ol)328 b(to)f(analyze)h(the)e(structure)g(of)h
15016: (solution)0 19040 y(space.)2601 20811 y(In)480 b(conclusion,)492
15017: b(a)480 b(n)-36 b(um)g(b)36 b(er)479 b(of)h(in)-36 b(teresting)480
15018: b(features)g(ha)-36 b(v)g(e)480 b(emerged)g(from)g(analysis)i(of)e(the)
15019: 0 22582 y(exact)582 b(solutions)g(of)h(the)e(driv)-36
15020: b(en)581 b(NLSE)g(and)g(HNLSE.)g(Dark)i(and)e(brigh)-36
15021: b(t)581 b(solitons)h(can)g(exist)0 24353 y(in)546 b(attractiv)-36
15022: b(e)548 b(and)e(repulsiv)-36 b(e)547 b(non-linear)f(regimes,)575
15023: b(a)547 b(feature)g(v)-36 b(ery)547 b(di\256eren)-36
15024: b(t)546 b(for)h(NLSE,)f(the)0 26124 y(presence)605 b(of)h(the)f
15025: (external)g(source)h(mak)-36 b(es)606 b(this)f(p)36 b(ossible.)1094
15026: b(In)605 b(a)h(wide)f(range)h(of)g(parameters)0 27895
15027: y(the)475 b(driv)-36 b(en)475 b(HNLSE)f(and)h(driv)-36
15028: b(en)475 b(NLSE)f(ha)-36 b(v)g(e)475 b(same)h(solutions.)703
15029: b(Eigen)476 b(solitons)g(are)f(found)g(in)0 29667 y(b)36
15030: b(oth)570 b(the)f(equations.)989 b(Both)569 b(the)h(equations,)605
15031: b(in)570 b(sp)36 b(eci\257c)570 b(parameter)g(regimes,)605
15032: b(giv)-36 b(e)571 b(solitons)0 31438 y(of)480 b(completely)g(arbitrary)
15033: g(size.)716 b(V)-108 b(ery)480 b(in)-36 b(terestingly)-108
15034: b(,)491 b(restriction)479 b(to)h(a)f(sub-class,)491 b(mak)-36
15035: b(es)480 b(these)0 33209 y(lo)36 b(calized)435 b(solutions)f
15036: (necessarily)h(singular.)2601 34980 y(The)453 b(in)-36
15037: b(v)g(estigation)453 b(of)g(the)f(situation,)458 b(where)452
15038: b(the)g(phase)g(is)h(allo)-36 b(w)g(ed)453 b(to)g(dep)36
15039: b(end)451 b(up)36 b(on)451 b(the)0 36751 y(in)-36 b(tensit)g(y)-108
15040: b(,)433 b(rev)-36 b(ealed)434 b(that)f(there)g(are)h(highly)g
15041: (restrictiv)-36 b(e,)435 b(non-singular)d(solutions.)2601
15042: 40097 y Fo(References)553 43111 y Fj([1])555 b(Lomdahl)371
15043: b(P)e(S)g(and)h(Sam)-31 b(uelsen)370 b(M)f(R,)g(1986)i
15044: Fa(Phys.)396 b(R)-57 b(ev.)371 b Fh(A)425 b(34)p Fj(,)370
15045: b(664)553 44550 y([2])555 b(Kaup)370 b(D)e(J)h(and)h(New)-31
15046: b(ell)371 b(A)e(C,)h(1978)h Fa(Phys.)396 b(R)-57 b(ev.)371
15047: b Fh(B)424 b(18)p Fj(,)370 b(5162)553 45989 y([3])555
15048: b(Sn)-31 b(yder)369 b(A)h(W)e(and)i(Lo)-31 b(v)g(e)370
15049: b(J)f(D,)g(1983)i Fa(Optic)-57 b(al)396 b(Wave)-57 b(guide)397
15050: b(The)-57 b(ory)p Fj(,)370 b(Chapman)g(and)g(Hall,)h(London)553
15051: 47428 y([4])555 b(Malomed)371 b(B)e(A,)h(1995)h Fa(Phys.)396
15052: b(R)-57 b(ev.)371 b Fh(E)424 b(51)p Fj(,)371 b(R864)553
15053: 48867 y([5])555 b(Cohen)370 b(G,)f(2000)i Fa(Phys.)397
15054: b(R)-57 b(ev.)370 b Fh(E)425 b(61)p Fj(,)371 b(874)553
15055: 50306 y([6])555 b(T.Solomon)373 b(Ra)61 b(ju,)370 b(Prasan)-31
15056: b(ta)371 b(K.)e(P)-31 b(anigrahi)372 b(and)d(K.P)-31
15057: b(orsezian,)371 b(2005)g Fa(Phys.)397 b(R)-57 b(ev.)370
15058: b Fh(E)425 b(71)p Fj(,)371 b(022608)553 51745 y([7])555
15059: b(Nozaki)371 b(K)e(and)h(Bekki)g(N,)f(1983)i Fa(Phys.)397
15060: b(R)-57 b(ev.)397 b(L)-57 b(ett.)370 b Fh(50)p Fj(,)h(1226)553
15061: 53184 y([8])555 b(Nozaki)371 b(K)e(and)h(Bekki)g(N,)f(1986)i
15062: Fa(Physic)-57 b(a)370 b Fh(D)425 b(21)p Fj(,)370 b(381)553
15063: 54623 y([9])555 b(Agra)-31 b(w)g(al)372 b(G)d(P)-92 b(,)369
15064: b(1989)i Fa(Nonline)-57 b(ar)397 b(Fib)-57 b(er)397 b(optics)p
15065: Fj(,)369 b(Academic)h(Press,)f(Boston)0 56062 y([10])555
15066: b(Barashenk)-31 b(o)g(v)371 b(I)e(V,)g(Smirno)-31 b(v)371
15067: b(Y)-92 b(u)369 b(S)g(and)g(Alexeev)-61 b(a)370 b(N)g(V,)f(1998)i
15068: Fa(Phys.)396 b(R)-57 b(ev.)371 b Fh(E)425 b(57)p Fj(,)370
15069: b(2350)0 57501 y([11])555 b(Barashenk)-31 b(o)g(v)371
15070: b(I)e(V,)g(Zemly)-31 b(ana)g(y)g(a)374 b(E)369 b(V,)h(and)f(B\304)-553
15071: b(ar)369 b(M,)g(2001)i Fa(Phys.)396 b(R)-57 b(ev.)371
15072: b Fh(E)425 b(64)p Fj(,)370 b(016603)0 58940 y([12])555
15073: b(Nistazakis)403 b(H)d(E,)i(Kevrekidis)e(P)h(G,)g(Malomed)h(B)e(A,)h(F)
15074: -92 b(ran)-31 b(tzesk)-61 b(akis)401 b(D)f(J,)g(and)h(Bishop)g(A)g(R,)f
15075: (2002)i Fa(Phys.)3382 60379 y(R)-57 b(ev.)371 b Fh(E)425
15076: b(66)p Fj(,)370 b(R015601)0 61818 y([13])555 b(F)-92
15077: b(riedland)370 b(L)f(and)g(Shagalo)-31 b(v)372 b(A)d(G,)g(1998)i
15078: Fa(Phys.)396 b(R)-57 b(ev.)398 b(L)-57 b(ett.)370 b Fh(81)p
15079: Fj(,)g(4357)0 63258 y([14])555 b(F)-92 b(riedland)370
15080: b(L,)f(1998)i Fa(Phys.)396 b(R)-57 b(ev.)371 b Fh(E)425
15081: b(58)p Fj(,)370 b(3865)0 64697 y([15])555 b(Ra)61 b(ju)370
15082: b(T)g(S,)f(Kumar)h(C)f(N)g(and)h(P)-31 b(anigrahi)371
15083: b(P)f(K,)f(2005)i Fa(J.)397 b(Phys.)f(A:)g(Math.)g(Gen.)370
15084: b Fh(38)p Fj(,)h(L271)0 66136 y([16])555 b(Ko)31 b(dama)371
15085: b(Y,)f(1985)h Fa(J.)396 b(Stat.Phys.)370 b Fh(39)p Fj(,)g(597)0
15086: 67575 y([17])555 b(Ko)31 b(dama)371 b(Y)e(and)h(Hasega)-31
15087: b(w)g(a)371 b(A,)f(1987)h Fa(J.)397 b(Quantum)f(Ele)-57
15088: b(ctr)g(on)369 b Fh(23)p Fj(,)i(510)0 69014 y([18])555
15089: b(Hasega)-31 b(w)g(a)367 b(A)c(and)h(Ko)31 b(dama)365
15090: b(Y,)f(1995)i Fa(Solitons)391 b(in)g(Optic)-57 b(al)391
15091: b(Communic)-57 b(ations)365 b Fj(\(Oxford)g(Univ)-31
15092: b(ersit)g(y)365 b(Press,)3382 70453 y(New)370 b(Y)-92
15093: b(ork\))0 71892 y([19])555 b(Sasa)370 b(N)f(and)h(Satsuma)g(J,)f(,)h
15094: (1991)h Fa(J.)396 b(Phys.)h(So)-57 b(c.)397 b(Jpn.)370
15095: b Fh(60)p Fj(,)g(409)0 73331 y([20])555 b(Hirota)371
15096: b(R,)e(1973)i Fa(J.)397 b(Math.)e(Phys.)370 b Fh(14)p
15097: Fj(,)g(805)0 74770 y([21])555 b(Anderson)369 b(D)g(and)g(Lisak)h(M,)f
15098: (1983)i Fa(Phys.)396 b(R)-57 b(ev.)371 b Fh(A27)p Fj(,)g(1393)p
15099: eop end end
15100: %%Page: 10 10
15101: TeXDict begin HPSdict begin 10 9 bop 0 221 a Ff(Dark)332
15102: b(and)g(Bright)g(solitons)g(of)f(driven)g(non-line)-66
15103: b(ar)330 b(Schr\304)-664 b(odinger)331 b(and)h(higher)f(or)-66
15104: b(der)332 b(non-line)-66 b(ar)330 b(Schr\304)-664 b(odinger)331
15105: b(e)-66 b(quations)p Fg(10)0 3099 y Fj([22])555 b(P)-31
15106: b(otsasek,)371 b(M)e(J,)g(and)h(T)-92 b(ab)31 b(or)369
15107: b(M,)h(1991)g Fa(Phys.)397 b(L)-57 b(ett.)766 b Fh(A154)p
15108: Fj(,)371 b(449)0 4539 y([23])555 b(P)-31 b(alacios)372
15109: b(S)d(L)g(et.al,1999)k Fa(Phys.)396 b(R)-57 b(ev.)371
15110: b Fh(E60)p Fj(,R45)0 5978 y([24])555 b(Kumar)370 b(C)f(N)h(and)f
15111: (Durganandi)h(P)-92 b(,)370 b(1999)g Fa(Pr)-57 b(amana)396
15112: b(-)h(J.Phys.)369 b Fh(53)p Fj(,)i(271)p eop end end
15113: %%Trailer
15114: 
15115: end